diff options
author | James D. Forrester <jforrester@wikimedia.org> | 2014-04-03 09:17:09 -0700 |
---|---|---|
committer | Timo Tijhof <krinklemail@gmail.com> | 2014-04-07 12:21:21 -0700 |
commit | 648667ac9f0848dfbb75b513d79c73d7a5e5b7b1 (patch) | |
tree | f46ba302d92bd2a3d00886dd84663dd2b3d5dbea /resources/lib | |
parent | 96995b3d8cecd9b3fa6ecb62912fb2c8cb20903b (diff) | |
download | mediawikicore-648667ac9f0848dfbb75b513d79c73d7a5e5b7b1.tar.gz mediawikicore-648667ac9f0848dfbb75b513d79c73d7a5e5b7b1.zip |
Split /resources into /resources/lib and /resources/src
Currently, MediaWiki has a mess of resources, some but not all of which are upstream libraries.
This means that occasionally people will attempt to make local modifications of the libraries
by accident, or deliberately but do not flag it, making dependency management a challenge (and
fixing upstream-related bugs a headache).
Instead, we now split the /resources directory into a /resources/lib directory for those items
which are used purely as intact upstream libraries, and a /resources/src directroy for those
which are either local libraries written for MediaWiki and mastered here, or downstream forks
of upstream libraries which require particular care and attention when being upgraded. Also,
some incidental files which are not to be loaded as part of a module have been moved to better
locations.
Upstream libaries
* jquery
resources/jquery/jquery.js
* jquery.appear
resources/jquery/jquery.appear.js
* jquery.async
resources/jquery/jquery.async.js
* jquery.chosen
resources/jquery.chosen/*
* jquery.cookie
resources/jquery/jquery.cookie.js
* jquery.form
resources/jquery/jquery.form.js
* jquery.fullscreen.js
resources/jquery/jquery.fullscreen.js
* jquery.hoverIntent
resources/jquery/jquery.hoverIntent.js
* jquery.json
resources/jquery/jquery.json.js
* jquery.mockjax
resources/jquery/jquery.mockjax.js
* jquery.qunit
resources/jquery/jquery.qunit.css
resources/jquery/jquery.qunit.js
* jquery.jStorage
resources/jquery/jquery.jStorage.js
* jquery.throttle-debounce
resources/jquery/jquery.ba-throttle-debounce.js
* jquery.validate
resources/jquery/jquery.validate.js
* jquery.xmldom
resources/jquery/jquery.xmldom.js
* moment
resources/moment/*
* OOjs
resource/oojs/*
* OOjs UI
resources/oojs-ui/*
* jquery.ui.*
resources/jquery.ui/*
resources/jquery.ui/themes/default moved to resources/lib/jquery.ui/themes/
resources/jquery.ui/themes/vector moved to resources/src/jquery.ui-themes/
* jquery.effects.*
resources/jquery.effects/*
* sinon
resources/sinonjs/*
Upstream libraries forked for MediaWiki
* jquery.color
resources/jquery/jquery.color.js
* jquery.tipsy
resources/jquery.tipsy/*
Local libraries
* jquery.arrowSteps
resources/jquery/jquery.arrowSteps.css
resources/jquery/jquery.arrowSteps.js
resources/jquery/images/jquery.arrowSteps.divider-ltr.png
resources/jquery/images/jquery.arrowSteps.divider-rtl.png
resources/jquery/images/jquery.arrowSteps.head-ltr.png
resources/jquery/images/jquery.arrowSteps.head-rtl.png
resources/jquery/images/jquery.arrowSteps.tail-ltr.png
resources/jquery/images/jquery.arrowSteps.tail-rtl.png
* jquery.autoEllipsis
resources/jquery/jquery.autoEllipsis.js
* jquery.badge
resources/jquery/jquery.badge.css
resources/jquery/jquery.badge.js
* jquery.byteLength
resources/jquery/jquery.byteLength.js
* jquery.byteLimit
resources/jquery/jquery.byteLimit.js
* jquery.checkboxShiftClick
resources/jquery/jquery.checkboxShiftClick.js
* jquery.client
resources/jquery/jquery.client.js
* jquery.colorUtil
resources/jquery/jquery.colorUtil.js
* jquery.delayedBind
resources/jquery/jquery.delayedBind.js
* jquery.expandableField
resources/jquery/jquery.expandableField.js
* jquery.farbtastic
resources/jquery/jquery.farbtastic.css
resources/jquery/jquery.farbtastic.js
resources/jquery/images/marker.png
resources/jquery/images/mask.png
resources/jquery/images/wheel.png
* jquery.footHovzer
resources/jquery/jquery.footHovzer.css
resources/jquery/jquery.footHovzer.js
* jquery.getAttrs
resources/jquery/jquery.getAttrs.js
* jquery.hidpi
resources/jquery/jquery.hidpi.js
* jquery.highlightText
resources/jquery/jquery.highlightText.js
* jquery.localize
resources/jquery/jquery.localize.js
* jquery.makeCollapsible
resources/jquery/jquery.makeCollapsible.css
resources/jquery/jquery.makeCollapsible.js
* jquery.mw-jump
resources/jquery/jquery.mw-jump.js
* jquery.mwExtension
resources/jquery/jquery.mwExtension.js
* jquery.placeholder
resources/jquery/jquery.placeholder.js
* jquery.spinner
resources/jquery/jquery.spinner.css
resources/jquery/jquery.spinner.js
resources/jquery/images/spinner-large.gif
resources/jquery/images/spinner.gif
* jquery.suggestions
resources/jquery/jquery.suggestions.css
resources/jquery/jquery.suggestions.js
* jquery.tabIndex
resources/jquery/jquery.tabIndex.js
* jquery.tablesorter
resources/jquery/jquery.tablesorter.css
resources/jquery/jquery.tablesorter.js
resources/jquery/images/sort_both.gif
resources/jquery/images/sort_down.gif
resources/jquery/images/sort_none.gif
resources/jquery/images/sort_up.gif
* jquery.textSelection
resources/jquery/jquery.textSelection.js
* jquery.qunit.completenessTest
resources/jquery/jquery.qunit.completenessTest.js
* mediawiki
resources/mediawiki/mediawiki.js
resources/mediawiki/mediawiki.log.js
* mediawiki.api
resources/mediawiki.api/mediawiki.api.js
* mediawiki.api.category
resources/mediawiki.api/mediawiki.api.category.js
* mediawiki.api.edit
resources/mediawiki.api/mediawiki.api.edit.js
* mediawiki.api.login
resources/mediawiki.api/mediawiki.api.login.js
* mediawiki.api.parse
resources/mediawiki.api/mediawiki.api.parse.js
* mediawiki.api.watch
resources/mediawiki.api/mediawiki.api.watch.js
* mediawiki.debug
resources/mediawiki/mediawiki.debug.js
resources/mediawiki/mediawiki.debug.less
resources/mediawiki/mediawiki.debug.profile.css
resources/mediawiki/mediawiki.debug.profile.js
* mediawiki.debug.init
resources/mediawiki/mediawiki.debug.init.js
* mediawiki.feedback
resources/mediawiki/mediawiki.feedback.css
resources/mediawiki/mediawiki.feedback.js
resources/mediawiki/mediawiki.feedback.spinner.gif
* mediawiki.hidpi
resources/mediawiki/mediawiki.hidpi.js
* mediawiki.hlist
resources/mediawiki/mediawiki.hlist.css
resources/mediawiki/mediawiki.hlist.js
* mediawiki.htmlform
resources/mediawiki/mediawiki.htmlform.js
* mediawiki.icon
resources/mediawiki/mediawiki.icon.less
resources/mediawiki/images/arrow-collapsed-ltr.png
resources/mediawiki/images/arrow-collapsed-ltr.svg
resources/mediawiki/images/arrow-collapsed-rtl.png
resources/mediawiki/images/arrow-collapsed-rtl.svg
resources/mediawiki/images/arrow-expanded.png
resources/mediawiki/images/arrow-expanded.svg
* mediawiki.inspect
resources/mediawiki/mediawiki.inspect.js
* mediawiki.notification
resources/mediawiki/mediawiki.notification.css
resources/mediawiki/mediawiki.notification.hideForPrint.css
resources/mediawiki/mediawiki.notification.js
* mediawiki.notify
resources/mediawiki/mediawiki.notify.js
* mediawiki.searchSuggest
resources/mediawiki/mediawiki.searchSuggest.css
resources/mediawiki/mediawiki.searchSuggest.js
* mediawiki.Title
resources/mediawiki/mediawiki.Title.js
* mediawiki.toc
resources/mediawiki/mediawiki.toc.js
* mediawiki.Uri
resources/mediawiki/mediawiki.Uri.js
* mediawiki.user
resources/mediawiki/mediawiki.user.js
* mediawiki.util
resources/mediawiki/mediawiki.util.js
* mediawiki.action.edit
resources/mediawiki.action/mediawiki.action.edit.js
* mediawiki.action.edit.styles
resources/mediawiki.action/mediawiki.action.edit.styles.css
* mediawiki.action.edit.collapsibleFooter
resources/mediawiki.action/mediawiki.action.edit.collapsibleFooter.css
resources/mediawiki.action/mediawiki.action.edit.collapsibleFooter.js
* mediawiki.action.edit.preview
resources/mediawiki.action/mediawiki.action.edit.preview.js
* mediawiki.action.history
resources/mediawiki.action/mediawiki.action.history.js
* mediawiki.action.history.diff
resources/mediawiki.action/mediawiki.action.history.diff.css
* mediawiki.action.view.dblClickEdit
resources/mediawiki.action/mediawiki.action.view.dblClickEdit.js
* mediawiki.action.view.metadata
resources/mediawiki.action/mediawiki.action.view.metadata.js
* mediawiki.action.view.postEdit
resources/mediawiki.action/mediawiki.action.view.postEdit.css
resources/mediawiki.action/mediawiki.action.view.postEdit.js
resources/mediawiki.action/images/green-checkmark.png
* mediawiki.action.view.redirectToFragment
resources/mediawiki.action/mediawiki.action.view.redirectToFragment.js
* mediawiki.action.view.rightClickEdit
resources/mediawiki.action/mediawiki.action.view.rightClickEdit.js
* mediawiki.action.edit.editWarning
resources/mediawiki.action/mediawiki.action.edit.editWarning.js
* mediawiki.action.watch.ajax
No files associated with this resource.
* mediawiki.language
resources/mediawiki.language/mediawiki.language.js
resources/mediawiki.language/mediawiki.language.numbers.js
resources/mediawiki.language/languages/bs.js
resources/mediawiki.language/languages/dsb.js
resources/mediawiki.language/languages/fi.js
resources/mediawiki.language/languages/ga.js
resources/mediawiki.language/languages/he.js
resources/mediawiki.language/languages/hsb.js
resources/mediawiki.language/languages/hu.js
resources/mediawiki.language/languages/hy.js
resources/mediawiki.language/languages/la.js
resources/mediawiki.language/languages/os.js
resources/mediawiki.language/languages/ru.js
resources/mediawiki.language/languages/sl.js
resources/mediawiki.language/languages/uk.js
* mediawiki.cldr
resources/mediawiki.language/mediawiki.cldr.js
* mediawiki.libs.pluralruleparser
Possibly should be moved to /lib
resources/mediawiki.libs/CLDRPluralRuleParser.js
* mediawiki.language.init
resources/mediawiki.language/mediawiki.language.init.js
* mediawiki.jqueryMsg
resources/mediawiki/mediawiki.jqueryMsg.js
resources/mediawiki/mediawiki.jqueryMsg.peg
* mediawiki.language.months
resources/mediawiki.language/mediawiki.language.months.js
* mediawiki.libs.jpegmeta
resources/mediawiki.libs/mediawiki.libs.jpegmeta.js
* mediawiki.page.gallery
resources/mediawiki.page/mediawiki.page.gallery.js
* mediawiki.page.ready
resources/mediawiki.page/mediawiki.page.ready.js
* mediawiki.page.startup
resources/mediawiki.page/mediawiki.page.startup.js
* mediawiki.page.patrol.ajax
resources/mediawiki.page/mediawiki.page.patrol.ajax.js
* mediawiki.page.watch.ajax
resources/mediawiki.page/mediawiki.page.watch.ajax.js
* mediawiki.page.image.pagination
resources/mediawiki.page/mediawiki.page.image.pagination.js
* mediawiki.special
resources/mediawiki.special/mediawiki.special.css
resources/mediawiki.special/mediawiki.special.js
* mediawiki.special.block
resources/mediawiki.special/mediawiki.special.block.css
resources/mediawiki.special/mediawiki.special.block.js
* mediawiki.special.changeemail
resources/mediawiki.special/mediawiki.special.changeemail.css
resources/mediawiki.special/mediawiki.special.changeemail.js
* mediawiki.special.changeslist
resources/mediawiki.special/mediawiki.special.changeslist.css
* mediawiki.special.changeslist.legend
resources/mediawiki.special/mediawiki.special.changeslist.legend.css
* mediawiki.special.changeslist.legend.js
resources/mediawiki.special/mediawiki.special.changeslist.legend.js
* mediawiki.special.changeslist.enhanced
resources/mediawiki.special/mediawiki.special.changeslist.enhanced.css
* mediawiki.special.movePage
resources/mediawiki.special/mediawiki.special.movePage.js
* mediawiki.special.pagesWithProp
resources/mediawiki.special/mediawiki.special.pagesWithProp.css
* mediawiki.special.preferences
resources/mediawiki.special/mediawiki.special.preferences.css
resources/mediawiki.special/mediawiki.special.preferences.js
* mediawiki.special.recentchanges
resources/mediawiki.special/mediawiki.special.recentchanges.js
* mediawiki.special.search
resources/mediawiki.special/mediawiki.special.search.css
resources/mediawiki.special/mediawiki.special.search.js
* mediawiki.special.undelete
resources/mediawiki.special/mediawiki.special.undelete.js
* mediawiki.special.upload
resources/mediawiki.special/mediawiki.special.upload.js
* mediawiki.special.userlogin.common.styles
resources/mediawiki.special/mediawiki.special.userlogin.common.css
resources/mediawiki.special/images/icon-lock.png
* mediawiki.special.userlogin.signup.styles
resources/mediawiki.special/mediawiki.special.userlogin.signup.css
resources/mediawiki.special/images/icon-edits.png
resources/mediawiki.special/images/icon-pages.png
resources/mediawiki.special/images/icon-contributors.png
* mediawiki.special.userlogin.login.styles
resources/mediawiki.special/mediawiki.special.userlogin.login.css
resources/mediawiki.special/images/glyph-people-large.png
* mediawiki.special.userlogin.common.js
resources/mediawiki.special/mediawiki.special.userlogin.common.js
* mediawiki.special.userlogin.signup.js
resources/mediawiki.special/mediawiki.special.userlogin.signup.js
* mediawiki.special.javaScriptTest
resources/mediawiki.special/mediawiki.special.javaScriptTest.js
* mediawiki.special.version
resources/mediawiki.special/mediawiki.special.version.css
* mediawiki.ui
resources/mediawiki.ui/default.less
resources/mediawiki.ui/vector.less
resources/mediawiki.ui/components/utilities.less
resources/mediawiki.ui/components/default/forms.less
resources/mediawiki.ui/components/vector/containers.less
resources/mediawiki.ui/components/vector/forms.less
resources/mediawiki.ui/mixins/effects.less
resources/mediawiki.ui/mixins/forms.less
resources/mediawiki.ui/mixins/type.less
resources/mediawiki.ui/mixins/utilities.less
resources/mediawiki.ui/settings/colors.less
resources/mediawiki.ui/settings/typography.less
resources/mediawiki.ui/styleguide.md
* mediawiki.ui.button
resources/mediawiki.ui/components/default/buttons.less
resources/mediawiki.ui/components/vector/buttons.less
Legacy modules, untouched:
* mediawiki.legacy.ajax
* mediawiki.legacy.commonPrint
* mediawiki.legacy.config
* mediawiki.legacy.protect
* mediawiki.legacy.shared
* mediawiki.legacy.oldshared
* mediawiki.legacy.upload
* mediawiki.legacy.wikibits
Miscellaneous files moved elsewhere
* A currently-failing (unused?) script attempting to build some kss style documentation.
Previously in the root of the resources directory, now moved to a new folder, /docs/kss.
Makefile
README.txt
package.json
scripts/nodecheck.sh
styleguide-template/index.html
styleguide-template/public/kss.less
styleguide-template/public/less.js
* ResourceLoader startup JS code was also moved to /src
resources/startup.js
* mediawiki.mixins, hard-coded to be loaded by ResourceLoader, also moved to /src
resources/mediawiki.less/mediawiki.mixins.animation.less
resources/mediawiki.less/mediawiki.mixins.less
resources/mediawiki.less/mediawiki.mixins.rotation.less
* jquery.cycle.all.js appears not to be refered to (?!):
(added in 2f1f0abc6b)
resources/jquery/jquery.cycle.all.js
Change-Id: Id5ead1453412e763bdb3763084e43694517088fd
Diffstat (limited to 'resources/lib')
405 files changed, 59868 insertions, 0 deletions
diff --git a/resources/lib/jquery.chosen/LICENSE b/resources/lib/jquery.chosen/LICENSE new file mode 100644 index 000000000000..0675dc5264af --- /dev/null +++ b/resources/lib/jquery.chosen/LICENSE @@ -0,0 +1,24 @@ +# Chosen, a Select Box Enhancer for jQuery and Protoype +## by Patrick Filler for [Harvest](http://getharvest.com) + +Available for use under the [MIT License](http://en.wikipedia.org/wiki/MIT_License) + +Copyright (c) 2011-2013 by Harvest + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/resources/lib/jquery.chosen/chosen-sprite.png b/resources/lib/jquery.chosen/chosen-sprite.png Binary files differnew file mode 100644 index 000000000000..3611ae4ace1c --- /dev/null +++ b/resources/lib/jquery.chosen/chosen-sprite.png diff --git a/resources/lib/jquery.chosen/chosen-sprite@2x.png b/resources/lib/jquery.chosen/chosen-sprite@2x.png Binary files differnew file mode 100644 index 000000000000..bd61d9638f0b --- /dev/null +++ b/resources/lib/jquery.chosen/chosen-sprite@2x.png diff --git a/resources/lib/jquery.chosen/chosen.css b/resources/lib/jquery.chosen/chosen.css new file mode 100644 index 000000000000..17793ed7426a --- /dev/null +++ b/resources/lib/jquery.chosen/chosen.css @@ -0,0 +1,440 @@ +/* @group Base */ +.chzn-container { + font-size: 13px; + position: relative; + display: inline-block; + vertical-align: middle; + zoom: 1; + *display: inline; +} +.chzn-container .chzn-drop { + background: #fff; + border: 1px solid #aaa; + border-top: 0; + position: absolute; + top: 100%; + left: -9999px; + -webkit-box-shadow: 0 4px 5px rgba(0,0,0,.15); + -moz-box-shadow : 0 4px 5px rgba(0,0,0,.15); + box-shadow : 0 4px 5px rgba(0,0,0,.15); + z-index: 1010; + width: 100%; + -moz-box-sizing : border-box; + -ms-box-sizing : border-box; + -webkit-box-sizing: border-box; + -khtml-box-sizing : border-box; + box-sizing : border-box; +} + +.chzn-container.chzn-with-drop .chzn-drop { + left: 0; +} + +/* @end */ + +/* @group Single Chosen */ +.chzn-container-single .chzn-single { + background-color: #ffffff; + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0 ); + background-image: -webkit-gradient(linear, 0 0, 0 100%, color-stop(20%, #ffffff), color-stop(50%, #f6f6f6), color-stop(52%, #eeeeee), color-stop(100%, #f4f4f4)); + background-image: -webkit-linear-gradient(top, #ffffff 20%, #f6f6f6 50%, #eeeeee 52%, #f4f4f4 100%); + background-image: -moz-linear-gradient(top, #ffffff 20%, #f6f6f6 50%, #eeeeee 52%, #f4f4f4 100%); + background-image: -o-linear-gradient(top, #ffffff 20%, #f6f6f6 50%, #eeeeee 52%, #f4f4f4 100%); + background-image: linear-gradient(#ffffff 20%, #f6f6f6 50%, #eeeeee 52%, #f4f4f4 100%); + -webkit-border-radius: 5px; + -moz-border-radius : 5px; + border-radius : 5px; + -moz-background-clip : padding; + -webkit-background-clip: padding-box; + background-clip : padding-box; + border: 1px solid #aaaaaa; + -webkit-box-shadow: 0 0 3px #ffffff inset, 0 1px 1px rgba(0,0,0,0.1); + -moz-box-shadow : 0 0 3px #ffffff inset, 0 1px 1px rgba(0,0,0,0.1); + box-shadow : 0 0 3px #ffffff inset, 0 1px 1px rgba(0,0,0,0.1); + display: block; + overflow: hidden; + white-space: nowrap; + position: relative; + height: 23px; + line-height: 24px; + padding: 0 0 0 8px; + color: #444444; + text-decoration: none; +} +.chzn-container-single .chzn-default { + color: #999; +} +.chzn-container-single .chzn-single span { + margin-right: 26px; + display: block; + overflow: hidden; + white-space: nowrap; + -o-text-overflow: ellipsis; + -ms-text-overflow: ellipsis; + text-overflow: ellipsis; +} +.chzn-container-single .chzn-single abbr { + display: block; + position: absolute; + right: 26px; + top: 6px; + width: 12px; + height: 12px; + font-size: 1px; + background: url('chosen-sprite.png') -42px 1px no-repeat; +} +.chzn-container-single .chzn-single abbr:hover { + background-position: -42px -10px; +} +.chzn-container-single.chzn-disabled .chzn-single abbr:hover { + background-position: -42px -10px; +} +.chzn-container-single .chzn-single div { + position: absolute; + right: 0; + top: 0; + display: block; + height: 100%; + width: 18px; +} +.chzn-container-single .chzn-single div b { + background: url('chosen-sprite.png') no-repeat 0px 2px; + display: block; + width: 100%; + height: 100%; +} +.chzn-container-single .chzn-search { + padding: 3px 4px; + position: relative; + margin: 0; + white-space: nowrap; + z-index: 1010; +} +.chzn-container-single .chzn-search input { + background: #fff url('chosen-sprite.png') no-repeat 100% -20px; + background: url('chosen-sprite.png') no-repeat 100% -20px, -webkit-gradient(linear, 0 0, 0 100%, color-stop(1%, #eeeeee), color-stop(15%, #ffffff)); + background: url('chosen-sprite.png') no-repeat 100% -20px, -webkit-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background: url('chosen-sprite.png') no-repeat 100% -20px, -moz-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background: url('chosen-sprite.png') no-repeat 100% -20px, -o-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background: url('chosen-sprite.png') no-repeat 100% -20px, linear-gradient(#eeeeee 1%, #ffffff 15%); + margin: 1px 0; + padding: 4px 20px 4px 5px; + outline: 0; + border: 1px solid #aaa; + font-family: sans-serif; + font-size: 1em; + width: 100%; + -moz-box-sizing : border-box; + -ms-box-sizing : border-box; + -webkit-box-sizing: border-box; + -khtml-box-sizing : border-box; + box-sizing : border-box; +} +.chzn-container-single .chzn-drop { + margin-top: -1px; + -webkit-border-radius: 0 0 4px 4px; + -moz-border-radius : 0 0 4px 4px; + border-radius : 0 0 4px 4px; + -moz-background-clip : padding; + -webkit-background-clip: padding-box; + background-clip : padding-box; +} +.chzn-container-single-nosearch .chzn-search { + position: absolute; + left: -9999px; +} +/* @end */ + +/* @group Multi Chosen */ +.chzn-container-multi .chzn-choices { + background-color: #fff; + background-image: -webkit-gradient(linear, 0 0, 0 100%, color-stop(1%, #eeeeee), color-stop(15%, #ffffff)); + background-image: -webkit-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background-image: -moz-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background-image: -o-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background-image: linear-gradient(#eeeeee 1%, #ffffff 15%); + border: 1px solid #aaa; + margin: 0; + padding: 0; + cursor: text; + overflow: hidden; + height: auto !important; + height: 1%; + position: relative; + width: 100%; + -moz-box-sizing : border-box; + -ms-box-sizing : border-box; + -webkit-box-sizing: border-box; + -khtml-box-sizing : border-box; + box-sizing : border-box; +} +.chzn-container-multi .chzn-choices li { + float: left; + list-style: none; +} +.chzn-container-multi .chzn-choices .search-field { + white-space: nowrap; + margin: 0; + padding: 0; +} +.chzn-container-multi .chzn-choices .search-field input { + color: #666; + background: transparent !important; + border: 0 !important; + font-family: sans-serif; + font-size: 100%; + height: 15px; + padding: 5px; + margin: 1px 0; + outline: 0; + -webkit-box-shadow: none; + -moz-box-shadow : none; + box-shadow : none; +} +.chzn-container-multi .chzn-choices .search-field .default { + color: #999; +} +.chzn-container-multi .chzn-choices .search-choice { + -webkit-border-radius: 3px; + -moz-border-radius : 3px; + border-radius : 3px; + -moz-background-clip : padding; + -webkit-background-clip: padding-box; + background-clip : padding-box; + background-color: #e4e4e4; + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#f4f4f4', endColorstr='#eeeeee', GradientType=0 ); + background-image: -webkit-gradient(linear, 0 0, 0 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eeeeee)); + background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + background-image: -o-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + background-image: linear-gradient(#f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + -webkit-box-shadow: 0 0 2px #ffffff inset, 0 1px 0 rgba(0,0,0,0.05); + -moz-box-shadow : 0 0 2px #ffffff inset, 0 1px 0 rgba(0,0,0,0.05); + box-shadow : 0 0 2px #ffffff inset, 0 1px 0 rgba(0,0,0,0.05); + color: #333; + border: 1px solid #aaaaaa; + line-height: 13px; + padding: 3px 20px 3px 5px; + margin: 3px 0 3px 5px; + position: relative; + cursor: default; +} +.chzn-container-multi .chzn-choices .search-choice.search-choice-disabled { + background-color: #e4e4e4; + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#f4f4f4', endColorstr='#eeeeee', GradientType=0 ); + background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eeeeee)); + background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + background-image: -o-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + background-image: -ms-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + background-image: linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eeeeee 100%); + color: #666; + border: 1px solid #cccccc; + padding-right: 5px; +} +.chzn-container-multi .chzn-choices .search-choice-focus { + background: #d4d4d4; +} +.chzn-container-multi .chzn-choices .search-choice .search-choice-close { + display: block; + position: absolute; + right: 3px; + top: 4px; + width: 12px; + height: 12px; + font-size: 1px; + background: url('chosen-sprite.png') -42px 1px no-repeat; +} +.chzn-container-multi .chzn-choices .search-choice .search-choice-close:hover { + background-position: -42px -10px; +} +.chzn-container-multi .chzn-choices .search-choice-focus .search-choice-close { + background-position: -42px -10px; +} +/* @end */ + +/* @group Results */ +.chzn-container .chzn-results { + margin: 0 4px 4px 0; + max-height: 240px; + padding: 0 0 0 4px; + position: relative; + overflow-x: hidden; + overflow-y: auto; + -webkit-overflow-scrolling: touch; +} +.chzn-container-multi .chzn-results { + margin: 0; + padding: 0; +} +.chzn-container .chzn-results li { + display: none; + line-height: 15px; + padding: 5px 6px; + margin: 0; + list-style: none; +} +.chzn-container .chzn-results .active-result { + cursor: pointer; + display: list-item; +} +.chzn-container .chzn-results .highlighted { + background-color: #3875d7; + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#3875d7', endColorstr='#2a62bc', GradientType=0 ); + background-image: -webkit-gradient(linear, 0 0, 0 100%, color-stop(20%, #3875d7), color-stop(90%, #2a62bc)); + background-image: -webkit-linear-gradient(top, #3875d7 20%, #2a62bc 90%); + background-image: -moz-linear-gradient(top, #3875d7 20%, #2a62bc 90%); + background-image: -o-linear-gradient(top, #3875d7 20%, #2a62bc 90%); + background-image: linear-gradient(#3875d7 20%, #2a62bc 90%); + color: #fff; +} +.chzn-container .chzn-results li em { + background: #feffde; + font-style: normal; +} +.chzn-container .chzn-results .highlighted em { + background: transparent; +} +.chzn-container .chzn-results .no-results { + background: #f4f4f4; + display: list-item; +} +.chzn-container .chzn-results .group-result { + cursor: default; + color: #999; + font-weight: bold; +} +.chzn-container .chzn-results .group-option { + padding-left: 15px; +} +.chzn-container-multi .chzn-drop .result-selected { + display: none; +} +.chzn-container .chzn-results-scroll { + background: white; + margin: 0 4px; + position: absolute; + text-align: center; + width: 321px; /* This should by dynamic with js */ + z-index: 1; +} +.chzn-container .chzn-results-scroll span { + display: inline-block; + height: 17px; + text-indent: -5000px; + width: 9px; +} +.chzn-container .chzn-results-scroll-down { + bottom: 0; +} +.chzn-container .chzn-results-scroll-down span { + background: url('chosen-sprite.png') no-repeat -4px -3px; +} +.chzn-container .chzn-results-scroll-up span { + background: url('chosen-sprite.png') no-repeat -22px -3px; +} +/* @end */ + +/* @group Active */ +.chzn-container-active .chzn-single { + -webkit-box-shadow: 0 0 5px rgba(0,0,0,.3); + -moz-box-shadow : 0 0 5px rgba(0,0,0,.3); + box-shadow : 0 0 5px rgba(0,0,0,.3); + border: 1px solid #5897fb; +} +.chzn-container-active.chzn-with-drop .chzn-single { + border: 1px solid #aaa; + -webkit-box-shadow: 0 1px 0 #fff inset; + -moz-box-shadow : 0 1px 0 #fff inset; + box-shadow : 0 1px 0 #fff inset; + background-color: #eee; + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0 ); + background-image: -webkit-gradient(linear, 0 0, 0 100%, color-stop(20%, #eeeeee), color-stop(80%, #ffffff)); + background-image: -webkit-linear-gradient(top, #eeeeee 20%, #ffffff 80%); + background-image: -moz-linear-gradient(top, #eeeeee 20%, #ffffff 80%); + background-image: -o-linear-gradient(top, #eeeeee 20%, #ffffff 80%); + background-image: linear-gradient(#eeeeee 20%, #ffffff 80%); + -webkit-border-bottom-left-radius : 0; + -webkit-border-bottom-right-radius: 0; + -moz-border-radius-bottomleft : 0; + -moz-border-radius-bottomright: 0; + border-bottom-left-radius : 0; + border-bottom-right-radius: 0; +} +.chzn-container-active.chzn-with-drop .chzn-single div { + background: transparent; + border-left: none; +} +.chzn-container-active.chzn-with-drop .chzn-single div b { + background-position: -18px 2px; +} +.chzn-container-active .chzn-choices { + -webkit-box-shadow: 0 0 5px rgba(0,0,0,.3); + -moz-box-shadow : 0 0 5px rgba(0,0,0,.3); + box-shadow : 0 0 5px rgba(0,0,0,.3); + border: 1px solid #5897fb; +} +.chzn-container-active .chzn-choices .search-field input { + color: #111 !important; +} +/* @end */ + +/* @group Disabled Support */ +.chzn-disabled { + cursor: default; + opacity:0.5 !important; +} +.chzn-disabled .chzn-single { + cursor: default; +} +.chzn-disabled .chzn-choices .search-choice .search-choice-close { + cursor: default; +} + +/* @group Right to Left */ +.chzn-rtl { text-align: right; } +.chzn-rtl .chzn-single { padding: 0 8px 0 0; overflow: visible; } +.chzn-rtl .chzn-single span { margin-left: 26px; margin-right: 0; direction: rtl; } + +.chzn-rtl .chzn-single div { left: 3px; right: auto; } +.chzn-rtl .chzn-single abbr { + left: 26px; + right: auto; +} +.chzn-rtl .chzn-choices .search-field input { direction: rtl; } +.chzn-rtl .chzn-choices li { float: right; } +.chzn-rtl .chzn-choices .search-choice { padding: 3px 5px 3px 19px; margin: 3px 5px 3px 0; } +.chzn-rtl .chzn-choices .search-choice .search-choice-close { left: 4px; right: auto; } +.chzn-rtl .chzn-search { left: 9999px; } +.chzn-rtl.chzn-with-drop .chzn-search { left: 0px; } +.chzn-rtl .chzn-drop { left: 9999px; } +.chzn-rtl.chzn-container-single .chzn-results { margin: 0 0 4px 4px; padding: 0 4px 0 0; } +.chzn-rtl .chzn-results .group-option { padding-left: 0; padding-right: 15px; } +.chzn-rtl.chzn-container-active.chzn-with-drop .chzn-single div { border-right: none; } +.chzn-rtl .chzn-search input { + background: #fff url('chosen-sprite.png') no-repeat -30px -20px; + background: url('chosen-sprite.png') no-repeat -30px -20px, -webkit-gradient(linear, 0 0, 0 100%, color-stop(1%, #eeeeee), color-stop(15%, #ffffff)); + background: url('chosen-sprite.png') no-repeat -30px -20px, -webkit-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background: url('chosen-sprite.png') no-repeat -30px -20px, -moz-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background: url('chosen-sprite.png') no-repeat -30px -20px, -o-linear-gradient(top, #eeeeee 1%, #ffffff 15%); + background: url('chosen-sprite.png') no-repeat -30px -20px, linear-gradient(#eeeeee 1%, #ffffff 15%); + padding: 4px 5px 4px 20px; + direction: rtl; +} +.chzn-container-single.chzn-rtl .chzn-single div b { + background-position: 6px 2px; +} +.chzn-container-single.chzn-rtl.chzn-with-drop .chzn-single div b { + background-position: -12px 2px; +} +/* @end */ + +/* @group Retina compatibility */ +@media only screen and (-webkit-min-device-pixel-ratio: 2), only screen and (min-resolution: 144dpi) { + .chzn-rtl .chzn-search input, .chzn-container-single .chzn-single abbr, .chzn-container-single .chzn-single div b, .chzn-container-single .chzn-search input, .chzn-container-multi .chzn-choices .search-choice .search-choice-close, .chzn-container .chzn-results-scroll-down span, .chzn-container .chzn-results-scroll-up span { + background-image: url('chosen-sprite@2x.png') !important; + background-repeat: no-repeat !important; + background-size: 52px 37px !important; + } +} +/* @end */ diff --git a/resources/lib/jquery.chosen/chosen.jquery.js b/resources/lib/jquery.chosen/chosen.jquery.js new file mode 100644 index 000000000000..745174f7684e --- /dev/null +++ b/resources/lib/jquery.chosen/chosen.jquery.js @@ -0,0 +1,1103 @@ +// Chosen, a Select Box Enhancer for jQuery and Protoype +// by Patrick Filler for Harvest, http://getharvest.com +// +// Version 0.9.14 +// Full source at https://github.com/harvesthq/chosen +// Copyright (c) 2011 Harvest http://getharvest.com + +// MIT License, https://github.com/harvesthq/chosen/blob/master/LICENSE.md +// This file is generated by `cake build`, do not edit it by hand. +(function() { + var SelectParser; + + SelectParser = (function() { + + function SelectParser() { + this.options_index = 0; + this.parsed = []; + } + + SelectParser.prototype.add_node = function(child) { + if (child.nodeName.toUpperCase() === "OPTGROUP") { + return this.add_group(child); + } else { + return this.add_option(child); + } + }; + + SelectParser.prototype.add_group = function(group) { + var group_position, option, _i, _len, _ref, _results; + group_position = this.parsed.length; + this.parsed.push({ + array_index: group_position, + group: true, + label: group.label, + children: 0, + disabled: group.disabled + }); + _ref = group.childNodes; + _results = []; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + option = _ref[_i]; + _results.push(this.add_option(option, group_position, group.disabled)); + } + return _results; + }; + + SelectParser.prototype.add_option = function(option, group_position, group_disabled) { + if (option.nodeName.toUpperCase() === "OPTION") { + if (option.text !== "") { + if (group_position != null) { + this.parsed[group_position].children += 1; + } + this.parsed.push({ + array_index: this.parsed.length, + options_index: this.options_index, + value: option.value, + text: option.text, + html: option.innerHTML, + selected: option.selected, + disabled: group_disabled === true ? group_disabled : option.disabled, + group_array_index: group_position, + classes: option.className, + style: option.style.cssText + }); + } else { + this.parsed.push({ + array_index: this.parsed.length, + options_index: this.options_index, + empty: true + }); + } + return this.options_index += 1; + } + }; + + return SelectParser; + + })(); + + SelectParser.select_to_array = function(select) { + var child, parser, _i, _len, _ref; + parser = new SelectParser(); + _ref = select.childNodes; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + child = _ref[_i]; + parser.add_node(child); + } + return parser.parsed; + }; + + this.SelectParser = SelectParser; + +}).call(this); + +/* +Chosen source: generate output using 'cake build' +Copyright (c) 2011 by Harvest +*/ + + +(function() { + var AbstractChosen, root; + + root = this; + + AbstractChosen = (function() { + + function AbstractChosen(form_field, options) { + this.form_field = form_field; + this.options = options != null ? options : {}; + if (!AbstractChosen.browser_is_supported()) { + return; + } + this.is_multiple = this.form_field.multiple; + this.set_default_text(); + this.set_default_values(); + this.setup(); + this.set_up_html(); + this.register_observers(); + this.finish_setup(); + } + + AbstractChosen.prototype.set_default_values = function() { + var _this = this; + this.click_test_action = function(evt) { + return _this.test_active_click(evt); + }; + this.activate_action = function(evt) { + return _this.activate_field(evt); + }; + this.active_field = false; + this.mouse_on_container = false; + this.results_showing = false; + this.result_highlighted = null; + this.result_single_selected = null; + this.allow_single_deselect = (this.options.allow_single_deselect != null) && (this.form_field.options[0] != null) && this.form_field.options[0].text === "" ? this.options.allow_single_deselect : false; + this.disable_search_threshold = this.options.disable_search_threshold || 0; + this.disable_search = this.options.disable_search || false; + this.enable_split_word_search = this.options.enable_split_word_search != null ? this.options.enable_split_word_search : true; + this.search_contains = this.options.search_contains || false; + this.choices = 0; + this.single_backstroke_delete = this.options.single_backstroke_delete || false; + this.max_selected_options = this.options.max_selected_options || Infinity; + return this.inherit_select_classes = this.options.inherit_select_classes || false; + }; + + AbstractChosen.prototype.set_default_text = function() { + if (this.form_field.getAttribute("data-placeholder")) { + this.default_text = this.form_field.getAttribute("data-placeholder"); + } else if (this.is_multiple) { + this.default_text = this.options.placeholder_text_multiple || this.options.placeholder_text || AbstractChosen.default_multiple_text; + } else { + this.default_text = this.options.placeholder_text_single || this.options.placeholder_text || AbstractChosen.default_single_text; + } + return this.results_none_found = this.form_field.getAttribute("data-no_results_text") || this.options.no_results_text || AbstractChosen.default_no_result_text; + }; + + AbstractChosen.prototype.mouse_enter = function() { + return this.mouse_on_container = true; + }; + + AbstractChosen.prototype.mouse_leave = function() { + return this.mouse_on_container = false; + }; + + AbstractChosen.prototype.input_focus = function(evt) { + var _this = this; + if (this.is_multiple) { + if (!this.active_field) { + return setTimeout((function() { + return _this.container_mousedown(); + }), 50); + } + } else { + if (!this.active_field) { + return this.activate_field(); + } + } + }; + + AbstractChosen.prototype.input_blur = function(evt) { + var _this = this; + if (!this.mouse_on_container) { + this.active_field = false; + return setTimeout((function() { + return _this.blur_test(); + }), 100); + } + }; + + AbstractChosen.prototype.result_add_option = function(option) { + var classes, style; + if (!option.disabled) { + option.dom_id = this.container_id + "_o_" + option.array_index; + classes = option.selected && this.is_multiple ? [] : ["active-result"]; + if (option.selected) { + classes.push("result-selected"); + } + if (option.group_array_index != null) { + classes.push("group-option"); + } + if (option.classes !== "") { + classes.push(option.classes); + } + style = option.style.cssText !== "" ? " style=\"" + option.style + "\"" : ""; + return '<li id="' + option.dom_id + '" class="' + classes.join(' ') + '"' + style + '>' + option.html + '</li>'; + } else { + return ""; + } + }; + + AbstractChosen.prototype.results_update_field = function() { + this.set_default_text(); + if (!this.is_multiple) { + this.results_reset_cleanup(); + } + this.result_clear_highlight(); + this.result_single_selected = null; + return this.results_build(); + }; + + AbstractChosen.prototype.results_toggle = function() { + if (this.results_showing) { + return this.results_hide(); + } else { + return this.results_show(); + } + }; + + AbstractChosen.prototype.results_search = function(evt) { + if (this.results_showing) { + return this.winnow_results(); + } else { + return this.results_show(); + } + }; + + AbstractChosen.prototype.choices_click = function(evt) { + evt.preventDefault(); + if (!this.results_showing) { + return this.results_show(); + } + }; + + AbstractChosen.prototype.keyup_checker = function(evt) { + var stroke, _ref; + stroke = (_ref = evt.which) != null ? _ref : evt.keyCode; + this.search_field_scale(); + switch (stroke) { + case 8: + if (this.is_multiple && this.backstroke_length < 1 && this.choices > 0) { + return this.keydown_backstroke(); + } else if (!this.pending_backstroke) { + this.result_clear_highlight(); + return this.results_search(); + } + break; + case 13: + evt.preventDefault(); + if (this.results_showing) { + return this.result_select(evt); + } + break; + case 27: + if (this.results_showing) { + this.results_hide(); + } + return true; + case 9: + case 38: + case 40: + case 16: + case 91: + case 17: + break; + default: + return this.results_search(); + } + }; + + AbstractChosen.prototype.generate_field_id = function() { + var new_id; + new_id = this.generate_random_id(); + this.form_field.id = new_id; + return new_id; + }; + + AbstractChosen.prototype.generate_random_char = function() { + var chars, newchar, rand; + chars = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ"; + rand = Math.floor(Math.random() * chars.length); + return newchar = chars.substring(rand, rand + 1); + }; + + AbstractChosen.prototype.container_width = function() { + var width; + if (this.options.width != null) { + return this.options.width; + } + width = window.getComputedStyle != null ? parseFloat(window.getComputedStyle(this.form_field).getPropertyValue('width')) : (typeof jQuery !== "undefined" && jQuery !== null) && (this.form_field_jq != null) ? this.form_field_jq.outerWidth() : this.form_field.getWidth(); + return width + "px"; + }; + + AbstractChosen.browser_is_supported = function() { + var _ref; + if (window.navigator.appName === "Microsoft Internet Explorer") { + return (null !== (_ref = document.documentMode) && _ref >= 8); + } + return true; + }; + + AbstractChosen.default_multiple_text = "Select Some Options"; + + AbstractChosen.default_single_text = "Select an Option"; + + AbstractChosen.default_no_result_text = "No results match"; + + return AbstractChosen; + + })(); + + root.AbstractChosen = AbstractChosen; + +}).call(this); + +/* +Chosen source: generate output using 'cake build' +Copyright (c) 2011 by Harvest +*/ + + +(function() { + var $, Chosen, root, + __hasProp = {}.hasOwnProperty, + __extends = function(child, parent) { for (var key in parent) { if (__hasProp.call(parent, key)) child[key] = parent[key]; } function ctor() { this.constructor = child; } ctor.prototype = parent.prototype; child.prototype = new ctor(); child.__super__ = parent.prototype; return child; }; + + root = this; + + $ = jQuery; + + $.fn.extend({ + chosen: function(options) { + if (!AbstractChosen.browser_is_supported()) { + return this; + } + return this.each(function(input_field) { + var $this; + $this = $(this); + if (!$this.hasClass("chzn-done")) { + return $this.data('chosen', new Chosen(this, options)); + } + }); + } + }); + + Chosen = (function(_super) { + + __extends(Chosen, _super); + + function Chosen() { + return Chosen.__super__.constructor.apply(this, arguments); + } + + Chosen.prototype.setup = function() { + this.form_field_jq = $(this.form_field); + this.current_selectedIndex = this.form_field.selectedIndex; + return this.is_rtl = this.form_field_jq.hasClass("chzn-rtl"); + }; + + Chosen.prototype.finish_setup = function() { + return this.form_field_jq.addClass("chzn-done"); + }; + + Chosen.prototype.set_up_html = function() { + var container_classes, container_props; + this.container_id = this.form_field.id.length ? this.form_field.id.replace(/[^\w]/g, '_') : this.generate_field_id(); + this.container_id += "_chzn"; + container_classes = ["chzn-container"]; + container_classes.push("chzn-container-" + (this.is_multiple ? "multi" : "single")); + if (this.inherit_select_classes && this.form_field.className) { + container_classes.push(this.form_field.className); + } + if (this.is_rtl) { + container_classes.push("chzn-rtl"); + } + container_props = { + 'id': this.container_id, + 'class': container_classes.join(' '), + 'style': "width: " + (this.container_width()) + ";", + 'title': this.form_field.title + }; + this.container = $("<div />", container_props); + if (this.is_multiple) { + this.container.html('<ul class="chzn-choices"><li class="search-field"><input type="text" value="' + this.default_text + '" class="default" autocomplete="off" style="width:auto;" /></li></ul><div class="chzn-drop"><ul class="chzn-results"></ul></div>'); + } else { + this.container.html('<a href="javascript:void(0)" class="chzn-single chzn-default" tabindex="-1"><span>' + this.default_text + '</span><div><b></b></div></a><div class="chzn-drop"><div class="chzn-search"><input type="text" autocomplete="off" /></div><ul class="chzn-results"></ul></div>'); + } + this.form_field_jq.hide().after(this.container); + this.dropdown = this.container.find('div.chzn-drop').first(); + this.search_field = this.container.find('input').first(); + this.search_results = this.container.find('ul.chzn-results').first(); + this.search_field_scale(); + this.search_no_results = this.container.find('li.no-results').first(); + if (this.is_multiple) { + this.search_choices = this.container.find('ul.chzn-choices').first(); + this.search_container = this.container.find('li.search-field').first(); + } else { + this.search_container = this.container.find('div.chzn-search').first(); + this.selected_item = this.container.find('.chzn-single').first(); + } + this.results_build(); + this.set_tab_index(); + this.set_label_behavior(); + return this.form_field_jq.trigger("liszt:ready", { + chosen: this + }); + }; + + Chosen.prototype.register_observers = function() { + var _this = this; + this.container.mousedown(function(evt) { + _this.container_mousedown(evt); + }); + this.container.mouseup(function(evt) { + _this.container_mouseup(evt); + }); + this.container.mouseenter(function(evt) { + _this.mouse_enter(evt); + }); + this.container.mouseleave(function(evt) { + _this.mouse_leave(evt); + }); + this.search_results.mouseup(function(evt) { + _this.search_results_mouseup(evt); + }); + this.search_results.mouseover(function(evt) { + _this.search_results_mouseover(evt); + }); + this.search_results.mouseout(function(evt) { + _this.search_results_mouseout(evt); + }); + this.search_results.bind('mousewheel DOMMouseScroll', function(evt) { + _this.search_results_mousewheel(evt); + }); + this.form_field_jq.bind("liszt:updated", function(evt) { + _this.results_update_field(evt); + }); + this.form_field_jq.bind("liszt:activate", function(evt) { + _this.activate_field(evt); + }); + this.form_field_jq.bind("liszt:open", function(evt) { + _this.container_mousedown(evt); + }); + this.search_field.blur(function(evt) { + _this.input_blur(evt); + }); + this.search_field.keyup(function(evt) { + _this.keyup_checker(evt); + }); + this.search_field.keydown(function(evt) { + _this.keydown_checker(evt); + }); + this.search_field.focus(function(evt) { + _this.input_focus(evt); + }); + if (this.is_multiple) { + return this.search_choices.click(function(evt) { + _this.choices_click(evt); + }); + } else { + return this.container.click(function(evt) { + evt.preventDefault(); + }); + } + }; + + Chosen.prototype.search_field_disabled = function() { + this.is_disabled = this.form_field_jq[0].disabled; + if (this.is_disabled) { + this.container.addClass('chzn-disabled'); + this.search_field[0].disabled = true; + if (!this.is_multiple) { + this.selected_item.unbind("focus", this.activate_action); + } + return this.close_field(); + } else { + this.container.removeClass('chzn-disabled'); + this.search_field[0].disabled = false; + if (!this.is_multiple) { + return this.selected_item.bind("focus", this.activate_action); + } + } + }; + + Chosen.prototype.container_mousedown = function(evt) { + if (!this.is_disabled) { + if (evt && evt.type === "mousedown" && !this.results_showing) { + evt.preventDefault(); + } + if (!((evt != null) && ($(evt.target)).hasClass("search-choice-close"))) { + if (!this.active_field) { + if (this.is_multiple) { + this.search_field.val(""); + } + $(document).click(this.click_test_action); + this.results_show(); + } else if (!this.is_multiple && evt && (($(evt.target)[0] === this.selected_item[0]) || $(evt.target).parents("a.chzn-single").length)) { + evt.preventDefault(); + this.results_toggle(); + } + return this.activate_field(); + } + } + }; + + Chosen.prototype.container_mouseup = function(evt) { + if (evt.target.nodeName === "ABBR" && !this.is_disabled) { + return this.results_reset(evt); + } + }; + + Chosen.prototype.search_results_mousewheel = function(evt) { + var delta, _ref, _ref1; + delta = -((_ref = evt.originalEvent) != null ? _ref.wheelDelta : void 0) || ((_ref1 = evt.originialEvent) != null ? _ref1.detail : void 0); + if (delta != null) { + evt.preventDefault(); + if (evt.type === 'DOMMouseScroll') { + delta = delta * 40; + } + return this.search_results.scrollTop(delta + this.search_results.scrollTop()); + } + }; + + Chosen.prototype.blur_test = function(evt) { + if (!this.active_field && this.container.hasClass("chzn-container-active")) { + return this.close_field(); + } + }; + + Chosen.prototype.close_field = function() { + $(document).unbind("click", this.click_test_action); + this.active_field = false; + this.results_hide(); + this.container.removeClass("chzn-container-active"); + this.winnow_results_clear(); + this.clear_backstroke(); + this.show_search_field_default(); + return this.search_field_scale(); + }; + + Chosen.prototype.activate_field = function() { + this.container.addClass("chzn-container-active"); + this.active_field = true; + this.search_field.val(this.search_field.val()); + return this.search_field.focus(); + }; + + Chosen.prototype.test_active_click = function(evt) { + if ($(evt.target).parents('#' + this.container_id).length) { + return this.active_field = true; + } else { + return this.close_field(); + } + }; + + Chosen.prototype.results_build = function() { + var content, data, _i, _len, _ref; + this.parsing = true; + this.results_data = root.SelectParser.select_to_array(this.form_field); + if (this.is_multiple && this.choices > 0) { + this.search_choices.find("li.search-choice").remove(); + this.choices = 0; + } else if (!this.is_multiple) { + this.selected_item.addClass("chzn-default").find("span").text(this.default_text); + if (this.disable_search || this.form_field.options.length <= this.disable_search_threshold) { + this.container.addClass("chzn-container-single-nosearch"); + } else { + this.container.removeClass("chzn-container-single-nosearch"); + } + } + content = ''; + _ref = this.results_data; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + data = _ref[_i]; + if (data.group) { + content += this.result_add_group(data); + } else if (!data.empty) { + content += this.result_add_option(data); + if (data.selected && this.is_multiple) { + this.choice_build(data); + } else if (data.selected && !this.is_multiple) { + this.selected_item.removeClass("chzn-default").find("span").text(data.text); + if (this.allow_single_deselect) { + this.single_deselect_control_build(); + } + } + } + } + this.search_field_disabled(); + this.show_search_field_default(); + this.search_field_scale(); + this.search_results.html(content); + return this.parsing = false; + }; + + Chosen.prototype.result_add_group = function(group) { + if (!group.disabled) { + group.dom_id = this.container_id + "_g_" + group.array_index; + return '<li id="' + group.dom_id + '" class="group-result">' + $("<div />").text(group.label).html() + '</li>'; + } else { + return ""; + } + }; + + Chosen.prototype.result_do_highlight = function(el) { + var high_bottom, high_top, maxHeight, visible_bottom, visible_top; + if (el.length) { + this.result_clear_highlight(); + this.result_highlight = el; + this.result_highlight.addClass("highlighted"); + maxHeight = parseInt(this.search_results.css("maxHeight"), 10); + visible_top = this.search_results.scrollTop(); + visible_bottom = maxHeight + visible_top; + high_top = this.result_highlight.position().top + this.search_results.scrollTop(); + high_bottom = high_top + this.result_highlight.outerHeight(); + if (high_bottom >= visible_bottom) { + return this.search_results.scrollTop((high_bottom - maxHeight) > 0 ? high_bottom - maxHeight : 0); + } else if (high_top < visible_top) { + return this.search_results.scrollTop(high_top); + } + } + }; + + Chosen.prototype.result_clear_highlight = function() { + if (this.result_highlight) { + this.result_highlight.removeClass("highlighted"); + } + return this.result_highlight = null; + }; + + Chosen.prototype.results_show = function() { + if (this.result_single_selected != null) { + this.result_do_highlight(this.result_single_selected); + } else if (this.is_multiple && this.max_selected_options <= this.choices) { + this.form_field_jq.trigger("liszt:maxselected", { + chosen: this + }); + return false; + } + this.container.addClass("chzn-with-drop"); + this.form_field_jq.trigger("liszt:showing_dropdown", { + chosen: this + }); + this.results_showing = true; + this.search_field.focus(); + this.search_field.val(this.search_field.val()); + return this.winnow_results(); + }; + + Chosen.prototype.results_hide = function() { + this.result_clear_highlight(); + this.container.removeClass("chzn-with-drop"); + this.form_field_jq.trigger("liszt:hiding_dropdown", { + chosen: this + }); + return this.results_showing = false; + }; + + Chosen.prototype.set_tab_index = function(el) { + var ti; + if (this.form_field_jq.attr("tabindex")) { + ti = this.form_field_jq.attr("tabindex"); + this.form_field_jq.attr("tabindex", -1); + return this.search_field.attr("tabindex", ti); + } + }; + + Chosen.prototype.set_label_behavior = function() { + var _this = this; + this.form_field_label = this.form_field_jq.parents("label"); + if (!this.form_field_label.length && this.form_field.id.length) { + this.form_field_label = $("label[for=" + this.form_field.id + "]"); + } + if (this.form_field_label.length > 0) { + return this.form_field_label.click(function(evt) { + if (_this.is_multiple) { + return _this.container_mousedown(evt); + } else { + return _this.activate_field(); + } + }); + } + }; + + Chosen.prototype.show_search_field_default = function() { + if (this.is_multiple && this.choices < 1 && !this.active_field) { + this.search_field.val(this.default_text); + return this.search_field.addClass("default"); + } else { + this.search_field.val(""); + return this.search_field.removeClass("default"); + } + }; + + Chosen.prototype.search_results_mouseup = function(evt) { + var target; + target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first(); + if (target.length) { + this.result_highlight = target; + this.result_select(evt); + return this.search_field.focus(); + } + }; + + Chosen.prototype.search_results_mouseover = function(evt) { + var target; + target = $(evt.target).hasClass("active-result") ? $(evt.target) : $(evt.target).parents(".active-result").first(); + if (target) { + return this.result_do_highlight(target); + } + }; + + Chosen.prototype.search_results_mouseout = function(evt) { + if ($(evt.target).hasClass("active-result" || $(evt.target).parents('.active-result').first())) { + return this.result_clear_highlight(); + } + }; + + Chosen.prototype.choice_build = function(item) { + var choice_id, html, link, + _this = this; + if (this.is_multiple && this.max_selected_options <= this.choices) { + this.form_field_jq.trigger("liszt:maxselected", { + chosen: this + }); + return false; + } + choice_id = this.container_id + "_c_" + item.array_index; + this.choices += 1; + if (item.disabled) { + html = '<li class="search-choice search-choice-disabled" id="' + choice_id + '"><span>' + item.html + '</span></li>'; + } else { + html = '<li class="search-choice" id="' + choice_id + '"><span>' + item.html + '</span><a href="javascript:void(0)" class="search-choice-close" rel="' + item.array_index + '"></a></li>'; + } + this.search_container.before(html); + link = $('#' + choice_id).find("a").first(); + return link.click(function(evt) { + return _this.choice_destroy_link_click(evt); + }); + }; + + Chosen.prototype.choice_destroy_link_click = function(evt) { + evt.preventDefault(); + evt.stopPropagation(); + if (!this.is_disabled) { + return this.choice_destroy($(evt.target)); + } + }; + + Chosen.prototype.choice_destroy = function(link) { + if (this.result_deselect(link.attr("rel"))) { + this.choices -= 1; + this.show_search_field_default(); + if (this.is_multiple && this.choices > 0 && this.search_field.val().length < 1) { + this.results_hide(); + } + link.parents('li').first().remove(); + return this.search_field_scale(); + } + }; + + Chosen.prototype.results_reset = function() { + this.form_field.options[0].selected = true; + this.selected_item.find("span").text(this.default_text); + if (!this.is_multiple) { + this.selected_item.addClass("chzn-default"); + } + this.show_search_field_default(); + this.results_reset_cleanup(); + this.form_field_jq.trigger("change"); + if (this.active_field) { + return this.results_hide(); + } + }; + + Chosen.prototype.results_reset_cleanup = function() { + this.current_selectedIndex = this.form_field.selectedIndex; + return this.selected_item.find("abbr").remove(); + }; + + Chosen.prototype.result_select = function(evt) { + var high, high_id, item, position; + if (this.result_highlight) { + high = this.result_highlight; + high_id = high.attr("id"); + this.result_clear_highlight(); + if (this.is_multiple) { + this.result_deactivate(high); + } else { + this.search_results.find(".result-selected").removeClass("result-selected"); + this.result_single_selected = high; + this.selected_item.removeClass("chzn-default"); + } + high.addClass("result-selected"); + position = high_id.substr(high_id.lastIndexOf("_") + 1); + item = this.results_data[position]; + item.selected = true; + this.form_field.options[item.options_index].selected = true; + if (this.is_multiple) { + this.choice_build(item); + } else { + this.selected_item.find("span").first().text(item.text); + if (this.allow_single_deselect) { + this.single_deselect_control_build(); + } + } + if (!((evt.metaKey || evt.ctrlKey) && this.is_multiple)) { + this.results_hide(); + } + this.search_field.val(""); + if (this.is_multiple || this.form_field.selectedIndex !== this.current_selectedIndex) { + this.form_field_jq.trigger("change", { + 'selected': this.form_field.options[item.options_index].value + }); + } + this.current_selectedIndex = this.form_field.selectedIndex; + return this.search_field_scale(); + } + }; + + Chosen.prototype.result_activate = function(el) { + return el.addClass("active-result"); + }; + + Chosen.prototype.result_deactivate = function(el) { + return el.removeClass("active-result"); + }; + + Chosen.prototype.result_deselect = function(pos) { + var result, result_data; + result_data = this.results_data[pos]; + if (!this.form_field.options[result_data.options_index].disabled) { + result_data.selected = false; + this.form_field.options[result_data.options_index].selected = false; + result = $("#" + this.container_id + "_o_" + pos); + result.removeClass("result-selected").addClass("active-result").show(); + this.result_clear_highlight(); + this.winnow_results(); + this.form_field_jq.trigger("change", { + deselected: this.form_field.options[result_data.options_index].value + }); + this.search_field_scale(); + return true; + } else { + return false; + } + }; + + Chosen.prototype.single_deselect_control_build = function() { + if (this.allow_single_deselect && this.selected_item.find("abbr").length < 1) { + return this.selected_item.find("span").first().after("<abbr class=\"search-choice-close\"></abbr>"); + } + }; + + Chosen.prototype.winnow_results = function() { + var found, option, part, parts, regex, regexAnchor, result, result_id, results, searchText, startpos, text, zregex, _i, _j, _len, _len1, _ref; + this.no_results_clear(); + results = 0; + searchText = this.search_field.val() === this.default_text ? "" : $('<div/>').text($.trim(this.search_field.val())).html(); + regexAnchor = this.search_contains ? "" : "^"; + regex = new RegExp(regexAnchor + searchText.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"), 'i'); + zregex = new RegExp(searchText.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"), 'i'); + _ref = this.results_data; + for (_i = 0, _len = _ref.length; _i < _len; _i++) { + option = _ref[_i]; + if (!option.disabled && !option.empty) { + if (option.group) { + $('#' + option.dom_id).css('display', 'none'); + } else if (!(this.is_multiple && option.selected)) { + found = false; + result_id = option.dom_id; + result = $("#" + result_id); + if (regex.test(option.html)) { + found = true; + results += 1; + } else if (this.enable_split_word_search && (option.html.indexOf(" ") >= 0 || option.html.indexOf("[") === 0)) { + parts = option.html.replace(/\[|\]/g, "").split(" "); + if (parts.length) { + for (_j = 0, _len1 = parts.length; _j < _len1; _j++) { + part = parts[_j]; + if (regex.test(part)) { + found = true; + results += 1; + } + } + } + } + if (found) { + if (searchText.length) { + startpos = option.html.search(zregex); + text = option.html.substr(0, startpos + searchText.length) + '</em>' + option.html.substr(startpos + searchText.length); + text = text.substr(0, startpos) + '<em>' + text.substr(startpos); + } else { + text = option.html; + } + result.html(text); + this.result_activate(result); + if (option.group_array_index != null) { + $("#" + this.results_data[option.group_array_index].dom_id).css('display', 'list-item'); + } + } else { + if (this.result_highlight && result_id === this.result_highlight.attr('id')) { + this.result_clear_highlight(); + } + this.result_deactivate(result); + } + } + } + } + if (results < 1 && searchText.length) { + return this.no_results(searchText); + } else { + return this.winnow_results_set_highlight(); + } + }; + + Chosen.prototype.winnow_results_clear = function() { + var li, lis, _i, _len, _results; + this.search_field.val(""); + lis = this.search_results.find("li"); + _results = []; + for (_i = 0, _len = lis.length; _i < _len; _i++) { + li = lis[_i]; + li = $(li); + if (li.hasClass("group-result")) { + _results.push(li.css('display', 'auto')); + } else if (!this.is_multiple || !li.hasClass("result-selected")) { + _results.push(this.result_activate(li)); + } else { + _results.push(void 0); + } + } + return _results; + }; + + Chosen.prototype.winnow_results_set_highlight = function() { + var do_high, selected_results; + if (!this.result_highlight) { + selected_results = !this.is_multiple ? this.search_results.find(".result-selected.active-result") : []; + do_high = selected_results.length ? selected_results.first() : this.search_results.find(".active-result").first(); + if (do_high != null) { + return this.result_do_highlight(do_high); + } + } + }; + + Chosen.prototype.no_results = function(terms) { + var no_results_html; + no_results_html = $('<li class="no-results">' + this.results_none_found + ' "<span></span>"</li>'); + no_results_html.find("span").first().html(terms); + return this.search_results.append(no_results_html); + }; + + Chosen.prototype.no_results_clear = function() { + return this.search_results.find(".no-results").remove(); + }; + + Chosen.prototype.keydown_arrow = function() { + var first_active, next_sib; + if (!this.result_highlight) { + first_active = this.search_results.find("li.active-result").first(); + if (first_active) { + this.result_do_highlight($(first_active)); + } + } else if (this.results_showing) { + next_sib = this.result_highlight.nextAll("li.active-result").first(); + if (next_sib) { + this.result_do_highlight(next_sib); + } + } + if (!this.results_showing) { + return this.results_show(); + } + }; + + Chosen.prototype.keyup_arrow = function() { + var prev_sibs; + if (!this.results_showing && !this.is_multiple) { + return this.results_show(); + } else if (this.result_highlight) { + prev_sibs = this.result_highlight.prevAll("li.active-result"); + if (prev_sibs.length) { + return this.result_do_highlight(prev_sibs.first()); + } else { + if (this.choices > 0) { + this.results_hide(); + } + return this.result_clear_highlight(); + } + } + }; + + Chosen.prototype.keydown_backstroke = function() { + var next_available_destroy; + if (this.pending_backstroke) { + this.choice_destroy(this.pending_backstroke.find("a").first()); + return this.clear_backstroke(); + } else { + next_available_destroy = this.search_container.siblings("li.search-choice").last(); + if (next_available_destroy.length && !next_available_destroy.hasClass("search-choice-disabled")) { + this.pending_backstroke = next_available_destroy; + if (this.single_backstroke_delete) { + return this.keydown_backstroke(); + } else { + return this.pending_backstroke.addClass("search-choice-focus"); + } + } + } + }; + + Chosen.prototype.clear_backstroke = function() { + if (this.pending_backstroke) { + this.pending_backstroke.removeClass("search-choice-focus"); + } + return this.pending_backstroke = null; + }; + + Chosen.prototype.keydown_checker = function(evt) { + var stroke, _ref; + stroke = (_ref = evt.which) != null ? _ref : evt.keyCode; + this.search_field_scale(); + if (stroke !== 8 && this.pending_backstroke) { + this.clear_backstroke(); + } + switch (stroke) { + case 8: + this.backstroke_length = this.search_field.val().length; + break; + case 9: + if (this.results_showing && !this.is_multiple) { + this.result_select(evt); + } + this.mouse_on_container = false; + break; + case 13: + evt.preventDefault(); + break; + case 38: + evt.preventDefault(); + this.keyup_arrow(); + break; + case 40: + this.keydown_arrow(); + break; + } + }; + + Chosen.prototype.search_field_scale = function() { + var div, h, style, style_block, styles, w, _i, _len; + if (this.is_multiple) { + h = 0; + w = 0; + style_block = "position:absolute; left: -1000px; top: -1000px; display:none;"; + styles = ['font-size', 'font-style', 'font-weight', 'font-family', 'line-height', 'text-transform', 'letter-spacing']; + for (_i = 0, _len = styles.length; _i < _len; _i++) { + style = styles[_i]; + style_block += style + ":" + this.search_field.css(style) + ";"; + } + div = $('<div />', { + 'style': style_block + }); + div.text(this.search_field.val()); + $('body').append(div); + w = div.width() + 25; + div.remove(); + if (!this.f_width) { + this.f_width = this.container.outerWidth(); + } + if (w > this.f_width - 10) { + w = this.f_width - 10; + } + return this.search_field.css({ + 'width': w + 'px' + }); + } + }; + + Chosen.prototype.generate_random_id = function() { + var string; + string = "sel" + this.generate_random_char() + this.generate_random_char() + this.generate_random_char(); + while ($("#" + string).length > 0) { + string += this.generate_random_char(); + } + return string; + }; + + return Chosen; + + })(AbstractChosen); + + root.Chosen = Chosen; + +}).call(this); diff --git a/resources/lib/jquery.effects/jquery.effects.blind.js b/resources/lib/jquery.effects/jquery.effects.blind.js new file mode 100644 index 000000000000..ac25bbd8217f --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.blind.js @@ -0,0 +1,49 @@ +/*! + * jQuery UI Effects Blind 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.bounce.js b/resources/lib/jquery.effects/jquery.effects.bounce.js new file mode 100644 index 000000000000..1169d77033d4 --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.bounce.js @@ -0,0 +1,78 @@ +/*! + * jQuery UI Effects Bounce 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight(true) / 3 : el.outerWidth(true) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.clip.js b/resources/lib/jquery.effects/jquery.effects.clip.js new file mode 100644 index 000000000000..edd51a6ade60 --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.clip.js @@ -0,0 +1,54 @@ +/*! + * jQuery UI Effects Clip 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.core.js b/resources/lib/jquery.effects/jquery.effects.core.js new file mode 100644 index 000000000000..7fd946fd689d --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.core.js @@ -0,0 +1,612 @@ +/*! + * jQuery UI Effects 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + // jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css + color = ($.curCSS || $.css)(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class') || ""; + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.24", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + // support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch( e ) { + active = document.body; + } + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + var unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +// based on easing equations from Robert Penner (http://www.robertpenner.com/easing) + +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +}); + +$.extend( baseEasings, { + Sine: function ( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); + }, + Circ: function ( p ) { + return 1 - Math.sqrt( 1 - p * p ); + }, + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 ); + }, + Back: function( p ) { + return p * p * ( 3 * p - 2 ); + }, + Bounce: function ( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); + } +}); + +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < .5 ? + easeIn( p * 2 ) / 2 : + easeIn( p * -2 + 2 ) / -2 + 1; + }; +}); + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.drop.js b/resources/lib/jquery.effects/jquery.effects.drop.js new file mode 100644 index 000000000000..97e5abd43a36 --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.drop.js @@ -0,0 +1,50 @@ +/*! + * jQuery UI Effects Drop 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) / 2 : el.outerWidth( true ) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.explode.js b/resources/lib/jquery.effects/jquery.effects.explode.js new file mode 100644 index 000000000000..f63e47a225d8 --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.explode.js @@ -0,0 +1,79 @@ +/*! + * jQuery UI Effects Explode 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.fade.js b/resources/lib/jquery.effects/jquery.effects.fade.js new file mode 100644 index 000000000000..7aa37b1aa747 --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.fade.js @@ -0,0 +1,32 @@ +/*! + * jQuery UI Effects Fade 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.fold.js b/resources/lib/jquery.effects/jquery.effects.fold.js new file mode 100644 index 000000000000..06cc553382dd --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.fold.js @@ -0,0 +1,56 @@ +/*! + * jQuery UI Effects Fold 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.highlight.js b/resources/lib/jquery.effects/jquery.effects.highlight.js new file mode 100644 index 000000000000..ad9e7bd4d497 --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.highlight.js @@ -0,0 +1,50 @@ +/*! + * jQuery UI Effects Highlight 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.pulsate.js b/resources/lib/jquery.effects/jquery.effects.pulsate.js new file mode 100644 index 000000000000..d730beedf5bc --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.pulsate.js @@ -0,0 +1,51 @@ +/*! + * jQuery UI Effects Pulsate 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'), + times = ((o.options.times || 5) * 2) - 1, + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.scale.js b/resources/lib/jquery.effects/jquery.effects.scale.js new file mode 100644 index 000000000000..52d18710616e --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.scale.js @@ -0,0 +1,178 @@ +/*! + * jQuery UI Effects Scale 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + var child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.shake.js b/resources/lib/jquery.effects/jquery.effects.shake.js new file mode 100644 index 000000000000..44b8ea44cee6 --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.shake.js @@ -0,0 +1,57 @@ +/*! + * jQuery UI Effects Shake 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.slide.js b/resources/lib/jquery.effects/jquery.effects.slide.js new file mode 100644 index 000000000000..502e6c9d590b --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.slide.js @@ -0,0 +1,50 @@ +/*! + * jQuery UI Effects Slide 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) : el.outerWidth( true )); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); diff --git a/resources/lib/jquery.effects/jquery.effects.transfer.js b/resources/lib/jquery.effects/jquery.effects.transfer.js new file mode 100644 index 000000000000..4ee4ae88b1ce --- /dev/null +++ b/resources/lib/jquery.effects/jquery.effects.transfer.js @@ -0,0 +1,45 @@ +/*! + * jQuery UI Effects Transfer 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-af.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-af.js new file mode 100644 index 000000000000..0922ef7a1c02 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-af.js @@ -0,0 +1,23 @@ +/* Afrikaans initialisation for the jQuery UI date picker plugin. */ +/* Written by Renier Pretorius. */ +jQuery(function($){ + $.datepicker.regional['af'] = { + closeText: 'Selekteer', + prevText: 'Vorige', + nextText: 'Volgende', + currentText: 'Vandag', + monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie', + 'Julie','Augustus','September','Oktober','November','Desember'], + monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun', + 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'], + dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'], + dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'], + dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['af']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ar.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ar.js new file mode 100644 index 000000000000..8a9218d8b135 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ar.js @@ -0,0 +1,23 @@ +/* Arabic Translation for jQuery UI date picker plugin. */ +/* Khaled Alhourani -- me@khaledalhourani.com */ +/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */ +jQuery(function($){ + $.datepicker.regional['ar'] = { + closeText: 'إغلاق', + prevText: '<السابق', + nextText: 'التالي>', + currentText: 'اليوم', + monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'مايو', 'حزيران', + 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'], + monthNamesShort: ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12'], + dayNames: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'], + dayNamesShort: ['الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة', 'السبت'], + dayNamesMin: ['ح', 'ن', 'ث', 'ر', 'خ', 'ج', 'س'], + weekHeader: 'أسبوع', + dateFormat: 'dd/mm/yy', + firstDay: 6, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ar']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-az.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-az.js new file mode 100644 index 000000000000..57802a40bafb --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-az.js @@ -0,0 +1,23 @@ +/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Jamil Najafov (necefov33@gmail.com). */ +jQuery(function($) { + $.datepicker.regional['az'] = { + closeText: 'Bağla', + prevText: '<Geri', + nextText: 'İrəli>', + currentText: 'Bugün', + monthNames: ['Yanvar','Fevral','Mart','Aprel','May','İyun', + 'İyul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'], + monthNamesShort: ['Yan','Fev','Mar','Apr','May','İyun', + 'İyul','Avq','Sen','Okt','Noy','Dek'], + dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'], + dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'], + dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['az']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-bg.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-bg.js new file mode 100644 index 000000000000..c19d20fb1f45 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-bg.js @@ -0,0 +1,24 @@ +/* Bulgarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Stoyan Kyosev (http://svest.org). */ +jQuery(function($){ + $.datepicker.regional['bg'] = { + closeText: 'затвори', + prevText: '<назад', + nextText: 'напред>', + nextBigText: '>>', + currentText: 'днес', + monthNames: ['Януари','Февруари','Март','Април','Май','Юни', + 'Юли','Август','Септември','Октомври','Ноември','Декември'], + monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни', + 'Юли','Авг','Сеп','Окт','Нов','Дек'], + dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'], + dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'], + dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bg']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-bs.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-bs.js new file mode 100644 index 000000000000..d4dc8b0ec276 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-bs.js @@ -0,0 +1,23 @@ +/* Bosnian i18n for the jQuery UI date picker plugin. */ +/* Written by Kenan Konjo. */ +jQuery(function($){ + $.datepicker.regional['bs'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Juni', + 'Juli','August','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Wk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['bs']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ca.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ca.js new file mode 100644 index 000000000000..b128e699efde --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ca.js @@ -0,0 +1,23 @@ +/* Inicialització en català per a l'extenció 'calendar' per jQuery. */ +/* Writers: (joan.leon@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ca'] = { + closeText: 'Tancar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Avui', + monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny', + 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'], + monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Oct','Nov','Des'], + dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'], + dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'], + dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ca']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-cs.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-cs.js new file mode 100644 index 000000000000..9805bcdb826e --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-cs.js @@ -0,0 +1,23 @@ +/* Czech initialisation for the jQuery UI date picker plugin. */ +/* Written by Tomas Muller (tomas@tomas-muller.net). */ +jQuery(function($){ + $.datepicker.regional['cs'] = { + closeText: 'Zavřít', + prevText: '<Dříve', + nextText: 'Později>', + currentText: 'Nyní', + monthNames: ['leden','únor','březen','duben','květen','červen', + 'červenec','srpen','září','říjen','listopad','prosinec'], + monthNamesShort: ['led','úno','bře','dub','kvě','čer', + 'čvc','srp','zář','říj','lis','pro'], + dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'], + dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'], + dayNamesMin: ['ne','po','út','st','čt','pá','so'], + weekHeader: 'Týd', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['cs']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-da.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-da.js new file mode 100644 index 000000000000..176044e18606 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-da.js @@ -0,0 +1,23 @@ +/* Danish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jan Christensen ( deletestuff@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['da'] = { + closeText: 'Luk', + prevText: '<Forrige', + nextText: 'Næste>', + currentText: 'Idag', + monthNames: ['Januar','Februar','Marts','April','Maj','Juni', + 'Juli','August','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'], + dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'], + dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'], + weekHeader: 'Uge', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['da']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-de.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-de.js new file mode 100644 index 000000000000..f3ef9e82c6de --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-de.js @@ -0,0 +1,23 @@ +/* German initialisation for the jQuery UI date picker plugin. */ +/* Written by Milian Wolff (mail@milianw.de). */ +jQuery(function($){ + $.datepicker.regional['de'] = { + closeText: 'schließen', + prevText: '<zurück', + nextText: 'Vor>', + currentText: 'heute', + monthNames: ['Januar','Februar','März','April','Mai','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dez'], + dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'], + dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'], + dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'], + weekHeader: 'KW', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['de']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-el.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-el.js new file mode 100644 index 000000000000..6d775f995f94 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-el.js @@ -0,0 +1,23 @@ +/* Greek (el) initialisation for the jQuery UI date picker plugin. */ +/* Written by Alex Cicovic (http://www.alexcicovic.com) */ +jQuery(function($){ + $.datepicker.regional['el'] = { + closeText: 'Κλείσιμο', + prevText: 'Προηγούμενος', + nextText: 'Επόμενος', + currentText: 'Τρέχων Μήνας', + monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος', + 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'], + monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν', + 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'], + dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'], + dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'], + dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'], + weekHeader: 'Εβδ', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['el']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-en-GB.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-en-GB.js new file mode 100644 index 000000000000..16a096e758aa --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-en-GB.js @@ -0,0 +1,23 @@ +/* English/UK initialisation for the jQuery UI date picker plugin. */ +/* Written by Stuart. */ +jQuery(function($){ + $.datepicker.regional['en-GB'] = { + closeText: 'Done', + prevText: 'Prev', + nextText: 'Next', + currentText: 'Today', + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', + 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['en-GB']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-eo.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-eo.js new file mode 100644 index 000000000000..6cabc2c468ed --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-eo.js @@ -0,0 +1,23 @@ +/* Esperanto initialisation for the jQuery UI date picker plugin. */ +/* Written by Olivier M. (olivierweb@ifrance.com). */ +jQuery(function($){ + $.datepicker.regional['eo'] = { + closeText: 'Fermi', + prevText: '<Anta', + nextText: 'Sekv>', + currentText: 'Nuna', + monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio', + 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aŭg','Sep','Okt','Nov','Dec'], + dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'], + dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'], + dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'], + weekHeader: 'Sb', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eo']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-es.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-es.js new file mode 100644 index 000000000000..a02133de3ff4 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-es.js @@ -0,0 +1,23 @@ +/* Inicialización en español para la extensión 'UI date picker' para jQuery. */ +/* Traducido por Vester (xvester@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['es'] = { + closeText: 'Cerrar', + prevText: '<Ant', + nextText: 'Sig>', + currentText: 'Hoy', + monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio', + 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'], + monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun', + 'Jul','Ago','Sep','Oct','Nov','Dic'], + dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['es']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-et.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-et.js new file mode 100644 index 000000000000..32702b243022 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-et.js @@ -0,0 +1,23 @@ +/* Estonian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */ +jQuery(function($){ + $.datepicker.regional['et'] = { + closeText: 'Sulge', + prevText: 'Eelnev', + nextText: 'Järgnev', + currentText: 'Täna', + monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni', + 'Juuli','August','September','Oktoober','November','Detsember'], + monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni', + 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'], + dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'], + dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'], + dayNamesMin: ['P','E','T','K','N','R','L'], + weekHeader: 'näd', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['et']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-eu.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-eu.js new file mode 100644 index 000000000000..ff66e494cb38 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-eu.js @@ -0,0 +1,23 @@ +/* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */ +/* Karrikas-ek itzulia (karrikas@karrikas.com) */ +jQuery(function($){ + $.datepicker.regional['eu'] = { + closeText: 'Egina', + prevText: '<Aur', + nextText: 'Hur>', + currentText: 'Gaur', + monthNames: ['urtarrila','otsaila','martxoa','apirila','maiatza','ekaina', + 'uztaila','abuztua','iraila','urria','azaroa','abendua'], + monthNamesShort: ['urt.','ots.','mar.','api.','mai.','eka.', + 'uzt.','abu.','ira.','urr.','aza.','abe.'], + dayNames: ['igandea','astelehena','asteartea','asteazkena','osteguna','ostirala','larunbata'], + dayNamesShort: ['ig.','al.','ar.','az.','og.','ol.','lr.'], + dayNamesMin: ['ig','al','ar','az','og','ol','lr'], + weekHeader: 'As', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['eu']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fa.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fa.js new file mode 100644 index 000000000000..be8acd2a5aa5 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fa.js @@ -0,0 +1,59 @@ +/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */ +/* Javad Mowlanezhad -- jmowla@gmail.com */ +/* Jalali calendar should supported soon! (Its implemented but I have to test it) */ +jQuery(function($) { + $.datepicker.regional['fa'] = { + closeText: 'بستن', + prevText: '<قبلی', + nextText: 'بعدی>', + currentText: 'امروز', + monthNames: [ + 'فروردين', + 'ارديبهشت', + 'خرداد', + 'تير', + 'مرداد', + 'شهريور', + 'مهر', + 'آبان', + 'آذر', + 'دی', + 'بهمن', + 'اسفند' + ], + monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'], + dayNames: [ + 'يکشنبه', + 'دوشنبه', + 'سهشنبه', + 'چهارشنبه', + 'پنجشنبه', + 'جمعه', + 'شنبه' + ], + dayNamesShort: [ + 'ی', + 'د', + 'س', + 'چ', + 'پ', + 'ج', + 'ش' + ], + dayNamesMin: [ + 'ی', + 'د', + 'س', + 'چ', + 'پ', + 'ج', + 'ش' + ], + weekHeader: 'هف', + dateFormat: 'yy/mm/dd', + firstDay: 6, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fa']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fi.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fi.js new file mode 100644 index 000000000000..4c5adda35ea5 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fi.js @@ -0,0 +1,23 @@ +/* Finnish initialisation for the jQuery UI date picker plugin. */ +/* Written by Harri Kilpiö (harrikilpio@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['fi'] = { + closeText: 'Sulje', + prevText: '«Edellinen', + nextText: 'Seuraava»', + currentText: 'Tänään', + monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu', + 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'], + monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä', + 'Heinä','Elo','Syys','Loka','Marras','Joulu'], + dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','La'], + dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'], + dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'], + weekHeader: 'Vk', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fi']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fo.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fo.js new file mode 100644 index 000000000000..8a6cb99cbc7f --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fo.js @@ -0,0 +1,23 @@ +/* Faroese initialisation for the jQuery UI date picker plugin */ +/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */ +jQuery(function($){ + $.datepicker.regional['fo'] = { + closeText: 'Lat aftur', + prevText: '<Fyrra', + nextText: 'Næsta>', + currentText: 'Í dag', + monthNames: ['Januar','Februar','Mars','Apríl','Mei','Juni', + 'Juli','August','September','Oktober','November','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Aug','Sep','Okt','Nov','Des'], + dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','Fríggjadagur','Leyardagur'], + dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','Frí','Ley'], + dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'], + weekHeader: 'Vk', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fo']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fr.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fr.js new file mode 100644 index 000000000000..7e793639f5f0 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-fr.js @@ -0,0 +1,25 @@ +/* French initialisation for the jQuery UI date picker plugin. */ +/* Written by Keith Wood (kbwood{at}iinet.com.au), + Stéphane Nahmani (sholby@sholby.net), + Stéphane Raimbault <stephane.raimbault@gmail.com> */ +jQuery(function($){ + $.datepicker.regional['fr'] = { + closeText: 'Fermer', + prevText: 'Précédent', + nextText: 'Suivant', + currentText: 'Aujourd\'hui', + monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin', + 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'], + monthNamesShort: ['Janv.','Févr.','Mars','Avril','Mai','Juin', + 'Juil.','Août','Sept.','Oct.','Nov.','Déc.'], + dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'], + dayNamesShort: ['Dim.','Lun.','Mar.','Mer.','Jeu.','Ven.','Sam.'], + dayNamesMin: ['D','L','M','M','J','V','S'], + weekHeader: 'Sem.', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['fr']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-gl.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-gl.js new file mode 100644 index 000000000000..278403e8f17e --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-gl.js @@ -0,0 +1,23 @@ +/* Galician localization for 'UI date picker' jQuery extension. */ +/* Translated by Jorge Barreiro <yortx.barry@gmail.com>. */ +jQuery(function($){ + $.datepicker.regional['gl'] = { + closeText: 'Pechar', + prevText: '<Ant', + nextText: 'Seg>', + currentText: 'Hoxe', + monthNames: ['Xaneiro','Febreiro','Marzo','Abril','Maio','Xuño', + 'Xullo','Agosto','Setembro','Outubro','Novembro','Decembro'], + monthNamesShort: ['Xan','Feb','Mar','Abr','Mai','Xuñ', + 'Xul','Ago','Set','Out','Nov','Dec'], + dayNames: ['Domingo','Luns','Martes','Mércores','Xoves','Venres','Sábado'], + dayNamesShort: ['Dom','Lun','Mar','Mér','Xov','Ven','Sáb'], + dayNamesMin: ['Do','Lu','Ma','Mé','Xo','Ve','Sá'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['gl']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-he.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-he.js new file mode 100644 index 000000000000..135cdec1d015 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-he.js @@ -0,0 +1,23 @@ +/* Hebrew initialisation for the UI Datepicker extension. */ +/* Written by Amir Hardon (ahardon at gmail dot com). */ +jQuery(function($){ + $.datepicker.regional['he'] = { + closeText: 'סגור', + prevText: '<הקודם', + nextText: 'הבא>', + currentText: 'היום', + monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני', + 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'], + monthNamesShort: ['ינו','פבר','מרץ','אפר','מאי','יוני', + 'יולי','אוג','ספט','אוק','נוב','דצמ'], + dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'], + dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: true, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['he']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hi.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hi.js new file mode 100644 index 000000000000..6c563b997516 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hi.js @@ -0,0 +1,23 @@ +/* Hindi initialisation for the jQuery UI date picker plugin. */ +/* Written by Michael Dawart. */ +jQuery(function($){ + $.datepicker.regional['hi'] = { + closeText: 'बंद', + prevText: 'पिछला', + nextText: 'अगला', + currentText: 'आज', + monthNames: ['जनवरी ','फरवरी','मार्च','अप्रेल','मई','जून', + 'जूलाई','अगस्त ','सितम्बर','अक्टूबर','नवम्बर','दिसम्बर'], + monthNamesShort: ['जन', 'फर', 'मार्च', 'अप्रेल', 'मई', 'जून', + 'जूलाई', 'अग', 'सित', 'अक्ट', 'नव', 'दि'], + dayNames: ['रविवार', 'सोमवार', 'मंगलवार', 'बुधवार', 'गुरुवार', 'शुक्रवार', 'शनिवार'], + dayNamesShort: ['रवि', 'सोम', 'मंगल', 'बुध', 'गुरु', 'शुक्र', 'शनि'], + dayNamesMin: ['रवि', 'सोम', 'मंगल', 'बुध', 'गुरु', 'शुक्र', 'शनि'], + weekHeader: 'हफ्ता', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hi']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hr.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hr.js new file mode 100644 index 000000000000..1eb3dd926f96 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hr.js @@ -0,0 +1,23 @@ +/* Croatian i18n for the jQuery UI date picker plugin. */ +/* Written by Vjekoslav Nesek. */ +jQuery(function($){ + $.datepicker.regional['hr'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipanj', + 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'], + monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip', + 'Srp','Kol','Ruj','Lis','Stu','Pro'], + dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Tje', + dateFormat: 'dd.mm.yy.', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hr']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hu.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hu.js new file mode 100644 index 000000000000..b28c268c1c44 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hu.js @@ -0,0 +1,23 @@ +/* Hungarian initialisation for the jQuery UI date picker plugin. */ +/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */ +jQuery(function($){ + $.datepicker.regional['hu'] = { + closeText: 'bezár', + prevText: 'vissza', + nextText: 'előre', + currentText: 'ma', + monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június', + 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'], + monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún', + 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'], + dayNames: ['Vasárnap', 'Hétfő', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'], + dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'], + dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'], + weekHeader: 'Hét', + dateFormat: 'yy.mm.dd.', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hu']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hy.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hy.js new file mode 100644 index 000000000000..c6cc1946c47e --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-hy.js @@ -0,0 +1,23 @@ +/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/ +jQuery(function($){ + $.datepicker.regional['hy'] = { + closeText: 'Փակել', + prevText: '<Նախ.', + nextText: 'Հաջ.>', + currentText: 'Այսօր', + monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս', + 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'], + monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս', + 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'], + dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'], + dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'], + weekHeader: 'ՇԲՏ', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['hy']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-id.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-id.js new file mode 100644 index 000000000000..c626fbb7b83c --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-id.js @@ -0,0 +1,23 @@ +/* Indonesian initialisation for the jQuery UI date picker plugin. */ +/* Written by Deden Fathurahman (dedenf@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['id'] = { + closeText: 'Tutup', + prevText: '<mundur', + nextText: 'maju>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Maret','April','Mei','Juni', + 'Juli','Agustus','September','Oktober','Nopember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun', + 'Jul','Agus','Sep','Okt','Nop','Des'], + dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'], + dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'], + dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['id']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-is.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-is.js new file mode 100644 index 000000000000..c53235a49e16 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-is.js @@ -0,0 +1,23 @@ +/* Icelandic initialisation for the jQuery UI date picker plugin. */ +/* Written by Haukur H. Thorsson (haukur@eskill.is). */ +jQuery(function($){ + $.datepicker.regional['is'] = { + closeText: 'Loka', + prevText: '< Fyrri', + nextText: 'Næsti >', + currentText: 'Í dag', + monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní', + 'Júlí','Ágúst','September','Október','Nóvember','Desember'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún', + 'Júl','Ágú','Sep','Okt','Nóv','Des'], + dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'], + dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'], + dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'], + weekHeader: 'Vika', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['is']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-it.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-it.js new file mode 100644 index 000000000000..59da2df671e8 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-it.js @@ -0,0 +1,23 @@ +/* Italian initialisation for the jQuery UI date picker plugin. */ +/* Written by Antonello Pasella (antonello.pasella@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['it'] = { + closeText: 'Chiudi', + prevText: '<Prec', + nextText: 'Succ>', + currentText: 'Oggi', + monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno', + 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'], + monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu', + 'Lug','Ago','Set','Ott','Nov','Dic'], + dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'], + dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'], + dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['it']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ja.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ja.js new file mode 100644 index 000000000000..7eb4268d41e1 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ja.js @@ -0,0 +1,23 @@ +/* Japanese initialisation for the jQuery UI date picker plugin. */ +/* Written by Kentaro SATO (kentaro@ranvis.com). */ +jQuery(function($){ + $.datepicker.regional['ja'] = { + closeText: '閉じる', + prevText: '<前', + nextText: '次>', + currentText: '今日', + monthNames: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + monthNamesShort: ['1月','2月','3月','4月','5月','6月', + '7月','8月','9月','10月','11月','12月'], + dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'], + dayNamesShort: ['日','月','火','水','木','金','土'], + dayNamesMin: ['日','月','火','水','木','金','土'], + weekHeader: '週', + dateFormat: 'yy/mm/dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['ja']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ka.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ka.js new file mode 100644 index 000000000000..c10658d79bf3 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ka.js @@ -0,0 +1,21 @@ +/* Georgian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Lado Lomidze (lado.lomidze@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ka'] = { + closeText: 'დახურვა', + prevText: '< წინა', + nextText: 'შემდეგი >', + currentText: 'დღეს', + monthNames: ['იანვარი','თებერვალი','მარტი','აპრილი','მაისი','ივნისი', 'ივლისი','აგვისტო','სექტემბერი','ოქტომბერი','ნოემბერი','დეკემბერი'], + monthNamesShort: ['იან','თებ','მარ','აპრ','მაი','ივნ', 'ივლ','აგვ','სექ','ოქტ','ნოე','დეკ'], + dayNames: ['კვირა','ორშაბათი','სამშაბათი','ოთხშაბათი','ხუთშაბათი','პარასკევი','შაბათი'], + dayNamesShort: ['კვ','ორშ','სამ','ოთხ','ხუთ','პარ','შაბ'], + dayNamesMin: ['კვ','ორშ','სამ','ოთხ','ხუთ','პარ','შაბ'], + weekHeader: 'კვირა', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ka']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-kk.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-kk.js new file mode 100644 index 000000000000..79e3f248158a --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-kk.js @@ -0,0 +1,23 @@ +/* Kazakh (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Dmitriy Karasyov (dmitriy.karasyov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['kk'] = { + closeText: 'Жабу', + prevText: '<Алдыңғы', + nextText: 'Келесі>', + currentText: 'Бүгін', + monthNames: ['Қаңтар','Ақпан','Наурыз','Сәуір','Мамыр','Маусым', + 'Шілде','Тамыз','Қыркүйек','Қазан','Қараша','Желтоқсан'], + monthNamesShort: ['Қаң','Ақп','Нау','Сәу','Мам','Мау', + 'Шіл','Там','Қыр','Қаз','Қар','Жел'], + dayNames: ['Жексенбі','Дүйсенбі','Сейсенбі','Сәрсенбі','Бейсенбі','Жұма','Сенбі'], + dayNamesShort: ['жкс','дсн','ссн','срс','бсн','жма','снб'], + dayNamesMin: ['Жк','Дс','Сс','Ср','Бс','Жм','Сн'], + weekHeader: 'Не', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['kk']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-km.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-km.js new file mode 100644 index 000000000000..f9c4e3a02d92 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-km.js @@ -0,0 +1,23 @@ +/* Khmer initialisation for the jQuery calendar extension. */ +/* Written by Chandara Om (chandara.teacher@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['km'] = { + closeText: 'ធ្វើរួច', + prevText: 'មុន', + nextText: 'បន្ទាប់', + currentText: 'ថ្ងៃនេះ', + monthNames: ['មករា','កុម្ភៈ','មីនា','មេសា','ឧសភា','មិថុនា', + 'កក្កដា','សីហា','កញ្ញា','តុលា','វិច្ឆិកា','ធ្នូ'], + monthNamesShort: ['មករា','កុម្ភៈ','មីនា','មេសា','ឧសភា','មិថុនា', + 'កក្កដា','សីហា','កញ្ញា','តុលា','វិច្ឆិកា','ធ្នូ'], + dayNames: ['អាទិត្យ', 'ចន្ទ', 'អង្គារ', 'ពុធ', 'ព្រហស្បតិ៍', 'សុក្រ', 'សៅរ៍'], + dayNamesShort: ['អា', 'ច', 'អ', 'ពុ', 'ព្រហ', 'សុ', 'សៅ'], + dayNamesMin: ['អា', 'ច', 'អ', 'ពុ', 'ព្រហ', 'សុ', 'សៅ'], + weekHeader: 'សប្ដាហ៍', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['km']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ko.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ko.js new file mode 100644 index 000000000000..04112424dac8 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ko.js @@ -0,0 +1,23 @@ +/* Korean initialisation for the jQuery calendar extension. */ +/* Written by DaeKwon Kang (ncrash.dk@gmail.com), Edited by Genie. */ +jQuery(function($){ + $.datepicker.regional['ko'] = { + closeText: '닫기', + prevText: '이전달', + nextText: '다음달', + currentText: '오늘', + monthNames: ['1월','2월','3월','4월','5월','6월', + '7월','8월','9월','10월','11월','12월'], + monthNamesShort: ['1월','2월','3월','4월','5월','6월', + '7월','8월','9월','10월','11월','12월'], + dayNames: ['일요일','월요일','화요일','수요일','목요일','금요일','토요일'], + dayNamesShort: ['일','월','화','수','목','금','토'], + dayNamesMin: ['일','월','화','수','목','금','토'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '년'}; + $.datepicker.setDefaults($.datepicker.regional['ko']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lb.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lb.js new file mode 100644 index 000000000000..87c79d594eb3 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lb.js @@ -0,0 +1,23 @@ +/* Luxembourgish initialisation for the jQuery UI date picker plugin. */ +/* Written by Michel Weimerskirch <michel@weimerskirch.net> */ +jQuery(function($){ + $.datepicker.regional['lb'] = { + closeText: 'Fäerdeg', + prevText: 'Zréck', + nextText: 'Weider', + currentText: 'Haut', + monthNames: ['Januar','Februar','Mäerz','Abrëll','Mee','Juni', + 'Juli','August','September','Oktober','November','Dezember'], + monthNamesShort: ['Jan', 'Feb', 'Mäe', 'Abr', 'Mee', 'Jun', + 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Dez'], + dayNames: ['Sonndeg', 'Méindeg', 'Dënschdeg', 'Mëttwoch', 'Donneschdeg', 'Freideg', 'Samschdeg'], + dayNamesShort: ['Son', 'Méi', 'Dën', 'Mët', 'Don', 'Fre', 'Sam'], + dayNamesMin: ['So','Mé','Dë','Më','Do','Fr','Sa'], + weekHeader: 'W', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lb']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lt.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lt.js new file mode 100644 index 000000000000..67d5119ca70f --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lt.js @@ -0,0 +1,23 @@ +/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas <arturas@avalon.lt> */ +jQuery(function($){ + $.datepicker.regional['lt'] = { + closeText: 'Uždaryti', + prevText: '<Atgal', + nextText: 'Pirmyn>', + currentText: 'Šiandien', + monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis', + 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'], + monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir', + 'Lie','Rugp','Rugs','Spa','Lap','Gru'], + dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'], + dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'], + dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'], + weekHeader: 'Wk', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lt']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lv.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lv.js new file mode 100644 index 000000000000..003934e7212b --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-lv.js @@ -0,0 +1,23 @@ +/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */ +jQuery(function($){ + $.datepicker.regional['lv'] = { + closeText: 'Aizvērt', + prevText: 'Iepr', + nextText: 'Nāka', + currentText: 'Šodien', + monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs', + 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn', + 'Jūl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'], + dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'], + dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'], + weekHeader: 'Nav', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['lv']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-mk.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-mk.js new file mode 100644 index 000000000000..0285325519f8 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-mk.js @@ -0,0 +1,23 @@ +/* Macedonian i18n for the jQuery UI date picker plugin. */ +/* Written by Stojce Slavkovski. */ +jQuery(function($){ + $.datepicker.regional['mk'] = { + closeText: 'Затвори', + prevText: '<', + nextText: '>', + currentText: 'Денес', + monthNames: ['Јануари','Февруари','Март','Април','Мај','Јуни', + 'Јули','Август','Септември','Октомври','Ноември','Декември'], + monthNamesShort: ['Јан','Фев','Мар','Апр','Мај','Јун', + 'Јул','Авг','Сеп','Окт','Ное','Дек'], + dayNames: ['Недела','Понеделник','Вторник','Среда','Четврток','Петок','Сабота'], + dayNamesShort: ['Нед','Пон','Вто','Сре','Чет','Пет','Саб'], + dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Са'], + weekHeader: 'Сед', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['mk']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ml.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ml.js new file mode 100644 index 000000000000..1e3432c0a8f2 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ml.js @@ -0,0 +1,23 @@ +/* Malayalam (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Saji Nediyanchath (saji89@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ml'] = { + closeText: 'ശരി', + prevText: 'മുന്നത്തെ', + nextText: 'അടുത്തത് ', + currentText: 'ഇന്ന്', + monthNames: ['ജനുവരി','ഫെബ്രുവരി','മാര്ച്ച്','ഏപ്രില്','മേയ്','ജൂണ്', + 'ജൂലൈ','ആഗസ്റ്റ്','സെപ്റ്റംബര്','ഒക്ടോബര്','നവംബര്','ഡിസംബര്'], + monthNamesShort: ['ജനു', 'ഫെബ്', 'മാര്', 'ഏപ്രി', 'മേയ്', 'ജൂണ്', + 'ജൂലാ', 'ആഗ', 'സെപ്', 'ഒക്ടോ', 'നവം', 'ഡിസ'], + dayNames: ['ഞായര്', 'തിങ്കള്', 'ചൊവ്വ', 'ബുധന്', 'വ്യാഴം', 'വെള്ളി', 'ശനി'], + dayNamesShort: ['ഞായ', 'തിങ്ക', 'ചൊവ്വ', 'ബുധ', 'വ്യാഴം', 'വെള്ളി', 'ശനി'], + dayNamesMin: ['ഞാ','തി','ചൊ','ബു','വ്യാ','വെ','ശ'], + weekHeader: 'ആ', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ml']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ms.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ms.js new file mode 100644 index 000000000000..e953ac04f198 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ms.js @@ -0,0 +1,23 @@ +/* Malaysian initialisation for the jQuery UI date picker plugin. */ +/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */ +jQuery(function($){ + $.datepicker.regional['ms'] = { + closeText: 'Tutup', + prevText: '<Sebelum', + nextText: 'Selepas>', + currentText: 'hari ini', + monthNames: ['Januari','Februari','Mac','April','Mei','Jun', + 'Julai','Ogos','September','Oktober','November','Disember'], + monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun', + 'Jul','Ogo','Sep','Okt','Nov','Dis'], + dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'], + dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'], + dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'], + weekHeader: 'Mg', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ms']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-nl.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-nl.js new file mode 100644 index 000000000000..781fe6191761 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-nl.js @@ -0,0 +1,23 @@ +/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Mathias Bynens <http://mathiasbynens.be/> */ +jQuery(function($){ + $.datepicker.regional.nl = { + closeText: 'Sluiten', + prevText: '←', + nextText: '→', + currentText: 'Vandaag', + monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni', + 'juli', 'augustus', 'september', 'oktober', 'november', 'december'], + monthNamesShort: ['jan', 'feb', 'mrt', 'apr', 'mei', 'jun', + 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'], + dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'], + dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'], + dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'], + weekHeader: 'Wk', + dateFormat: 'dd-mm-yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional.nl); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-no.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-no.js new file mode 100644 index 000000000000..2507043a3f26 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-no.js @@ -0,0 +1,23 @@ +/* Norwegian initialisation for the jQuery UI date picker plugin. */ +/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */ + +jQuery(function($){ + $.datepicker.regional['no'] = { + closeText: 'Lukk', + prevText: '«Forrige', + nextText: 'Neste»', + currentText: 'I dag', + monthNames: ['januar','februar','mars','april','mai','juni','juli','august','september','oktober','november','desember'], + monthNamesShort: ['jan','feb','mar','apr','mai','jun','jul','aug','sep','okt','nov','des'], + dayNamesShort: ['søn','man','tir','ons','tor','fre','lør'], + dayNames: ['søndag','mandag','tirsdag','onsdag','torsdag','fredag','lørdag'], + dayNamesMin: ['sø','ma','ti','on','to','fr','lø'], + weekHeader: 'Uke', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: '' + }; + $.datepicker.setDefaults($.datepicker.regional['no']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pl.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pl.js new file mode 100644 index 000000000000..61fa29ccd83a --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pl.js @@ -0,0 +1,23 @@ +/* Polish initialisation for the jQuery UI date picker plugin. */ +/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pl'] = { + closeText: 'Zamknij', + prevText: '<Poprzedni', + nextText: 'Następny>', + currentText: 'Dziś', + monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec', + 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'], + monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze', + 'Lip','Sie','Wrz','Pa','Lis','Gru'], + dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'], + dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'], + dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'], + weekHeader: 'Tydz', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pl']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pt-BR.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pt-BR.js new file mode 100644 index 000000000000..3cc8c796c87a --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pt-BR.js @@ -0,0 +1,23 @@ +/* Brazilian initialisation for the jQuery UI date picker plugin. */ +/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['pt-BR'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Próximo>', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + weekHeader: 'Sm', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pt-BR']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pt.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pt.js new file mode 100644 index 000000000000..f09f5aeb00df --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-pt.js @@ -0,0 +1,22 @@ +/* Portuguese initialisation for the jQuery UI date picker plugin. */ +jQuery(function($){ + $.datepicker.regional['pt'] = { + closeText: 'Fechar', + prevText: '<Anterior', + nextText: 'Seguinte', + currentText: 'Hoje', + monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho', + 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'], + monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun', + 'Jul','Ago','Set','Out','Nov','Dez'], + dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sábado'], + dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sáb'], + weekHeader: 'Sem', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['pt']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-rm.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-rm.js new file mode 100644 index 000000000000..cf03cd4c1afa --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-rm.js @@ -0,0 +1,21 @@ +/* Romansh initialisation for the jQuery UI date picker plugin. */ +/* Written by Yvonne Gienal (yvonne.gienal@educa.ch). */ +jQuery(function($){ + $.datepicker.regional['rm'] = { + closeText: 'Serrar', + prevText: '<Suandant', + nextText: 'Precedent>', + currentText: 'Actual', + monthNames: ['Schaner','Favrer','Mars','Avrigl','Matg','Zercladur', 'Fanadur','Avust','Settember','October','November','December'], + monthNamesShort: ['Scha','Fev','Mar','Avr','Matg','Zer', 'Fan','Avu','Sett','Oct','Nov','Dec'], + dayNames: ['Dumengia','Glindesdi','Mardi','Mesemna','Gievgia','Venderdi','Sonda'], + dayNamesShort: ['Dum','Gli','Mar','Mes','Gie','Ven','Som'], + dayNamesMin: ['Du','Gl','Ma','Me','Gi','Ve','So'], + weekHeader: 'emna', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['rm']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ro.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ro.js new file mode 100644 index 000000000000..6b140aff615f --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ro.js @@ -0,0 +1,26 @@ +/* Romanian initialisation for the jQuery UI date picker plugin. + * + * Written by Edmond L. (ll_edmond@walla.com) + * and Ionut G. Stan (ionut.g.stan@gmail.com) + */ +jQuery(function($){ + $.datepicker.regional['ro'] = { + closeText: 'Închide', + prevText: '« Luna precedentă', + nextText: 'Luna următoare »', + currentText: 'Azi', + monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie', + 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'], + monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun', + 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'], + dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'], + dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'], + weekHeader: 'Săpt', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ro']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ru.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ru.js new file mode 100644 index 000000000000..50a4613523c3 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ru.js @@ -0,0 +1,23 @@ +/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Andrew Stromnov (stromnov@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['ru'] = { + closeText: 'Закрыть', + prevText: '<Пред', + nextText: 'След>', + currentText: 'Сегодня', + monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь', + 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'], + monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн', + 'Июл','Авг','Сен','Окт','Ноя','Дек'], + dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'], + dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'], + dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Нед', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ru']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sk.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sk.js new file mode 100644 index 000000000000..078d1b0fa8a6 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sk.js @@ -0,0 +1,23 @@ +/* Slovak initialisation for the jQuery UI date picker plugin. */ +/* Written by Vojtech Rinik (vojto@hmm.sk). */ +jQuery(function($){ + $.datepicker.regional['sk'] = { + closeText: 'Zavrieť', + prevText: '<Predchádzajúci', + nextText: 'Nasledujúci>', + currentText: 'Dnes', + monthNames: ['Január','Február','Marec','Apríl','Máj','Jún', + 'Júl','August','September','Október','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún', + 'Júl','Aug','Sep','Okt','Nov','Dec'], + dayNames: ['Nedeľa','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'], + dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'], + dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'], + weekHeader: 'Ty', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sk']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sl.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sl.js new file mode 100644 index 000000000000..516550192a71 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sl.js @@ -0,0 +1,24 @@ +/* Slovenian initialisation for the jQuery UI date picker plugin. */ +/* Written by Jaka Jancar (jaka@kubje.org). */ +/* c = č, s = š z = ž C = Č S = Š Z = Ž */ +jQuery(function($){ + $.datepicker.regional['sl'] = { + closeText: 'Zapri', + prevText: '<Prejšnji', + nextText: 'Naslednji>', + currentText: 'Trenutni', + monthNames: ['Januar','Februar','Marec','April','Maj','Junij', + 'Julij','Avgust','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'], + dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'], + dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'], + weekHeader: 'Teden', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sl']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sq.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sq.js new file mode 100644 index 000000000000..21974c56cd70 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sq.js @@ -0,0 +1,23 @@ +/* Albanian initialisation for the jQuery UI date picker plugin. */ +/* Written by Flakron Bytyqi (flakron@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['sq'] = { + closeText: 'mbylle', + prevText: '<mbrapa', + nextText: 'Përpara>', + currentText: 'sot', + monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor', + 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'], + monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer', + 'Kor','Gus','Sht','Tet','Nën','Dhj'], + dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'], + dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'], + dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'], + weekHeader: 'Ja', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sq']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sr-SR.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sr-SR.js new file mode 100644 index 000000000000..e7a8683e48de --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sr-SR.js @@ -0,0 +1,23 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr-SR'] = { + closeText: 'Zatvori', + prevText: '<', + nextText: '>', + currentText: 'Danas', + monthNames: ['Januar','Februar','Mart','April','Maj','Jun', + 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Avg','Sep','Okt','Nov','Dec'], + dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'], + dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'], + dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'], + weekHeader: 'Sed', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr-SR']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sr.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sr.js new file mode 100644 index 000000000000..0bd240e69df8 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sr.js @@ -0,0 +1,23 @@ +/* Serbian i18n for the jQuery UI date picker plugin. */ +/* Written by Dejan Dimić. */ +jQuery(function($){ + $.datepicker.regional['sr'] = { + closeText: 'Затвори', + prevText: '<', + nextText: '>', + currentText: 'Данас', + monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун', + 'Јул','Август','Септембар','Октобар','Новембар','Децембар'], + monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун', + 'Јул','Авг','Сеп','Окт','Нов','Дец'], + dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'], + dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'], + dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'], + weekHeader: 'Сед', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sr']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sv.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sv.js new file mode 100644 index 000000000000..e5f549fbf228 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-sv.js @@ -0,0 +1,23 @@ +/* Swedish initialisation for the jQuery UI date picker plugin. */ +/* Written by Anders Ekdahl ( anders@nomadiz.se). */ +jQuery(function($){ + $.datepicker.regional['sv'] = { + closeText: 'Stäng', + prevText: '«Förra', + nextText: 'Nästa»', + currentText: 'Idag', + monthNames: ['Januari','Februari','Mars','April','Maj','Juni', + 'Juli','Augusti','September','Oktober','November','December'], + monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun', + 'Jul','Aug','Sep','Okt','Nov','Dec'], + dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'], + dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'], + dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'], + weekHeader: 'Ve', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['sv']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ta.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ta.js new file mode 100644 index 000000000000..40431ed8ec7f --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-ta.js @@ -0,0 +1,23 @@ +/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by S A Sureshkumar (saskumar@live.com). */ +jQuery(function($){ + $.datepicker.regional['ta'] = { + closeText: 'மூடு', + prevText: 'முன்னையது', + nextText: 'அடுத்தது', + currentText: 'இன்று', + monthNames: ['தை','மாசி','பங்குனி','சித்திரை','வைகாசி','ஆனி', + 'ஆடி','ஆவணி','புரட்டாசி','ஐப்பசி','கார்த்திகை','மார்கழி'], + monthNamesShort: ['தை','மாசி','பங்','சித்','வைகா','ஆனி', + 'ஆடி','ஆவ','புர','ஐப்','கார்','மார்'], + dayNames: ['ஞாயிற்றுக்கிழமை','திங்கட்கிழமை','செவ்வாய்க்கிழமை','புதன்கிழமை','வியாழக்கிழமை','வெள்ளிக்கிழமை','சனிக்கிழமை'], + dayNamesShort: ['ஞாயிறு','திங்கள்','செவ்வாய்','புதன்','வியாழன்','வெள்ளி','சனி'], + dayNamesMin: ['ஞா','தி','செ','பு','வி','வெ','ச'], + weekHeader: 'Не', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['ta']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-th.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-th.js new file mode 100644 index 000000000000..2e5300cfd4a6 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-th.js @@ -0,0 +1,23 @@ +/* Thai initialisation for the jQuery UI date picker plugin. */ +/* Written by pipo (pipo@sixhead.com). */ +jQuery(function($){ + $.datepicker.regional['th'] = { + closeText: 'ปิด', + prevText: '« ย้อน', + nextText: 'ถัดไป »', + currentText: 'วันนี้', + monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน', + 'กรกฎาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'], + monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.', + 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'], + dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'], + dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'], + weekHeader: 'Wk', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['th']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-tr.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-tr.js new file mode 100644 index 000000000000..dedfc7ff99b2 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-tr.js @@ -0,0 +1,23 @@ +/* Turkish initialisation for the jQuery UI date picker plugin. */ +/* Written by Izzet Emre Erkan (kara@karalamalar.net). */ +jQuery(function($){ + $.datepicker.regional['tr'] = { + closeText: 'kapat', + prevText: '<geri', + nextText: 'ileri>', + currentText: 'bugün', + monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran', + 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'], + monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz', + 'Tem','Ağu','Eyl','Eki','Kas','Ara'], + dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'], + dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'], + weekHeader: 'Hf', + dateFormat: 'dd.mm.yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['tr']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-uk.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-uk.js new file mode 100644 index 000000000000..2718f5d1ccc9 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-uk.js @@ -0,0 +1,24 @@ +/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */ +/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */ +/* Corrected by Igor Milla (igor.fsp.milla@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['uk'] = { + closeText: 'Закрити', + prevText: '<', + nextText: '>', + currentText: 'Сьогодні', + monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень', + 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'], + monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер', + 'Лип','Сер','Вер','Жов','Лис','Гру'], + dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'], + dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'], + dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'], + weekHeader: 'Тиж', + dateFormat: 'dd/mm/yy', + firstDay: 1, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['uk']); +});
\ No newline at end of file diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-vi.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-vi.js new file mode 100644 index 000000000000..1d8f7bbd9cbd --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-vi.js @@ -0,0 +1,23 @@ +/* Vietnamese initialisation for the jQuery UI date picker plugin. */ +/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */ +jQuery(function($){ + $.datepicker.regional['vi'] = { + closeText: 'Đóng', + prevText: '<Trước', + nextText: 'Tiếp>', + currentText: 'Hôm nay', + monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu', + 'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mười', 'Tháng Mười Một', 'Tháng Mười Hai'], + monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6', + 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'], + dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'], + dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'], + weekHeader: 'Tu', + dateFormat: 'dd/mm/yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: false, + yearSuffix: ''}; + $.datepicker.setDefaults($.datepicker.regional['vi']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-CN.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-CN.js new file mode 100644 index 000000000000..83f2825cefb3 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-CN.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Cloudream (cloudream@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-CN'] = { + closeText: '关闭', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy-mm-dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-CN']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-HK.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-HK.js new file mode 100644 index 000000000000..11189d3aa5bd --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-HK.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by SCCY (samuelcychan@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-HK'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'dd-mm-yy', + firstDay: 0, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-HK']); +}); diff --git a/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-TW.js b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-TW.js new file mode 100644 index 000000000000..089498b4f937 --- /dev/null +++ b/resources/lib/jquery.ui/i18n/jquery.ui.datepicker-zh-TW.js @@ -0,0 +1,23 @@ +/* Chinese initialisation for the jQuery UI date picker plugin. */ +/* Written by Ressol (ressol@gmail.com). */ +jQuery(function($){ + $.datepicker.regional['zh-TW'] = { + closeText: '關閉', + prevText: '<上月', + nextText: '下月>', + currentText: '今天', + monthNames: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + monthNamesShort: ['一月','二月','三月','四月','五月','六月', + '七月','八月','九月','十月','十一月','十二月'], + dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'], + dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'], + dayNamesMin: ['日','一','二','三','四','五','六'], + weekHeader: '周', + dateFormat: 'yy/mm/dd', + firstDay: 1, + isRTL: false, + showMonthAfterYear: true, + yearSuffix: '年'}; + $.datepicker.setDefaults($.datepicker.regional['zh-TW']); +}); diff --git a/resources/lib/jquery.ui/jquery.ui.accordion.js b/resources/lib/jquery.ui/jquery.ui.accordion.js new file mode 100644 index 000000000000..dc1ba60aa4ef --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.accordion.js @@ -0,0 +1,611 @@ +/*! + * jQuery UI Accordion 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.24", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( s.parent().width() + - parseFloat( s.css( "paddingLeft" ) ) + - parseFloat( s.css( "paddingRight" ) ) + - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) + - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); diff --git a/resources/lib/jquery.ui/jquery.ui.autocomplete.js b/resources/lib/jquery.ui/jquery.ui.autocomplete.js new file mode 100644 index 000000000000..8d69be28777d --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.autocomplete.js @@ -0,0 +1,631 @@ +/*! + * jQuery UI Autocomplete 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + this.isMultiLine = this.element.is( "textarea" ); + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + self._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + self.beforeunloadHandler = function() { + self.element.removeAttr( "autocomplete" ); + }; + $( window ).bind( "beforeunload", self.beforeunloadHandler ); + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $( window ).unbind( "beforeunload", this.beforeunloadHandler ); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data, status ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); diff --git a/resources/lib/jquery.ui/jquery.ui.button.js b/resources/lib/jquery.ui/jquery.ui.button.js new file mode 100644 index 000000000000..8326262c23af --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.button.js @@ -0,0 +1,414 @@ +/*! + * jQuery UI Button 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.propAttr( "disabled" ); + } else { + this.element.propAttr( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>", this.element[0].ownerDocument ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); diff --git a/resources/lib/jquery.ui/jquery.ui.core.js b/resources/lib/jquery.ui/jquery.ui.core.js new file mode 100644 index 000000000000..b36c1ac4bf3c --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.core.js @@ -0,0 +1,334 @@ +/*! + * jQuery UI 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.24", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +// support: jQuery <1.8 +if ( !$( "<a>" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + // access offsetHeight before setting the style to prevent a layout bug + // in IE 9 which causes the elemnt to continue to take up space even + // after it is removed from the DOM (#8026) + div.offsetHeight; + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); diff --git a/resources/lib/jquery.ui/jquery.ui.datepicker.js b/resources/lib/jquery.ui/jquery.ui.datepicker.js new file mode 100644 index 000000000000..1fcea12a1c80 --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.datepicker.js @@ -0,0 +1,1854 @@ +/*! + * jQuery UI Datepicker 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.24" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); + var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, 'stepMonths'); + var id = '#' + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find('[data-handler]').map(function () { + var handler = { + prev: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); + }, + next: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); + }, + hide: function () { + window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); + return false; + }, + selectMonth: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); + return false; + }, + selectYear: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); + return false; + } + }; + $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" data-handler="prev" data-event="click"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" data-handler="next" data-event="click"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" data-handler="hide" data-event="click">' + + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" data-handler="today" data-event="click"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' data-handler="selectDay" data-event="click" data-month="' + printDate.getMonth() + '" data-year="' + printDate.getFullYear() + '"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" data-handler="selectMonth" data-event="change">'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" data-handler="selectYear" data-event="change">'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.24"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); diff --git a/resources/lib/jquery.ui/jquery.ui.dialog.js b/resources/lib/jquery.ui/jquery.ui.dialog.js new file mode 100644 index 000000000000..06b85f23a1ab --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.dialog.js @@ -0,0 +1,866 @@ +/*! + * jQuery UI Dialog 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in button ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.24", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); diff --git a/resources/lib/jquery.ui/jquery.ui.draggable.js b/resources/lib/jquery.ui/jquery.ui.draggable.js new file mode 100644 index 000000000000..149035c247c3 --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.draggable.js @@ -0,0 +1,832 @@ +/*! + * jQuery UI Draggable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + this.helper.addClass("ui-draggable-dragging"); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + var element = this.element[0], elementInDom = false; + while ( element && (element = element.parentNode) ) { + if (element == document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + //Remove frame helpers + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.24" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); diff --git a/resources/lib/jquery.ui/jquery.ui.droppable.js b/resources/lib/jquery.ui/jquery.ui.droppable.js new file mode 100644 index 000000000000..f17c2223aaf2 --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.droppable.js @@ -0,0 +1,301 @@ +/*! + * jQuery UI Droppable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.24" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + // find droppable parents with same scope + var scope = this.options.scope; + var parent = this.element.parents(':data(droppable)').filter(function () { + return $.data(this, 'droppable').options.scope === scope; + }); + + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); diff --git a/resources/lib/jquery.ui/jquery.ui.mouse.js b/resources/lib/jquery.ui/jquery.ui.mouse.js new file mode 100644 index 000000000000..52a1786c695f --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.mouse.js @@ -0,0 +1,167 @@ +/*! + * jQuery UI Mouse 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); diff --git a/resources/lib/jquery.ui/jquery.ui.position.js b/resources/lib/jquery.ui/jquery.ui.position.js new file mode 100644 index 000000000000..8b20179b1b30 --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.position.js @@ -0,0 +1,308 @@ +/*! + * jQuery UI Position 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); diff --git a/resources/lib/jquery.ui/jquery.ui.progressbar.js b/resources/lib/jquery.ui/jquery.ui.progressbar.js new file mode 100644 index 000000000000..7cea1baafe4b --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.progressbar.js @@ -0,0 +1,109 @@ +/*! + * jQuery UI Progressbar 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.24" +}); + +})( jQuery ); diff --git a/resources/lib/jquery.ui/jquery.ui.resizable.js b/resources/lib/jquery.ui/jquery.ui.resizable.js new file mode 100644 index 000000000000..6cc6f41fb65f --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.resizable.js @@ -0,0 +1,807 @@ +/*! + * jQuery UI Resizable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.24" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); diff --git a/resources/lib/jquery.ui/jquery.ui.selectable.js b/resources/lib/jquery.ui/jquery.ui.selectable.js new file mode 100644 index 000000000000..44c6e8c54e2d --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.selectable.js @@ -0,0 +1,267 @@ +/*! + * jQuery UI Selectable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.24" +}); + +})(jQuery); diff --git a/resources/lib/jquery.ui/jquery.ui.slider.js b/resources/lib/jquery.ui/jquery.ui.slider.js new file mode 100644 index 000000000000..c554e7836fe3 --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.slider.js @@ -0,0 +1,662 @@ +/*! + * jQuery UI Slider 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "<div></div>" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.24" +}); + +}(jQuery)); diff --git a/resources/lib/jquery.ui/jquery.ui.sortable.js b/resources/lib/jquery.ui/jquery.ui.sortable.js new file mode 100644 index 000000000000..9e0cac68e0bb --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.sortable.js @@ -0,0 +1,1094 @@ +/*! + * jQuery UI Sortable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true + + }, + + destroy: function() { + $.Widget.prototype.destroy.call( this ); + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + // Only put the placeholder inside the current Container, skip all + // items form other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this moving items in "sub-sortables" can cause the placeholder to jitter + // beetween the outer and inner container. + if (item.instance !== this.currentContainer) continue; + + if (itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.containers[innermostIndex].floating ? this.items[j].item.offset().left : this.items[j].item.offset().top; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = (cur - base > 0) ? 'down' : 'up'; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + + // Check if the items Container has Changed and trigger appropriate + // events. + if (this !== this.currentContainer) { + if(!noPropagation) { + delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + } + } + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.24" +}); + +})(jQuery); diff --git a/resources/lib/jquery.ui/jquery.ui.tabs.js b/resources/lib/jquery.ui/jquery.ui.tabs.js new file mode 100644 index 000000000000..0c47f0e1c0b7 --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.tabs.js @@ -0,0 +1,757 @@ +/*! + * jQuery UI Tabs 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.24" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/resources/lib/jquery.ui/jquery.ui.widget.js b/resources/lib/jquery.ui/jquery.ui.widget.js new file mode 100644 index 000000000000..66ef0133ef32 --- /dev/null +++ b/resources/lib/jquery.ui/jquery.ui.widget.js @@ -0,0 +1,272 @@ +/*! + * jQuery UI Widget 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png Binary files differnew file mode 100644 index 000000000000..e425e6e46ebd --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_flat_0_aaaaaa_40x100.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png Binary files differnew file mode 100644 index 000000000000..72d4757363cd --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_flat_75_ffffff_40x100.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_55_fbf9ee_1x400.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_55_fbf9ee_1x400.png Binary files differnew file mode 100644 index 000000000000..3b2914a2db9b --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_55_fbf9ee_1x400.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_65_ffffff_1x400.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_65_ffffff_1x400.png Binary files differnew file mode 100644 index 000000000000..8569c1bc9f4b --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_75_dadada_1x400.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_75_dadada_1x400.png Binary files differnew file mode 100644 index 000000000000..d6cc3c58fc03 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_75_dadada_1x400.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_75_e6e6e6_1x400.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_75_e6e6e6_1x400.png Binary files differnew file mode 100644 index 000000000000..86c2baa655ea --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_75_e6e6e6_1x400.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png Binary files differnew file mode 100644 index 000000000000..4443fdc1a156 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_glass_95_fef1ec_1x400.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/resources/lib/jquery.ui/themes/default/images/ui-bg_highlight-soft_75_cccccc_1x100.png Binary files differnew file mode 100644 index 000000000000..3cd467e18ef2 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-bg_highlight-soft_75_cccccc_1x100.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-icons_222222_256x240.png b/resources/lib/jquery.ui/themes/default/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 000000000000..9a9606f7614c --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-icons_222222_256x240.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-icons_2e83ff_256x240.png b/resources/lib/jquery.ui/themes/default/images/ui-icons_2e83ff_256x240.png Binary files differnew file mode 100644 index 000000000000..08d26179c305 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-icons_2e83ff_256x240.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-icons_454545_256x240.png b/resources/lib/jquery.ui/themes/default/images/ui-icons_454545_256x240.png Binary files differnew file mode 100644 index 000000000000..80cb644a58f9 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-icons_454545_256x240.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-icons_888888_256x240.png b/resources/lib/jquery.ui/themes/default/images/ui-icons_888888_256x240.png Binary files differnew file mode 100644 index 000000000000..8373712d13cf --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-icons_888888_256x240.png diff --git a/resources/lib/jquery.ui/themes/default/images/ui-icons_cd0a0a_256x240.png b/resources/lib/jquery.ui/themes/default/images/ui-icons_cd0a0a_256x240.png Binary files differnew file mode 100644 index 000000000000..34fc89371bbd --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/images/ui-icons_cd0a0a_256x240.png diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.accordion.css b/resources/lib/jquery.ui/themes/default/jquery.ui.accordion.css new file mode 100644 index 000000000000..cd8f971c3a46 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.accordion.css @@ -0,0 +1,19 @@ +/*! + * jQuery UI Accordion 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.autocomplete.css b/resources/lib/jquery.ui/themes/default/jquery.ui.autocomplete.css new file mode 100644 index 000000000000..c7eaff226ef3 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.autocomplete.css @@ -0,0 +1,53 @@ +/*! + * jQuery UI Autocomplete 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.24 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.button.css b/resources/lib/jquery.ui/themes/default/jquery.ui.button.css new file mode 100644 index 000000000000..cd2dbb6e8567 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.button.css @@ -0,0 +1,110 @@ +/*! + * jQuery UI Button 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ + +.ui-button { + display: inline-block; + position: relative; + padding: 0; + margin-right: .1em; + text-decoration: none !important; + cursor: pointer; + text-align: center; + zoom: 1; + overflow: visible; /* the overflow property removes extra width in IE */ +} +/* to make room for the icon, a width needs to be set here */ +.ui-button-icon-only { + width: 2.2em; +} + +/* button elements seem to need a little more width */ +button.ui-button-icon-only { + width: 2.4em; +} +.ui-button-icons-only { + width: 3.4em; +} +button.ui-button-icons-only { + width: 3.7em; +} + +/*button text element */ +.ui-button .ui-button-text { + display: block; + line-height: 1.4; +} +.ui-button-text-only .ui-button-text { + padding: .4em 1em; +} +.ui-button-icon-only .ui-button-text, +.ui-button-icons-only .ui-button-text { + padding: .4em; + text-indent: -9999999px; +} +.ui-button-text-icon-primary .ui-button-text, +.ui-button-text-icons .ui-button-text { + padding: .4em 1em .4em 2.1em; +} +.ui-button-text-icon-secondary .ui-button-text, +.ui-button-text-icons .ui-button-text { + padding: .4em 2.1em .4em 1em; +} +.ui-button-text-icons .ui-button-text { + padding-left: 2.1em; + padding-right: 2.1em; +} +/* no icon support for input elements, provide padding by default */ + input.ui-button { + padding: .4em 1em; +} + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, +.ui-button-text-icon-primary .ui-icon, +.ui-button-text-icon-secondary .ui-icon, +.ui-button-text-icons .ui-icon, +.ui-button-icons-only .ui-icon { + position: absolute; + top: 50%; + margin-top: -8px; +} +.ui-button-icon-only .ui-icon { + left: 50%; + margin-left: -8px; +} +.ui-button-text-icon-primary .ui-button-icon-primary, +.ui-button-text-icons .ui-button-icon-primary, +.ui-button-icons-only .ui-button-icon-primary { + left: .5em; +} +.ui-button-text-icon-secondary .ui-button-icon-secondary, +.ui-button-text-icons .ui-button-icon-secondary, +.ui-button-icons-only .ui-button-icon-secondary { + right: .5em; +} +.ui-button-text-icons .ui-button-icon-secondary, +.ui-button-icons-only .ui-button-icon-secondary { + right: .5em; +} + +/*button sets*/ +.ui-buttonset { + margin-right: 7px; +} +.ui-buttonset .ui-button { + margin-left: 0; + margin-right: -.3em; +} + +/* workarounds */ +button.ui-button::-moz-focus-inner { + border: 0; + padding: 0; /* reset extra padding in Firefox */ +} diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.core.css b/resources/lib/jquery.ui/themes/default/jquery.ui.core.css new file mode 100644 index 000000000000..8b953a2b37b7 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.core.css @@ -0,0 +1,38 @@ +/*! + * jQuery UI CSS Framework 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.datepicker.css b/resources/lib/jquery.ui/themes/default/jquery.ui.datepicker.css new file mode 100644 index 000000000000..37d3a98e3baa --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.datepicker.css @@ -0,0 +1,66 @@ +/*! + * jQuery UI Datepicker 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}
\ No newline at end of file diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.dialog.css b/resources/lib/jquery.ui/themes/default/jquery.ui.dialog.css new file mode 100644 index 000000000000..04515f48cbb6 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.dialog.css @@ -0,0 +1,21 @@ +/*! + * jQuery UI Dialog 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.progressbar.css b/resources/lib/jquery.ui/themes/default/jquery.ui.progressbar.css new file mode 100644 index 000000000000..90bf30812929 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.progressbar.css @@ -0,0 +1,11 @@ +/*! + * jQuery UI Progressbar 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.resizable.css b/resources/lib/jquery.ui/themes/default/jquery.ui.resizable.css new file mode 100644 index 000000000000..d17873e72e23 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.resizable.css @@ -0,0 +1,20 @@ +/*! + * jQuery UI Resizable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.selectable.css b/resources/lib/jquery.ui/themes/default/jquery.ui.selectable.css new file mode 100644 index 000000000000..9850ee7e4cac --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.selectable.css @@ -0,0 +1,10 @@ +/*! + * jQuery UI Selectable 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.slider.css b/resources/lib/jquery.ui/themes/default/jquery.ui.slider.css new file mode 100644 index 000000000000..fbfe66585dc4 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.slider.css @@ -0,0 +1,24 @@ +/*! + * jQuery UI Slider 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.tabs.css b/resources/lib/jquery.ui/themes/default/jquery.ui.tabs.css new file mode 100644 index 000000000000..f0bee7a20903 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.tabs.css @@ -0,0 +1,18 @@ +/*! + * jQuery UI Tabs 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/resources/lib/jquery.ui/themes/default/jquery.ui.theme.css b/resources/lib/jquery.ui/themes/default/jquery.ui.theme.css new file mode 100644 index 000000000000..b7d2f6179574 --- /dev/null +++ b/resources/lib/jquery.ui/themes/default/jquery.ui.theme.css @@ -0,0 +1,247 @@ +/*! + * jQuery UI CSS Framework 1.8.24 + * + * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file diff --git a/resources/lib/jquery/jquery.appear.js b/resources/lib/jquery/jquery.appear.js new file mode 100644 index 000000000000..4f77886cda80 --- /dev/null +++ b/resources/lib/jquery/jquery.appear.js @@ -0,0 +1,138 @@ +/* + * jQuery.appear + * http://code.google.com/p/jquery-appear/ + * + * Copyright (c) 2009 Michael Hixson + * Licensed under the MIT license (http://www.opensource.org/licenses/mit-license.php) +*/ +(function($) { + + $.fn.appear = function(fn, options) { + + var settings = $.extend({ + + //arbitrary data to pass to fn + data: undefined, + + //call fn only on the first appear? + one: true + + }, options); + + return this.each(function() { + + var t = $(this); + + //whether the element is currently visible + t.appeared = false; + + if (!fn) { + + //trigger the custom event + t.trigger('appear', settings.data); + return; + } + + var w = $(window); + + //fires the appear event when appropriate + var check = function() { + + //is the element hidden? + if (!t.is(':visible')) { + + //it became hidden + t.appeared = false; + return; + } + + //is the element inside the visible window? + var a = w.scrollLeft(); + var b = w.scrollTop(); + var o = t.offset(); + var x = o.left; + var y = o.top; + + if (y + t.height() >= b && + y <= b + w.height() && + x + t.width() >= a && + x <= a + w.width()) { + + //trigger the custom event + if (!t.appeared) t.trigger('appear', settings.data); + + } else { + + //it scrolled out of view + t.appeared = false; + } + }; + + //create a modified fn with some additional logic + var modifiedFn = function() { + + //mark the element as visible + t.appeared = true; + + //is this supposed to happen only once? + if (settings.one) { + + //remove the check + w.unbind('scroll', check); + var i = $.inArray(check, $.fn.appear.checks); + if (i >= 0) $.fn.appear.checks.splice(i, 1); + } + + //trigger the original fn + fn.apply(this, arguments); + }; + + //bind the modified fn to the element + if (settings.one) t.one('appear', settings.data, modifiedFn); + else t.bind('appear', settings.data, modifiedFn); + + //check whenever the window scrolls + w.scroll(check); + + //check whenever the dom changes + $.fn.appear.checks.push(check); + + //check now + (check)(); + }); + }; + + //keep a queue of appearance checks + $.extend($.fn.appear, { + + checks: [], + timeout: null, + + //process the queue + checkAll: function() { + var length = $.fn.appear.checks.length; + if (length > 0) while (length--) ($.fn.appear.checks[length])(); + }, + + //check the queue asynchronously + run: function() { + if ($.fn.appear.timeout) clearTimeout($.fn.appear.timeout); + $.fn.appear.timeout = setTimeout($.fn.appear.checkAll, 20); + } + }); + + //run checks when these methods are called + $.each(['append', 'prepend', 'after', 'before', 'attr', + 'removeAttr', 'addClass', 'removeClass', 'toggleClass', + 'remove', 'css', 'show', 'hide'], function(i, n) { + var old = $.fn[n]; + if (old) { + $.fn[n] = function() { + var r = old.apply(this, arguments); + $.fn.appear.run(); + return r; + } + } + }); + +})(jQuery);
\ No newline at end of file diff --git a/resources/lib/jquery/jquery.async.js b/resources/lib/jquery/jquery.async.js new file mode 100644 index 000000000000..2161f6b9e3ae --- /dev/null +++ b/resources/lib/jquery/jquery.async.js @@ -0,0 +1,69 @@ +/* + * jQuery Asynchronous Plugin 1.0 + * + * Copyright (c) 2008 Vincent Robert (genezys.net) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + */ +(function($){ + +// opts.delay : (default 10) delay between async call in ms +// opts.bulk : (default 500) delay during which the loop can continue synchronously without yielding the CPU +// opts.test : (default true) function to test in the while test part +// opts.loop : (default empty) function to call in the while loop part +// opts.end : (default empty) function to call at the end of the while loop +$.whileAsync = function(opts) { + var delay = Math.abs(opts.delay) || 10, + bulk = isNaN(opts.bulk) ? 500 : Math.abs(opts.bulk), + test = opts.test || function(){ return true; }, + loop = opts.loop || function(){}, + end = opts.end || function(){}; + + (function(){ + + var t = false, + begin = new Date(); + + while( t = test() ) { + loop(); + if( bulk === 0 || (new Date() - begin) > bulk ) { + break; + } + } + if( t ) { + setTimeout(arguments.callee, delay); + } + else { + end(); + } + + })(); +}; + +// opts.delay : (default 10) delay between async call in ms +// opts.bulk : (default 500) delay during which the loop can continue synchronously without yielding the CPU +// opts.loop : (default empty) function to call in the each loop part, signature: function(index, value) this = value +// opts.end : (default empty) function to call at the end of the each loop +$.eachAsync = function(array, opts) { + var i = 0, + l = array.length, + loop = opts.loop || function(){}; + + $.whileAsync( + $.extend(opts, { + test: function() { return i < l; }, + loop: function() { + var val = array[i]; + return loop.call(val, i++, val); + } + }) + ); +}; + +$.fn.eachAsync = function(opts) { + $.eachAsync(this, opts); + return this; +} + +})(jQuery);
\ No newline at end of file diff --git a/resources/lib/jquery/jquery.ba-throttle-debounce.js b/resources/lib/jquery/jquery.ba-throttle-debounce.js new file mode 100644 index 000000000000..fa30bdfffe23 --- /dev/null +++ b/resources/lib/jquery/jquery.ba-throttle-debounce.js @@ -0,0 +1,252 @@ +/*! + * jQuery throttle / debounce - v1.1 - 3/7/2010 + * http://benalman.com/projects/jquery-throttle-debounce-plugin/ + * + * Copyright (c) 2010 "Cowboy" Ben Alman + * Dual licensed under the MIT and GPL licenses. + * http://benalman.com/about/license/ + */ + +// Script: jQuery throttle / debounce: Sometimes, less is more! +// +// *Version: 1.1, Last updated: 3/7/2010* +// +// Project Home - http://benalman.com/projects/jquery-throttle-debounce-plugin/ +// GitHub - http://github.com/cowboy/jquery-throttle-debounce/ +// Source - http://github.com/cowboy/jquery-throttle-debounce/raw/master/jquery.ba-throttle-debounce.js +// (Minified) - http://github.com/cowboy/jquery-throttle-debounce/raw/master/jquery.ba-throttle-debounce.min.js (0.7kb) +// +// About: License +// +// Copyright (c) 2010 "Cowboy" Ben Alman, +// Dual licensed under the MIT and GPL licenses. +// http://benalman.com/about/license/ +// +// About: Examples +// +// These working examples, complete with fully commented code, illustrate a few +// ways in which this plugin can be used. +// +// Throttle - http://benalman.com/code/projects/jquery-throttle-debounce/examples/throttle/ +// Debounce - http://benalman.com/code/projects/jquery-throttle-debounce/examples/debounce/ +// +// About: Support and Testing +// +// Information about what version or versions of jQuery this plugin has been +// tested with, what browsers it has been tested in, and where the unit tests +// reside (so you can test it yourself). +// +// jQuery Versions - none, 1.3.2, 1.4.2 +// Browsers Tested - Internet Explorer 6-8, Firefox 2-3.6, Safari 3-4, Chrome 4-5, Opera 9.6-10.1. +// Unit Tests - http://benalman.com/code/projects/jquery-throttle-debounce/unit/ +// +// About: Release History +// +// 1.1 - (3/7/2010) Fixed a bug in <jQuery.throttle> where trailing callbacks +// executed later than they should. Reworked a fair amount of internal +// logic as well. +// 1.0 - (3/6/2010) Initial release as a stand-alone project. Migrated over +// from jquery-misc repo v0.4 to jquery-throttle repo v1.0, added the +// no_trailing throttle parameter and debounce functionality. +// +// Topic: Note for non-jQuery users +// +// jQuery isn't actually required for this plugin, because nothing internal +// uses any jQuery methods or properties. jQuery is just used as a namespace +// under which these methods can exist. +// +// Since jQuery isn't actually required for this plugin, if jQuery doesn't exist +// when this plugin is loaded, the method described below will be created in +// the `Cowboy` namespace. Usage will be exactly the same, but instead of +// $.method() or jQuery.method(), you'll need to use Cowboy.method(). + +(function(window,undefined){ + '$:nomunge'; // Used by YUI compressor. + + // Since jQuery really isn't required for this plugin, use `jQuery` as the + // namespace only if it already exists, otherwise use the `Cowboy` namespace, + // creating it if necessary. + var $ = window.jQuery || window.Cowboy || ( window.Cowboy = {} ), + + // Internal method reference. + jq_throttle; + + // Method: jQuery.throttle + // + // Throttle execution of a function. Especially useful for rate limiting + // execution of handlers on events like resize and scroll. If you want to + // rate-limit execution of a function to a single time, see the + // <jQuery.debounce> method. + // + // In this visualization, | is a throttled-function call and X is the actual + // callback execution: + // + // > Throttled with `no_trailing` specified as false or unspecified: + // > ||||||||||||||||||||||||| (pause) ||||||||||||||||||||||||| + // > X X X X X X X X X X X X + // > + // > Throttled with `no_trailing` specified as true: + // > ||||||||||||||||||||||||| (pause) ||||||||||||||||||||||||| + // > X X X X X X X X X X + // + // Usage: + // + // > var throttled = jQuery.throttle( delay, [ no_trailing, ] callback ); + // > + // > jQuery('selector').bind( 'someevent', throttled ); + // > jQuery('selector').unbind( 'someevent', throttled ); + // + // This also works in jQuery 1.4+: + // + // > jQuery('selector').bind( 'someevent', jQuery.throttle( delay, [ no_trailing, ] callback ) ); + // > jQuery('selector').unbind( 'someevent', callback ); + // + // Arguments: + // + // delay - (Number) A zero-or-greater delay in milliseconds. For event + // callbacks, values around 100 or 250 (or even higher) are most useful. + // no_trailing - (Boolean) Optional, defaults to false. If no_trailing is + // true, callback will only execute every `delay` milliseconds while the + // throttled-function is being called. If no_trailing is false or + // unspecified, callback will be executed one final time after the last + // throttled-function call. (After the throttled-function has not been + // called for `delay` milliseconds, the internal counter is reset) + // callback - (Function) A function to be executed after delay milliseconds. + // The `this` context and all arguments are passed through, as-is, to + // `callback` when the throttled-function is executed. + // + // Returns: + // + // (Function) A new, throttled, function. + + $.throttle = jq_throttle = function( delay, no_trailing, callback, debounce_mode ) { + // After wrapper has stopped being called, this timeout ensures that + // `callback` is executed at the proper times in `throttle` and `end` + // debounce modes. + var timeout_id, + + // Keep track of the last time `callback` was executed. + last_exec = 0; + + // `no_trailing` defaults to falsy. + if ( typeof no_trailing !== 'boolean' ) { + debounce_mode = callback; + callback = no_trailing; + no_trailing = undefined; + } + + // The `wrapper` function encapsulates all of the throttling / debouncing + // functionality and when executed will limit the rate at which `callback` + // is executed. + function wrapper() { + var that = this, + elapsed = +new Date() - last_exec, + args = arguments; + + // Execute `callback` and update the `last_exec` timestamp. + function exec() { + last_exec = +new Date(); + callback.apply( that, args ); + }; + + // If `debounce_mode` is true (at_begin) this is used to clear the flag + // to allow future `callback` executions. + function clear() { + timeout_id = undefined; + }; + + if ( debounce_mode && !timeout_id ) { + // Since `wrapper` is being called for the first time and + // `debounce_mode` is true (at_begin), execute `callback`. + exec(); + } + + // Clear any existing timeout. + timeout_id && clearTimeout( timeout_id ); + + if ( debounce_mode === undefined && elapsed > delay ) { + // In throttle mode, if `delay` time has been exceeded, execute + // `callback`. + exec(); + + } else if ( no_trailing !== true ) { + // In trailing throttle mode, since `delay` time has not been + // exceeded, schedule `callback` to execute `delay` ms after most + // recent execution. + // + // If `debounce_mode` is true (at_begin), schedule `clear` to execute + // after `delay` ms. + // + // If `debounce_mode` is false (at end), schedule `callback` to + // execute after `delay` ms. + timeout_id = setTimeout( debounce_mode ? clear : exec, debounce_mode === undefined ? delay - elapsed : delay ); + } + }; + + // Set the guid of `wrapper` function to the same of original callback, so + // it can be removed in jQuery 1.4+ .unbind or .die by using the original + // callback as a reference. + if ( $.guid ) { + wrapper.guid = callback.guid = callback.guid || $.guid++; + } + + // Return the wrapper function. + return wrapper; + }; + + // Method: jQuery.debounce + // + // Debounce execution of a function. Debouncing, unlike throttling, + // guarantees that a function is only executed a single time, either at the + // very beginning of a series of calls, or at the very end. If you want to + // simply rate-limit execution of a function, see the <jQuery.throttle> + // method. + // + // In this visualization, | is a debounced-function call and X is the actual + // callback execution: + // + // > Debounced with `at_begin` specified as false or unspecified: + // > ||||||||||||||||||||||||| (pause) ||||||||||||||||||||||||| + // > X X + // > + // > Debounced with `at_begin` specified as true: + // > ||||||||||||||||||||||||| (pause) ||||||||||||||||||||||||| + // > X X + // + // Usage: + // + // > var debounced = jQuery.debounce( delay, [ at_begin, ] callback ); + // > + // > jQuery('selector').bind( 'someevent', debounced ); + // > jQuery('selector').unbind( 'someevent', debounced ); + // + // This also works in jQuery 1.4+: + // + // > jQuery('selector').bind( 'someevent', jQuery.debounce( delay, [ at_begin, ] callback ) ); + // > jQuery('selector').unbind( 'someevent', callback ); + // + // Arguments: + // + // delay - (Number) A zero-or-greater delay in milliseconds. For event + // callbacks, values around 100 or 250 (or even higher) are most useful. + // at_begin - (Boolean) Optional, defaults to false. If at_begin is false or + // unspecified, callback will only be executed `delay` milliseconds after + // the last debounced-function call. If at_begin is true, callback will be + // executed only at the first debounced-function call. (After the + // throttled-function has not been called for `delay` milliseconds, the + // internal counter is reset) + // callback - (Function) A function to be executed after delay milliseconds. + // The `this` context and all arguments are passed through, as-is, to + // `callback` when the debounced-function is executed. + // + // Returns: + // + // (Function) A new, debounced, function. + + $.debounce = function( delay, at_begin, callback ) { + return callback === undefined + ? jq_throttle( delay, at_begin, false ) + : jq_throttle( delay, callback, at_begin !== false ); + }; + +})(this); diff --git a/resources/lib/jquery/jquery.cookie.js b/resources/lib/jquery/jquery.cookie.js new file mode 100644 index 000000000000..6d5974a2c573 --- /dev/null +++ b/resources/lib/jquery/jquery.cookie.js @@ -0,0 +1,47 @@ +/*! + * jQuery Cookie Plugin + * https://github.com/carhartl/jquery-cookie + * + * Copyright 2011, Klaus Hartl + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://www.opensource.org/licenses/mit-license.php + * http://www.opensource.org/licenses/GPL-2.0 + */ +(function($) { + $.cookie = function(key, value, options) { + + // key and at least value given, set cookie... + if (arguments.length > 1 && (!/Object/.test(Object.prototype.toString.call(value)) || value === null || value === undefined)) { + options = $.extend({}, options); + + if (value === null || value === undefined) { + options.expires = -1; + } + + if (typeof options.expires === 'number') { + var days = options.expires, t = options.expires = new Date(); + t.setDate(t.getDate() + days); + } + + value = String(value); + + return (document.cookie = [ + encodeURIComponent(key), '=', options.raw ? value : encodeURIComponent(value), + options.expires ? '; expires=' + options.expires.toUTCString() : '', // use expires attribute, max-age is not supported by IE + options.path ? '; path=' + options.path : '', + options.domain ? '; domain=' + options.domain : '', + options.secure ? '; secure' : '' + ].join('')); + } + + // key and possibly options given, get cookie... + options = value || {}; + var decode = options.raw ? function(s) { return s; } : decodeURIComponent; + + var pairs = document.cookie.split('; '); + for (var i = 0, pair; pair = pairs[i] && pairs[i].split('='); i++) { + if (decode(pair[0]) === key) return decode(pair[1] || ''); // IE saves cookies with empty string as "c; ", e.g. without "=" as opposed to EOMB, thus pair[1] may be undefined + } + return null; + }; +})(jQuery); diff --git a/resources/lib/jquery/jquery.cycle.all.js b/resources/lib/jquery/jquery.cycle.all.js new file mode 100644 index 000000000000..d57fb7207f26 --- /dev/null +++ b/resources/lib/jquery/jquery.cycle.all.js @@ -0,0 +1,1529 @@ +/*! + * jQuery Cycle Plugin (with Transition Definitions) + * Examples and documentation at: http://jquery.malsup.com/cycle/ + * Copyright (c) 2007-2010 M. Alsup + * Version: 2.9999 (13-NOV-2011) + * Dual licensed under the MIT and GPL licenses. + * http://jquery.malsup.com/license.html + * Requires: jQuery v1.3.2 or later + */ +;(function($, undefined) { + +var ver = '2.9999'; + +// if $.support is not defined (pre jQuery 1.3) add what I need +if ($.support == undefined) { + $.support = { + opacity: !($.browser.msie) + }; +} + +function debug(s) { + $.fn.cycle.debug && log(s); +} +function log() { + window.console && console.log && console.log('[cycle] ' + Array.prototype.join.call(arguments,' ')); +} +$.expr[':'].paused = function(el) { + return el.cyclePause; +} + + +// the options arg can be... +// a number - indicates an immediate transition should occur to the given slide index +// a string - 'pause', 'resume', 'toggle', 'next', 'prev', 'stop', 'destroy' or the name of a transition effect (ie, 'fade', 'zoom', etc) +// an object - properties to control the slideshow +// +// the arg2 arg can be... +// the name of an fx (only used in conjunction with a numeric value for 'options') +// the value true (only used in first arg == 'resume') and indicates +// that the resume should occur immediately (not wait for next timeout) + +$.fn.cycle = function(options, arg2) { + var o = { s: this.selector, c: this.context }; + + // in 1.3+ we can fix mistakes with the ready state + if (this.length === 0 && options != 'stop') { + if (!$.isReady && o.s) { + log('DOM not ready, queuing slideshow'); + $(function() { + $(o.s,o.c).cycle(options,arg2); + }); + return this; + } + // is your DOM ready? http://docs.jquery.com/Tutorials:Introducing_$(document).ready() + log('terminating; zero elements found by selector' + ($.isReady ? '' : ' (DOM not ready)')); + return this; + } + + // iterate the matched nodeset + return this.each(function() { + var opts = handleArguments(this, options, arg2); + if (opts === false) + return; + + opts.updateActivePagerLink = opts.updateActivePagerLink || $.fn.cycle.updateActivePagerLink; + + // stop existing slideshow for this container (if there is one) + if (this.cycleTimeout) + clearTimeout(this.cycleTimeout); + this.cycleTimeout = this.cyclePause = 0; + + var $cont = $(this); + var $slides = opts.slideExpr ? $(opts.slideExpr, this) : $cont.children(); + var els = $slides.get(); + + var opts2 = buildOptions($cont, $slides, els, opts, o); + if (opts2 === false) + return; + + if (els.length < 2) { + log('terminating; too few slides: ' + els.length); + return; + } + + var startTime = opts2.continuous ? 10 : getTimeout(els[opts2.currSlide], els[opts2.nextSlide], opts2, !opts2.backwards); + + // if it's an auto slideshow, kick it off + if (startTime) { + startTime += (opts2.delay || 0); + if (startTime < 10) + startTime = 10; + debug('first timeout: ' + startTime); + this.cycleTimeout = setTimeout(function(){go(els,opts2,0,!opts.backwards)}, startTime); + } + }); +}; + +function triggerPause(cont, byHover, onPager) { + var opts = $(cont).data('cycle.opts'); + var paused = !!cont.cyclePause; + if (paused && opts.paused) + opts.paused(cont, opts, byHover, onPager); + else if (!paused && opts.resumed) + opts.resumed(cont, opts, byHover, onPager); +} + +// process the args that were passed to the plugin fn +function handleArguments(cont, options, arg2) { + if (cont.cycleStop == undefined) + cont.cycleStop = 0; + if (options === undefined || options === null) + options = {}; + if (options.constructor == String) { + switch(options) { + case 'destroy': + case 'stop': + var opts = $(cont).data('cycle.opts'); + if (!opts) + return false; + cont.cycleStop++; // callbacks look for change + if (cont.cycleTimeout) + clearTimeout(cont.cycleTimeout); + cont.cycleTimeout = 0; + opts.elements && $(opts.elements).stop(); + $(cont).removeData('cycle.opts'); + if (options == 'destroy') + destroy(opts); + return false; + case 'toggle': + cont.cyclePause = (cont.cyclePause === 1) ? 0 : 1; + checkInstantResume(cont.cyclePause, arg2, cont); + triggerPause(cont); + return false; + case 'pause': + cont.cyclePause = 1; + triggerPause(cont); + return false; + case 'resume': + cont.cyclePause = 0; + checkInstantResume(false, arg2, cont); + triggerPause(cont); + return false; + case 'prev': + case 'next': + var opts = $(cont).data('cycle.opts'); + if (!opts) { + log('options not found, "prev/next" ignored'); + return false; + } + $.fn.cycle[options](opts); + return false; + default: + options = { fx: options }; + }; + return options; + } + else if (options.constructor == Number) { + // go to the requested slide + var num = options; + options = $(cont).data('cycle.opts'); + if (!options) { + log('options not found, can not advance slide'); + return false; + } + if (num < 0 || num >= options.elements.length) { + log('invalid slide index: ' + num); + return false; + } + options.nextSlide = num; + if (cont.cycleTimeout) { + clearTimeout(cont.cycleTimeout); + cont.cycleTimeout = 0; + } + if (typeof arg2 == 'string') + options.oneTimeFx = arg2; + go(options.elements, options, 1, num >= options.currSlide); + return false; + } + return options; + + function checkInstantResume(isPaused, arg2, cont) { + if (!isPaused && arg2 === true) { // resume now! + var options = $(cont).data('cycle.opts'); + if (!options) { + log('options not found, can not resume'); + return false; + } + if (cont.cycleTimeout) { + clearTimeout(cont.cycleTimeout); + cont.cycleTimeout = 0; + } + go(options.elements, options, 1, !options.backwards); + } + } +}; + +function removeFilter(el, opts) { + if (!$.support.opacity && opts.cleartype && el.style.filter) { + try { el.style.removeAttribute('filter'); } + catch(smother) {} // handle old opera versions + } +}; + +// unbind event handlers +function destroy(opts) { + if (opts.next) + $(opts.next).unbind(opts.prevNextEvent); + if (opts.prev) + $(opts.prev).unbind(opts.prevNextEvent); + + if (opts.pager || opts.pagerAnchorBuilder) + $.each(opts.pagerAnchors || [], function() { + this.unbind().remove(); + }); + opts.pagerAnchors = null; + if (opts.destroy) // callback + opts.destroy(opts); +}; + +// one-time initialization +function buildOptions($cont, $slides, els, options, o) { + var startingSlideSpecified; + // support metadata plugin (v1.0 and v2.0) + var opts = $.extend({}, $.fn.cycle.defaults, options || {}, $.metadata ? $cont.metadata() : $.meta ? $cont.data() : {}); + var meta = $.isFunction($cont.data) ? $cont.data(opts.metaAttr) : null; + if (meta) + opts = $.extend(opts, meta); + if (opts.autostop) + opts.countdown = opts.autostopCount || els.length; + + var cont = $cont[0]; + $cont.data('cycle.opts', opts); + opts.$cont = $cont; + opts.stopCount = cont.cycleStop; + opts.elements = els; + opts.before = opts.before ? [opts.before] : []; + opts.after = opts.after ? [opts.after] : []; + + // push some after callbacks + if (!$.support.opacity && opts.cleartype) + opts.after.push(function() { removeFilter(this, opts); }); + if (opts.continuous) + opts.after.push(function() { go(els,opts,0,!opts.backwards); }); + + saveOriginalOpts(opts); + + // clearType corrections + if (!$.support.opacity && opts.cleartype && !opts.cleartypeNoBg) + clearTypeFix($slides); + + // container requires non-static position so that slides can be position within + if ($cont.css('position') == 'static') + $cont.css('position', 'relative'); + if (opts.width) + $cont.width(opts.width); + if (opts.height && opts.height != 'auto') + $cont.height(opts.height); + + if (opts.startingSlide != undefined) { + opts.startingSlide = parseInt(opts.startingSlide,10); + if (opts.startingSlide >= els.length || opts.startSlide < 0) + opts.startingSlide = 0; // catch bogus input + else + startingSlideSpecified = true; + } + else if (opts.backwards) + opts.startingSlide = els.length - 1; + else + opts.startingSlide = 0; + + // if random, mix up the slide array + if (opts.random) { + opts.randomMap = []; + for (var i = 0; i < els.length; i++) + opts.randomMap.push(i); + opts.randomMap.sort(function(a,b) {return Math.random() - 0.5;}); + if (startingSlideSpecified) { + // try to find the specified starting slide and if found set start slide index in the map accordingly + for ( var cnt = 0; cnt < els.length; cnt++ ) { + if ( opts.startingSlide == opts.randomMap[cnt] ) { + opts.randomIndex = cnt; + } + } + } + else { + opts.randomIndex = 1; + opts.startingSlide = opts.randomMap[1]; + } + } + else if (opts.startingSlide >= els.length) + opts.startingSlide = 0; // catch bogus input + opts.currSlide = opts.startingSlide || 0; + var first = opts.startingSlide; + + // set position and zIndex on all the slides + $slides.css({position: 'absolute', top:0, left:0}).hide().each(function(i) { + var z; + if (opts.backwards) + z = first ? i <= first ? els.length + (i-first) : first-i : els.length-i; + else + z = first ? i >= first ? els.length - (i-first) : first-i : els.length-i; + $(this).css('z-index', z) + }); + + // make sure first slide is visible + $(els[first]).css('opacity',1).show(); // opacity bit needed to handle restart use case + removeFilter(els[first], opts); + + // stretch slides + if (opts.fit) { + if (!opts.aspect) { + if (opts.width) + $slides.width(opts.width); + if (opts.height && opts.height != 'auto') + $slides.height(opts.height); + } else { + $slides.each(function(){ + var $slide = $(this); + var ratio = (opts.aspect === true) ? $slide.width()/$slide.height() : opts.aspect; + if( opts.width && $slide.width() != opts.width ) { + $slide.width( opts.width ); + $slide.height( opts.width / ratio ); + } + + if( opts.height && $slide.height() < opts.height ) { + $slide.height( opts.height ); + $slide.width( opts.height * ratio ); + } + }); + } + } + + if (opts.center && ((!opts.fit) || opts.aspect)) { + $slides.each(function(){ + var $slide = $(this); + $slide.css({ + "margin-left": opts.width ? + ((opts.width - $slide.width()) / 2) + "px" : + 0, + "margin-top": opts.height ? + ((opts.height - $slide.height()) / 2) + "px" : + 0 + }); + }); + } + + if (opts.center && !opts.fit && !opts.slideResize) { + $slides.each(function(){ + var $slide = $(this); + $slide.css({ + "margin-left": opts.width ? ((opts.width - $slide.width()) / 2) + "px" : 0, + "margin-top": opts.height ? ((opts.height - $slide.height()) / 2) + "px" : 0 + }); + }); + } + + // stretch container + var reshape = opts.containerResize && !$cont.innerHeight(); + if (reshape) { // do this only if container has no size http://tinyurl.com/da2oa9 + var maxw = 0, maxh = 0; + for(var j=0; j < els.length; j++) { + var $e = $(els[j]), e = $e[0], w = $e.outerWidth(), h = $e.outerHeight(); + if (!w) w = e.offsetWidth || e.width || $e.attr('width'); + if (!h) h = e.offsetHeight || e.height || $e.attr('height'); + maxw = w > maxw ? w : maxw; + maxh = h > maxh ? h : maxh; + } + if (maxw > 0 && maxh > 0) + $cont.css({width:maxw+'px',height:maxh+'px'}); + } + + var pauseFlag = false; // https://github.com/malsup/cycle/issues/44 + if (opts.pause) + $cont.hover( + function(){ + pauseFlag = true; + this.cyclePause++; + triggerPause(cont, true); + }, + function(){ + pauseFlag && this.cyclePause--; + triggerPause(cont, true); + } + ); + + if (supportMultiTransitions(opts) === false) + return false; + + // apparently a lot of people use image slideshows without height/width attributes on the images. + // Cycle 2.50+ requires the sizing info for every slide; this block tries to deal with that. + var requeue = false; + options.requeueAttempts = options.requeueAttempts || 0; + $slides.each(function() { + // try to get height/width of each slide + var $el = $(this); + this.cycleH = (opts.fit && opts.height) ? opts.height : ($el.height() || this.offsetHeight || this.height || $el.attr('height') || 0); + this.cycleW = (opts.fit && opts.width) ? opts.width : ($el.width() || this.offsetWidth || this.width || $el.attr('width') || 0); + + if ( $el.is('img') ) { + // sigh.. sniffing, hacking, shrugging... this crappy hack tries to account for what browsers do when + // an image is being downloaded and the markup did not include sizing info (height/width attributes); + // there seems to be some "default" sizes used in this situation + var loadingIE = ($.browser.msie && this.cycleW == 28 && this.cycleH == 30 && !this.complete); + var loadingFF = ($.browser.mozilla && this.cycleW == 34 && this.cycleH == 19 && !this.complete); + var loadingOp = ($.browser.opera && ((this.cycleW == 42 && this.cycleH == 19) || (this.cycleW == 37 && this.cycleH == 17)) && !this.complete); + var loadingOther = (this.cycleH == 0 && this.cycleW == 0 && !this.complete); + // don't requeue for images that are still loading but have a valid size + if (loadingIE || loadingFF || loadingOp || loadingOther) { + if (o.s && opts.requeueOnImageNotLoaded && ++options.requeueAttempts < 100) { // track retry count so we don't loop forever + log(options.requeueAttempts,' - img slide not loaded, requeuing slideshow: ', this.src, this.cycleW, this.cycleH); + setTimeout(function() {$(o.s,o.c).cycle(options)}, opts.requeueTimeout); + requeue = true; + return false; // break each loop + } + else { + log('could not determine size of image: '+this.src, this.cycleW, this.cycleH); + } + } + } + return true; + }); + + if (requeue) + return false; + + opts.cssBefore = opts.cssBefore || {}; + opts.cssAfter = opts.cssAfter || {}; + opts.cssFirst = opts.cssFirst || {}; + opts.animIn = opts.animIn || {}; + opts.animOut = opts.animOut || {}; + + $slides.not(':eq('+first+')').css(opts.cssBefore); + $($slides[first]).css(opts.cssFirst); + + if (opts.timeout) { + opts.timeout = parseInt(opts.timeout,10); + // ensure that timeout and speed settings are sane + if (opts.speed.constructor == String) + opts.speed = $.fx.speeds[opts.speed] || parseInt(opts.speed,10); + if (!opts.sync) + opts.speed = opts.speed / 2; + + var buffer = opts.fx == 'none' ? 0 : opts.fx == 'shuffle' ? 500 : 250; + while((opts.timeout - opts.speed) < buffer) // sanitize timeout + opts.timeout += opts.speed; + } + if (opts.easing) + opts.easeIn = opts.easeOut = opts.easing; + if (!opts.speedIn) + opts.speedIn = opts.speed; + if (!opts.speedOut) + opts.speedOut = opts.speed; + + opts.slideCount = els.length; + opts.currSlide = opts.lastSlide = first; + if (opts.random) { + if (++opts.randomIndex == els.length) + opts.randomIndex = 0; + opts.nextSlide = opts.randomMap[opts.randomIndex]; + } + else if (opts.backwards) + opts.nextSlide = opts.startingSlide == 0 ? (els.length-1) : opts.startingSlide-1; + else + opts.nextSlide = opts.startingSlide >= (els.length-1) ? 0 : opts.startingSlide+1; + + // run transition init fn + if (!opts.multiFx) { + var init = $.fn.cycle.transitions[opts.fx]; + if ($.isFunction(init)) + init($cont, $slides, opts); + else if (opts.fx != 'custom' && !opts.multiFx) { + log('unknown transition: ' + opts.fx,'; slideshow terminating'); + return false; + } + } + + // fire artificial events + var e0 = $slides[first]; + if (!opts.skipInitializationCallbacks) { + if (opts.before.length) + opts.before[0].apply(e0, [e0, e0, opts, true]); + if (opts.after.length) + opts.after[0].apply(e0, [e0, e0, opts, true]); + } + if (opts.next) + $(opts.next).bind(opts.prevNextEvent,function(){return advance(opts,1)}); + if (opts.prev) + $(opts.prev).bind(opts.prevNextEvent,function(){return advance(opts,0)}); + if (opts.pager || opts.pagerAnchorBuilder) + buildPager(els,opts); + + exposeAddSlide(opts, els); + + return opts; +}; + +// save off original opts so we can restore after clearing state +function saveOriginalOpts(opts) { + opts.original = { before: [], after: [] }; + opts.original.cssBefore = $.extend({}, opts.cssBefore); + opts.original.cssAfter = $.extend({}, opts.cssAfter); + opts.original.animIn = $.extend({}, opts.animIn); + opts.original.animOut = $.extend({}, opts.animOut); + $.each(opts.before, function() { opts.original.before.push(this); }); + $.each(opts.after, function() { opts.original.after.push(this); }); +}; + +function supportMultiTransitions(opts) { + var i, tx, txs = $.fn.cycle.transitions; + // look for multiple effects + if (opts.fx.indexOf(',') > 0) { + opts.multiFx = true; + opts.fxs = opts.fx.replace(/\s*/g,'').split(','); + // discard any bogus effect names + for (i=0; i < opts.fxs.length; i++) { + var fx = opts.fxs[i]; + tx = txs[fx]; + if (!tx || !txs.hasOwnProperty(fx) || !$.isFunction(tx)) { + log('discarding unknown transition: ',fx); + opts.fxs.splice(i,1); + i--; + } + } + // if we have an empty list then we threw everything away! + if (!opts.fxs.length) { + log('No valid transitions named; slideshow terminating.'); + return false; + } + } + else if (opts.fx == 'all') { // auto-gen the list of transitions + opts.multiFx = true; + opts.fxs = []; + for (p in txs) { + tx = txs[p]; + if (txs.hasOwnProperty(p) && $.isFunction(tx)) + opts.fxs.push(p); + } + } + if (opts.multiFx && opts.randomizeEffects) { + // munge the fxs array to make effect selection random + var r1 = Math.floor(Math.random() * 20) + 30; + for (i = 0; i < r1; i++) { + var r2 = Math.floor(Math.random() * opts.fxs.length); + opts.fxs.push(opts.fxs.splice(r2,1)[0]); + } + debug('randomized fx sequence: ',opts.fxs); + } + return true; +}; + +// provide a mechanism for adding slides after the slideshow has started +function exposeAddSlide(opts, els) { + opts.addSlide = function(newSlide, prepend) { + var $s = $(newSlide), s = $s[0]; + if (!opts.autostopCount) + opts.countdown++; + els[prepend?'unshift':'push'](s); + if (opts.els) + opts.els[prepend?'unshift':'push'](s); // shuffle needs this + opts.slideCount = els.length; + + // add the slide to the random map and resort + if (opts.random) { + opts.randomMap.push(opts.slideCount-1); + opts.randomMap.sort(function(a,b) {return Math.random() - 0.5;}); + } + + $s.css('position','absolute'); + $s[prepend?'prependTo':'appendTo'](opts.$cont); + + if (prepend) { + opts.currSlide++; + opts.nextSlide++; + } + + if (!$.support.opacity && opts.cleartype && !opts.cleartypeNoBg) + clearTypeFix($s); + + if (opts.fit && opts.width) + $s.width(opts.width); + if (opts.fit && opts.height && opts.height != 'auto') + $s.height(opts.height); + s.cycleH = (opts.fit && opts.height) ? opts.height : $s.height(); + s.cycleW = (opts.fit && opts.width) ? opts.width : $s.width(); + + $s.css(opts.cssBefore); + + if (opts.pager || opts.pagerAnchorBuilder) + $.fn.cycle.createPagerAnchor(els.length-1, s, $(opts.pager), els, opts); + + if ($.isFunction(opts.onAddSlide)) + opts.onAddSlide($s); + else + $s.hide(); // default behavior + }; +} + +// reset internal state; we do this on every pass in order to support multiple effects +$.fn.cycle.resetState = function(opts, fx) { + fx = fx || opts.fx; + opts.before = []; opts.after = []; + opts.cssBefore = $.extend({}, opts.original.cssBefore); + opts.cssAfter = $.extend({}, opts.original.cssAfter); + opts.animIn = $.extend({}, opts.original.animIn); + opts.animOut = $.extend({}, opts.original.animOut); + opts.fxFn = null; + $.each(opts.original.before, function() { opts.before.push(this); }); + $.each(opts.original.after, function() { opts.after.push(this); }); + + // re-init + var init = $.fn.cycle.transitions[fx]; + if ($.isFunction(init)) + init(opts.$cont, $(opts.elements), opts); +}; + +// this is the main engine fn, it handles the timeouts, callbacks and slide index mgmt +function go(els, opts, manual, fwd) { + // opts.busy is true if we're in the middle of an animation + if (manual && opts.busy && opts.manualTrump) { + // let manual transitions requests trump active ones + debug('manualTrump in go(), stopping active transition'); + $(els).stop(true,true); + opts.busy = 0; + } + // don't begin another timeout-based transition if there is one active + if (opts.busy) { + debug('transition active, ignoring new tx request'); + return; + } + + var p = opts.$cont[0], curr = els[opts.currSlide], next = els[opts.nextSlide]; + + // stop cycling if we have an outstanding stop request + if (p.cycleStop != opts.stopCount || p.cycleTimeout === 0 && !manual) + return; + + // check to see if we should stop cycling based on autostop options + if (!manual && !p.cyclePause && !opts.bounce && + ((opts.autostop && (--opts.countdown <= 0)) || + (opts.nowrap && !opts.random && opts.nextSlide < opts.currSlide))) { + if (opts.end) + opts.end(opts); + return; + } + + // if slideshow is paused, only transition on a manual trigger + var changed = false; + if ((manual || !p.cyclePause) && (opts.nextSlide != opts.currSlide)) { + changed = true; + var fx = opts.fx; + // keep trying to get the slide size if we don't have it yet + curr.cycleH = curr.cycleH || $(curr).height(); + curr.cycleW = curr.cycleW || $(curr).width(); + next.cycleH = next.cycleH || $(next).height(); + next.cycleW = next.cycleW || $(next).width(); + + // support multiple transition types + if (opts.multiFx) { + if (fwd && (opts.lastFx == undefined || ++opts.lastFx >= opts.fxs.length)) + opts.lastFx = 0; + else if (!fwd && (opts.lastFx == undefined || --opts.lastFx < 0)) + opts.lastFx = opts.fxs.length - 1; + fx = opts.fxs[opts.lastFx]; + } + + // one-time fx overrides apply to: $('div').cycle(3,'zoom'); + if (opts.oneTimeFx) { + fx = opts.oneTimeFx; + opts.oneTimeFx = null; + } + + $.fn.cycle.resetState(opts, fx); + + // run the before callbacks + if (opts.before.length) + $.each(opts.before, function(i,o) { + if (p.cycleStop != opts.stopCount) return; + o.apply(next, [curr, next, opts, fwd]); + }); + + // stage the after callacks + var after = function() { + opts.busy = 0; + $.each(opts.after, function(i,o) { + if (p.cycleStop != opts.stopCount) return; + o.apply(next, [curr, next, opts, fwd]); + }); + if (!p.cycleStop) { + // queue next transition + queueNext(); + } + }; + + debug('tx firing('+fx+'); currSlide: ' + opts.currSlide + '; nextSlide: ' + opts.nextSlide); + + // get ready to perform the transition + opts.busy = 1; + if (opts.fxFn) // fx function provided? + opts.fxFn(curr, next, opts, after, fwd, manual && opts.fastOnEvent); + else if ($.isFunction($.fn.cycle[opts.fx])) // fx plugin ? + $.fn.cycle[opts.fx](curr, next, opts, after, fwd, manual && opts.fastOnEvent); + else + $.fn.cycle.custom(curr, next, opts, after, fwd, manual && opts.fastOnEvent); + } + else { + queueNext(); + } + + if (changed || opts.nextSlide == opts.currSlide) { + // calculate the next slide + opts.lastSlide = opts.currSlide; + if (opts.random) { + opts.currSlide = opts.nextSlide; + if (++opts.randomIndex == els.length) { + opts.randomIndex = 0; + opts.randomMap.sort(function(a,b) {return Math.random() - 0.5;}); + } + opts.nextSlide = opts.randomMap[opts.randomIndex]; + if (opts.nextSlide == opts.currSlide) + opts.nextSlide = (opts.currSlide == opts.slideCount - 1) ? 0 : opts.currSlide + 1; + } + else if (opts.backwards) { + var roll = (opts.nextSlide - 1) < 0; + if (roll && opts.bounce) { + opts.backwards = !opts.backwards; + opts.nextSlide = 1; + opts.currSlide = 0; + } + else { + opts.nextSlide = roll ? (els.length-1) : opts.nextSlide-1; + opts.currSlide = roll ? 0 : opts.nextSlide+1; + } + } + else { // sequence + var roll = (opts.nextSlide + 1) == els.length; + if (roll && opts.bounce) { + opts.backwards = !opts.backwards; + opts.nextSlide = els.length-2; + opts.currSlide = els.length-1; + } + else { + opts.nextSlide = roll ? 0 : opts.nextSlide+1; + opts.currSlide = roll ? els.length-1 : opts.nextSlide-1; + } + } + } + if (changed && opts.pager) + opts.updateActivePagerLink(opts.pager, opts.currSlide, opts.activePagerClass); + + function queueNext() { + // stage the next transition + var ms = 0, timeout = opts.timeout; + if (opts.timeout && !opts.continuous) { + ms = getTimeout(els[opts.currSlide], els[opts.nextSlide], opts, fwd); + if (opts.fx == 'shuffle') + ms -= opts.speedOut; + } + else if (opts.continuous && p.cyclePause) // continuous shows work off an after callback, not this timer logic + ms = 10; + if (ms > 0) + p.cycleTimeout = setTimeout(function(){ go(els, opts, 0, !opts.backwards) }, ms); + } +}; + +// invoked after transition +$.fn.cycle.updateActivePagerLink = function(pager, currSlide, clsName) { + $(pager).each(function() { + $(this).children().removeClass(clsName).eq(currSlide).addClass(clsName); + }); +}; + +// calculate timeout value for current transition +function getTimeout(curr, next, opts, fwd) { + if (opts.timeoutFn) { + // call user provided calc fn + var t = opts.timeoutFn.call(curr,curr,next,opts,fwd); + while (opts.fx != 'none' && (t - opts.speed) < 250) // sanitize timeout + t += opts.speed; + debug('calculated timeout: ' + t + '; speed: ' + opts.speed); + if (t !== false) + return t; + } + return opts.timeout; +}; + +// expose next/prev function, caller must pass in state +$.fn.cycle.next = function(opts) { advance(opts,1); }; +$.fn.cycle.prev = function(opts) { advance(opts,0);}; + +// advance slide forward or back +function advance(opts, moveForward) { + var val = moveForward ? 1 : -1; + var els = opts.elements; + var p = opts.$cont[0], timeout = p.cycleTimeout; + if (timeout) { + clearTimeout(timeout); + p.cycleTimeout = 0; + } + if (opts.random && val < 0) { + // move back to the previously display slide + opts.randomIndex--; + if (--opts.randomIndex == -2) + opts.randomIndex = els.length-2; + else if (opts.randomIndex == -1) + opts.randomIndex = els.length-1; + opts.nextSlide = opts.randomMap[opts.randomIndex]; + } + else if (opts.random) { + opts.nextSlide = opts.randomMap[opts.randomIndex]; + } + else { + opts.nextSlide = opts.currSlide + val; + if (opts.nextSlide < 0) { + if (opts.nowrap) return false; + opts.nextSlide = els.length - 1; + } + else if (opts.nextSlide >= els.length) { + if (opts.nowrap) return false; + opts.nextSlide = 0; + } + } + + var cb = opts.onPrevNextEvent || opts.prevNextClick; // prevNextClick is deprecated + if ($.isFunction(cb)) + cb(val > 0, opts.nextSlide, els[opts.nextSlide]); + go(els, opts, 1, moveForward); + return false; +}; + +function buildPager(els, opts) { + var $p = $(opts.pager); + $.each(els, function(i,o) { + $.fn.cycle.createPagerAnchor(i,o,$p,els,opts); + }); + opts.updateActivePagerLink(opts.pager, opts.startingSlide, opts.activePagerClass); +}; + +$.fn.cycle.createPagerAnchor = function(i, el, $p, els, opts) { + var a; + if ($.isFunction(opts.pagerAnchorBuilder)) { + a = opts.pagerAnchorBuilder(i,el); + debug('pagerAnchorBuilder('+i+', el) returned: ' + a); + } + else + a = '<a href="#">'+(i+1)+'</a>'; + + if (!a) + return; + var $a = $(a); + // don't reparent if anchor is in the dom + if ($a.parents('body').length === 0) { + var arr = []; + if ($p.length > 1) { + $p.each(function() { + var $clone = $a.clone(true); + $(this).append($clone); + arr.push($clone[0]); + }); + $a = $(arr); + } + else { + $a.appendTo($p); + } + } + + opts.pagerAnchors = opts.pagerAnchors || []; + opts.pagerAnchors.push($a); + + var pagerFn = function(e) { + e.preventDefault(); + opts.nextSlide = i; + var p = opts.$cont[0], timeout = p.cycleTimeout; + if (timeout) { + clearTimeout(timeout); + p.cycleTimeout = 0; + } + var cb = opts.onPagerEvent || opts.pagerClick; // pagerClick is deprecated + if ($.isFunction(cb)) + cb(opts.nextSlide, els[opts.nextSlide]); + go(els,opts,1,opts.currSlide < i); // trigger the trans +// return false; // <== allow bubble + } + + if ( /mouseenter|mouseover/i.test(opts.pagerEvent) ) { + $a.hover(pagerFn, function(){/* no-op */} ); + } + else { + $a.bind(opts.pagerEvent, pagerFn); + } + + if ( ! /^click/.test(opts.pagerEvent) && !opts.allowPagerClickBubble) + $a.bind('click.cycle', function(){return false;}); // suppress click + + var cont = opts.$cont[0]; + var pauseFlag = false; // https://github.com/malsup/cycle/issues/44 + if (opts.pauseOnPagerHover) { + $a.hover( + function() { + pauseFlag = true; + cont.cyclePause++; + triggerPause(cont,true,true); + }, function() { + pauseFlag && cont.cyclePause--; + triggerPause(cont,true,true); + } + ); + } +}; + +// helper fn to calculate the number of slides between the current and the next +$.fn.cycle.hopsFromLast = function(opts, fwd) { + var hops, l = opts.lastSlide, c = opts.currSlide; + if (fwd) + hops = c > l ? c - l : opts.slideCount - l; + else + hops = c < l ? l - c : l + opts.slideCount - c; + return hops; +}; + +// fix clearType problems in ie6 by setting an explicit bg color +// (otherwise text slides look horrible during a fade transition) +function clearTypeFix($slides) { + debug('applying clearType background-color hack'); + function hex(s) { + s = parseInt(s,10).toString(16); + return s.length < 2 ? '0'+s : s; + }; + function getBg(e) { + for ( ; e && e.nodeName.toLowerCase() != 'html'; e = e.parentNode) { + var v = $.css(e,'background-color'); + if (v && v.indexOf('rgb') >= 0 ) { + var rgb = v.match(/\d+/g); + return '#'+ hex(rgb[0]) + hex(rgb[1]) + hex(rgb[2]); + } + if (v && v != 'transparent') + return v; + } + return '#ffffff'; + }; + $slides.each(function() { $(this).css('background-color', getBg(this)); }); +}; + +// reset common props before the next transition +$.fn.cycle.commonReset = function(curr,next,opts,w,h,rev) { + $(opts.elements).not(curr).hide(); + if (typeof opts.cssBefore.opacity == 'undefined') + opts.cssBefore.opacity = 1; + opts.cssBefore.display = 'block'; + if (opts.slideResize && w !== false && next.cycleW > 0) + opts.cssBefore.width = next.cycleW; + if (opts.slideResize && h !== false && next.cycleH > 0) + opts.cssBefore.height = next.cycleH; + opts.cssAfter = opts.cssAfter || {}; + opts.cssAfter.display = 'none'; + $(curr).css('zIndex',opts.slideCount + (rev === true ? 1 : 0)); + $(next).css('zIndex',opts.slideCount + (rev === true ? 0 : 1)); +}; + +// the actual fn for effecting a transition +$.fn.cycle.custom = function(curr, next, opts, cb, fwd, speedOverride) { + var $l = $(curr), $n = $(next); + var speedIn = opts.speedIn, speedOut = opts.speedOut, easeIn = opts.easeIn, easeOut = opts.easeOut; + $n.css(opts.cssBefore); + if (speedOverride) { + if (typeof speedOverride == 'number') + speedIn = speedOut = speedOverride; + else + speedIn = speedOut = 1; + easeIn = easeOut = null; + } + var fn = function() { + $n.animate(opts.animIn, speedIn, easeIn, function() { + cb(); + }); + }; + $l.animate(opts.animOut, speedOut, easeOut, function() { + $l.css(opts.cssAfter); + if (!opts.sync) + fn(); + }); + if (opts.sync) fn(); +}; + +// transition definitions - only fade is defined here, transition pack defines the rest +$.fn.cycle.transitions = { + fade: function($cont, $slides, opts) { + $slides.not(':eq('+opts.currSlide+')').css('opacity',0); + opts.before.push(function(curr,next,opts) { + $.fn.cycle.commonReset(curr,next,opts); + opts.cssBefore.opacity = 0; + }); + opts.animIn = { opacity: 1 }; + opts.animOut = { opacity: 0 }; + opts.cssBefore = { top: 0, left: 0 }; + } +}; + +$.fn.cycle.ver = function() { return ver; }; + +// override these globally if you like (they are all optional) +$.fn.cycle.defaults = { + activePagerClass: 'activeSlide', // class name used for the active pager link + after: null, // transition callback (scope set to element that was shown): function(currSlideElement, nextSlideElement, options, forwardFlag) + allowPagerClickBubble: false, // allows or prevents click event on pager anchors from bubbling + animIn: null, // properties that define how the slide animates in + animOut: null, // properties that define how the slide animates out + aspect: false, // preserve aspect ratio during fit resizing, cropping if necessary (must be used with fit option) + autostop: 0, // true to end slideshow after X transitions (where X == slide count) + autostopCount: 0, // number of transitions (optionally used with autostop to define X) + backwards: false, // true to start slideshow at last slide and move backwards through the stack + before: null, // transition callback (scope set to element to be shown): function(currSlideElement, nextSlideElement, options, forwardFlag) + center: null, // set to true to have cycle add top/left margin to each slide (use with width and height options) + cleartype: !$.support.opacity, // true if clearType corrections should be applied (for IE) + cleartypeNoBg: false, // set to true to disable extra cleartype fixing (leave false to force background color setting on slides) + containerResize: 1, // resize container to fit largest slide + continuous: 0, // true to start next transition immediately after current one completes + cssAfter: null, // properties that defined the state of the slide after transitioning out + cssBefore: null, // properties that define the initial state of the slide before transitioning in + delay: 0, // additional delay (in ms) for first transition (hint: can be negative) + easeIn: null, // easing for "in" transition + easeOut: null, // easing for "out" transition + easing: null, // easing method for both in and out transitions + end: null, // callback invoked when the slideshow terminates (use with autostop or nowrap options): function(options) + fastOnEvent: 0, // force fast transitions when triggered manually (via pager or prev/next); value == time in ms + fit: 0, // force slides to fit container + fx: 'fade', // name of transition effect (or comma separated names, ex: 'fade,scrollUp,shuffle') + fxFn: null, // function used to control the transition: function(currSlideElement, nextSlideElement, options, afterCalback, forwardFlag) + height: 'auto', // container height (if the 'fit' option is true, the slides will be set to this height as well) + manualTrump: true, // causes manual transition to stop an active transition instead of being ignored + metaAttr: 'cycle',// data- attribute that holds the option data for the slideshow + next: null, // element, jQuery object, or jQuery selector string for the element to use as event trigger for next slide + nowrap: 0, // true to prevent slideshow from wrapping + onPagerEvent: null, // callback fn for pager events: function(zeroBasedSlideIndex, slideElement) + onPrevNextEvent: null,// callback fn for prev/next events: function(isNext, zeroBasedSlideIndex, slideElement) + pager: null, // element, jQuery object, or jQuery selector string for the element to use as pager container + pagerAnchorBuilder: null, // callback fn for building anchor links: function(index, DOMelement) + pagerEvent: 'click.cycle', // name of event which drives the pager navigation + pause: 0, // true to enable "pause on hover" + pauseOnPagerHover: 0, // true to pause when hovering over pager link + prev: null, // element, jQuery object, or jQuery selector string for the element to use as event trigger for previous slide + prevNextEvent:'click.cycle',// event which drives the manual transition to the previous or next slide + random: 0, // true for random, false for sequence (not applicable to shuffle fx) + randomizeEffects: 1, // valid when multiple effects are used; true to make the effect sequence random + requeueOnImageNotLoaded: true, // requeue the slideshow if any image slides are not yet loaded + requeueTimeout: 250, // ms delay for requeue + rev: 0, // causes animations to transition in reverse (for effects that support it such as scrollHorz/scrollVert/shuffle) + shuffle: null, // coords for shuffle animation, ex: { top:15, left: 200 } + skipInitializationCallbacks: false, // set to true to disable the first before/after callback that occurs prior to any transition + slideExpr: null, // expression for selecting slides (if something other than all children is required) + slideResize: 1, // force slide width/height to fixed size before every transition + speed: 1000, // speed of the transition (any valid fx speed value) + speedIn: null, // speed of the 'in' transition + speedOut: null, // speed of the 'out' transition + startingSlide: undefined, // zero-based index of the first slide to be displayed + sync: 1, // true if in/out transitions should occur simultaneously + timeout: 4000, // milliseconds between slide transitions (0 to disable auto advance) + timeoutFn: null, // callback for determining per-slide timeout value: function(currSlideElement, nextSlideElement, options, forwardFlag) + updateActivePagerLink: null, // callback fn invoked to update the active pager link (adds/removes activePagerClass style) + width: null // container width (if the 'fit' option is true, the slides will be set to this width as well) +}; + +})(jQuery); + + +/*! + * jQuery Cycle Plugin Transition Definitions + * This script is a plugin for the jQuery Cycle Plugin + * Examples and documentation at: http://malsup.com/jquery/cycle/ + * Copyright (c) 2007-2010 M. Alsup + * Version: 2.73 + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + */ +(function($) { + +// +// These functions define slide initialization and properties for the named +// transitions. To save file size feel free to remove any of these that you +// don't need. +// +$.fn.cycle.transitions.none = function($cont, $slides, opts) { + opts.fxFn = function(curr,next,opts,after){ + $(next).show(); + $(curr).hide(); + after(); + }; +}; + +// not a cross-fade, fadeout only fades out the top slide +$.fn.cycle.transitions.fadeout = function($cont, $slides, opts) { + $slides.not(':eq('+opts.currSlide+')').css({ display: 'block', 'opacity': 1 }); + opts.before.push(function(curr,next,opts,w,h,rev) { + $(curr).css('zIndex',opts.slideCount + (!rev === true ? 1 : 0)); + $(next).css('zIndex',opts.slideCount + (!rev === true ? 0 : 1)); + }); + opts.animIn.opacity = 1; + opts.animOut.opacity = 0; + opts.cssBefore.opacity = 1; + opts.cssBefore.display = 'block'; + opts.cssAfter.zIndex = 0; +}; + +// scrollUp/Down/Left/Right +$.fn.cycle.transitions.scrollUp = function($cont, $slides, opts) { + $cont.css('overflow','hidden'); + opts.before.push($.fn.cycle.commonReset); + var h = $cont.height(); + opts.cssBefore.top = h; + opts.cssBefore.left = 0; + opts.cssFirst.top = 0; + opts.animIn.top = 0; + opts.animOut.top = -h; +}; +$.fn.cycle.transitions.scrollDown = function($cont, $slides, opts) { + $cont.css('overflow','hidden'); + opts.before.push($.fn.cycle.commonReset); + var h = $cont.height(); + opts.cssFirst.top = 0; + opts.cssBefore.top = -h; + opts.cssBefore.left = 0; + opts.animIn.top = 0; + opts.animOut.top = h; +}; +$.fn.cycle.transitions.scrollLeft = function($cont, $slides, opts) { + $cont.css('overflow','hidden'); + opts.before.push($.fn.cycle.commonReset); + var w = $cont.width(); + opts.cssFirst.left = 0; + opts.cssBefore.left = w; + opts.cssBefore.top = 0; + opts.animIn.left = 0; + opts.animOut.left = 0-w; +}; +$.fn.cycle.transitions.scrollRight = function($cont, $slides, opts) { + $cont.css('overflow','hidden'); + opts.before.push($.fn.cycle.commonReset); + var w = $cont.width(); + opts.cssFirst.left = 0; + opts.cssBefore.left = -w; + opts.cssBefore.top = 0; + opts.animIn.left = 0; + opts.animOut.left = w; +}; +$.fn.cycle.transitions.scrollHorz = function($cont, $slides, opts) { + $cont.css('overflow','hidden').width(); + opts.before.push(function(curr, next, opts, fwd) { + if (opts.rev) + fwd = !fwd; + $.fn.cycle.commonReset(curr,next,opts); + opts.cssBefore.left = fwd ? (next.cycleW-1) : (1-next.cycleW); + opts.animOut.left = fwd ? -curr.cycleW : curr.cycleW; + }); + opts.cssFirst.left = 0; + opts.cssBefore.top = 0; + opts.animIn.left = 0; + opts.animOut.top = 0; +}; +$.fn.cycle.transitions.scrollVert = function($cont, $slides, opts) { + $cont.css('overflow','hidden'); + opts.before.push(function(curr, next, opts, fwd) { + if (opts.rev) + fwd = !fwd; + $.fn.cycle.commonReset(curr,next,opts); + opts.cssBefore.top = fwd ? (1-next.cycleH) : (next.cycleH-1); + opts.animOut.top = fwd ? curr.cycleH : -curr.cycleH; + }); + opts.cssFirst.top = 0; + opts.cssBefore.left = 0; + opts.animIn.top = 0; + opts.animOut.left = 0; +}; + +// slideX/slideY +$.fn.cycle.transitions.slideX = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $(opts.elements).not(curr).hide(); + $.fn.cycle.commonReset(curr,next,opts,false,true); + opts.animIn.width = next.cycleW; + }); + opts.cssBefore.left = 0; + opts.cssBefore.top = 0; + opts.cssBefore.width = 0; + opts.animIn.width = 'show'; + opts.animOut.width = 0; +}; +$.fn.cycle.transitions.slideY = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $(opts.elements).not(curr).hide(); + $.fn.cycle.commonReset(curr,next,opts,true,false); + opts.animIn.height = next.cycleH; + }); + opts.cssBefore.left = 0; + opts.cssBefore.top = 0; + opts.cssBefore.height = 0; + opts.animIn.height = 'show'; + opts.animOut.height = 0; +}; + +// shuffle +$.fn.cycle.transitions.shuffle = function($cont, $slides, opts) { + var i, w = $cont.css('overflow', 'visible').width(); + $slides.css({left: 0, top: 0}); + opts.before.push(function(curr,next,opts) { + $.fn.cycle.commonReset(curr,next,opts,true,true,true); + }); + // only adjust speed once! + if (!opts.speedAdjusted) { + opts.speed = opts.speed / 2; // shuffle has 2 transitions + opts.speedAdjusted = true; + } + opts.random = 0; + opts.shuffle = opts.shuffle || {left:-w, top:15}; + opts.els = []; + for (i=0; i < $slides.length; i++) + opts.els.push($slides[i]); + + for (i=0; i < opts.currSlide; i++) + opts.els.push(opts.els.shift()); + + // custom transition fn (hat tip to Benjamin Sterling for this bit of sweetness!) + opts.fxFn = function(curr, next, opts, cb, fwd) { + if (opts.rev) + fwd = !fwd; + var $el = fwd ? $(curr) : $(next); + $(next).css(opts.cssBefore); + var count = opts.slideCount; + $el.animate(opts.shuffle, opts.speedIn, opts.easeIn, function() { + var hops = $.fn.cycle.hopsFromLast(opts, fwd); + for (var k=0; k < hops; k++) + fwd ? opts.els.push(opts.els.shift()) : opts.els.unshift(opts.els.pop()); + if (fwd) { + for (var i=0, len=opts.els.length; i < len; i++) + $(opts.els[i]).css('z-index', len-i+count); + } + else { + var z = $(curr).css('z-index'); + $el.css('z-index', parseInt(z,10)+1+count); + } + $el.animate({left:0, top:0}, opts.speedOut, opts.easeOut, function() { + $(fwd ? this : curr).hide(); + if (cb) cb(); + }); + }); + }; + $.extend(opts.cssBefore, { display: 'block', opacity: 1, top: 0, left: 0 }); +}; + +// turnUp/Down/Left/Right +$.fn.cycle.transitions.turnUp = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,true,false); + opts.cssBefore.top = next.cycleH; + opts.animIn.height = next.cycleH; + opts.animOut.width = next.cycleW; + }); + opts.cssFirst.top = 0; + opts.cssBefore.left = 0; + opts.cssBefore.height = 0; + opts.animIn.top = 0; + opts.animOut.height = 0; +}; +$.fn.cycle.transitions.turnDown = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,true,false); + opts.animIn.height = next.cycleH; + opts.animOut.top = curr.cycleH; + }); + opts.cssFirst.top = 0; + opts.cssBefore.left = 0; + opts.cssBefore.top = 0; + opts.cssBefore.height = 0; + opts.animOut.height = 0; +}; +$.fn.cycle.transitions.turnLeft = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,false,true); + opts.cssBefore.left = next.cycleW; + opts.animIn.width = next.cycleW; + }); + opts.cssBefore.top = 0; + opts.cssBefore.width = 0; + opts.animIn.left = 0; + opts.animOut.width = 0; +}; +$.fn.cycle.transitions.turnRight = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,false,true); + opts.animIn.width = next.cycleW; + opts.animOut.left = curr.cycleW; + }); + $.extend(opts.cssBefore, { top: 0, left: 0, width: 0 }); + opts.animIn.left = 0; + opts.animOut.width = 0; +}; + +// zoom +$.fn.cycle.transitions.zoom = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,false,false,true); + opts.cssBefore.top = next.cycleH/2; + opts.cssBefore.left = next.cycleW/2; + $.extend(opts.animIn, { top: 0, left: 0, width: next.cycleW, height: next.cycleH }); + $.extend(opts.animOut, { width: 0, height: 0, top: curr.cycleH/2, left: curr.cycleW/2 }); + }); + opts.cssFirst.top = 0; + opts.cssFirst.left = 0; + opts.cssBefore.width = 0; + opts.cssBefore.height = 0; +}; + +// fadeZoom +$.fn.cycle.transitions.fadeZoom = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,false,false); + opts.cssBefore.left = next.cycleW/2; + opts.cssBefore.top = next.cycleH/2; + $.extend(opts.animIn, { top: 0, left: 0, width: next.cycleW, height: next.cycleH }); + }); + opts.cssBefore.width = 0; + opts.cssBefore.height = 0; + opts.animOut.opacity = 0; +}; + +// blindX +$.fn.cycle.transitions.blindX = function($cont, $slides, opts) { + var w = $cont.css('overflow','hidden').width(); + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts); + opts.animIn.width = next.cycleW; + opts.animOut.left = curr.cycleW; + }); + opts.cssBefore.left = w; + opts.cssBefore.top = 0; + opts.animIn.left = 0; + opts.animOut.left = w; +}; +// blindY +$.fn.cycle.transitions.blindY = function($cont, $slides, opts) { + var h = $cont.css('overflow','hidden').height(); + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts); + opts.animIn.height = next.cycleH; + opts.animOut.top = curr.cycleH; + }); + opts.cssBefore.top = h; + opts.cssBefore.left = 0; + opts.animIn.top = 0; + opts.animOut.top = h; +}; +// blindZ +$.fn.cycle.transitions.blindZ = function($cont, $slides, opts) { + var h = $cont.css('overflow','hidden').height(); + var w = $cont.width(); + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts); + opts.animIn.height = next.cycleH; + opts.animOut.top = curr.cycleH; + }); + opts.cssBefore.top = h; + opts.cssBefore.left = w; + opts.animIn.top = 0; + opts.animIn.left = 0; + opts.animOut.top = h; + opts.animOut.left = w; +}; + +// growX - grow horizontally from centered 0 width +$.fn.cycle.transitions.growX = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,false,true); + opts.cssBefore.left = this.cycleW/2; + opts.animIn.left = 0; + opts.animIn.width = this.cycleW; + opts.animOut.left = 0; + }); + opts.cssBefore.top = 0; + opts.cssBefore.width = 0; +}; +// growY - grow vertically from centered 0 height +$.fn.cycle.transitions.growY = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,true,false); + opts.cssBefore.top = this.cycleH/2; + opts.animIn.top = 0; + opts.animIn.height = this.cycleH; + opts.animOut.top = 0; + }); + opts.cssBefore.height = 0; + opts.cssBefore.left = 0; +}; + +// curtainX - squeeze in both edges horizontally +$.fn.cycle.transitions.curtainX = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,false,true,true); + opts.cssBefore.left = next.cycleW/2; + opts.animIn.left = 0; + opts.animIn.width = this.cycleW; + opts.animOut.left = curr.cycleW/2; + opts.animOut.width = 0; + }); + opts.cssBefore.top = 0; + opts.cssBefore.width = 0; +}; +// curtainY - squeeze in both edges vertically +$.fn.cycle.transitions.curtainY = function($cont, $slides, opts) { + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,true,false,true); + opts.cssBefore.top = next.cycleH/2; + opts.animIn.top = 0; + opts.animIn.height = next.cycleH; + opts.animOut.top = curr.cycleH/2; + opts.animOut.height = 0; + }); + opts.cssBefore.height = 0; + opts.cssBefore.left = 0; +}; + +// cover - curr slide covered by next slide +$.fn.cycle.transitions.cover = function($cont, $slides, opts) { + var d = opts.direction || 'left'; + var w = $cont.css('overflow','hidden').width(); + var h = $cont.height(); + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts); + if (d == 'right') + opts.cssBefore.left = -w; + else if (d == 'up') + opts.cssBefore.top = h; + else if (d == 'down') + opts.cssBefore.top = -h; + else + opts.cssBefore.left = w; + }); + opts.animIn.left = 0; + opts.animIn.top = 0; + opts.cssBefore.top = 0; + opts.cssBefore.left = 0; +}; + +// uncover - curr slide moves off next slide +$.fn.cycle.transitions.uncover = function($cont, $slides, opts) { + var d = opts.direction || 'left'; + var w = $cont.css('overflow','hidden').width(); + var h = $cont.height(); + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,true,true,true); + if (d == 'right') + opts.animOut.left = w; + else if (d == 'up') + opts.animOut.top = -h; + else if (d == 'down') + opts.animOut.top = h; + else + opts.animOut.left = -w; + }); + opts.animIn.left = 0; + opts.animIn.top = 0; + opts.cssBefore.top = 0; + opts.cssBefore.left = 0; +}; + +// toss - move top slide and fade away +$.fn.cycle.transitions.toss = function($cont, $slides, opts) { + var w = $cont.css('overflow','visible').width(); + var h = $cont.height(); + opts.before.push(function(curr, next, opts) { + $.fn.cycle.commonReset(curr,next,opts,true,true,true); + // provide default toss settings if animOut not provided + if (!opts.animOut.left && !opts.animOut.top) + $.extend(opts.animOut, { left: w*2, top: -h/2, opacity: 0 }); + else + opts.animOut.opacity = 0; + }); + opts.cssBefore.left = 0; + opts.cssBefore.top = 0; + opts.animIn.left = 0; +}; + +// wipe - clip animation +$.fn.cycle.transitions.wipe = function($cont, $slides, opts) { + var w = $cont.css('overflow','hidden').width(); + var h = $cont.height(); + opts.cssBefore = opts.cssBefore || {}; + var clip; + if (opts.clip) { + if (/l2r/.test(opts.clip)) + clip = 'rect(0px 0px '+h+'px 0px)'; + else if (/r2l/.test(opts.clip)) + clip = 'rect(0px '+w+'px '+h+'px '+w+'px)'; + else if (/t2b/.test(opts.clip)) + clip = 'rect(0px '+w+'px 0px 0px)'; + else if (/b2t/.test(opts.clip)) + clip = 'rect('+h+'px '+w+'px '+h+'px 0px)'; + else if (/zoom/.test(opts.clip)) { + var top = parseInt(h/2,10); + var left = parseInt(w/2,10); + clip = 'rect('+top+'px '+left+'px '+top+'px '+left+'px)'; + } + } + + opts.cssBefore.clip = opts.cssBefore.clip || clip || 'rect(0px 0px 0px 0px)'; + + var d = opts.cssBefore.clip.match(/(\d+)/g); + var t = parseInt(d[0],10), r = parseInt(d[1],10), b = parseInt(d[2],10), l = parseInt(d[3],10); + + opts.before.push(function(curr, next, opts) { + if (curr == next) return; + var $curr = $(curr), $next = $(next); + $.fn.cycle.commonReset(curr,next,opts,true,true,false); + opts.cssAfter.display = 'block'; + + var step = 1, count = parseInt((opts.speedIn / 13),10) - 1; + (function f() { + var tt = t ? t - parseInt(step * (t/count),10) : 0; + var ll = l ? l - parseInt(step * (l/count),10) : 0; + var bb = b < h ? b + parseInt(step * ((h-b)/count || 1),10) : h; + var rr = r < w ? r + parseInt(step * ((w-r)/count || 1),10) : w; + $next.css({ clip: 'rect('+tt+'px '+rr+'px '+bb+'px '+ll+'px)' }); + (step++ <= count) ? setTimeout(f, 13) : $curr.css('display', 'none'); + })(); + }); + $.extend(opts.cssBefore, { display: 'block', opacity: 1, top: 0, left: 0 }); + opts.animIn = { left: 0 }; + opts.animOut = { left: 0 }; +}; + +})(jQuery); diff --git a/resources/lib/jquery/jquery.form.js b/resources/lib/jquery/jquery.form.js new file mode 100644 index 000000000000..13e9a55c5836 --- /dev/null +++ b/resources/lib/jquery/jquery.form.js @@ -0,0 +1,1089 @@ +/*! + * jQuery Form Plugin + * version: 3.14 (30-JUL-2012) + * @requires jQuery v1.3.2 or later + * + * Examples and documentation at: http://malsup.com/jquery/form/ + * Project repository: https://github.com/malsup/form + * Dual licensed under the MIT and GPL licenses: + * http://malsup.github.com/mit-license.txt + * http://malsup.github.com/gpl-license-v2.txt + */ +/*global ActiveXObject alert */ +;(function($) { +"use strict"; + +/* + Usage Note: + ----------- + Do not use both ajaxSubmit and ajaxForm on the same form. These + functions are mutually exclusive. Use ajaxSubmit if you want + to bind your own submit handler to the form. For example, + + $(document).ready(function() { + $('#myForm').on('submit', function(e) { + e.preventDefault(); // <-- important + $(this).ajaxSubmit({ + target: '#output' + }); + }); + }); + + Use ajaxForm when you want the plugin to manage all the event binding + for you. For example, + + $(document).ready(function() { + $('#myForm').ajaxForm({ + target: '#output' + }); + }); + + You can also use ajaxForm with delegation (requires jQuery v1.7+), so the + form does not have to exist when you invoke ajaxForm: + + $('#myForm').ajaxForm({ + delegation: true, + target: '#output' + }); + + When using ajaxForm, the ajaxSubmit function will be invoked for you + at the appropriate time. +*/ + +/** + * Feature detection + */ +var feature = {}; +feature.fileapi = $("<input type='file'/>").get(0).files !== undefined; +feature.formdata = window.FormData !== undefined; + +/** + * ajaxSubmit() provides a mechanism for immediately submitting + * an HTML form using AJAX. + */ +$.fn.ajaxSubmit = function(options) { + /*jshint scripturl:true */ + + // fast fail if nothing selected (http://dev.jquery.com/ticket/2752) + if (!this.length) { + log('ajaxSubmit: skipping submit process - no element selected'); + return this; + } + + var method, action, url, $form = this; + + if (typeof options == 'function') { + options = { success: options }; + } + + method = this.attr('method'); + action = this.attr('action'); + url = (typeof action === 'string') ? $.trim(action) : ''; + url = url || window.location.href || ''; + if (url) { + // clean url (don't include hash vaue) + url = (url.match(/^([^#]+)/)||[])[1]; + } + + options = $.extend(true, { + url: url, + success: $.ajaxSettings.success, + type: method || 'GET', + iframeSrc: /^https/i.test(window.location.href || '') ? 'javascript:false' : 'about:blank' + }, options); + + // hook for manipulating the form data before it is extracted; + // convenient for use with rich editors like tinyMCE or FCKEditor + var veto = {}; + this.trigger('form-pre-serialize', [this, options, veto]); + if (veto.veto) { + log('ajaxSubmit: submit vetoed via form-pre-serialize trigger'); + return this; + } + + // provide opportunity to alter form data before it is serialized + if (options.beforeSerialize && options.beforeSerialize(this, options) === false) { + log('ajaxSubmit: submit aborted via beforeSerialize callback'); + return this; + } + + var traditional = options.traditional; + if ( traditional === undefined ) { + traditional = $.ajaxSettings.traditional; + } + + var elements = []; + var qx, a = this.formToArray(options.semantic, elements); + if (options.data) { + options.extraData = options.data; + qx = $.param(options.data, traditional); + } + + // give pre-submit callback an opportunity to abort the submit + if (options.beforeSubmit && options.beforeSubmit(a, this, options) === false) { + log('ajaxSubmit: submit aborted via beforeSubmit callback'); + return this; + } + + // fire vetoable 'validate' event + this.trigger('form-submit-validate', [a, this, options, veto]); + if (veto.veto) { + log('ajaxSubmit: submit vetoed via form-submit-validate trigger'); + return this; + } + + var q = $.param(a, traditional); + if (qx) { + q = ( q ? (q + '&' + qx) : qx ); + } + if (options.type.toUpperCase() == 'GET') { + options.url += (options.url.indexOf('?') >= 0 ? '&' : '?') + q; + options.data = null; // data is null for 'get' + } + else { + options.data = q; // data is the query string for 'post' + } + + var callbacks = []; + if (options.resetForm) { + callbacks.push(function() { $form.resetForm(); }); + } + if (options.clearForm) { + callbacks.push(function() { $form.clearForm(options.includeHidden); }); + } + + // perform a load on the target only if dataType is not provided + if (!options.dataType && options.target) { + var oldSuccess = options.success || function(){}; + callbacks.push(function(data) { + var fn = options.replaceTarget ? 'replaceWith' : 'html'; + $(options.target)[fn](data).each(oldSuccess, arguments); + }); + } + else if (options.success) { + callbacks.push(options.success); + } + + options.success = function(data, status, xhr) { // jQuery 1.4+ passes xhr as 3rd arg + var context = options.context || this ; // jQuery 1.4+ supports scope context + for (var i=0, max=callbacks.length; i < max; i++) { + callbacks[i].apply(context, [data, status, xhr || $form, $form]); + } + }; + + // are there files to upload? + var fileInputs = $('input:file:enabled[value]', this); // [value] (issue #113) + var hasFileInputs = fileInputs.length > 0; + var mp = 'multipart/form-data'; + var multipart = ($form.attr('enctype') == mp || $form.attr('encoding') == mp); + + var fileAPI = feature.fileapi && feature.formdata; + log("fileAPI :" + fileAPI); + var shouldUseFrame = (hasFileInputs || multipart) && !fileAPI; + + // options.iframe allows user to force iframe mode + // 06-NOV-09: now defaulting to iframe mode if file input is detected + if (options.iframe !== false && (options.iframe || shouldUseFrame)) { + // hack to fix Safari hang (thanks to Tim Molendijk for this) + // see: http://groups.google.com/group/jquery-dev/browse_thread/thread/36395b7ab510dd5d + if (options.closeKeepAlive) { + $.get(options.closeKeepAlive, function() { + fileUploadIframe(a); + }); + } + else { + fileUploadIframe(a); + } + } + else if ((hasFileInputs || multipart) && fileAPI) { + fileUploadXhr(a); + } + else { + $.ajax(options); + } + + // clear element array + for (var k=0; k < elements.length; k++) + elements[k] = null; + + // fire 'notify' event + this.trigger('form-submit-notify', [this, options]); + return this; + + // XMLHttpRequest Level 2 file uploads (big hat tip to francois2metz) + function fileUploadXhr(a) { + var formdata = new FormData(); + + for (var i=0; i < a.length; i++) { + formdata.append(a[i].name, a[i].value); + } + + if (options.extraData) { + for (var p in options.extraData) + if (options.extraData.hasOwnProperty(p)) + formdata.append(p, options.extraData[p]); + } + + options.data = null; + + var s = $.extend(true, {}, $.ajaxSettings, options, { + contentType: false, + processData: false, + cache: false, + type: 'POST' + }); + + if (options.uploadProgress) { + // workaround because jqXHR does not expose upload property + s.xhr = function() { + var xhr = jQuery.ajaxSettings.xhr(); + if (xhr.upload) { + xhr.upload.onprogress = function(event) { + var percent = 0; + var position = event.loaded || event.position; /*event.position is deprecated*/ + var total = event.total; + if (event.lengthComputable) { + percent = Math.ceil(position / total * 100); + } + options.uploadProgress(event, position, total, percent); + }; + } + return xhr; + }; + } + + s.data = null; + var beforeSend = s.beforeSend; + s.beforeSend = function(xhr, o) { + o.data = formdata; + if(beforeSend) + beforeSend.call(this, xhr, o); + }; + $.ajax(s); + } + + // private function for handling file uploads (hat tip to YAHOO!) + function fileUploadIframe(a) { + var form = $form[0], el, i, s, g, id, $io, io, xhr, sub, n, timedOut, timeoutHandle; + var useProp = !!$.fn.prop; + + if ($(':input[name=submit],:input[id=submit]', form).length) { + // if there is an input with a name or id of 'submit' then we won't be + // able to invoke the submit fn on the form (at least not x-browser) + alert('Error: Form elements must not have name or id of "submit".'); + return; + } + + if (a) { + // ensure that every serialized input is still enabled + for (i=0; i < elements.length; i++) { + el = $(elements[i]); + if ( useProp ) + el.prop('disabled', false); + else + el.removeAttr('disabled'); + } + } + + s = $.extend(true, {}, $.ajaxSettings, options); + s.context = s.context || s; + id = 'jqFormIO' + (new Date().getTime()); + if (s.iframeTarget) { + $io = $(s.iframeTarget); + n = $io.attr('name'); + if (!n) + $io.attr('name', id); + else + id = n; + } + else { + $io = $('<iframe name="' + id + '" src="'+ s.iframeSrc +'" />'); + $io.css({ position: 'absolute', top: '-1000px', left: '-1000px' }); + } + io = $io[0]; + + + xhr = { // mock object + aborted: 0, + responseText: null, + responseXML: null, + status: 0, + statusText: 'n/a', + getAllResponseHeaders: function() {}, + getResponseHeader: function() {}, + setRequestHeader: function() {}, + abort: function(status) { + var e = (status === 'timeout' ? 'timeout' : 'aborted'); + log('aborting upload... ' + e); + this.aborted = 1; + // #214 + if (io.contentWindow.document.execCommand) { + try { // #214 + io.contentWindow.document.execCommand('Stop'); + } catch(ignore) {} + } + $io.attr('src', s.iframeSrc); // abort op in progress + xhr.error = e; + if (s.error) + s.error.call(s.context, xhr, e, status); + if (g) + $.event.trigger("ajaxError", [xhr, s, e]); + if (s.complete) + s.complete.call(s.context, xhr, e); + } + }; + + g = s.global; + // trigger ajax global events so that activity/block indicators work like normal + if (g && 0 === $.active++) { + $.event.trigger("ajaxStart"); + } + if (g) { + $.event.trigger("ajaxSend", [xhr, s]); + } + + if (s.beforeSend && s.beforeSend.call(s.context, xhr, s) === false) { + if (s.global) { + $.active--; + } + return; + } + if (xhr.aborted) { + return; + } + + // add submitting element to data if we know it + sub = form.clk; + if (sub) { + n = sub.name; + if (n && !sub.disabled) { + s.extraData = s.extraData || {}; + s.extraData[n] = sub.value; + if (sub.type == "image") { + s.extraData[n+'.x'] = form.clk_x; + s.extraData[n+'.y'] = form.clk_y; + } + } + } + + var CLIENT_TIMEOUT_ABORT = 1; + var SERVER_ABORT = 2; + + function getDoc(frame) { + var doc = frame.contentWindow ? frame.contentWindow.document : frame.contentDocument ? frame.contentDocument : frame.document; + return doc; + } + + // Rails CSRF hack (thanks to Yvan Barthelemy) + var csrf_token = $('meta[name=csrf-token]').attr('content'); + var csrf_param = $('meta[name=csrf-param]').attr('content'); + if (csrf_param && csrf_token) { + s.extraData = s.extraData || {}; + s.extraData[csrf_param] = csrf_token; + } + + // take a breath so that pending repaints get some cpu time before the upload starts + function doSubmit() { + // make sure form attrs are set + var t = $form.attr('target'), a = $form.attr('action'); + + // update form attrs in IE friendly way + form.setAttribute('target',id); + if (!method) { + form.setAttribute('method', 'POST'); + } + if (a != s.url) { + form.setAttribute('action', s.url); + } + + // ie borks in some cases when setting encoding + if (! s.skipEncodingOverride && (!method || /post/i.test(method))) { + $form.attr({ + encoding: 'multipart/form-data', + enctype: 'multipart/form-data' + }); + } + + // support timout + if (s.timeout) { + timeoutHandle = setTimeout(function() { timedOut = true; cb(CLIENT_TIMEOUT_ABORT); }, s.timeout); + } + + // look for server aborts + function checkState() { + try { + var state = getDoc(io).readyState; + log('state = ' + state); + if (state && state.toLowerCase() == 'uninitialized') + setTimeout(checkState,50); + } + catch(e) { + log('Server abort: ' , e, ' (', e.name, ')'); + cb(SERVER_ABORT); + if (timeoutHandle) + clearTimeout(timeoutHandle); + timeoutHandle = undefined; + } + } + + // add "extra" data to form if provided in options + var extraInputs = []; + try { + if (s.extraData) { + for (var n in s.extraData) { + if (s.extraData.hasOwnProperty(n)) { + // if using the $.param format that allows for multiple values with the same name + if($.isPlainObject(s.extraData[n]) && s.extraData[n].hasOwnProperty('name') && s.extraData[n].hasOwnProperty('value')) { + extraInputs.push( + $('<input type="hidden" name="'+s.extraData[n].name+'">').attr('value',s.extraData[n].value) + .appendTo(form)[0]); + } else { + extraInputs.push( + $('<input type="hidden" name="'+n+'">').attr('value',s.extraData[n]) + .appendTo(form)[0]); + } + } + } + } + + if (!s.iframeTarget) { + // add iframe to doc and submit the form + $io.appendTo('body'); + if (io.attachEvent) + io.attachEvent('onload', cb); + else + io.addEventListener('load', cb, false); + } + setTimeout(checkState,15); + form.submit(); + } + finally { + // reset attrs and remove "extra" input elements + form.setAttribute('action',a); + if(t) { + form.setAttribute('target', t); + } else { + $form.removeAttr('target'); + } + $(extraInputs).remove(); + } + } + + if (s.forceSync) { + doSubmit(); + } + else { + setTimeout(doSubmit, 10); // this lets dom updates render + } + + var data, doc, domCheckCount = 50, callbackProcessed; + + function cb(e) { + if (xhr.aborted || callbackProcessed) { + return; + } + try { + doc = getDoc(io); + } + catch(ex) { + log('cannot access response document: ', ex); + e = SERVER_ABORT; + } + if (e === CLIENT_TIMEOUT_ABORT && xhr) { + xhr.abort('timeout'); + return; + } + else if (e == SERVER_ABORT && xhr) { + xhr.abort('server abort'); + return; + } + + if (!doc || doc.location.href == s.iframeSrc) { + // response not received yet + if (!timedOut) + return; + } + if (io.detachEvent) + io.detachEvent('onload', cb); + else + io.removeEventListener('load', cb, false); + + var status = 'success', errMsg; + try { + if (timedOut) { + throw 'timeout'; + } + + var isXml = s.dataType == 'xml' || doc.XMLDocument || $.isXMLDoc(doc); + log('isXml='+isXml); + if (!isXml && window.opera && (doc.body === null || !doc.body.innerHTML)) { + if (--domCheckCount) { + // in some browsers (Opera) the iframe DOM is not always traversable when + // the onload callback fires, so we loop a bit to accommodate + log('requeing onLoad callback, DOM not available'); + setTimeout(cb, 250); + return; + } + // let this fall through because server response could be an empty document + //log('Could not access iframe DOM after mutiple tries.'); + //throw 'DOMException: not available'; + } + + //log('response detected'); + var docRoot = doc.body ? doc.body : doc.documentElement; + xhr.responseText = docRoot ? docRoot.innerHTML : null; + xhr.responseXML = doc.XMLDocument ? doc.XMLDocument : doc; + if (isXml) + s.dataType = 'xml'; + xhr.getResponseHeader = function(header){ + var headers = {'content-type': s.dataType}; + return headers[header]; + }; + // support for XHR 'status' & 'statusText' emulation : + if (docRoot) { + xhr.status = Number( docRoot.getAttribute('status') ) || xhr.status; + xhr.statusText = docRoot.getAttribute('statusText') || xhr.statusText; + } + + var dt = (s.dataType || '').toLowerCase(); + var scr = /(json|script|text)/.test(dt); + if (scr || s.textarea) { + // see if user embedded response in textarea + var ta = doc.getElementsByTagName('textarea')[0]; + if (ta) { + xhr.responseText = ta.value; + // support for XHR 'status' & 'statusText' emulation : + xhr.status = Number( ta.getAttribute('status') ) || xhr.status; + xhr.statusText = ta.getAttribute('statusText') || xhr.statusText; + } + else if (scr) { + // account for browsers injecting pre around json response + var pre = doc.getElementsByTagName('pre')[0]; + var b = doc.getElementsByTagName('body')[0]; + if (pre) { + xhr.responseText = pre.textContent ? pre.textContent : pre.innerText; + } + else if (b) { + xhr.responseText = b.textContent ? b.textContent : b.innerText; + } + } + } + else if (dt == 'xml' && !xhr.responseXML && xhr.responseText) { + xhr.responseXML = toXml(xhr.responseText); + } + + try { + data = httpData(xhr, dt, s); + } + catch (e) { + status = 'parsererror'; + xhr.error = errMsg = (e || status); + } + } + catch (e) { + log('error caught: ',e); + status = 'error'; + xhr.error = errMsg = (e || status); + } + + if (xhr.aborted) { + log('upload aborted'); + status = null; + } + + if (xhr.status) { // we've set xhr.status + status = (xhr.status >= 200 && xhr.status < 300 || xhr.status === 304) ? 'success' : 'error'; + } + + // ordering of these callbacks/triggers is odd, but that's how $.ajax does it + if (status === 'success') { + if (s.success) + s.success.call(s.context, data, 'success', xhr); + if (g) + $.event.trigger("ajaxSuccess", [xhr, s]); + } + else if (status) { + if (errMsg === undefined) + errMsg = xhr.statusText; + if (s.error) + s.error.call(s.context, xhr, status, errMsg); + if (g) + $.event.trigger("ajaxError", [xhr, s, errMsg]); + } + + if (g) + $.event.trigger("ajaxComplete", [xhr, s]); + + if (g && ! --$.active) { + $.event.trigger("ajaxStop"); + } + + if (s.complete) + s.complete.call(s.context, xhr, status); + + callbackProcessed = true; + if (s.timeout) + clearTimeout(timeoutHandle); + + // clean up + setTimeout(function() { + if (!s.iframeTarget) + $io.remove(); + xhr.responseXML = null; + }, 100); + } + + var toXml = $.parseXML || function(s, doc) { // use parseXML if available (jQuery 1.5+) + if (window.ActiveXObject) { + doc = new ActiveXObject('Microsoft.XMLDOM'); + doc.async = 'false'; + doc.loadXML(s); + } + else { + doc = (new DOMParser()).parseFromString(s, 'text/xml'); + } + return (doc && doc.documentElement && doc.documentElement.nodeName != 'parsererror') ? doc : null; + }; + var parseJSON = $.parseJSON || function(s) { + /*jslint evil:true */ + return window['eval']('(' + s + ')'); + }; + + var httpData = function( xhr, type, s ) { // mostly lifted from jq1.4.4 + + var ct = xhr.getResponseHeader('content-type') || '', + xml = type === 'xml' || !type && ct.indexOf('xml') >= 0, + data = xml ? xhr.responseXML : xhr.responseText; + + if (xml && data.documentElement.nodeName === 'parsererror') { + if ($.error) + $.error('parsererror'); + } + if (s && s.dataFilter) { + data = s.dataFilter(data, type); + } + if (typeof data === 'string') { + if (type === 'json' || !type && ct.indexOf('json') >= 0) { + data = parseJSON(data); + } else if (type === "script" || !type && ct.indexOf("javascript") >= 0) { + $.globalEval(data); + } + } + return data; + }; + } +}; + +/** + * ajaxForm() provides a mechanism for fully automating form submission. + * + * The advantages of using this method instead of ajaxSubmit() are: + * + * 1: This method will include coordinates for <input type="image" /> elements (if the element + * is used to submit the form). + * 2. This method will include the submit element's name/value data (for the element that was + * used to submit the form). + * 3. This method binds the submit() method to the form for you. + * + * The options argument for ajaxForm works exactly as it does for ajaxSubmit. ajaxForm merely + * passes the options argument along after properly binding events for submit elements and + * the form itself. + */ +$.fn.ajaxForm = function(options) { + options = options || {}; + options.delegation = options.delegation && $.isFunction($.fn.on); + + // in jQuery 1.3+ we can fix mistakes with the ready state + if (!options.delegation && this.length === 0) { + var o = { s: this.selector, c: this.context }; + if (!$.isReady && o.s) { + log('DOM not ready, queuing ajaxForm'); + $(function() { + $(o.s,o.c).ajaxForm(options); + }); + return this; + } + // is your DOM ready? http://docs.jquery.com/Tutorials:Introducing_$(document).ready() + log('terminating; zero elements found by selector' + ($.isReady ? '' : ' (DOM not ready)')); + return this; + } + + if ( options.delegation ) { + $(document) + .off('submit.form-plugin', this.selector, doAjaxSubmit) + .off('click.form-plugin', this.selector, captureSubmittingElement) + .on('submit.form-plugin', this.selector, options, doAjaxSubmit) + .on('click.form-plugin', this.selector, options, captureSubmittingElement); + return this; + } + + return this.ajaxFormUnbind() + .bind('submit.form-plugin', options, doAjaxSubmit) + .bind('click.form-plugin', options, captureSubmittingElement); +}; + +// private event handlers +function doAjaxSubmit(e) { + /*jshint validthis:true */ + var options = e.data; + if (!e.isDefaultPrevented()) { // if event has been canceled, don't proceed + e.preventDefault(); + $(this).ajaxSubmit(options); + } +} + +function captureSubmittingElement(e) { + /*jshint validthis:true */ + var target = e.target; + var $el = $(target); + if (!($el.is(":submit,input:image"))) { + // is this a child element of the submit el? (ex: a span within a button) + var t = $el.closest(':submit'); + if (t.length === 0) { + return; + } + target = t[0]; + } + var form = this; + form.clk = target; + if (target.type == 'image') { + if (e.offsetX !== undefined) { + form.clk_x = e.offsetX; + form.clk_y = e.offsetY; + } else if (typeof $.fn.offset == 'function') { + var offset = $el.offset(); + form.clk_x = e.pageX - offset.left; + form.clk_y = e.pageY - offset.top; + } else { + form.clk_x = e.pageX - target.offsetLeft; + form.clk_y = e.pageY - target.offsetTop; + } + } + // clear form vars + setTimeout(function() { form.clk = form.clk_x = form.clk_y = null; }, 100); +} + + +// ajaxFormUnbind unbinds the event handlers that were bound by ajaxForm +$.fn.ajaxFormUnbind = function() { + return this.unbind('submit.form-plugin click.form-plugin'); +}; + +/** + * formToArray() gathers form element data into an array of objects that can + * be passed to any of the following ajax functions: $.get, $.post, or load. + * Each object in the array has both a 'name' and 'value' property. An example of + * an array for a simple login form might be: + * + * [ { name: 'username', value: 'jresig' }, { name: 'password', value: 'secret' } ] + * + * It is this array that is passed to pre-submit callback functions provided to the + * ajaxSubmit() and ajaxForm() methods. + */ +$.fn.formToArray = function(semantic, elements) { + var a = []; + if (this.length === 0) { + return a; + } + + var form = this[0]; + var els = semantic ? form.getElementsByTagName('*') : form.elements; + if (!els) { + return a; + } + + var i,j,n,v,el,max,jmax; + for(i=0, max=els.length; i < max; i++) { + el = els[i]; + n = el.name; + if (!n) { + continue; + } + + if (semantic && form.clk && el.type == "image") { + // handle image inputs on the fly when semantic == true + if(!el.disabled && form.clk == el) { + a.push({name: n, value: $(el).val(), type: el.type }); + a.push({name: n+'.x', value: form.clk_x}, {name: n+'.y', value: form.clk_y}); + } + continue; + } + + v = $.fieldValue(el, true); + if (v && v.constructor == Array) { + if (elements) + elements.push(el); + for(j=0, jmax=v.length; j < jmax; j++) { + a.push({name: n, value: v[j]}); + } + } + else if (feature.fileapi && el.type == 'file' && !el.disabled) { + if (elements) + elements.push(el); + var files = el.files; + if (files.length) { + for (j=0; j < files.length; j++) { + a.push({name: n, value: files[j], type: el.type}); + } + } + else { + // #180 + a.push({ name: n, value: '', type: el.type }); + } + } + else if (v !== null && typeof v != 'undefined') { + if (elements) + elements.push(el); + a.push({name: n, value: v, type: el.type, required: el.required}); + } + } + + if (!semantic && form.clk) { + // input type=='image' are not found in elements array! handle it here + var $input = $(form.clk), input = $input[0]; + n = input.name; + if (n && !input.disabled && input.type == 'image') { + a.push({name: n, value: $input.val()}); + a.push({name: n+'.x', value: form.clk_x}, {name: n+'.y', value: form.clk_y}); + } + } + return a; +}; + +/** + * Serializes form data into a 'submittable' string. This method will return a string + * in the format: name1=value1&name2=value2 + */ +$.fn.formSerialize = function(semantic) { + //hand off to jQuery.param for proper encoding + return $.param(this.formToArray(semantic)); +}; + +/** + * Serializes all field elements in the jQuery object into a query string. + * This method will return a string in the format: name1=value1&name2=value2 + */ +$.fn.fieldSerialize = function(successful) { + var a = []; + this.each(function() { + var n = this.name; + if (!n) { + return; + } + var v = $.fieldValue(this, successful); + if (v && v.constructor == Array) { + for (var i=0,max=v.length; i < max; i++) { + a.push({name: n, value: v[i]}); + } + } + else if (v !== null && typeof v != 'undefined') { + a.push({name: this.name, value: v}); + } + }); + //hand off to jQuery.param for proper encoding + return $.param(a); +}; + +/** + * Returns the value(s) of the element in the matched set. For example, consider the following form: + * + * <form><fieldset> + * <input name="A" type="text" /> + * <input name="A" type="text" /> + * <input name="B" type="checkbox" value="B1" /> + * <input name="B" type="checkbox" value="B2"/> + * <input name="C" type="radio" value="C1" /> + * <input name="C" type="radio" value="C2" /> + * </fieldset></form> + * + * var v = $(':text').fieldValue(); + * // if no values are entered into the text inputs + * v == ['',''] + * // if values entered into the text inputs are 'foo' and 'bar' + * v == ['foo','bar'] + * + * var v = $(':checkbox').fieldValue(); + * // if neither checkbox is checked + * v === undefined + * // if both checkboxes are checked + * v == ['B1', 'B2'] + * + * var v = $(':radio').fieldValue(); + * // if neither radio is checked + * v === undefined + * // if first radio is checked + * v == ['C1'] + * + * The successful argument controls whether or not the field element must be 'successful' + * (per http://www.w3.org/TR/html4/interact/forms.html#successful-controls). + * The default value of the successful argument is true. If this value is false the value(s) + * for each element is returned. + * + * Note: This method *always* returns an array. If no valid value can be determined the + * array will be empty, otherwise it will contain one or more values. + */ +$.fn.fieldValue = function(successful) { + for (var val=[], i=0, max=this.length; i < max; i++) { + var el = this[i]; + var v = $.fieldValue(el, successful); + if (v === null || typeof v == 'undefined' || (v.constructor == Array && !v.length)) { + continue; + } + if (v.constructor == Array) + $.merge(val, v); + else + val.push(v); + } + return val; +}; + +/** + * Returns the value of the field element. + */ +$.fieldValue = function(el, successful) { + var n = el.name, t = el.type, tag = el.tagName.toLowerCase(); + if (successful === undefined) { + successful = true; + } + + if (successful && (!n || el.disabled || t == 'reset' || t == 'button' || + (t == 'checkbox' || t == 'radio') && !el.checked || + (t == 'submit' || t == 'image') && el.form && el.form.clk != el || + tag == 'select' && el.selectedIndex == -1)) { + return null; + } + + if (tag == 'select') { + var index = el.selectedIndex; + if (index < 0) { + return null; + } + var a = [], ops = el.options; + var one = (t == 'select-one'); + var max = (one ? index+1 : ops.length); + for(var i=(one ? index : 0); i < max; i++) { + var op = ops[i]; + if (op.selected) { + var v = op.value; + if (!v) { // extra pain for IE... + v = (op.attributes && op.attributes['value'] && !(op.attributes['value'].specified)) ? op.text : op.value; + } + if (one) { + return v; + } + a.push(v); + } + } + return a; + } + return $(el).val(); +}; + +/** + * Clears the form data. Takes the following actions on the form's input fields: + * - input text fields will have their 'value' property set to the empty string + * - select elements will have their 'selectedIndex' property set to -1 + * - checkbox and radio inputs will have their 'checked' property set to false + * - inputs of type submit, button, reset, and hidden will *not* be effected + * - button elements will *not* be effected + */ +$.fn.clearForm = function(includeHidden) { + return this.each(function() { + $('input,select,textarea', this).clearFields(includeHidden); + }); +}; + +/** + * Clears the selected form elements. + */ +$.fn.clearFields = $.fn.clearInputs = function(includeHidden) { + var re = /^(?:color|date|datetime|email|month|number|password|range|search|tel|text|time|url|week)$/i; // 'hidden' is not in this list + return this.each(function() { + var t = this.type, tag = this.tagName.toLowerCase(); + if (re.test(t) || tag == 'textarea') { + this.value = ''; + } + else if (t == 'checkbox' || t == 'radio') { + this.checked = false; + } + else if (tag == 'select') { + this.selectedIndex = -1; + } + else if (includeHidden) { + // includeHidden can be the value true, or it can be a selector string + // indicating a special test; for example: + // $('#myForm').clearForm('.special:hidden') + // the above would clean hidden inputs that have the class of 'special' + if ( (includeHidden === true && /hidden/.test(t)) || + (typeof includeHidden == 'string' && $(this).is(includeHidden)) ) + this.value = ''; + } + }); +}; + +/** + * Resets the form data. Causes all form elements to be reset to their original value. + */ +$.fn.resetForm = function() { + return this.each(function() { + // guard against an input with the name of 'reset' + // note that IE reports the reset function as an 'object' + if (typeof this.reset == 'function' || (typeof this.reset == 'object' && !this.reset.nodeType)) { + this.reset(); + } + }); +}; + +/** + * Enables or disables any matching elements. + */ +$.fn.enable = function(b) { + if (b === undefined) { + b = true; + } + return this.each(function() { + this.disabled = !b; + }); +}; + +/** + * Checks/unchecks any matching checkboxes or radio buttons and + * selects/deselects and matching option elements. + */ +$.fn.selected = function(select) { + if (select === undefined) { + select = true; + } + return this.each(function() { + var t = this.type; + if (t == 'checkbox' || t == 'radio') { + this.checked = select; + } + else if (this.tagName.toLowerCase() == 'option') { + var $sel = $(this).parent('select'); + if (select && $sel[0] && $sel[0].type == 'select-one') { + // deselect all other options + $sel.find('option').selected(false); + } + this.selected = select; + } + }); +}; + +// expose debug var +$.fn.ajaxSubmit.debug = false; + +// helper fn for console logging +function log() { + if (!$.fn.ajaxSubmit.debug) + return; + var msg = '[jquery.form] ' + Array.prototype.join.call(arguments,''); + if (window.console && window.console.log) { + window.console.log(msg); + } + else if (window.opera && window.opera.postError) { + window.opera.postError(msg); + } +} + +})(jQuery); diff --git a/resources/lib/jquery/jquery.fullscreen.js b/resources/lib/jquery/jquery.fullscreen.js new file mode 100644 index 000000000000..30e44846ee9b --- /dev/null +++ b/resources/lib/jquery/jquery.fullscreen.js @@ -0,0 +1,175 @@ +/** + * jQuery fullscreen plugin v2.0.0-git (9f8f97d127) + * https://github.com/theopolisme/jquery-fullscreen + * + * Copyright (c) 2013 Theopolisme <theopolismewiki@gmail.com> + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License as published by + * the Free Software Foundation; either version 2 of the License, or + * (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License along + * with this program; if not, write to the Free Software Foundation, Inc., + * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. + */ +( function ( $ ) { + var setupFullscreen, + fsClass = 'jq-fullscreened'; + + /** + * On fullscreenchange, trigger a jq-fullscreen-change event + * The event is given an object, which contains the fullscreened DOM element (element), if any + * and a boolean value (fullscreen) indicating if we've entered or exited fullscreen mode + * Also remove the 'fullscreened' class from elements that are no longer fullscreen + */ + function handleFullscreenChange () { + var fullscreenElement = document.fullscreenElement || + document.mozFullScreenElement || + document.webkitFullscreenElement || + document.msFullscreenElement; + + if ( !fullscreenElement ) { + $( '.' + fsClass ).data( 'isFullscreened', false ).removeClass( fsClass ); + } + + $( document ).trigger( $.Event( 'jq-fullscreen-change', { element: fullscreenElement, fullscreen: !!fullscreenElement } ) ); + } + + /** + * Enters full screen with the "this" element in focus. + * Check the .data( 'isFullscreened' ) of the return value to check + * success or failure, if you're into that sort of thing. + * @chainable + * @return {jQuery} + */ + function enterFullscreen () { + var element = this.get(0), + $element = this.first(); + if ( element ) { + if ( element.requestFullscreen ) { + element.requestFullscreen(); + } else if ( element.mozRequestFullScreen ) { + element.mozRequestFullScreen(); + } else if ( element.webkitRequestFullscreen ) { + element.webkitRequestFullscreen(); + } else if ( element.msRequestFullscreen ) { + element.msRequestFullscreen(); + } else { + // Unable to make fullscreen + $element.data( 'isFullscreened', false ); + return this; + } + // Add the fullscreen class and data attribute to `element` + $element.addClass( fsClass ).data( 'isFullscreened', true ); + return this; + } else { + $element.data( 'isFullscreened', false ); + return this; + } + } + + /** + * Brings the "this" element out of fullscreen. + * Check the .data( 'isFullscreened' ) of the return value to check + * success or failure, if you're into that sort of thing. + * @chainable + * @return {jQuery} + */ + function exitFullscreen () { + var fullscreenElement = ( document.fullscreenElement || + document.mozFullScreenElement || + document.webkitFullscreenElement || + document.msFullscreenElement ); + + // Ensure that we only exit fullscreen if exitFullscreen() is being called on the same element that is currently fullscreen + if ( fullscreenElement && this.get(0) === fullscreenElement ) { + if ( document.exitFullscreen ) { + document.exitFullscreen(); + } else if ( document.mozCancelFullScreen ) { + document.mozCancelFullScreen(); + } else if ( document.webkitCancelFullScreen ) { + document.webkitCancelFullScreen(); + } else if ( document.msExitFullscreen ) { + document.msExitFullscreen(); + } else { + // Unable to cancel fullscreen mode + return this; + } + // We don't need to remove the fullscreen class here, + // because it will be removed in handleFullscreenChange. + // But we should change the data on the element so the + // caller can check for success. + this.first().data( 'isFullscreened', false ); + } + + return this; + } + + /** + * Set up fullscreen handling and install necessary event handlers. + * Return false if fullscreen is not supported. + */ + setupFullscreen = function () { + if ( $.support.fullscreen ) { + // When the fullscreen mode is changed, trigger the + // fullscreen events (and when exiting, + // also remove the fullscreen class) + $( document ).on( 'fullscreenchange webkitfullscreenchange mozfullscreenchange MSFullscreenChange', handleFullscreenChange); + // Convenience wrapper so that one only needs to listen for + // 'fullscreenerror', not all of the prefixed versions + $( document ).on( 'webkitfullscreenerror mozfullscreenerror MSFullscreenError', function () { + $( document ).trigger( $.Event( 'fullscreenerror' ) ); + } ); + // Fullscreen has been set up, so always return true + setupFullscreen = function () { return true; }; + return true; + } else { + // Always return false from now on, since fullscreen is not supported + setupFullscreen = function () { return false; }; + return false; + } + }; + + /** + * Set up fullscreen handling if necessary, then make the first element + * matching the given selector fullscreen + * @chainable + * @return {jQuery} + */ + $.fn.enterFullscreen = function () { + if ( setupFullscreen() ) { + $.fn.enterFullscreen = enterFullscreen; + return this.enterFullscreen(); + } else { + $.fn.enterFullscreen = function () { return this; }; + return this; + } + }; + + /** + * Set up fullscreen handling if necessary, then cancel fullscreen mode + * for the first element matching the given selector. + * @chainable + * @return {jQuery} + */ + $.fn.exitFullscreen = function () { + if ( setupFullscreen() ) { + $.fn.exitFullscreen = exitFullscreen; + return this.exitFullscreen(); + } else { + $.fn.exitFullscreen = function () { return this; }; + return this; + } + }; + + $.support.fullscreen = document.fullscreenEnabled || + document.webkitFullscreenEnabled || + document.mozFullScreenEnabled || + document.msFullscreenEnabled; +}( jQuery ) ); diff --git a/resources/lib/jquery/jquery.hoverIntent.js b/resources/lib/jquery/jquery.hoverIntent.js new file mode 100644 index 000000000000..adf948df10de --- /dev/null +++ b/resources/lib/jquery/jquery.hoverIntent.js @@ -0,0 +1,111 @@ +/** +* hoverIntent is similar to jQuery's built-in "hover" function except that +* instead of firing the onMouseOver event immediately, hoverIntent checks +* to see if the user's mouse has slowed down (beneath the sensitivity +* threshold) before firing the onMouseOver event. +* +* hoverIntent r5 // 2007.03.27 // jQuery 1.1.2+ +* <http://cherne.net/brian/resources/jquery.hoverIntent.html> +* +* hoverIntent is currently available for use in all personal or commercial +* projects under both MIT and GPL licenses. This means that you can choose +* the license that best suits your project, and use it accordingly. +* +* // basic usage (just like .hover) receives onMouseOver and onMouseOut functions +* $("ul li").hoverIntent( showNav , hideNav ); +* +* // advanced usage receives configuration object only +* $("ul li").hoverIntent({ +* sensitivity: 7, // number = sensitivity threshold (must be 1 or higher) +* interval: 100, // number = milliseconds of polling interval +* over: showNav, // function = onMouseOver callback (required) +* timeout: 0, // number = milliseconds delay before onMouseOut function call +* out: hideNav // function = onMouseOut callback (required) +* }); +* +* @param f onMouseOver function || An object with configuration options +* @param g onMouseOut function || Nothing (use configuration options object) +* @author Brian Cherne <brian@cherne.net> +*/ +(function($) { + $.fn.hoverIntent = function(f,g) { + // default configuration options + var cfg = { + sensitivity: 7, + interval: 100, + timeout: 0 + }; + // override configuration options with user supplied object + cfg = $.extend(cfg, g ? { over: f, out: g } : f ); + + // instantiate variables + // cX, cY = current X and Y position of mouse, updated by mousemove event + // pX, pY = previous X and Y position of mouse, set by mouseover and polling interval + var cX, cY, pX, pY; + + // A private function for getting mouse position + var track = function(ev) { + cX = ev.pageX; + cY = ev.pageY; + }; + + // A private function for comparing current and previous mouse position + var compare = function(ev,ob) { + ob.hoverIntent_t = clearTimeout(ob.hoverIntent_t); + // compare mouse positions to see if they've crossed the threshold + if ( ( Math.abs(pX-cX) + Math.abs(pY-cY) ) < cfg.sensitivity ) { + $(ob).unbind("mousemove",track); + // set hoverIntent state to true (so mouseOut can be called) + ob.hoverIntent_s = 1; + return cfg.over.apply(ob,[ev]); + } else { + // set previous coordinates for next time + pX = cX; pY = cY; + // use self-calling timeout, guarantees intervals are spaced out properly (avoids JavaScript timer bugs) + ob.hoverIntent_t = setTimeout( function(){compare(ev, ob);} , cfg.interval ); + } + }; + + // A private function for delaying the mouseOut function + var delay = function(ev,ob) { + ob.hoverIntent_t = clearTimeout(ob.hoverIntent_t); + ob.hoverIntent_s = 0; + return cfg.out.apply(ob,[ev]); + }; + + // A private function for handling mouse 'hovering' + var handleHover = function(e) { + // next three lines copied from jQuery.hover, ignore children onMouseOver/onMouseOut + var p = (e.type == "mouseover" ? e.fromElement : e.toElement) || e.relatedTarget; + while ( p && p != this ) { try { p = p.parentNode; } catch(e) { p = this; } } + if ( p == this ) { return false; } + + // copy objects to be passed into t (required for event object to be passed in IE) + var ev = $.extend({},e); + var ob = this; + + // cancel hoverIntent timer if it exists + if (ob.hoverIntent_t) { ob.hoverIntent_t = clearTimeout(ob.hoverIntent_t); } + + // else e.type == "onmouseover" + if (e.type == "mouseover") { + // set "previous" X and Y position based on initial entry point + pX = ev.pageX; pY = ev.pageY; + // update "current" X and Y position based on mousemove + $(ob).bind("mousemove",track); + // start polling interval (self-calling timeout) to compare mouse coordinates over time + if (ob.hoverIntent_s != 1) { ob.hoverIntent_t = setTimeout( function(){compare(ev,ob);} , cfg.interval );} + + // else e.type == "onmouseout" + } else { + // unbind expensive mousemove event + $(ob).unbind("mousemove",track); + // if hoverIntent state is true, then call the mouseOut function after the specified delay + if (ob.hoverIntent_s == 1) { ob.hoverIntent_t = setTimeout( function(){delay(ev,ob);} , cfg.timeout );} + } + }; + + // bind the function to the two event listeners + return this.mouseover(handleHover).mouseout(handleHover); + }; +})(jQuery);
\ No newline at end of file diff --git a/resources/lib/jquery/jquery.jStorage.js b/resources/lib/jquery/jquery.jStorage.js new file mode 100644 index 000000000000..324833c92efb --- /dev/null +++ b/resources/lib/jquery/jquery.jStorage.js @@ -0,0 +1,960 @@ +/* + * ----------------------------- JSTORAGE ------------------------------------- + * Simple local storage wrapper to save data on the browser side, supporting + * all major browsers - IE6+, Firefox2+, Safari4+, Chrome4+ and Opera 10.5+ + * + * Author: Andris Reinman, andris.reinman@gmail.com + * Project homepage: www.jstorage.info + * + * Licensed under Unlicense: + * + * This is free and unencumbered software released into the public domain. + * + * Anyone is free to copy, modify, publish, use, compile, sell, or + * distribute this software, either in source code form or as a compiled + * binary, for any purpose, commercial or non-commercial, and by any + * means. + * + * In jurisdictions that recognize copyright laws, the author or authors + * of this software dedicate any and all copyright interest in the + * software to the public domain. We make this dedication for the benefit + * of the public at large and to the detriment of our heirs and + * successors. We intend this dedication to be an overt act of + * relinquishment in perpetuity of all present and future rights to this + * software under copyright law. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. + * IN NO EVENT SHALL THE AUTHORS BE LIABLE FOR ANY CLAIM, DAMAGES OR + * OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, + * ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR + * OTHER DEALINGS IN THE SOFTWARE. + * + * For more information, please refer to <http://unlicense.org/> + */ + + (function(){ + var + /* jStorage version */ + JSTORAGE_VERSION = "0.4.8", + + /* detect a dollar object or create one if not found */ + $ = window.jQuery || window.$ || (window.$ = {}), + + /* check for a JSON handling support */ + JSON = { + parse: + window.JSON && (window.JSON.parse || window.JSON.decode) || + String.prototype.evalJSON && function(str){return String(str).evalJSON();} || + $.parseJSON || + $.evalJSON, + stringify: + Object.toJSON || + window.JSON && (window.JSON.stringify || window.JSON.encode) || + $.toJSON + }; + + // Break if no JSON support was found + if(!("parse" in JSON) || !("stringify" in JSON)){ + throw new Error("No JSON support found, include //cdnjs.cloudflare.com/ajax/libs/json2/20110223/json2.js to page"); + } + + var + /* This is the object, that holds the cached values */ + _storage = {__jstorage_meta:{CRC32:{}}}, + + /* Actual browser storage (localStorage or globalStorage["domain"]) */ + _storage_service = {jStorage:"{}"}, + + /* DOM element for older IE versions, holds userData behavior */ + _storage_elm = null, + + /* How much space does the storage take */ + _storage_size = 0, + + /* which backend is currently used */ + _backend = false, + + /* onchange observers */ + _observers = {}, + + /* timeout to wait after onchange event */ + _observer_timeout = false, + + /* last update time */ + _observer_update = 0, + + /* pubsub observers */ + _pubsub_observers = {}, + + /* skip published items older than current timestamp */ + _pubsub_last = +new Date(), + + /* Next check for TTL */ + _ttl_timeout, + + /** + * XML encoding and decoding as XML nodes can't be JSON'ized + * XML nodes are encoded and decoded if the node is the value to be saved + * but not if it's as a property of another object + * Eg. - + * $.jStorage.set("key", xmlNode); // IS OK + * $.jStorage.set("key", {xml: xmlNode}); // NOT OK + */ + _XMLService = { + + /** + * Validates a XML node to be XML + * based on jQuery.isXML function + */ + isXML: function(elm){ + var documentElement = (elm ? elm.ownerDocument || elm : 0).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; + }, + + /** + * Encodes a XML node to string + * based on http://www.mercurytide.co.uk/news/article/issues-when-working-ajax/ + */ + encode: function(xmlNode) { + if(!this.isXML(xmlNode)){ + return false; + } + try{ // Mozilla, Webkit, Opera + return new XMLSerializer().serializeToString(xmlNode); + }catch(E1) { + try { // IE + return xmlNode.xml; + }catch(E2){} + } + return false; + }, + + /** + * Decodes a XML node from string + * loosely based on http://outwestmedia.com/jquery-plugins/xmldom/ + */ + decode: function(xmlString){ + var dom_parser = ("DOMParser" in window && (new DOMParser()).parseFromString) || + (window.ActiveXObject && function(_xmlString) { + var xml_doc = new ActiveXObject("Microsoft.XMLDOM"); + xml_doc.async = "false"; + xml_doc.loadXML(_xmlString); + return xml_doc; + }), + resultXML; + if(!dom_parser){ + return false; + } + resultXML = dom_parser.call("DOMParser" in window && (new DOMParser()) || window, xmlString, "text/xml"); + return this.isXML(resultXML)?resultXML:false; + } + }; + + + ////////////////////////// PRIVATE METHODS //////////////////////// + + /** + * Initialization function. Detects if the browser supports DOM Storage + * or userData behavior and behaves accordingly. + */ + function _init(){ + /* Check if browser supports localStorage */ + var localStorageReallyWorks = false; + if("localStorage" in window){ + try { + window.localStorage.setItem("_tmptest", "tmpval"); + localStorageReallyWorks = true; + window.localStorage.removeItem("_tmptest"); + } catch(BogusQuotaExceededErrorOnIos5) { + // Thanks be to iOS5 Private Browsing mode which throws + // QUOTA_EXCEEDED_ERRROR DOM Exception 22. + } + } + + if(localStorageReallyWorks){ + try { + if(window.localStorage) { + _storage_service = window.localStorage; + _backend = "localStorage"; + _observer_update = _storage_service.jStorage_update; + } + } catch(E3) {/* Firefox fails when touching localStorage and cookies are disabled */} + } + /* Check if browser supports globalStorage */ + else if("globalStorage" in window){ + try { + if(window.globalStorage) { + if(window.location.hostname == "localhost"){ + _storage_service = window.globalStorage["localhost.localdomain"]; + } + else{ + _storage_service = window.globalStorage[window.location.hostname]; + } + _backend = "globalStorage"; + _observer_update = _storage_service.jStorage_update; + } + } catch(E4) {/* Firefox fails when touching localStorage and cookies are disabled */} + } + /* Check if browser supports userData behavior */ + else { + _storage_elm = document.createElement("link"); + if(_storage_elm.addBehavior){ + + /* Use a DOM element to act as userData storage */ + _storage_elm.style.behavior = "url(#default#userData)"; + + /* userData element needs to be inserted into the DOM! */ + document.getElementsByTagName("head")[0].appendChild(_storage_elm); + + try{ + _storage_elm.load("jStorage"); + }catch(E){ + // try to reset cache + _storage_elm.setAttribute("jStorage", "{}"); + _storage_elm.save("jStorage"); + _storage_elm.load("jStorage"); + } + + var data = "{}"; + try{ + data = _storage_elm.getAttribute("jStorage"); + }catch(E5){} + + try{ + _observer_update = _storage_elm.getAttribute("jStorage_update"); + }catch(E6){} + + _storage_service.jStorage = data; + _backend = "userDataBehavior"; + }else{ + _storage_elm = null; + return; + } + } + + // Load data from storage + _load_storage(); + + // remove dead keys + _handleTTL(); + + // start listening for changes + _setupObserver(); + + // initialize publish-subscribe service + _handlePubSub(); + + // handle cached navigation + if("addEventListener" in window){ + window.addEventListener("pageshow", function(event){ + if(event.persisted){ + _storageObserver(); + } + }, false); + } + } + + /** + * Reload data from storage when needed + */ + function _reloadData(){ + var data = "{}"; + + if(_backend == "userDataBehavior"){ + _storage_elm.load("jStorage"); + + try{ + data = _storage_elm.getAttribute("jStorage"); + }catch(E5){} + + try{ + _observer_update = _storage_elm.getAttribute("jStorage_update"); + }catch(E6){} + + _storage_service.jStorage = data; + } + + _load_storage(); + + // remove dead keys + _handleTTL(); + + _handlePubSub(); + } + + /** + * Sets up a storage change observer + */ + function _setupObserver(){ + if(_backend == "localStorage" || _backend == "globalStorage"){ + if("addEventListener" in window){ + window.addEventListener("storage", _storageObserver, false); + }else{ + document.attachEvent("onstorage", _storageObserver); + } + }else if(_backend == "userDataBehavior"){ + setInterval(_storageObserver, 1000); + } + } + + /** + * Fired on any kind of data change, needs to check if anything has + * really been changed + */ + function _storageObserver(){ + var updateTime; + // cumulate change notifications with timeout + clearTimeout(_observer_timeout); + _observer_timeout = setTimeout(function(){ + + if(_backend == "localStorage" || _backend == "globalStorage"){ + updateTime = _storage_service.jStorage_update; + }else if(_backend == "userDataBehavior"){ + _storage_elm.load("jStorage"); + try{ + updateTime = _storage_elm.getAttribute("jStorage_update"); + }catch(E5){} + } + + if(updateTime && updateTime != _observer_update){ + _observer_update = updateTime; + _checkUpdatedKeys(); + } + + }, 25); + } + + /** + * Reloads the data and checks if any keys are changed + */ + function _checkUpdatedKeys(){ + var oldCrc32List = JSON.parse(JSON.stringify(_storage.__jstorage_meta.CRC32)), + newCrc32List; + + _reloadData(); + newCrc32List = JSON.parse(JSON.stringify(_storage.__jstorage_meta.CRC32)); + + var key, + updated = [], + removed = []; + + for(key in oldCrc32List){ + if(oldCrc32List.hasOwnProperty(key)){ + if(!newCrc32List[key]){ + removed.push(key); + continue; + } + if(oldCrc32List[key] != newCrc32List[key] && String(oldCrc32List[key]).substr(0,2) == "2."){ + updated.push(key); + } + } + } + + for(key in newCrc32List){ + if(newCrc32List.hasOwnProperty(key)){ + if(!oldCrc32List[key]){ + updated.push(key); + } + } + } + + _fireObservers(updated, "updated"); + _fireObservers(removed, "deleted"); + } + + /** + * Fires observers for updated keys + * + * @param {Array|String} keys Array of key names or a key + * @param {String} action What happened with the value (updated, deleted, flushed) + */ + function _fireObservers(keys, action){ + keys = [].concat(keys || []); + if(action == "flushed"){ + keys = []; + for(var key in _observers){ + if(_observers.hasOwnProperty(key)){ + keys.push(key); + } + } + action = "deleted"; + } + for(var i=0, len = keys.length; i<len; i++){ + if(_observers[keys[i]]){ + for(var j=0, jlen = _observers[keys[i]].length; j<jlen; j++){ + _observers[keys[i]][j](keys[i], action); + } + } + if(_observers["*"]){ + for(var j=0, jlen = _observers["*"].length; j<jlen; j++){ + _observers["*"][j](keys[i], action); + } + } + } + } + + /** + * Publishes key change to listeners + */ + function _publishChange(){ + var updateTime = (+new Date()).toString(); + + if(_backend == "localStorage" || _backend == "globalStorage"){ + try { + _storage_service.jStorage_update = updateTime; + } catch (E8) { + // safari private mode has been enabled after the jStorage initialization + _backend = false; + } + }else if(_backend == "userDataBehavior"){ + _storage_elm.setAttribute("jStorage_update", updateTime); + _storage_elm.save("jStorage"); + } + + _storageObserver(); + } + + /** + * Loads the data from the storage based on the supported mechanism + */ + function _load_storage(){ + /* if jStorage string is retrieved, then decode it */ + if(_storage_service.jStorage){ + try{ + _storage = JSON.parse(String(_storage_service.jStorage)); + }catch(E6){_storage_service.jStorage = "{}";} + }else{ + _storage_service.jStorage = "{}"; + } + _storage_size = _storage_service.jStorage?String(_storage_service.jStorage).length:0; + + if(!_storage.__jstorage_meta){ + _storage.__jstorage_meta = {}; + } + if(!_storage.__jstorage_meta.CRC32){ + _storage.__jstorage_meta.CRC32 = {}; + } + } + + /** + * This functions provides the "save" mechanism to store the jStorage object + */ + function _save(){ + _dropOldEvents(); // remove expired events + try{ + _storage_service.jStorage = JSON.stringify(_storage); + // If userData is used as the storage engine, additional + if(_storage_elm) { + _storage_elm.setAttribute("jStorage",_storage_service.jStorage); + _storage_elm.save("jStorage"); + } + _storage_size = _storage_service.jStorage?String(_storage_service.jStorage).length:0; + }catch(E7){/* probably cache is full, nothing is saved this way*/} + } + + /** + * Function checks if a key is set and is string or numberic + * + * @param {String} key Key name + */ + function _checkKey(key){ + if(typeof key != "string" && typeof key != "number"){ + throw new TypeError("Key name must be string or numeric"); + } + if(key == "__jstorage_meta"){ + throw new TypeError("Reserved key name"); + } + return true; + } + + /** + * Removes expired keys + */ + function _handleTTL(){ + var curtime, i, TTL, CRC32, nextExpire = Infinity, changed = false, deleted = []; + + clearTimeout(_ttl_timeout); + + if(!_storage.__jstorage_meta || typeof _storage.__jstorage_meta.TTL != "object"){ + // nothing to do here + return; + } + + curtime = +new Date(); + TTL = _storage.__jstorage_meta.TTL; + + CRC32 = _storage.__jstorage_meta.CRC32; + for(i in TTL){ + if(TTL.hasOwnProperty(i)){ + if(TTL[i] <= curtime){ + delete TTL[i]; + delete CRC32[i]; + delete _storage[i]; + changed = true; + deleted.push(i); + }else if(TTL[i] < nextExpire){ + nextExpire = TTL[i]; + } + } + } + + // set next check + if(nextExpire != Infinity){ + _ttl_timeout = setTimeout(_handleTTL, nextExpire - curtime); + } + + // save changes + if(changed){ + _save(); + _publishChange(); + _fireObservers(deleted, "deleted"); + } + } + + /** + * Checks if there's any events on hold to be fired to listeners + */ + function _handlePubSub(){ + var i, len; + if(!_storage.__jstorage_meta.PubSub){ + return; + } + var pubelm, + _pubsubCurrent = _pubsub_last; + + for(i=len=_storage.__jstorage_meta.PubSub.length-1; i>=0; i--){ + pubelm = _storage.__jstorage_meta.PubSub[i]; + if(pubelm[0] > _pubsub_last){ + _pubsubCurrent = pubelm[0]; + _fireSubscribers(pubelm[1], pubelm[2]); + } + } + + _pubsub_last = _pubsubCurrent; + } + + /** + * Fires all subscriber listeners for a pubsub channel + * + * @param {String} channel Channel name + * @param {Mixed} payload Payload data to deliver + */ + function _fireSubscribers(channel, payload){ + if(_pubsub_observers[channel]){ + for(var i=0, len = _pubsub_observers[channel].length; i<len; i++){ + // send immutable data that can't be modified by listeners + try{ + _pubsub_observers[channel][i](channel, JSON.parse(JSON.stringify(payload))); + }catch(E){}; + } + } + } + + /** + * Remove old events from the publish stream (at least 2sec old) + */ + function _dropOldEvents(){ + if(!_storage.__jstorage_meta.PubSub){ + return; + } + + var retire = +new Date() - 2000; + + for(var i=0, len = _storage.__jstorage_meta.PubSub.length; i<len; i++){ + if(_storage.__jstorage_meta.PubSub[i][0] <= retire){ + // deleteCount is needed for IE6 + _storage.__jstorage_meta.PubSub.splice(i, _storage.__jstorage_meta.PubSub.length - i); + break; + } + } + + if(!_storage.__jstorage_meta.PubSub.length){ + delete _storage.__jstorage_meta.PubSub; + } + + } + + /** + * Publish payload to a channel + * + * @param {String} channel Channel name + * @param {Mixed} payload Payload to send to the subscribers + */ + function _publish(channel, payload){ + if(!_storage.__jstorage_meta){ + _storage.__jstorage_meta = {}; + } + if(!_storage.__jstorage_meta.PubSub){ + _storage.__jstorage_meta.PubSub = []; + } + + _storage.__jstorage_meta.PubSub.unshift([+new Date, channel, payload]); + + _save(); + _publishChange(); + } + + + /** + * JS Implementation of MurmurHash2 + * + * SOURCE: https://github.com/garycourt/murmurhash-js (MIT licensed) + * + * @author <a href="mailto:gary.court@gmail.com">Gary Court</a> + * @see http://github.com/garycourt/murmurhash-js + * @author <a href="mailto:aappleby@gmail.com">Austin Appleby</a> + * @see http://sites.google.com/site/murmurhash/ + * + * @param {string} str ASCII only + * @param {number} seed Positive integer only + * @return {number} 32-bit positive integer hash + */ + + function murmurhash2_32_gc(str, seed) { + var + l = str.length, + h = seed ^ l, + i = 0, + k; + + while (l >= 4) { + k = + ((str.charCodeAt(i) & 0xff)) | + ((str.charCodeAt(++i) & 0xff) << 8) | + ((str.charCodeAt(++i) & 0xff) << 16) | + ((str.charCodeAt(++i) & 0xff) << 24); + + k = (((k & 0xffff) * 0x5bd1e995) + ((((k >>> 16) * 0x5bd1e995) & 0xffff) << 16)); + k ^= k >>> 24; + k = (((k & 0xffff) * 0x5bd1e995) + ((((k >>> 16) * 0x5bd1e995) & 0xffff) << 16)); + + h = (((h & 0xffff) * 0x5bd1e995) + ((((h >>> 16) * 0x5bd1e995) & 0xffff) << 16)) ^ k; + + l -= 4; + ++i; + } + + switch (l) { + case 3: h ^= (str.charCodeAt(i + 2) & 0xff) << 16; + case 2: h ^= (str.charCodeAt(i + 1) & 0xff) << 8; + case 1: h ^= (str.charCodeAt(i) & 0xff); + h = (((h & 0xffff) * 0x5bd1e995) + ((((h >>> 16) * 0x5bd1e995) & 0xffff) << 16)); + } + + h ^= h >>> 13; + h = (((h & 0xffff) * 0x5bd1e995) + ((((h >>> 16) * 0x5bd1e995) & 0xffff) << 16)); + h ^= h >>> 15; + + return h >>> 0; + } + + ////////////////////////// PUBLIC INTERFACE ///////////////////////// + + $.jStorage = { + /* Version number */ + version: JSTORAGE_VERSION, + + /** + * Sets a key's value. + * + * @param {String} key Key to set. If this value is not set or not + * a string an exception is raised. + * @param {Mixed} value Value to set. This can be any value that is JSON + * compatible (Numbers, Strings, Objects etc.). + * @param {Object} [options] - possible options to use + * @param {Number} [options.TTL] - optional TTL value + * @return {Mixed} the used value + */ + set: function(key, value, options){ + _checkKey(key); + + options = options || {}; + + // undefined values are deleted automatically + if(typeof value == "undefined"){ + this.deleteKey(key); + return value; + } + + if(_XMLService.isXML(value)){ + value = {_is_xml:true,xml:_XMLService.encode(value)}; + }else if(typeof value == "function"){ + return undefined; // functions can't be saved! + }else if(value && typeof value == "object"){ + // clone the object before saving to _storage tree + value = JSON.parse(JSON.stringify(value)); + } + + _storage[key] = value; + + _storage.__jstorage_meta.CRC32[key] = "2." + murmurhash2_32_gc(JSON.stringify(value), 0x9747b28c); + + this.setTTL(key, options.TTL || 0); // also handles saving and _publishChange + + _fireObservers(key, "updated"); + return value; + }, + + /** + * Looks up a key in cache + * + * @param {String} key - Key to look up. + * @param {mixed} def - Default value to return, if key didn't exist. + * @return {Mixed} the key value, default value or null + */ + get: function(key, def){ + _checkKey(key); + if(key in _storage){ + if(_storage[key] && typeof _storage[key] == "object" && _storage[key]._is_xml) { + return _XMLService.decode(_storage[key].xml); + }else{ + return _storage[key]; + } + } + return typeof(def) == "undefined" ? null : def; + }, + + /** + * Deletes a key from cache. + * + * @param {String} key - Key to delete. + * @return {Boolean} true if key existed or false if it didn't + */ + deleteKey: function(key){ + _checkKey(key); + if(key in _storage){ + delete _storage[key]; + // remove from TTL list + if(typeof _storage.__jstorage_meta.TTL == "object" && + key in _storage.__jstorage_meta.TTL){ + delete _storage.__jstorage_meta.TTL[key]; + } + + delete _storage.__jstorage_meta.CRC32[key]; + + _save(); + _publishChange(); + _fireObservers(key, "deleted"); + return true; + } + return false; + }, + + /** + * Sets a TTL for a key, or remove it if ttl value is 0 or below + * + * @param {String} key - key to set the TTL for + * @param {Number} ttl - TTL timeout in milliseconds + * @return {Boolean} true if key existed or false if it didn't + */ + setTTL: function(key, ttl){ + var curtime = +new Date(); + _checkKey(key); + ttl = Number(ttl) || 0; + if(key in _storage){ + + if(!_storage.__jstorage_meta.TTL){ + _storage.__jstorage_meta.TTL = {}; + } + + // Set TTL value for the key + if(ttl>0){ + _storage.__jstorage_meta.TTL[key] = curtime + ttl; + }else{ + delete _storage.__jstorage_meta.TTL[key]; + } + + _save(); + + _handleTTL(); + + _publishChange(); + return true; + } + return false; + }, + + /** + * Gets remaining TTL (in milliseconds) for a key or 0 when no TTL has been set + * + * @param {String} key Key to check + * @return {Number} Remaining TTL in milliseconds + */ + getTTL: function(key){ + var curtime = +new Date(), ttl; + _checkKey(key); + if(key in _storage && _storage.__jstorage_meta.TTL && _storage.__jstorage_meta.TTL[key]){ + ttl = _storage.__jstorage_meta.TTL[key] - curtime; + return ttl || 0; + } + return 0; + }, + + /** + * Deletes everything in cache. + * + * @return {Boolean} Always true + */ + flush: function(){ + _storage = {__jstorage_meta:{CRC32:{}}}; + _save(); + _publishChange(); + _fireObservers(null, "flushed"); + return true; + }, + + /** + * Returns a read-only copy of _storage + * + * @return {Object} Read-only copy of _storage + */ + storageObj: function(){ + function F() {} + F.prototype = _storage; + return new F(); + }, + + /** + * Returns an index of all used keys as an array + * ["key1", "key2",.."keyN"] + * + * @return {Array} Used keys + */ + index: function(){ + var index = [], i; + for(i in _storage){ + if(_storage.hasOwnProperty(i) && i != "__jstorage_meta"){ + index.push(i); + } + } + return index; + }, + + /** + * How much space in bytes does the storage take? + * + * @return {Number} Storage size in chars (not the same as in bytes, + * since some chars may take several bytes) + */ + storageSize: function(){ + return _storage_size; + }, + + /** + * Which backend is currently in use? + * + * @return {String} Backend name + */ + currentBackend: function(){ + return _backend; + }, + + /** + * Test if storage is available + * + * @return {Boolean} True if storage can be used + */ + storageAvailable: function(){ + return !!_backend; + }, + + /** + * Register change listeners + * + * @param {String} key Key name + * @param {Function} callback Function to run when the key changes + */ + listenKeyChange: function(key, callback){ + _checkKey(key); + if(!_observers[key]){ + _observers[key] = []; + } + _observers[key].push(callback); + }, + + /** + * Remove change listeners + * + * @param {String} key Key name to unregister listeners against + * @param {Function} [callback] If set, unregister the callback, if not - unregister all + */ + stopListening: function(key, callback){ + _checkKey(key); + + if(!_observers[key]){ + return; + } + + if(!callback){ + delete _observers[key]; + return; + } + + for(var i = _observers[key].length - 1; i>=0; i--){ + if(_observers[key][i] == callback){ + _observers[key].splice(i,1); + } + } + }, + + /** + * Subscribe to a Publish/Subscribe event stream + * + * @param {String} channel Channel name + * @param {Function} callback Function to run when the something is published to the channel + */ + subscribe: function(channel, callback){ + channel = (channel || "").toString(); + if(!channel){ + throw new TypeError("Channel not defined"); + } + if(!_pubsub_observers[channel]){ + _pubsub_observers[channel] = []; + } + _pubsub_observers[channel].push(callback); + }, + + /** + * Publish data to an event stream + * + * @param {String} channel Channel name + * @param {Mixed} payload Payload to deliver + */ + publish: function(channel, payload){ + channel = (channel || "").toString(); + if(!channel){ + throw new TypeError("Channel not defined"); + } + + _publish(channel, payload); + }, + + /** + * Reloads the data from browser storage + */ + reInit: function(){ + _reloadData(); + }, + + /** + * Removes reference from global objects and saves it as jStorage + * + * @param {Boolean} option if needed to save object as simple "jStorage" in windows context + */ + noConflict: function( saveInGlobal ) { + delete window.$.jStorage + + if ( saveInGlobal ) { + window.jStorage = this; + } + + return this; + } + }; + + // Initialize jStorage + _init(); + +})(); diff --git a/resources/lib/jquery/jquery.js b/resources/lib/jquery/jquery.js new file mode 100644 index 000000000000..a86bf797a8bf --- /dev/null +++ b/resources/lib/jquery/jquery.js @@ -0,0 +1,9472 @@ +/*! + * jQuery JavaScript Library v1.8.3 + * http://jquery.com/ + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + * + * Date: Tue Nov 13 2012 08:20:33 GMT-0500 (Eastern Standard Time) + */ +(function( window, undefined ) { +var + // A central reference to the root jQuery(document) + rootjQuery, + + // The deferred used on DOM ready + readyList, + + // Use the correct document accordingly with window argument (sandbox) + document = window.document, + location = window.location, + navigator = window.navigator, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // Save a reference to some core methods + core_push = Array.prototype.push, + core_slice = Array.prototype.slice, + core_indexOf = Array.prototype.indexOf, + core_toString = Object.prototype.toString, + core_hasOwn = Object.prototype.hasOwnProperty, + core_trim = String.prototype.trim, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Used for matching numbers + core_pnum = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source, + + // Used for detecting and trimming whitespace + core_rnotwhite = /\S/, + core_rspace = /\s+/, + + // Make sure we trim BOM and NBSP (here's looking at you, Safari 5.0 and IE) + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, + + // A simple way to check for HTML strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + rquickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + rvalidescape = /\\(?:["\\\/bfnrt]|u[\da-fA-F]{4})/g, + rvalidtokens = /"[^"\\\r\n]*"|true|false|null|-?(?:\d\d*\.|)\d+(?:[eE][\-+]?\d+|)/g, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // The ready event handler and self cleanup method + DOMContentLoaded = function() { + if ( document.addEventListener ) { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + } else if ( document.readyState === "complete" ) { + // we're here because readyState === "complete" in oldIE + // which is good enough for us to call the dom ready! + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context && context.nodeType ? context.ownerDocument || context : document ); + + // scripts is true for back-compat + selector = jQuery.parseHTML( match[1], doc, true ); + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + this.attr.call( selector, context, true ); + } + + return jQuery.merge( this, selector ); + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.8.3", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return core_slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; + }, + + eq: function( i ) { + i = +i; + return i === -1 ? + this.slice( i ) : + this.slice( i, i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( core_slice.apply( this, arguments ), + "slice", core_slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: core_push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + isWindow: function( obj ) { + return obj != null && obj == obj.window; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ core_toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !core_hasOwn.call(obj, "constructor") && + !core_hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || core_hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // scripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, scripts ) { + var parsed; + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + scripts = context; + context = 0; + } + context = context || document; + + // Single tag + if ( (parsed = rsingleTag.exec( data )) ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = jQuery.buildFragment( [ data ], context, scripts ? null : [] ); + return jQuery.merge( [], + (parsed.cacheable ? jQuery.clone( parsed.fragment ) : parsed.fragment).childNodes ); + }, + + parseJSON: function( data ) { + if ( !data || typeof data !== "string") { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && core_rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + }, + + // args is for internal usage only + each: function( obj, callback, args ) { + var name, + i = 0, + length = obj.length, + isObj = length === undefined || jQuery.isFunction( obj ); + + if ( args ) { + if ( isObj ) { + for ( name in obj ) { + if ( callback.apply( obj[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( obj[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in obj ) { + if ( callback.call( obj[ name ], name, obj[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( obj[ i ], i, obj[ i++ ] ) === false ) { + break; + } + } + } + } + + return obj; + }, + + // Use native String.trim function wherever possible + trim: core_trim && !core_trim.call("\uFEFF\xA0") ? + function( text ) { + return text == null ? + "" : + core_trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var type, + ret = results || []; + + if ( arr != null ) { + // The window, strings (and functions) also have 'length' + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + type = jQuery.type( arr ); + + if ( arr.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( arr ) ) { + core_push.call( ret, arr ); + } else { + jQuery.merge( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + var len; + + if ( arr ) { + if ( core_indexOf ) { + return core_indexOf.call( arr, elem, i ); + } + + len = arr.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in arr && arr[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var l = second.length, + i = first.length, + j = 0; + + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var retVal, + ret = [], + i = 0, + length = elems.length; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, + ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context, args.concat( core_slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; + }, + + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, pass ) { + var exec, + bulk = key == null, + i = 0, + length = elems.length; + + // Sets many values + if ( key && typeof key === "object" ) { + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], 1, emptyGet, value ); + } + chainable = 1; + + // Sets one value + } else if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = pass === undefined && jQuery.isFunction( value ); + + if ( bulk ) { + // Bulk operations only iterate when executing function values + if ( exec ) { + exec = fn; + fn = function( elem, key, value ) { + return exec.call( jQuery( elem ), value ); + }; + + // Otherwise they run against the entire set + } else { + fn.call( elems, value ); + fn = null; + } + } + + if ( fn ) { + for (; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + } + + chainable = 1; + } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; + }, + + now: function() { + return ( new Date() ).getTime(); + } +}); + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the browser event has already occurred. + // we once tried to use readyState "interactive" here, but it caused issues like the one + // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15 + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready, 1 ); + + // Standards-based browsers support DOMContentLoaded + } else if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else { + // Ensure firing before onload, maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var top = false; + + try { + top = window.frameElement == null && document.documentElement; + } catch(e) {} + + if ( top && top.doScroll ) { + (function doScrollCheck() { + if ( !jQuery.isReady ) { + + try { + // Use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + top.doScroll("left"); + } catch(e) { + return setTimeout( doScrollCheck, 50 ); + } + + // and execute any waiting functions + jQuery.ready(); + } + })(); + } + } + } + return readyList.promise( obj ); +}; + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; + +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.split( core_rspace ), function( _, flag ) { + object[ flag ] = true; + }); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); + + var // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + var type = jQuery.type( arg ); + if ( type === "function" ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && type !== "string" ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; + } + if ( index <= firingIndex ) { + firingIndex--; + } + } + } + }); + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + return jQuery.inArray( fn, list ) > -1; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ]( jQuery.isFunction( fn ) ? + function() { + var returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + } : + newDefer[ action ] + ); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] = list.fire + deferred[ tuple[0] ] = list.fire; + deferred[ tuple[0] + "With" ] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +}); +jQuery.support = (function() { + + var support, + all, + a, + select, + opt, + input, + fragment, + eventName, + i, + isSupported, + clickFn, + div = document.createElement("div"); + + // Setup + div.setAttribute( "className", "t" ); + div.innerHTML = " <link/><table></table><a href='/a'>a</a><input type='checkbox'/>"; + + // Support tests won't run in some limited or non-browser environments + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + if ( !all || !a || !all.length ) { + return {}; + } + + // First batch of tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + a.style.cssText = "top:1px;float:left;opacity:.5"; + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute("href") === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form (#6743) + enctype: !!document.createElement("form").enctype, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: ( document.compatMode === "CSS1Compat" ), + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", clickFn = function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent("onclick"); + div.detachEvent( "onclick", clickFn ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + input.setAttribute( "checked", "checked" ); + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + fragment.removeChild( input ); + fragment.appendChild( div ); + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for ( i in { + submit: true, + change: true, + focusin: true + }) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Run tests that need a body at doc ready + jQuery(function() { + var container, div, tds, marginDiv, + divReset = "padding:0;margin:0;border:0;display:block;overflow:hidden;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "visibility:hidden;border:0;width:0;height:0;position:static;top:0;margin-top:1px"; + body.insertBefore( container, body.firstChild ); + + // Construct the test element + div = document.createElement("div"); + container.appendChild( div ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + div.innerHTML = "<table><tr><td></td><td>t</td></tr></table>"; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE <= 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // NOTE: To any future maintainer, we've window.getComputedStyle + // because jsdom on node.js will break without it. + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = document.createElement("div"); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = "block"; + div.style.overflow = "visible"; + div.innerHTML = "<div></div>"; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + container.style.zoom = 1; + } + + // Null elements to avoid leaks in IE + body.removeChild( container ); + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + fragment.removeChild( div ); + all = a = select = opt = input = fragment = div = null; + + return support; +})(); +var rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + deletedIds: [], + + // Remove at next major release (1.9/2.0) + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ internalKey ] = id = jQuery.deletedIds.pop() || jQuery.guid++; + } else { + id = internalKey; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support array or space separated string names for data keys + if ( !jQuery.isArray( name ) ) { + + // try the string as a key before any manipulation + if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces unless a key with the spaces exists + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split(" "); + } + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject( cache[ id ] ) ) { + return; + } + } + + // Destroy the cache + if ( isNode ) { + jQuery.cleanData( [ elem ], true ); + + // Use delete when supported for expandos or `cache` is not a window per isWindow (#10080) + } else if ( jQuery.support.deleteExpando || cache != cache.window ) { + delete cache[ id ]; + + // When all else fails, null + } else { + cache[ id ] = null; + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + var noData = elem.nodeName && jQuery.noData[ elem.nodeName.toLowerCase() ]; + + // nodes accept data unless otherwise specified; rejection can be conditional + return !noData || noData !== true && elem.getAttribute("classid") === noData; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, part, attr, name, l, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = jQuery.data( elem ); + + if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { + attr = elem.attributes; + for ( l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( !name.indexOf( "data-" ) ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( elem, name, data[ name ] ); + } + } + jQuery._data( elem, "parsedAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split( ".", 2 ); + parts[1] = parts[1] ? "." + parts[1] : ""; + part = parts[1] + "!"; + + return jQuery.access( this, function( value ) { + + if ( value === undefined ) { + data = this.triggerHandler( "getData" + part, [ parts[0] ] ); + + // Try to fetch any internally stored data first + if ( data === undefined && elem ) { + data = jQuery.data( elem, key ); + data = dataAttr( elem, key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } + + parts[1] = value; + this.each(function() { + var self = jQuery( this ); + + self.triggerHandler( "setData" + part, parts ); + jQuery.data( this, key, value ); + self.triggerHandler( "changeData" + part, parts ); + }); + }, null, value, arguments.length > 1, null, false ); + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + var name; + for ( name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery.removeData( elem, type + "queue", true ); + jQuery.removeData( elem, key, true ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, fixSpecified, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea|)$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( setClass.indexOf( " " + classNames[ c ] + " " ) < 0 ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var removes, className, elem, c, cl, i, l; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + if ( (value && typeof value === "string") || value === undefined ) { + removes = ( value || "" ).split( core_rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + if ( elem.nodeType === 1 && elem.className ) { + + className = (" " + elem.className + " ").replace( rclass, " " ); + + // loop over each item in the removal list + for ( c = 0, cl = removes.length; c < cl; c++ ) { + // Remove until there is nothing to remove, + while ( className.indexOf(" " + removes[ c ] + " ") >= 0 ) { + className = className.replace( " " + removes[ c ] + " " , " " ); + } + } + elem.className = value ? jQuery.trim( className ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( core_rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, option, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one" || index < 0, + values = one ? null : [], + max = one ? index + 1 : options.length, + i = index < 0 ? + max : + one ? index : 0; + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // oldIE doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + // Don't return options that are disabled or in a disabled optgroup + ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) && + ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + // Unused in 1.8, left in so attrFn-stabbers won't die; remove in 1.9 + attrFn: {}, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( pass && jQuery.isFunction( jQuery.fn[ name ] ) ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, value + "" ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, isBool, + i = 0; + + if ( value && elem.nodeType === 1 ) { + + attrNames = value.split( core_rspace ); + + for ( ; i < attrNames.length; i++ ) { + name = attrNames[ i ]; + + if ( name ) { + propName = jQuery.propFix[ name ] || name; + isBool = rboolean.test( name ); + + // See #9699 for explanation of this approach (setting first, then removal) + // Do not do this for boolean attributes (see #10870) + if ( !isBool ) { + jQuery.attr( elem, name, "" ); + } + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( isBool && propName in elem ) { + elem[ propName ] = false; + } + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true, + coords: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.value !== "" : ret.specified ) ? + ret.value : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.value = value + "" ); + } + }; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = value + "" ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); +var rformElems = /^(?:textarea|input|select)$/i, + rtypenamespace = /^([^\.]*|)(?:\.(.+)|)$/, + rhoverHack = /(?:^|\s)hover(\.\S+|)\b/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = jQuery.trim( hoverHack(types) ).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var t, tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + elemData = jQuery.hasData( elem ) && jQuery._data( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = jQuery.trim( hoverHack( types || "" ) ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, "events", true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = []; + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var i, j, cur, ret, selMatch, matched, matches, handleObj, sel, related, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = core_slice.call( arguments ), + run_all = !event.exclusive && !event.namespace, + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + + // Don't process clicks (ONLY) on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) >= 0 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events, metaKey==false if it's undefined (#3368, #11328; IE6/7/8) + event.metaKey = !!event.metaKey; + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + + focus: { + delegateType: "focusin" + }, + blur: { + delegateType: "focusout" + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + var name = "on" + type; + + if ( elem.detachEvent ) { + + // #8545, #7054, preventing memory leaks for custom events in IE6-8 + // detachEvent needed property on element, by name of that event, to properly expose it to GC + if ( typeof elem[ name ] === "undefined" ) { + elem[ name ] = null; + } + + elem.detachEvent( name, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !jQuery._data( form, "_submit_attached" ) ) { + jQuery.event.add( form, "submit._submit", function( event ) { + event._submit_bubble = true; + }); + jQuery._data( form, "_submit_attached", true ); + } + }); + // return undefined since we don't need an event listener + }, + + postDispatch: function( event ) { + // If form was submitted by the user, bubble the event up the tree + if ( event._submit_bubble ) { + delete event._submit_bubble; + if ( this.parentNode && !event.isTrigger ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + } + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed && !event.isTrigger ) { + this._just_changed = false; + } + // Allow triggered, simulated change events (#11500) + jQuery.event.simulate( "change", this, event, true ); + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !jQuery._data( elem, "_change_attached" ) ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + jQuery._data( elem, "_change_attached", true ); + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return !rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); +/*!
+ * Sizzle CSS Selector Engine
+ * Copyright 2012 jQuery Foundation and other contributors
+ * Released under the MIT license
+ * http://sizzlejs.com/
+ */
+(function( window, undefined ) {
+
+var cachedruns,
+ assertGetIdNotName,
+ Expr,
+ getText,
+ isXML,
+ contains,
+ compile,
+ sortOrder,
+ hasDuplicate,
+ outermostContext,
+
+ baseHasDuplicate = true,
+ strundefined = "undefined",
+
+ expando = ( "sizcache" + Math.random() ).replace( ".", "" ),
+
+ Token = String,
+ document = window.document,
+ docElem = document.documentElement,
+ dirruns = 0,
+ done = 0,
+ pop = [].pop,
+ push = [].push,
+ slice = [].slice,
+ // Use a stripped-down indexOf if a native one is unavailable
+ indexOf = [].indexOf || function( elem ) {
+ var i = 0,
+ len = this.length;
+ for ( ; i < len; i++ ) {
+ if ( this[i] === elem ) {
+ return i;
+ }
+ }
+ return -1;
+ },
+
+ // Augment a function for special use by Sizzle
+ markFunction = function( fn, value ) {
+ fn[ expando ] = value == null || value;
+ return fn;
+ },
+
+ createCache = function() {
+ var cache = {},
+ keys = [];
+
+ return markFunction(function( key, value ) {
+ // Only keep the most recent entries
+ if ( keys.push( key ) > Expr.cacheLength ) {
+ delete cache[ keys.shift() ];
+ }
+
+ // Retrieve with (key + " ") to avoid collision with native Object.prototype properties (see Issue #157)
+ return (cache[ key + " " ] = value);
+ }, cache );
+ },
+
+ classCache = createCache(),
+ tokenCache = createCache(),
+ compilerCache = createCache(),
+
+ // Regex
+
+ // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace
+ whitespace = "[\\x20\\t\\r\\n\\f]",
+ // http://www.w3.org/TR/css3-syntax/#characters
+ characterEncoding = "(?:\\\\.|[-\\w]|[^\\x00-\\xa0])+",
+
+ // Loosely modeled on CSS identifier characters
+ // An unquoted value should be a CSS identifier (http://www.w3.org/TR/css3-selectors/#attribute-selectors)
+ // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier
+ identifier = characterEncoding.replace( "w", "w#" ),
+
+ // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors
+ operators = "([*^$|!~]?=)",
+ attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace +
+ "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]",
+
+ // Prefer arguments not in parens/brackets,
+ // then attribute selectors and non-pseudos (denoted by :),
+ // then anything else
+ // These preferences are here to reduce the number of selectors
+ // needing tokenize in the PSEUDO preFilter
+ pseudos = ":(" + characterEncoding + ")(?:\\((?:(['\"])((?:\\\\.|[^\\\\])*?)\\2|([^()[\\]]*|(?:(?:" + attributes + ")|[^:]|\\\\.)*|.*))\\)|)",
+
+ // For matchExpr.POS and matchExpr.needsContext
+ pos = ":(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace +
+ "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)",
+
+ // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+ rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ),
+
+ rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+ rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ),
+ rpseudo = new RegExp( pseudos ),
+
+ // Easily-parseable/retrievable ID or TAG or CLASS selectors
+ rquickExpr = /^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,
+
+ rnot = /^:not/,
+ rsibling = /[\x20\t\r\n\f]*[+~]/,
+ rendsWithNot = /:not\($/,
+
+ rheader = /h\d/i,
+ rinputs = /input|select|textarea|button/i,
+
+ rbackslash = /\\(?!\\)/g,
+
+ matchExpr = {
+ "ID": new RegExp( "^#(" + characterEncoding + ")" ),
+ "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ),
+ "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ),
+ "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ),
+ "ATTR": new RegExp( "^" + attributes ),
+ "PSEUDO": new RegExp( "^" + pseudos ),
+ "POS": new RegExp( pos, "i" ),
+ "CHILD": new RegExp( "^:(only|nth|first|last)-child(?:\\(" + whitespace +
+ "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace +
+ "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+ // For use in libraries implementing .is()
+ "needsContext": new RegExp( "^" + whitespace + "*[>+~]|" + pos, "i" )
+ },
+
+ // Support
+
+ // Used for testing something on an element
+ assert = function( fn ) {
+ var div = document.createElement("div");
+
+ try {
+ return fn( div );
+ } catch (e) {
+ return false;
+ } finally {
+ // release memory in IE
+ div = null;
+ }
+ },
+
+ // Check if getElementsByTagName("*") returns only elements
+ assertTagNameNoComments = assert(function( div ) {
+ div.appendChild( document.createComment("") );
+ return !div.getElementsByTagName("*").length;
+ }),
+
+ // Check if getAttribute returns normalized href attributes
+ assertHrefNotNormalized = assert(function( div ) {
+ div.innerHTML = "<a href='#'></a>";
+ return div.firstChild && typeof div.firstChild.getAttribute !== strundefined &&
+ div.firstChild.getAttribute("href") === "#";
+ }),
+
+ // Check if attributes should be retrieved by attribute nodes
+ assertAttributes = assert(function( div ) {
+ div.innerHTML = "<select></select>";
+ var type = typeof div.lastChild.getAttribute("multiple");
+ // IE8 returns a string for some attributes even when not present
+ return type !== "boolean" && type !== "string";
+ }),
+
+ // Check if getElementsByClassName can be trusted
+ assertUsableClassName = assert(function( div ) {
+ // Opera can't find a second classname (in 9.6)
+ div.innerHTML = "<div class='hidden e'></div><div class='hidden'></div>";
+ if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) {
+ return false;
+ }
+
+ // Safari 3.2 caches class attributes and doesn't catch changes
+ div.lastChild.className = "e";
+ return div.getElementsByClassName("e").length === 2;
+ }),
+
+ // Check if getElementById returns elements by name
+ // Check if getElementsByName privileges form controls or returns elements by ID
+ assertUsableName = assert(function( div ) {
+ // Inject content
+ div.id = expando + 0;
+ div.innerHTML = "<a name='" + expando + "'></a><div name='" + expando + "'></div>";
+ docElem.insertBefore( div, docElem.firstChild );
+
+ // Test
+ var pass = document.getElementsByName &&
+ // buggy browsers will return fewer than the correct 2
+ document.getElementsByName( expando ).length === 2 +
+ // buggy browsers will return more than the correct 0
+ document.getElementsByName( expando + 0 ).length;
+ assertGetIdNotName = !document.getElementById( expando );
+
+ // Cleanup
+ docElem.removeChild( div );
+
+ return pass;
+ });
+
+// If slice is not available, provide a backup
+try {
+ slice.call( docElem.childNodes, 0 )[0].nodeType;
+} catch ( e ) {
+ slice = function( i ) {
+ var elem,
+ results = [];
+ for ( ; (elem = this[i]); i++ ) {
+ results.push( elem );
+ }
+ return results;
+ };
+}
+
+function Sizzle( selector, context, results, seed ) {
+ results = results || [];
+ context = context || document;
+ var match, elem, xml, m,
+ nodeType = context.nodeType;
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ if ( nodeType !== 1 && nodeType !== 9 ) {
+ return [];
+ }
+
+ xml = isXML( context );
+
+ if ( !xml && !seed ) {
+ if ( (match = rquickExpr.exec( selector )) ) {
+ // Speed-up: Sizzle("#ID")
+ if ( (m = match[1]) ) {
+ if ( nodeType === 9 ) {
+ elem = context.getElementById( m );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ if ( elem && elem.parentNode ) {
+ // Handle the case where IE, Opera, and Webkit return items
+ // by name instead of ID
+ if ( elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ } else {
+ return results;
+ }
+ } else {
+ // Context is not a document
+ if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) &&
+ contains( context, elem ) && elem.id === m ) {
+ results.push( elem );
+ return results;
+ }
+ }
+
+ // Speed-up: Sizzle("TAG")
+ } else if ( match[2] ) {
+ push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) );
+ return results;
+
+ // Speed-up: Sizzle(".CLASS")
+ } else if ( (m = match[3]) && assertUsableClassName && context.getElementsByClassName ) {
+ push.apply( results, slice.call(context.getElementsByClassName( m ), 0) );
+ return results;
+ }
+ }
+ }
+
+ // All others
+ return select( selector.replace( rtrim, "$1" ), context, results, seed, xml );
+}
+
+Sizzle.matches = function( expr, elements ) {
+ return Sizzle( expr, null, null, elements );
+};
+
+Sizzle.matchesSelector = function( elem, expr ) {
+ return Sizzle( expr, null, null, [ elem ] ).length > 0;
+};
+
+// Returns a function to use in pseudos for input types
+function createInputPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === type;
+ };
+}
+
+// Returns a function to use in pseudos for buttons
+function createButtonPseudo( type ) {
+ return function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return (name === "input" || name === "button") && elem.type === type;
+ };
+}
+
+// Returns a function to use in pseudos for positionals
+function createPositionalPseudo( fn ) {
+ return markFunction(function( argument ) {
+ argument = +argument;
+ return markFunction(function( seed, matches ) {
+ var j,
+ matchIndexes = fn( [], seed.length, argument ),
+ i = matchIndexes.length;
+
+ // Match elements found at the specified indexes
+ while ( i-- ) {
+ if ( seed[ (j = matchIndexes[i]) ] ) {
+ seed[j] = !(matches[j] = seed[j]);
+ }
+ }
+ });
+ });
+}
+
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+getText = Sizzle.getText = function( elem ) {
+ var node,
+ ret = "",
+ i = 0,
+ nodeType = elem.nodeType;
+
+ if ( nodeType ) {
+ if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+ // Use textContent for elements
+ // innerText usage removed for consistency of new lines (see #11153)
+ if ( typeof elem.textContent === "string" ) {
+ return elem.textContent;
+ } else {
+ // Traverse its children
+ for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+ ret += getText( elem );
+ }
+ }
+ } else if ( nodeType === 3 || nodeType === 4 ) {
+ return elem.nodeValue;
+ }
+ // Do not include comment or processing instruction nodes
+ } else {
+
+ // If no nodeType, this is expected to be an array
+ for ( ; (node = elem[i]); i++ ) {
+ // Do not traverse comment nodes
+ ret += getText( node );
+ }
+ }
+ return ret;
+};
+
+isXML = Sizzle.isXML = function( elem ) {
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = elem && (elem.ownerDocument || elem).documentElement;
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
+};
+
+// Element contains another
+contains = Sizzle.contains = docElem.contains ?
+ function( a, b ) {
+ var adown = a.nodeType === 9 ? a.documentElement : a,
+ bup = b && b.parentNode;
+ return a === bup || !!( bup && bup.nodeType === 1 && adown.contains && adown.contains(bup) );
+ } :
+ docElem.compareDocumentPosition ?
+ function( a, b ) {
+ return b && !!( a.compareDocumentPosition( b ) & 16 );
+ } :
+ function( a, b ) {
+ while ( (b = b.parentNode) ) {
+ if ( b === a ) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+Sizzle.attr = function( elem, name ) {
+ var val,
+ xml = isXML( elem );
+
+ if ( !xml ) {
+ name = name.toLowerCase();
+ }
+ if ( (val = Expr.attrHandle[ name ]) ) {
+ return val( elem );
+ }
+ if ( xml || assertAttributes ) {
+ return elem.getAttribute( name );
+ }
+ val = elem.getAttributeNode( name );
+ return val ?
+ typeof elem[ name ] === "boolean" ?
+ elem[ name ] ? name : null :
+ val.specified ? val.value : null :
+ null;
+};
+
+Expr = Sizzle.selectors = {
+
+ // Can be adjusted by the user
+ cacheLength: 50,
+
+ createPseudo: markFunction,
+
+ match: matchExpr,
+
+ // IE6/7 return a modified href
+ attrHandle: assertHrefNotNormalized ?
+ {} :
+ {
+ "href": function( elem ) {
+ return elem.getAttribute( "href", 2 );
+ },
+ "type": function( elem ) {
+ return elem.getAttribute("type");
+ }
+ },
+
+ find: {
+ "ID": assertGetIdNotName ?
+ function( id, context, xml ) {
+ if ( typeof context.getElementById !== strundefined && !xml ) {
+ var m = context.getElementById( id );
+ // Check parentNode to catch when Blackberry 4.6 returns
+ // nodes that are no longer in the document #6963
+ return m && m.parentNode ? [m] : [];
+ }
+ } :
+ function( id, context, xml ) {
+ if ( typeof context.getElementById !== strundefined && !xml ) {
+ var m = context.getElementById( id );
+
+ return m ?
+ m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ?
+ [m] :
+ undefined :
+ [];
+ }
+ },
+
+ "TAG": assertTagNameNoComments ?
+ function( tag, context ) {
+ if ( typeof context.getElementsByTagName !== strundefined ) {
+ return context.getElementsByTagName( tag );
+ }
+ } :
+ function( tag, context ) {
+ var results = context.getElementsByTagName( tag );
+
+ // Filter out possible comments
+ if ( tag === "*" ) {
+ var elem,
+ tmp = [],
+ i = 0;
+
+ for ( ; (elem = results[i]); i++ ) {
+ if ( elem.nodeType === 1 ) {
+ tmp.push( elem );
+ }
+ }
+
+ return tmp;
+ }
+ return results;
+ },
+
+ "NAME": assertUsableName && function( tag, context ) {
+ if ( typeof context.getElementsByName !== strundefined ) {
+ return context.getElementsByName( name );
+ }
+ },
+
+ "CLASS": assertUsableClassName && function( className, context, xml ) {
+ if ( typeof context.getElementsByClassName !== strundefined && !xml ) {
+ return context.getElementsByClassName( className );
+ }
+ }
+ },
+
+ relative: {
+ ">": { dir: "parentNode", first: true },
+ " ": { dir: "parentNode" },
+ "+": { dir: "previousSibling", first: true },
+ "~": { dir: "previousSibling" }
+ },
+
+ preFilter: {
+ "ATTR": function( match ) {
+ match[1] = match[1].replace( rbackslash, "" );
+
+ // Move the given value to match[3] whether quoted or unquoted
+ match[3] = ( match[4] || match[5] || "" ).replace( rbackslash, "" );
+
+ if ( match[2] === "~=" ) {
+ match[3] = " " + match[3] + " ";
+ }
+
+ return match.slice( 0, 4 );
+ },
+
+ "CHILD": function( match ) {
+ /* matches from matchExpr["CHILD"]
+ 1 type (only|nth|...)
+ 2 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+ 3 xn-component of xn+y argument ([+-]?\d*n|)
+ 4 sign of xn-component
+ 5 x of xn-component
+ 6 sign of y-component
+ 7 y of y-component
+ */
+ match[1] = match[1].toLowerCase();
+
+ if ( match[1] === "nth" ) {
+ // nth-child requires argument
+ if ( !match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ // numeric x and y parameters for Expr.filter.CHILD
+ // remember that false/true cast respectively to 0/1
+ match[3] = +( match[3] ? match[4] + (match[5] || 1) : 2 * ( match[2] === "even" || match[2] === "odd" ) );
+ match[4] = +( ( match[6] + match[7] ) || match[2] === "odd" );
+
+ // other types prohibit arguments
+ } else if ( match[2] ) {
+ Sizzle.error( match[0] );
+ }
+
+ return match;
+ },
+
+ "PSEUDO": function( match ) {
+ var unquoted, excess;
+ if ( matchExpr["CHILD"].test( match[0] ) ) {
+ return null;
+ }
+
+ if ( match[3] ) {
+ match[2] = match[3];
+ } else if ( (unquoted = match[4]) ) {
+ // Only check arguments that contain a pseudo
+ if ( rpseudo.test(unquoted) &&
+ // Get excess from tokenize (recursively)
+ (excess = tokenize( unquoted, true )) &&
+ // advance to the next closing parenthesis
+ (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) {
+
+ // excess is a negative index
+ unquoted = unquoted.slice( 0, excess );
+ match[0] = match[0].slice( 0, excess );
+ }
+ match[2] = unquoted;
+ }
+
+ // Return only captures needed by the pseudo filter method (type and argument)
+ return match.slice( 0, 3 );
+ }
+ },
+
+ filter: {
+ "ID": assertGetIdNotName ?
+ function( id ) {
+ id = id.replace( rbackslash, "" );
+ return function( elem ) {
+ return elem.getAttribute("id") === id;
+ };
+ } :
+ function( id ) {
+ id = id.replace( rbackslash, "" );
+ return function( elem ) {
+ var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id");
+ return node && node.value === id;
+ };
+ },
+
+ "TAG": function( nodeName ) {
+ if ( nodeName === "*" ) {
+ return function() { return true; };
+ }
+ nodeName = nodeName.replace( rbackslash, "" ).toLowerCase();
+
+ return function( elem ) {
+ return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+ };
+ },
+
+ "CLASS": function( className ) {
+ var pattern = classCache[ expando ][ className + " " ];
+
+ return pattern ||
+ (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) &&
+ classCache( className, function( elem ) {
+ return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" );
+ });
+ },
+
+ "ATTR": function( name, operator, check ) {
+ return function( elem, context ) {
+ var result = Sizzle.attr( elem, name );
+
+ if ( result == null ) {
+ return operator === "!=";
+ }
+ if ( !operator ) {
+ return true;
+ }
+
+ result += "";
+
+ return operator === "=" ? result === check :
+ operator === "!=" ? result !== check :
+ operator === "^=" ? check && result.indexOf( check ) === 0 :
+ operator === "*=" ? check && result.indexOf( check ) > -1 :
+ operator === "$=" ? check && result.substr( result.length - check.length ) === check :
+ operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 :
+ operator === "|=" ? result === check || result.substr( 0, check.length + 1 ) === check + "-" :
+ false;
+ };
+ },
+
+ "CHILD": function( type, argument, first, last ) {
+
+ if ( type === "nth" ) {
+ return function( elem ) {
+ var node, diff,
+ parent = elem.parentNode;
+
+ if ( first === 1 && last === 0 ) {
+ return true;
+ }
+
+ if ( parent ) {
+ diff = 0;
+ for ( node = parent.firstChild; node; node = node.nextSibling ) {
+ if ( node.nodeType === 1 ) {
+ diff++;
+ if ( elem === node ) {
+ break;
+ }
+ }
+ }
+ }
+
+ // Incorporate the offset (or cast to NaN), then check against cycle size
+ diff -= last;
+ return diff === first || ( diff % first === 0 && diff / first >= 0 );
+ };
+ }
+
+ return function( elem ) {
+ var node = elem;
+
+ switch ( type ) {
+ case "only":
+ case "first":
+ while ( (node = node.previousSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ if ( type === "first" ) {
+ return true;
+ }
+
+ node = elem;
+
+ /* falls through */
+ case "last":
+ while ( (node = node.nextSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+
+ return true;
+ }
+ };
+ },
+
+ "PSEUDO": function( pseudo, argument ) {
+ // pseudo-class names are case-insensitive
+ // http://www.w3.org/TR/selectors/#pseudo-classes
+ // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+ // Remember that setFilters inherits from pseudos
+ var args,
+ fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+ Sizzle.error( "unsupported pseudo: " + pseudo );
+
+ // The user may use createPseudo to indicate that
+ // arguments are needed to create the filter function
+ // just as Sizzle does
+ if ( fn[ expando ] ) {
+ return fn( argument );
+ }
+
+ // But maintain support for old signatures
+ if ( fn.length > 1 ) {
+ args = [ pseudo, pseudo, "", argument ];
+ return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+ markFunction(function( seed, matches ) {
+ var idx,
+ matched = fn( seed, argument ),
+ i = matched.length;
+ while ( i-- ) {
+ idx = indexOf.call( seed, matched[i] );
+ seed[ idx ] = !( matches[ idx ] = matched[i] );
+ }
+ }) :
+ function( elem ) {
+ return fn( elem, 0, args );
+ };
+ }
+
+ return fn;
+ }
+ },
+
+ pseudos: {
+ "not": markFunction(function( selector ) {
+ // Trim the selector passed to compile
+ // to avoid treating leading and trailing
+ // spaces as combinators
+ var input = [],
+ results = [],
+ matcher = compile( selector.replace( rtrim, "$1" ) );
+
+ return matcher[ expando ] ?
+ markFunction(function( seed, matches, context, xml ) {
+ var elem,
+ unmatched = matcher( seed, null, xml, [] ),
+ i = seed.length;
+
+ // Match elements unmatched by `matcher`
+ while ( i-- ) {
+ if ( (elem = unmatched[i]) ) {
+ seed[i] = !(matches[i] = elem);
+ }
+ }
+ }) :
+ function( elem, context, xml ) {
+ input[0] = elem;
+ matcher( input, null, xml, results );
+ return !results.pop();
+ };
+ }),
+
+ "has": markFunction(function( selector ) {
+ return function( elem ) {
+ return Sizzle( selector, elem ).length > 0;
+ };
+ }),
+
+ "contains": markFunction(function( text ) {
+ return function( elem ) {
+ return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1;
+ };
+ }),
+
+ "enabled": function( elem ) {
+ return elem.disabled === false;
+ },
+
+ "disabled": function( elem ) {
+ return elem.disabled === true;
+ },
+
+ "checked": function( elem ) {
+ // In CSS3, :checked should return both checked and selected elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ var nodeName = elem.nodeName.toLowerCase();
+ return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected);
+ },
+
+ "selected": function( elem ) {
+ // Accessing this property makes selected-by-default
+ // options in Safari work properly
+ if ( elem.parentNode ) {
+ elem.parentNode.selectedIndex;
+ }
+
+ return elem.selected === true;
+ },
+
+ "parent": function( elem ) {
+ return !Expr.pseudos["empty"]( elem );
+ },
+
+ "empty": function( elem ) {
+ // http://www.w3.org/TR/selectors/#empty-pseudo
+ // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)),
+ // not comment, processing instructions, or others
+ // Thanks to Diego Perini for the nodeName shortcut
+ // Greater than "@" means alpha characters (specifically not starting with "#" or "?")
+ var nodeType;
+ elem = elem.firstChild;
+ while ( elem ) {
+ if ( elem.nodeName > "@" || (nodeType = elem.nodeType) === 3 || nodeType === 4 ) {
+ return false;
+ }
+ elem = elem.nextSibling;
+ }
+ return true;
+ },
+
+ "header": function( elem ) {
+ return rheader.test( elem.nodeName );
+ },
+
+ "text": function( elem ) {
+ var type, attr;
+ // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc)
+ // use getAttribute instead to test this case
+ return elem.nodeName.toLowerCase() === "input" &&
+ (type = elem.type) === "text" &&
+ ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === type );
+ },
+
+ // Input types
+ "radio": createInputPseudo("radio"),
+ "checkbox": createInputPseudo("checkbox"),
+ "file": createInputPseudo("file"),
+ "password": createInputPseudo("password"),
+ "image": createInputPseudo("image"),
+
+ "submit": createButtonPseudo("submit"),
+ "reset": createButtonPseudo("reset"),
+
+ "button": function( elem ) {
+ var name = elem.nodeName.toLowerCase();
+ return name === "input" && elem.type === "button" || name === "button";
+ },
+
+ "input": function( elem ) {
+ return rinputs.test( elem.nodeName );
+ },
+
+ "focus": function( elem ) {
+ var doc = elem.ownerDocument;
+ return elem === doc.activeElement && (!doc.hasFocus || doc.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex);
+ },
+
+ "active": function( elem ) {
+ return elem === elem.ownerDocument.activeElement;
+ },
+
+ // Positional types
+ "first": createPositionalPseudo(function() {
+ return [ 0 ];
+ }),
+
+ "last": createPositionalPseudo(function( matchIndexes, length ) {
+ return [ length - 1 ];
+ }),
+
+ "eq": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ return [ argument < 0 ? argument + length : argument ];
+ }),
+
+ "even": createPositionalPseudo(function( matchIndexes, length ) {
+ for ( var i = 0; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "odd": createPositionalPseudo(function( matchIndexes, length ) {
+ for ( var i = 1; i < length; i += 2 ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "lt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ for ( var i = argument < 0 ? argument + length : argument; --i >= 0; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ }),
+
+ "gt": createPositionalPseudo(function( matchIndexes, length, argument ) {
+ for ( var i = argument < 0 ? argument + length : argument; ++i < length; ) {
+ matchIndexes.push( i );
+ }
+ return matchIndexes;
+ })
+ }
+};
+
+function siblingCheck( a, b, ret ) {
+ if ( a === b ) {
+ return ret;
+ }
+
+ var cur = a.nextSibling;
+
+ while ( cur ) {
+ if ( cur === b ) {
+ return -1;
+ }
+
+ cur = cur.nextSibling;
+ }
+
+ return 1;
+}
+
+sortOrder = docElem.compareDocumentPosition ?
+ function( a, b ) {
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+ }
+
+ return ( !a.compareDocumentPosition || !b.compareDocumentPosition ?
+ a.compareDocumentPosition :
+ a.compareDocumentPosition(b) & 4
+ ) ? -1 : 1;
+ } :
+ function( a, b ) {
+ // The nodes are identical, we can exit early
+ if ( a === b ) {
+ hasDuplicate = true;
+ return 0;
+
+ // Fallback to using sourceIndex (in IE) if it's available on both nodes
+ } else if ( a.sourceIndex && b.sourceIndex ) {
+ return a.sourceIndex - b.sourceIndex;
+ }
+
+ var al, bl,
+ ap = [],
+ bp = [],
+ aup = a.parentNode,
+ bup = b.parentNode,
+ cur = aup;
+
+ // If the nodes are siblings (or identical) we can do a quick check
+ if ( aup === bup ) {
+ return siblingCheck( a, b );
+
+ // If no parents were found then the nodes are disconnected
+ } else if ( !aup ) {
+ return -1;
+
+ } else if ( !bup ) {
+ return 1;
+ }
+
+ // Otherwise they're somewhere else in the tree so we need
+ // to build up a full list of the parentNodes for comparison
+ while ( cur ) {
+ ap.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ cur = bup;
+
+ while ( cur ) {
+ bp.unshift( cur );
+ cur = cur.parentNode;
+ }
+
+ al = ap.length;
+ bl = bp.length;
+
+ // Start walking down the tree looking for a discrepancy
+ for ( var i = 0; i < al && i < bl; i++ ) {
+ if ( ap[i] !== bp[i] ) {
+ return siblingCheck( ap[i], bp[i] );
+ }
+ }
+
+ // We ended someplace up the tree so do a sibling check
+ return i === al ?
+ siblingCheck( a, bp[i], -1 ) :
+ siblingCheck( ap[i], b, 1 );
+ };
+
+// Always assume the presence of duplicates if sort doesn't
+// pass them to our comparison function (as in Google Chrome).
+[0, 0].sort( sortOrder );
+baseHasDuplicate = !hasDuplicate;
+
+// Document sorting and removing duplicates
+Sizzle.uniqueSort = function( results ) {
+ var elem,
+ duplicates = [],
+ i = 1,
+ j = 0;
+
+ hasDuplicate = baseHasDuplicate;
+ results.sort( sortOrder );
+
+ if ( hasDuplicate ) {
+ for ( ; (elem = results[i]); i++ ) {
+ if ( elem === results[ i - 1 ] ) {
+ j = duplicates.push( i );
+ }
+ }
+ while ( j-- ) {
+ results.splice( duplicates[ j ], 1 );
+ }
+ }
+
+ return results;
+};
+
+Sizzle.error = function( msg ) {
+ throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+function tokenize( selector, parseOnly ) {
+ var matched, match, tokens, type,
+ soFar, groups, preFilters,
+ cached = tokenCache[ expando ][ selector + " " ];
+
+ if ( cached ) {
+ return parseOnly ? 0 : cached.slice( 0 );
+ }
+
+ soFar = selector;
+ groups = [];
+ preFilters = Expr.preFilter;
+
+ while ( soFar ) {
+
+ // Comma and first run
+ if ( !matched || (match = rcomma.exec( soFar )) ) {
+ if ( match ) {
+ // Don't consume trailing commas as valid
+ soFar = soFar.slice( match[0].length ) || soFar;
+ }
+ groups.push( tokens = [] );
+ }
+
+ matched = false;
+
+ // Combinators
+ if ( (match = rcombinators.exec( soFar )) ) {
+ tokens.push( matched = new Token( match.shift() ) );
+ soFar = soFar.slice( matched.length );
+
+ // Cast descendant combinators to space
+ matched.type = match[0].replace( rtrim, " " );
+ }
+
+ // Filters
+ for ( type in Expr.filter ) {
+ if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] ||
+ (match = preFilters[ type ]( match ))) ) {
+
+ tokens.push( matched = new Token( match.shift() ) );
+ soFar = soFar.slice( matched.length );
+ matched.type = type;
+ matched.matches = match;
+ }
+ }
+
+ if ( !matched ) {
+ break;
+ }
+ }
+
+ // Return the length of the invalid excess
+ // if we're just parsing
+ // Otherwise, throw an error or return tokens
+ return parseOnly ?
+ soFar.length :
+ soFar ?
+ Sizzle.error( selector ) :
+ // Cache the tokens
+ tokenCache( selector, groups ).slice( 0 );
+}
+
+function addCombinator( matcher, combinator, base ) {
+ var dir = combinator.dir,
+ checkNonElements = base && combinator.dir === "parentNode",
+ doneName = done++;
+
+ return combinator.first ?
+ // Check against closest ancestor/preceding element
+ function( elem, context, xml ) {
+ while ( (elem = elem[ dir ]) ) {
+ if ( checkNonElements || elem.nodeType === 1 ) {
+ return matcher( elem, context, xml );
+ }
+ }
+ } :
+
+ // Check against all ancestor/preceding elements
+ function( elem, context, xml ) {
+ // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching
+ if ( !xml ) {
+ var cache,
+ dirkey = dirruns + " " + doneName + " ",
+ cachedkey = dirkey + cachedruns;
+ while ( (elem = elem[ dir ]) ) {
+ if ( checkNonElements || elem.nodeType === 1 ) {
+ if ( (cache = elem[ expando ]) === cachedkey ) {
+ return elem.sizset;
+ } else if ( typeof cache === "string" && cache.indexOf(dirkey) === 0 ) {
+ if ( elem.sizset ) {
+ return elem;
+ }
+ } else {
+ elem[ expando ] = cachedkey;
+ if ( matcher( elem, context, xml ) ) {
+ elem.sizset = true;
+ return elem;
+ }
+ elem.sizset = false;
+ }
+ }
+ }
+ } else {
+ while ( (elem = elem[ dir ]) ) {
+ if ( checkNonElements || elem.nodeType === 1 ) {
+ if ( matcher( elem, context, xml ) ) {
+ return elem;
+ }
+ }
+ }
+ }
+ };
+}
+
+function elementMatcher( matchers ) {
+ return matchers.length > 1 ?
+ function( elem, context, xml ) {
+ var i = matchers.length;
+ while ( i-- ) {
+ if ( !matchers[i]( elem, context, xml ) ) {
+ return false;
+ }
+ }
+ return true;
+ } :
+ matchers[0];
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+ var elem,
+ newUnmatched = [],
+ i = 0,
+ len = unmatched.length,
+ mapped = map != null;
+
+ for ( ; i < len; i++ ) {
+ if ( (elem = unmatched[i]) ) {
+ if ( !filter || filter( elem, context, xml ) ) {
+ newUnmatched.push( elem );
+ if ( mapped ) {
+ map.push( i );
+ }
+ }
+ }
+ }
+
+ return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+ if ( postFilter && !postFilter[ expando ] ) {
+ postFilter = setMatcher( postFilter );
+ }
+ if ( postFinder && !postFinder[ expando ] ) {
+ postFinder = setMatcher( postFinder, postSelector );
+ }
+ return markFunction(function( seed, results, context, xml ) {
+ var temp, i, elem,
+ preMap = [],
+ postMap = [],
+ preexisting = results.length,
+
+ // Get initial elements from seed or context
+ elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ),
+
+ // Prefilter to get matcher input, preserving a map for seed-results synchronization
+ matcherIn = preFilter && ( seed || !selector ) ?
+ condense( elems, preMap, preFilter, context, xml ) :
+ elems,
+
+ matcherOut = matcher ?
+ // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+ postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+ // ...intermediate processing is necessary
+ [] :
+
+ // ...otherwise use results directly
+ results :
+ matcherIn;
+
+ // Find primary matches
+ if ( matcher ) {
+ matcher( matcherIn, matcherOut, context, xml );
+ }
+
+ // Apply postFilter
+ if ( postFilter ) {
+ temp = condense( matcherOut, postMap );
+ postFilter( temp, [], context, xml );
+
+ // Un-match failing elements by moving them back to matcherIn
+ i = temp.length;
+ while ( i-- ) {
+ if ( (elem = temp[i]) ) {
+ matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem);
+ }
+ }
+ }
+
+ if ( seed ) {
+ if ( postFinder || preFilter ) {
+ if ( postFinder ) {
+ // Get the final matcherOut by condensing this intermediate into postFinder contexts
+ temp = [];
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) ) {
+ // Restore matcherIn since elem is not yet a final match
+ temp.push( (matcherIn[i] = elem) );
+ }
+ }
+ postFinder( null, (matcherOut = []), temp, xml );
+ }
+
+ // Move matched elements from seed to results to keep them synchronized
+ i = matcherOut.length;
+ while ( i-- ) {
+ if ( (elem = matcherOut[i]) &&
+ (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) {
+
+ seed[temp] = !(results[temp] = elem);
+ }
+ }
+ }
+
+ // Add elements to results, through postFinder if defined
+ } else {
+ matcherOut = condense(
+ matcherOut === results ?
+ matcherOut.splice( preexisting, matcherOut.length ) :
+ matcherOut
+ );
+ if ( postFinder ) {
+ postFinder( null, results, matcherOut, xml );
+ } else {
+ push.apply( results, matcherOut );
+ }
+ }
+ });
+}
+
+function matcherFromTokens( tokens ) {
+ var checkContext, matcher, j,
+ len = tokens.length,
+ leadingRelative = Expr.relative[ tokens[0].type ],
+ implicitRelative = leadingRelative || Expr.relative[" "],
+ i = leadingRelative ? 1 : 0,
+
+ // The foundational matcher ensures that elements are reachable from top-level context(s)
+ matchContext = addCombinator( function( elem ) {
+ return elem === checkContext;
+ }, implicitRelative, true ),
+ matchAnyContext = addCombinator( function( elem ) {
+ return indexOf.call( checkContext, elem ) > -1;
+ }, implicitRelative, true ),
+ matchers = [ function( elem, context, xml ) {
+ return ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+ (checkContext = context).nodeType ?
+ matchContext( elem, context, xml ) :
+ matchAnyContext( elem, context, xml ) );
+ } ];
+
+ for ( ; i < len; i++ ) {
+ if ( (matcher = Expr.relative[ tokens[i].type ]) ) {
+ matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ];
+ } else {
+ matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches );
+
+ // Return special upon seeing a positional matcher
+ if ( matcher[ expando ] ) {
+ // Find the next relative operator (if any) for proper handling
+ j = ++i;
+ for ( ; j < len; j++ ) {
+ if ( Expr.relative[ tokens[j].type ] ) {
+ break;
+ }
+ }
+ return setMatcher(
+ i > 1 && elementMatcher( matchers ),
+ i > 1 && tokens.slice( 0, i - 1 ).join("").replace( rtrim, "$1" ),
+ matcher,
+ i < j && matcherFromTokens( tokens.slice( i, j ) ),
+ j < len && matcherFromTokens( (tokens = tokens.slice( j )) ),
+ j < len && tokens.join("")
+ );
+ }
+ matchers.push( matcher );
+ }
+ }
+
+ return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+ var bySet = setMatchers.length > 0,
+ byElement = elementMatchers.length > 0,
+ superMatcher = function( seed, context, xml, results, expandContext ) {
+ var elem, j, matcher,
+ setMatched = [],
+ matchedCount = 0,
+ i = "0",
+ unmatched = seed && [],
+ outermost = expandContext != null,
+ contextBackup = outermostContext,
+ // We must always have either seed elements or context
+ elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ),
+ // Nested matchers should use non-integer dirruns
+ dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.E);
+
+ if ( outermost ) {
+ outermostContext = context !== document && context;
+ cachedruns = superMatcher.el;
+ }
+
+ // Add elements passing elementMatchers directly to results
+ for ( ; (elem = elems[i]) != null; i++ ) {
+ if ( byElement && elem ) {
+ for ( j = 0; (matcher = elementMatchers[j]); j++ ) {
+ if ( matcher( elem, context, xml ) ) {
+ results.push( elem );
+ break;
+ }
+ }
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ cachedruns = ++superMatcher.el;
+ }
+ }
+
+ // Track unmatched elements for set filters
+ if ( bySet ) {
+ // They will have gone through all possible matchers
+ if ( (elem = !matcher && elem) ) {
+ matchedCount--;
+ }
+
+ // Lengthen the array for every element, matched or not
+ if ( seed ) {
+ unmatched.push( elem );
+ }
+ }
+ }
+
+ // Apply set filters to unmatched elements
+ matchedCount += i;
+ if ( bySet && i !== matchedCount ) {
+ for ( j = 0; (matcher = setMatchers[j]); j++ ) {
+ matcher( unmatched, setMatched, context, xml );
+ }
+
+ if ( seed ) {
+ // Reintegrate element matches to eliminate the need for sorting
+ if ( matchedCount > 0 ) {
+ while ( i-- ) {
+ if ( !(unmatched[i] || setMatched[i]) ) {
+ setMatched[i] = pop.call( results );
+ }
+ }
+ }
+
+ // Discard index placeholder values to get only actual matches
+ setMatched = condense( setMatched );
+ }
+
+ // Add matches to results
+ push.apply( results, setMatched );
+
+ // Seedless set matches succeeding multiple successful matchers stipulate sorting
+ if ( outermost && !seed && setMatched.length > 0 &&
+ ( matchedCount + setMatchers.length ) > 1 ) {
+
+ Sizzle.uniqueSort( results );
+ }
+ }
+
+ // Override manipulation of globals by nested matchers
+ if ( outermost ) {
+ dirruns = dirrunsUnique;
+ outermostContext = contextBackup;
+ }
+
+ return unmatched;
+ };
+
+ superMatcher.el = 0;
+ return bySet ?
+ markFunction( superMatcher ) :
+ superMatcher;
+}
+
+compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) {
+ var i,
+ setMatchers = [],
+ elementMatchers = [],
+ cached = compilerCache[ expando ][ selector + " " ];
+
+ if ( !cached ) {
+ // Generate a function of recursive functions that can be used to check each element
+ if ( !group ) {
+ group = tokenize( selector );
+ }
+ i = group.length;
+ while ( i-- ) {
+ cached = matcherFromTokens( group[i] );
+ if ( cached[ expando ] ) {
+ setMatchers.push( cached );
+ } else {
+ elementMatchers.push( cached );
+ }
+ }
+
+ // Cache the compiled function
+ cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) );
+ }
+ return cached;
+};
+
+function multipleContexts( selector, contexts, results ) {
+ var i = 0,
+ len = contexts.length;
+ for ( ; i < len; i++ ) {
+ Sizzle( selector, contexts[i], results );
+ }
+ return results;
+}
+
+function select( selector, context, results, seed, xml ) {
+ var i, tokens, token, type, find,
+ match = tokenize( selector ),
+ j = match.length;
+
+ if ( !seed ) {
+ // Try to minimize operations if there is only one group
+ if ( match.length === 1 ) {
+
+ // Take a shortcut and set the context if the root selector is an ID
+ tokens = match[0] = match[0].slice( 0 );
+ if ( tokens.length > 2 && (token = tokens[0]).type === "ID" &&
+ context.nodeType === 9 && !xml &&
+ Expr.relative[ tokens[1].type ] ) {
+
+ context = Expr.find["ID"]( token.matches[0].replace( rbackslash, "" ), context, xml )[0];
+ if ( !context ) {
+ return results;
+ }
+
+ selector = selector.slice( tokens.shift().length );
+ }
+
+ // Fetch a seed set for right-to-left matching
+ for ( i = matchExpr["POS"].test( selector ) ? -1 : tokens.length - 1; i >= 0; i-- ) {
+ token = tokens[i];
+
+ // Abort if we hit a combinator
+ if ( Expr.relative[ (type = token.type) ] ) {
+ break;
+ }
+ if ( (find = Expr.find[ type ]) ) {
+ // Search, expanding context for leading sibling combinators
+ if ( (seed = find(
+ token.matches[0].replace( rbackslash, "" ),
+ rsibling.test( tokens[0].type ) && context.parentNode || context,
+ xml
+ )) ) {
+
+ // If seed is empty or no tokens remain, we can return early
+ tokens.splice( i, 1 );
+ selector = seed.length && tokens.join("");
+ if ( !selector ) {
+ push.apply( results, slice.call( seed, 0 ) );
+ return results;
+ }
+
+ break;
+ }
+ }
+ }
+ }
+ }
+
+ // Compile and execute a filtering function
+ // Provide `match` to avoid retokenization if we modified the selector above
+ compile( selector, match )(
+ seed,
+ context,
+ xml,
+ results,
+ rsibling.test( selector )
+ );
+ return results;
+}
+
+if ( document.querySelectorAll ) {
+ (function() {
+ var disconnectedMatch,
+ oldSelect = select,
+ rescape = /'|\\/g,
+ rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,
+
+ // qSa(:focus) reports false when true (Chrome 21), no need to also add to buggyMatches since matches checks buggyQSA
+ // A support test would require too much code (would include document ready)
+ rbuggyQSA = [ ":focus" ],
+
+ // matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+ // A support test would require too much code (would include document ready)
+ // just skip matchesSelector for :active
+ rbuggyMatches = [ ":active" ],
+ matches = docElem.matchesSelector ||
+ docElem.mozMatchesSelector ||
+ docElem.webkitMatchesSelector ||
+ docElem.oMatchesSelector ||
+ docElem.msMatchesSelector;
+
+ // Build QSA regex
+ // Regex strategy adopted from Diego Perini
+ assert(function( div ) {
+ // Select is set to empty string on purpose
+ // This is to test IE's treatment of not explictly
+ // setting a boolean content attribute,
+ // since its presence should be enough
+ // http://bugs.jquery.com/ticket/12359
+ div.innerHTML = "<select><option selected=''></option></select>";
+
+ // IE8 - Some boolean attributes are not treated correctly
+ if ( !div.querySelectorAll("[selected]").length ) {
+ rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" );
+ }
+
+ // Webkit/Opera - :checked should return selected option elements
+ // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+ // IE8 throws error here (do not put tests after this one)
+ if ( !div.querySelectorAll(":checked").length ) {
+ rbuggyQSA.push(":checked");
+ }
+ });
+
+ assert(function( div ) {
+
+ // Opera 10-12/IE9 - ^= $= *= and empty values
+ // Should not select anything
+ div.innerHTML = "<p test=''></p>";
+ if ( div.querySelectorAll("[test^='']").length ) {
+ rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" );
+ }
+
+ // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+ // IE8 throws error here (do not put tests after this one)
+ div.innerHTML = "<input type='hidden'/>";
+ if ( !div.querySelectorAll(":enabled").length ) {
+ rbuggyQSA.push(":enabled", ":disabled");
+ }
+ });
+
+ // rbuggyQSA always contains :focus, so no need for a length check
+ rbuggyQSA = /* rbuggyQSA.length && */ new RegExp( rbuggyQSA.join("|") );
+
+ select = function( selector, context, results, seed, xml ) {
+ // Only use querySelectorAll when not filtering,
+ // when this is not xml,
+ // and when no QSA bugs apply
+ if ( !seed && !xml && !rbuggyQSA.test( selector ) ) {
+ var groups, i,
+ old = true,
+ nid = expando,
+ newContext = context,
+ newSelector = context.nodeType === 9 && selector;
+
+ // qSA works strangely on Element-rooted queries
+ // We can work around this by specifying an extra ID on the root
+ // and working up from there (Thanks to Andrew Dupont for the technique)
+ // IE 8 doesn't work on object elements
+ if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) {
+ groups = tokenize( selector );
+
+ if ( (old = context.getAttribute("id")) ) {
+ nid = old.replace( rescape, "\\$&" );
+ } else {
+ context.setAttribute( "id", nid );
+ }
+ nid = "[id='" + nid + "'] ";
+
+ i = groups.length;
+ while ( i-- ) {
+ groups[i] = nid + groups[i].join("");
+ }
+ newContext = rsibling.test( selector ) && context.parentNode || context;
+ newSelector = groups.join(",");
+ }
+
+ if ( newSelector ) {
+ try {
+ push.apply( results, slice.call( newContext.querySelectorAll(
+ newSelector
+ ), 0 ) );
+ return results;
+ } catch(qsaError) {
+ } finally {
+ if ( !old ) {
+ context.removeAttribute("id");
+ }
+ }
+ }
+ }
+
+ return oldSelect( selector, context, results, seed, xml );
+ };
+
+ if ( matches ) {
+ assert(function( div ) {
+ // Check to see if it's possible to do matchesSelector
+ // on a disconnected node (IE 9)
+ disconnectedMatch = matches.call( div, "div" );
+
+ // This should fail with an exception
+ // Gecko does not error, returns false instead
+ try {
+ matches.call( div, "[test!='']:sizzle" );
+ rbuggyMatches.push( "!=", pseudos );
+ } catch ( e ) {}
+ });
+
+ // rbuggyMatches always contains :active and :focus, so no need for a length check
+ rbuggyMatches = /* rbuggyMatches.length && */ new RegExp( rbuggyMatches.join("|") );
+
+ Sizzle.matchesSelector = function( elem, expr ) {
+ // Make sure that attribute selectors are quoted
+ expr = expr.replace( rattributeQuotes, "='$1']" );
+
+ // rbuggyMatches always contains :active, so no need for an existence check
+ if ( !isXML( elem ) && !rbuggyMatches.test( expr ) && !rbuggyQSA.test( expr ) ) {
+ try {
+ var ret = matches.call( elem, expr );
+
+ // IE 9's matchesSelector returns false on disconnected nodes
+ if ( ret || disconnectedMatch ||
+ // As well, disconnected nodes are said to be in a document
+ // fragment in IE 9
+ elem.document && elem.document.nodeType !== 11 ) {
+ return ret;
+ }
+ } catch(e) {}
+ }
+
+ return Sizzle( expr, null, null, [ elem ] ).length > 0;
+ };
+ }
+ })();
+}
+
+// Deprecated
+Expr.pseudos["nth"] = Expr.pseudos["eq"];
+
+// Back-compat
+function setFilters() {}
+Expr.filters = setFilters.prototype = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +
+
+})( window );
+var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var i, l, length, n, r, ret, + self = this; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + ret = this.pushStack( "", "find", selector ); + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var i, + targets = jQuery( target, this ), + len = targets.length; + + return this.filter(function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + ret = [], + pos = rneedsContext.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[i]; + + while ( cur && cur.ownerDocument && cur !== context && cur.nodeType !== 11 ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + } + cur = cur.parentNode; + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +function sibling( cur, dir ) { + do { + cur = cur[ dir ]; + } while ( cur && cur.nodeType !== 1 ); + + return cur; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( this.length > 1 && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, core_slice.call( arguments ).join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} +function createSafeFragment( document ) { + var list = nodeNames.split( "|" ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + + "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", + rinlinejQuery = / jQuery\d+="(?:null|\d+)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnoInnerhtml = /<(?:script|style|link)/i, + rnocache = /<(?:script|object|embed|option|style)/i, + rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"), + rcheckableType = /^(?:checkbox|radio)$/, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)|[\]\-]{2}>\s*$/g, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ), + fragmentDiv = safeFragment.appendChild( document.createElement("div") ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE6-8 can't serialize link, script, style, or any html5 (NoScope) tags, +// unless wrapped in a div with non-breaking characters in front of it. +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "X<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( value ) { + return jQuery.access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); + }, null, value, arguments.length ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + var isFunction = jQuery.isFunction( html ); + + return this.each(function(i) { + jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( set, this ), "before", this.selector ); + } + }, + + after: function() { + if ( !isDisconnected( this[0] ) ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } + + if ( arguments.length ) { + var set = jQuery.clean( arguments ); + return this.pushStack( jQuery.merge( this, set ), "after", this.selector ); + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + var elem, + i = 0; + + for ( ; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + return jQuery.access( this, function( value ) { + var elem = this[0] || {}, + i = 0, + l = this.length; + + if ( value === undefined ) { + return elem.nodeType === 1 ? + elem.innerHTML.replace( rinlinejQuery, "" ) : + undefined; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + ( jQuery.support.htmlSerialize || !rnoshimcache.test( value ) ) && + ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && + !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { + + value = value.replace( rxhtmlTag, "<$1></$2>" ); + + try { + for (; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + elem = this[i] || {}; + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName( "*" ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch(e) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function( value ) { + if ( !isDisconnected( this[0] ) ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } + + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + + // Flatten any nested arrays + args = [].concat.apply( [], args ); + + var results, first, fragment, iNoClone, + i = 0, + value = args[0], + scripts = [], + l = this.length; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && l > 1 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call( this, i, table ? self.html() : undefined ); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + results = jQuery.buildFragment( args, this, scripts ); + fragment = results.fragment; + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + // Use the original fragment for the last item instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + // Fragments from the fragment cache must always be cloned and never used in place. + for ( iNoClone = results.cacheable || l - 1; i < l; i++ ) { + callback.call( + table && jQuery.nodeName( this[i], "table" ) ? + findOrAppend( this[i], "tbody" ) : + this[i], + i === iNoClone ? + fragment : + jQuery.clone( fragment, true, true ) + ); + } + } + + // Fix #11809: Avoid leaking memory + fragment = first = null; + + if ( scripts.length ) { + jQuery.each( scripts, function( i, elem ) { + if ( elem.src ) { + if ( jQuery.ajax ) { + jQuery.ajax({ + url: elem.src, + type: "GET", + dataType: "script", + async: false, + global: false, + "throws": true + }); + } else { + jQuery.error("no ajax"); + } + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + }); + } + } + + return this; + } +}); + +function findOrAppend( elem, tag ) { + return elem.getElementsByTagName( tag )[0] || elem.appendChild( elem.ownerDocument.createElement( tag ) ); +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + if ( nodeName === "object" ) { + // IE6-10 improperly clones children of object elements using classid. + // IE10 throws NoModificationAllowedError if parent is null, #12132. + if ( dest.parentNode ) { + dest.outerHTML = src.outerHTML; + } + + // This path appears unavoidable for IE9. When cloning an object + // element in IE9, the outerHTML strategy above is not sufficient. + // If the src has innerHTML and the destination does not, + // copy the src.innerHTML into the dest.innerHTML. #10324 + if ( jQuery.support.html5Clone && (src.innerHTML && !jQuery.trim(dest.innerHTML)) ) { + dest.innerHTML = src.innerHTML; + } + + } else if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + + dest.defaultChecked = dest.checked = src.checked; + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + + // IE blanks contents when cloning scripts + } else if ( nodeName === "script" && dest.text !== src.text ) { + dest.text = src.text; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, context, scripts ) { + var fragment, cacheable, cachehit, + first = args[ 0 ]; + + // Set context from what may come in as undefined or a jQuery collection or a node + // Updated to fix #12266 where accessing context[0] could throw an exception in IE9/10 & + // also doubles as fix for #8950 where plain objects caused createDocumentFragment exception + context = context || document; + context = !context.nodeType && context[0] || context; + context = context.ownerDocument || context; + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && context === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { + + // Mark cacheable and look for a hit + cacheable = true; + fragment = jQuery.fragments[ first ]; + cachehit = fragment !== undefined; + } + + if ( !fragment ) { + fragment = context.createDocumentFragment(); + jQuery.clean( args, context, fragment, scripts ); + + // Update the cache, but only store false + // unless this is a second parsing of the same content + if ( cacheable ) { + jQuery.fragments[ first ] = cachehit && fragment; + } + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + i = 0, + ret = [], + insert = jQuery( selector ), + l = insert.length, + parent = this.length === 1 && this[0].parentNode; + + if ( (parent == null || parent && parent.nodeType === 11 && parent.childNodes.length === 1) && l === 1 ) { + insert[ original ]( this[0] ); + return this; + } else { + for ( ; i < l; i++ ) { + elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( rcheckableType.test( elem.type ) ) { + elem.defaultChecked = elem.checked; + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var srcElements, + destElements, + i, + clone; + + if ( jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ) { + clone = elem.cloneNode( true ); + + // IE<=8 does not properly clone detached, unknown element nodes + } else { + fragmentDiv.innerHTML = elem.outerHTML; + fragmentDiv.removeChild( clone = fragmentDiv.firstChild ); + } + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var i, j, elem, tag, wrap, depth, div, hasBody, tbody, len, handleScript, jsTags, + safe = context === document && safeFragment, + ret = []; + + // Ensure that context is a document + if ( !context || typeof context.createDocumentFragment === "undefined" ) { + context = document; + } + + // Use the already-created safe fragment if context permits + for ( i = 0; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Ensure a safe container in which to render the html + safe = safe || createSafeFragment( context ); + div = context.createElement("div"); + safe.appendChild( div ); + + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Go to html and back, then peel off extra wrappers + tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + depth = wrap[0]; + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + hasBody = rtbody.test(elem); + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + + // Take out of fragment container (we need a fresh div each time) + div.parentNode.removeChild( div ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + jQuery.merge( ret, elem ); + } + } + + // Fix #11356: Clear elements from safeFragment + if ( div ) { + elem = div = safe = null; + } + + // Reset defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + if ( !jQuery.support.appendChecked ) { + for ( i = 0; (elem = ret[i]) != null; i++ ) { + if ( jQuery.nodeName( elem, "input" ) ) { + fixDefaultChecked( elem ); + } else if ( typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } + } + } + + // Append elements to a provided document fragment + if ( fragment ) { + // Special handling of each script element + handleScript = function( elem ) { + // Check if we consider it executable + if ( !elem.type || rscriptType.test( elem.type ) ) { + // Detach the script and store it in the scripts array (if provided) or the fragment + // Return truthy to indicate that it has been handled + return scripts ? + scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) : + fragment.appendChild( elem ); + } + }; + + for ( i = 0; (elem = ret[i]) != null; i++ ) { + // Check if we're done after handling an executable script + if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) { + // Append to fragment and handle embedded scripts + fragment.appendChild( elem ); + if ( typeof elem.getElementsByTagName !== "undefined" ) { + // handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration + jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript ); + + // Splice the scripts into ret after their former ancestor and advance our index beyond them + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + i += jsTags.length; + } + } + } + } + + return ret; + }, + + cleanData: function( elems, /* internal */ acceptData ) { + var data, id, elem, type, + i = 0, + internalKey = jQuery.expando, + cache = jQuery.cache, + deleteExpando = jQuery.support.deleteExpando, + special = jQuery.event.special; + + for ( ; (elem = elems[i]) != null; i++ ) { + + if ( acceptData || jQuery.acceptData( elem ) ) { + + id = elem[ internalKey ]; + data = id && cache[ id ]; + + if ( data ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Remove cache only if it was not already removed by jQuery.event.remove + if ( cache[ id ] ) { + + delete cache[ id ]; + + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( deleteExpando ) { + delete elem[ internalKey ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( internalKey ); + + } else { + elem[ internalKey ] = null; + } + + jQuery.deletedIds.push( id ); + } + } + } + } + } +}); +// Limit scope pollution from any deprecated API +(function() { + +var matched, browser; + +// Use of jQuery.browser is frowned upon. +// More details: http://api.jquery.com/jQuery.browser +// jQuery.uaMatch maintained for back-compat +jQuery.uaMatch = function( ua ) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) || + /(webkit)[ \/]([\w.]+)/.exec( ua ) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) || + /(msie) ([\w.]+)/.exec( ua ) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; +}; + +matched = jQuery.uaMatch( navigator.userAgent ); +browser = {}; + +if ( matched.browser ) { + browser[ matched.browser ] = true; + browser.version = matched.version; +} + +// Chrome is Webkit, but Webkit is also Safari. +if ( browser.chrome ) { + browser.webkit = true; +} else if ( browser.webkit ) { + browser.safari = true; +} + +jQuery.browser = browser; + +jQuery.sub = function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; +}; + +})(); +var curCSS, iframe, iframeDoc, + ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + rposition = /^(top|right|bottom|left)$/, + // swappable if display is none or starts with table except "table", "table-cell", or "table-caption" + // see here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rmargin = /^margin/, + rnumsplit = new RegExp( "^(" + core_pnum + ")(.*)$", "i" ), + rnumnonpx = new RegExp( "^(" + core_pnum + ")(?!px)[a-z%]+$", "i" ), + rrelNum = new RegExp( "^([-+])=(" + core_pnum + ")", "i" ), + elemdisplay = { BODY: "block" }, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: 0, + fontWeight: 400 + }, + + cssExpand = [ "Top", "Right", "Bottom", "Left" ], + cssPrefixes = [ "Webkit", "O", "Moz", "ms" ], + + eventsToggle = jQuery.fn.toggle; + +// return a css property mapped to a potentially vendor prefixed property +function vendorPropName( style, name ) { + + // shortcut for names that are not vendor prefixed + if ( name in style ) { + return name; + } + + // check for vendor prefixed names + var capName = name.charAt(0).toUpperCase() + name.slice(1), + origName = name, + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in style ) { + return name; + } + } + + return origName; +} + +function isHidden( elem, el ) { + elem = el || elem; + return jQuery.css( elem, "display" ) === "none" || !jQuery.contains( elem.ownerDocument, elem ); +} + +function showHide( elements, show ) { + var elem, display, + values = [], + index = 0, + length = elements.length; + + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + values[ index ] = jQuery._data( elem, "olddisplay" ); + if ( show ) { + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !values[ index ] && elem.style.display === "none" ) { + elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( elem.style.display === "" && isHidden( elem ) ) { + values[ index ] = jQuery._data( elem, "olddisplay", css_defaultDisplay(elem.nodeName) ); + } + } else { + display = curCSS( elem, "display" ); + + if ( !values[ index ] && display !== "none" ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( index = 0; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + if ( !show || elem.style.display === "none" || elem.style.display === "" ) { + elem.style.display = show ? values[ index ] || "" : "none"; + } + } + + return elements; +} + +jQuery.fn.extend({ + css: function( name, value ) { + return jQuery.access( this, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + }, + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state, fn2 ) { + var bool = typeof state === "boolean"; + + if ( jQuery.isFunction( state ) && jQuery.isFunction( fn2 ) ) { + return eventsToggle.apply( this, arguments ); + } + + return this.each(function() { + if ( bool ? state : isHidden( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + }); + } +}); + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = jQuery.camelCase( name ), + style = elem.style; + + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( ret[1] + 1 ) * ret[2] + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value, extra )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, numeric, extra ) { + var val, num, hooks, + origName = jQuery.camelCase( name ); + + // Make sure that we're working with the right name + name = jQuery.cssProps[ origName ] || ( jQuery.cssProps[ origName ] = vendorPropName( elem.style, origName ) ); + + // gets hook for the prefixed version + // followed by the unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name ); + } + + //convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Return, converting to number if forced or a qualifier was provided and val looks numeric + if ( numeric || extra !== undefined ) { + num = parseFloat( val ); + return numeric || jQuery.isNumeric( num ) ? num || 0 : val; + } + return val; + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; + } +}); + +// NOTE: To any future maintainer, we've window.getComputedStyle +// because jsdom on node.js will break without it. +if ( window.getComputedStyle ) { + curCSS = function( elem, name ) { + var ret, width, minWidth, maxWidth, + computed = window.getComputedStyle( elem, null ), + style = elem.style; + + if ( computed ) { + + // getPropertyValue is only needed for .css('filter') in IE9, see #12537 + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !jQuery.contains( elem.ownerDocument, elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Chrome < 17 and Safari 5.0 uses "computed value" instead of "used value" for margin-right + // Safari 5.1.7 (at least) returns percentage for a larger set of values, but width seems to be reliably pixels + // this is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values + if ( rnumnonpx.test( ret ) && rmargin.test( name ) ) { + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret; + }; +} else if ( document.documentElement.currentStyle ) { + curCSS = function( elem, name ) { + var left, rsLeft, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret == null && style && style[ name ] ) { + ret = style[ name ]; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + // but not position css attributes, as those are proportional to the parent element instead + // and we can't measure the parent instead because it might trigger a "stacking dolls" problem + if ( rnumnonpx.test( ret ) && !rposition.test( name ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ret; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +function setPositiveNumber( elem, value, subtract ) { + var matches = rnumsplit.exec( value ); + return matches ? + Math.max( 0, matches[ 1 ] - ( subtract || 0 ) ) + ( matches[ 2 ] || "px" ) : + value; +} + +function augmentWidthOrHeight( elem, name, extra, isBorderBox ) { + var i = extra === ( isBorderBox ? "border" : "content" ) ? + // If we already have the right measurement, avoid augmentation + 4 : + // Otherwise initialize for horizontal or vertical properties + name === "width" ? 1 : 0, + + val = 0; + + for ( ; i < 4; i += 2 ) { + // both box models exclude margin, so add it if we want it + if ( extra === "margin" ) { + // we use jQuery.css instead of curCSS here + // because of the reliableMarginRight CSS hook! + val += jQuery.css( elem, extra + cssExpand[ i ], true ); + } + + // From this point on we use curCSS for maximum performance (relevant in animations) + if ( isBorderBox ) { + // border-box includes padding, so remove it if we want content + if ( extra === "content" ) { + val -= parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + } + + // at this point, extra isn't border nor margin, so remove border + if ( extra !== "margin" ) { + val -= parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } else { + // at this point, extra isn't content, so add padding + val += parseFloat( curCSS( elem, "padding" + cssExpand[ i ] ) ) || 0; + + // at this point, extra isn't content nor padding, so add border + if ( extra !== "padding" ) { + val += parseFloat( curCSS( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; + } + } + } + + return val; +} + +function getWidthOrHeight( elem, name, extra ) { + + // Start with offset property, which is equivalent to the border-box value + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + valueIsBorderBox = true, + isBorderBox = jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box"; + + // some non-html elements return undefined for offsetWidth, so check for null/undefined + // svg - https://bugzilla.mozilla.org/show_bug.cgi?id=649285 + // MathML - https://bugzilla.mozilla.org/show_bug.cgi?id=491668 + if ( val <= 0 || val == null ) { + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ]; + } + + // Computed unit is not pixels. Stop here and return. + if ( rnumnonpx.test(val) ) { + return val; + } + + // we need the check for style in case a browser which returns unreliable values + // for getComputedStyle silently falls back to the reliable elem.style + valueIsBorderBox = isBorderBox && ( jQuery.support.boxSizingReliable || val === elem.style[ name ] ); + + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + } + + // use the active box-sizing model to add/subtract irrelevant styles + return ( val + + augmentWidthOrHeight( + elem, + name, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox + ) + ) + "px"; +} + + +// Try to determine the default display value of an element +function css_defaultDisplay( nodeName ) { + if ( elemdisplay[ nodeName ] ) { + return elemdisplay[ nodeName ]; + } + + var elem = jQuery( "<" + nodeName + ">" ).appendTo( document.body ), + display = elem.css("display"); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // Use the already-created iframe if possible + iframe = document.body.appendChild( + iframe || jQuery.extend( document.createElement("iframe"), { + frameBorder: 0, + width: 0, + height: 0 + }) + ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write("<!doctype html><html><body>"); + iframeDoc.close(); + } + + elem = iframeDoc.body.appendChild( iframeDoc.createElement(nodeName) ); + + display = curCSS( elem, "display" ); + document.body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + + return display; +} + +jQuery.each([ "height", "width" ], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + // certain elements can have dimension info if we invisibly show them + // however, it must have a current display style that would benefit from this + if ( elem.offsetWidth === 0 && rdisplayswap.test( curCSS( elem, "display" ) ) ) { + return jQuery.swap( elem, cssShow, function() { + return getWidthOrHeight( elem, name, extra ); + }); + } else { + return getWidthOrHeight( elem, name, extra ); + } + } + }, + + set: function( elem, value, extra ) { + return setPositiveNumber( elem, value, extra ? + augmentWidthOrHeight( + elem, + name, + extra, + jQuery.support.boxSizing && jQuery.css( elem, "boxSizing" ) === "border-box" + ) : 0 + ); + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( 0.01 * parseFloat( RegExp.$1 ) ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" && + style.removeAttribute ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +// These hooks cannot be added until DOM ready because the support test +// for it is not run until after DOM ready +jQuery(function() { + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + return jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + return curCSS( elem, "marginRight" ); + } + }); + } + }; + } + + // Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 + // getComputedStyle returns percent when specified for top/left/bottom/right + // rather than make the css module depend on the offset module, we just check for it here + if ( !jQuery.support.pixelPosition && jQuery.fn.position ) { + jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = { + get: function( elem, computed ) { + if ( computed ) { + var ret = curCSS( elem, prop ); + // if curCSS returns percentage, fallback to offset + return rnumnonpx.test( ret ) ? jQuery( elem ).position()[ prop ] + "px" : ret; + } + } + }; + }); + } + +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + return ( elem.offsetWidth === 0 && elem.offsetHeight === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || curCSS( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + +// These hooks are used by animate to expand properties +jQuery.each({ + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i, + + // assumes a single number if not a string + parts = typeof value === "string" ? value.split(" ") : [ value ], + expanded = {}; + + for ( i = 0; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( !rmargin.test( prefix ) ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +}); +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + rselectTextarea = /^(?:select|textarea)/i; + +jQuery.fn.extend({ + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +//Serialize an array of form elements or a set of +//key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : ( value == null ? "" : value ); + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); +}; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && jQuery.type( obj ) === "object" ) { + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} +var + // Document location + ajaxLocParts, + ajaxLocation, + + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+)|)|)/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, list, placeBefore, + dataTypes = dataTypeExpression.toLowerCase().split( core_rspace ), + i = 0, + length = dataTypes.length; + + if ( jQuery.isFunction( func ) ) { + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var selection, + list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ); + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.load = function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + } + + // Don't do a request if no elements are being requested + if ( !this.length ) { + return this; + } + + var selector, type, response, + self = this, + off = url.indexOf(" "); + + if ( off >= 0 ) { + selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // If it's a function + if ( jQuery.isFunction( params ) ) { + + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( params && typeof params === "object" ) { + type = "POST"; + } + + // Request the remote document + jQuery.ajax({ + url: url, + + // if "type" variable is undefined, then "GET" method will be used + type: type, + dataType: "html", + data: params, + complete: function( jqXHR, status ) { + if ( callback ) { + self.each( callback, response || [ jqXHR.responseText, status, jqXHR ] ); + } + } + }).done(function( responseText ) { + + // Save response for use in complete callback + response = arguments; + + // See if a selector was specified + self.html( selector ? + + // Create a dummy div to hold the results + jQuery("<div>") + + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append( responseText.replace( rscript, "" ) ) + + // Locate the specified elements + .find( selector ) : + + // If not, just inject the full result + responseText ); + + }); + + return this; +}; + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.on( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // ifModified key + ifModifiedKey, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // The jqXHR state + state = 0, + // Default abort message + strAbort = "canceled", + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || strAbort; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + modified = jqXHR.getResponseHeader("Last-Modified"); + if ( modified ) { + jQuery.lastModified[ ifModifiedKey ] = modified; + } + modified = jqXHR.getResponseHeader("Etag"); + if ( modified ) { + jQuery.etag[ ifModifiedKey ] = modified; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + isSuccess = ajaxConvert( s, response ); + statusText = isSuccess.state; + success = isSuccess.data; + error = isSuccess.error; + isSuccess = !error; + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.always( tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( core_rspace ); + + // A cross-domain request is in order when we have a protocol:host:port mismatch + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] !== ajaxLocParts[ 1 ] || parts[ 2 ] !== ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( state === 2 ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already and return + return jqXHR.abort(); + + } + + // aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + throw e; + } + } + } + + return jqXHR; + }, + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + var conv, conv2, current, tmp, + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(), + prev = dataTypes[ 0 ], + converters = {}, + i = 0; + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + // Convert to each sequential dataType, tolerating list modification + for ( ; (current = dataTypes[++i]); ) { + + // There's only work to do if current dataType is non-auto + if ( current !== "*" ) { + + // Convert response if prev dataType is non-auto and differs from current + if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split(" "); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.splice( i--, 0, current ); + } + + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s["throws"] ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { state: "parsererror", error: conv ? e : "No conversion from " + prev + " to " + current }; + } + } + } + } + + // Update prev for next iteration + prev = current; + } + } + + return { state: "success", data: response }; +} +var oldCallbacks = [], + rquestion = /\?/, + rjsonp = /(=)\?(?=&|$)|\?\?/, + nonce = jQuery.now(); + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var callbackName, overwritten, responseContainer, + data = s.data, + url = s.url, + hasCallback = s.jsonp !== false, + replaceInUrl = hasCallback && rjsonp.test( url ), + replaceInData = hasCallback && !replaceInUrl && typeof data === "string" && + !( s.contentType || "" ).indexOf("application/x-www-form-urlencoded") && + rjsonp.test( data ); + + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( s.dataTypes[ 0 ] === "jsonp" || replaceInUrl || replaceInData ) { + + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = jQuery.isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; + overwritten = window[ callbackName ]; + + // Insert callback into url or form data + if ( replaceInUrl ) { + s.url = url.replace( rjsonp, "$1" + callbackName ); + } else if ( replaceInData ) { + s.data = data.replace( rjsonp, "$1" + callbackName ); + } else if ( hasCallback ) { + s.url += ( rquestion.test( url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Install callback + window[ callbackName ] = function() { + responseContainer = arguments; + }; + + // Clean-up function (fires after converters) + jqXHR.always(function() { + // Restore preexisting value + window[ callbackName ] = overwritten; + + // Save back as free + if ( s[ callbackName ] ) { + // make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; + + // save the callback name for future use + oldCallbacks.push( callbackName ); + } + + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); + } + + responseContainer = overwritten = undefined; + }); + + // Delegate to script + return "script"; + } +}); +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); +var xhrCallbacks, + // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var handle, i, + xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occurred + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + + // When requesting binary data, IE6-9 will throw an exception + // on any attempt to access responseText (#11426) + try { + responses.text = xhr.responseText; + } catch( e ) { + } + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + if ( !s.async ) { + // if we're in sync mode we fire the callback + callback(); + } else if ( xhr.readyState === 4 ) { + // (IE6 & IE7) if it's in cache and has been + // retrieved directly we need to fire the callback + setTimeout( callback, 0 ); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} +var fxNow, timerId, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = new RegExp( "^(?:([-+])=|)(" + core_pnum + ")([a-z%]*)$", "i" ), + rrun = /queueHooks$/, + animationPrefilters = [ defaultPrefilter ], + tweeners = { + "*": [function( prop, value ) { + var end, unit, + tween = this.createTween( prop, value ), + parts = rfxnum.exec( value ), + target = tween.cur(), + start = +target || 0, + scale = 1, + maxIterations = 20; + + if ( parts ) { + end = +parts[2]; + unit = parts[3] || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" && start ) { + // Iteratively approximate from a nonzero starting point + // Prefer the current property, because this process will be trivial if it uses the same units + // Fallback to end or a simple constant + start = jQuery.css( tween.elem, prop, true ) || end || 1; + + do { + // If previous iteration zeroed out, double until we get *something* + // Use a string for doubling factor so we don't accidentally see scale as unchanged below + scale = scale || ".5"; + + // Adjust and apply + start = start / scale; + jQuery.style( tween.elem, prop, start + unit ); + + // Update scale, tolerating zero or NaN from tween.cur() + // And breaking the loop if scale is unchanged or perfect, or if we've just had enough + } while ( scale !== (scale = tween.cur() / target) && scale !== 1 && --maxIterations ); + } + + tween.unit = unit; + tween.start = start; + // If a +=/-= token was provided, we're doing a relative animation + tween.end = parts[1] ? start + ( parts[1] + 1 ) * end : end; + } + return tween; + }] + }; + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout(function() { + fxNow = undefined; + }, 0 ); + return ( fxNow = jQuery.now() ); +} + +function createTweens( animation, props ) { + jQuery.each( props, function( prop, value ) { + var collection = ( tweeners[ prop ] || [] ).concat( tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( collection[ index ].call( animation, prop, value ) ) { + + // we're done with this property + return; + } + } + }); +} + +function Animation( elem, properties, options ) { + var result, + index = 0, + tweenerIndex = 0, + length = animationPrefilters.length, + deferred = jQuery.Deferred().always( function() { + // don't match elem in the :animated selector + delete tick.elem; + }), + tick = function() { + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + // archaic crash bug won't allow us to use 1 - ( 0.5 || 0 ) (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ]); + + if ( percent < 1 && length ) { + return remaining; + } else { + deferred.resolveWith( elem, [ animation ] ); + return false; + } + }, + animation = deferred.promise({ + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { specialEasing: {} }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end, easing ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + // if we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + + for ( ; index < length ; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // resolve when we played the last frame + // otherwise, reject + if ( gotoEnd ) { + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + }), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length ; index++ ) { + result = animationPrefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + return result; + } + } + + createTweens( animation, props ); + + if ( jQuery.isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + jQuery.fx.timer( + jQuery.extend( tick, { + anim: animation, + queue: animation.opts.queue, + elem: elem + }) + ); + + // attach callbacks from options + return animation.progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = jQuery.camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( jQuery.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // not quite $.extend, this wont overwrite keys already present. + // also - reusing 'index' from above because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweener: function( props, callback ) { + if ( jQuery.isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.split(" "); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length ; index++ ) { + prop = props[ index ]; + tweeners[ prop ] = tweeners[ prop ] || []; + tweeners[ prop ].unshift( callback ); + } + }, + + prefilter: function( callback, prepend ) { + if ( prepend ) { + animationPrefilters.unshift( callback ); + } else { + animationPrefilters.push( callback ); + } + } +}); + +function defaultPrefilter( elem, props, opts ) { + var index, prop, value, length, dataShow, toggle, tween, hooks, oldfire, + anim = this, + style = elem.style, + orig = {}, + handled = [], + hidden = elem.nodeType && isHidden( elem ); + + // handle queue: false promises + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always(function() { + // doing this makes sure that the complete handler will be called + // before this completes + anim.always(function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + }); + }); + } + + // height/width overflow pass + if ( elem.nodeType === 1 && ( "height" in props || "width" in props ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( elem, "display" ) === "inline" && + jQuery.css( elem, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || css_defaultDisplay( elem.nodeName ) === "inline" ) { + style.display = "inline-block"; + + } else { + style.zoom = 1; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + if ( !jQuery.support.shrinkWrapBlocks ) { + anim.done(function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + }); + } + } + + + // show/hide pass + for ( index in props ) { + value = props[ index ]; + if ( rfxtypes.exec( value ) ) { + delete props[ index ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + continue; + } + handled.push( index ); + } + } + + length = handled.length; + if ( length ) { + dataShow = jQuery._data( elem, "fxshow" ) || jQuery._data( elem, "fxshow", {} ); + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + + // store state if its toggle - enables .stop().toggle() to "reverse" + if ( toggle ) { + dataShow.hidden = !hidden; + } + if ( hidden ) { + jQuery( elem ).show(); + } else { + anim.done(function() { + jQuery( elem ).hide(); + }); + } + anim.done(function() { + var prop; + jQuery.removeData( elem, "fxshow", true ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + }); + for ( index = 0 ; index < length ; index++ ) { + prop = handled[ index ]; + tween = anim.createTween( prop, hidden ? dataShow[ prop ] : 0 ); + orig[ prop ] = dataShow[ prop ] || jQuery.style( elem, prop ); + + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = tween.start; + if ( hidden ) { + tween.end = tween.start; + tween.start = prop === "width" || prop === "height" ? 1 : 0; + } + } + } + } +} + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || "swing"; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + if ( tween.elem[ tween.prop ] != null && + (!tween.elem.style || tween.elem.style[ tween.prop ] == null) ) { + return tween.elem[ tween.prop ]; + } + + // passing any value as a 4th parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails + // so, simple values such as "10px" are parsed to Float. + // complex values such as "rotate(1rad)" are returned as is. + result = jQuery.css( tween.elem, tween.prop, false, "" ); + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + // use step hook for back compat - use cssHook if its there - use .style if its + // available and use plain properties where available + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.style && ( tween.elem.style[ jQuery.cssProps[ tween.prop ] ] != null || jQuery.cssHooks[ tween.prop ] ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Remove in 2.0 - this supports IE8's panic based approach +// to setting things on disconnected nodes + +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.each([ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" || + // special check for .toggle( handler, handler, ... ) + ( !i && jQuery.isFunction( speed ) && jQuery.isFunction( easing ) ) ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +}); + +jQuery.fn.extend({ + fadeTo: function( speed, to, easing, callback ) { + + // show any hidden elements after setting opacity to 0 + return this.filter( isHidden ).css( "opacity", 0 ).show() + + // animate to the value specified + .end().animate({ opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations resolve immediately + if ( empty ) { + anim.stop( true ); + } + }; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = jQuery._data( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + }); + } +}); + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + attrs = { height: type }, + i = 0; + + // if we include width, step value is 1 to do all cssExpand values, + // if we don't include width, step value is 2 to skip over Left and Right + includeWidth = includeWidth? 1 : 0; + for( ; i < 4 ; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show"), + slideUp: genFx("hide"), + slideToggle: genFx("toggle"), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p*Math.PI ) / 2; + } +}; + +jQuery.timers = []; +jQuery.fx = Tween.prototype.init; +jQuery.fx.tick = function() { + var timer, + timers = jQuery.timers, + i = 0; + + fxNow = jQuery.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + if ( timer() && jQuery.timers.push( timer ) && !timerId ) { + timerId = setInterval( jQuery.fx.tick, jQuery.fx.interval ); + } +}; + +jQuery.fx.interval = 13; + +jQuery.fx.stop = function() { + clearInterval( timerId ); + timerId = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + // Default speed + _default: 400 +}; + +// Back Compat <1.8 extension point +jQuery.fx.step = {}; + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} +var rroot = /^(?:body|html)$/i; + +jQuery.fn.offset = function( options ) { + if ( arguments.length ) { + return options === undefined ? + this : + this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + var docElem, body, win, clientTop, clientLeft, scrollTop, scrollLeft, + box = { top: 0, left: 0 }, + elem = this[ 0 ], + doc = elem && elem.ownerDocument; + + if ( !doc ) { + return; + } + + if ( (body = doc.body) === elem ) { + return jQuery.offset.bodyOffset( elem ); + } + + docElem = doc.documentElement; + + // Make sure it's not a disconnected DOM node + if ( !jQuery.contains( docElem, elem ) ) { + return box; + } + + // If we don't have gBCR, just use 0,0 rather than error + // BlackBerry 5, iOS 3 (original iPhone) + if ( typeof elem.getBoundingClientRect !== "undefined" ) { + box = elem.getBoundingClientRect(); + } + win = getWindow( doc ); + clientTop = docElem.clientTop || body.clientTop || 0; + clientLeft = docElem.clientLeft || body.clientLeft || 0; + scrollTop = win.pageYOffset || docElem.scrollTop; + scrollLeft = win.pageXOffset || docElem.scrollLeft; + return { + top: box.top + scrollTop - clientTop, + left: box.left + scrollLeft - clientLeft + }; +}; + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent || document.body; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) { + var top = /Y/.test( prop ); + + jQuery.fn[ method ] = function( val ) { + return jQuery.access( this, function( elem, method, val ) { + var win = getWindow( elem ); + + if ( val === undefined ) { + return win ? (prop in win) ? win[ prop ] : + win.document.documentElement[ method ] : + elem[ method ]; + } + + if ( win ) { + win.scrollTo( + !top ? val : jQuery( win ).scrollLeft(), + top ? val : jQuery( win ).scrollTop() + ); + + } else { + elem[ method ] = val; + } + }, method, val, arguments.length, null ); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, function( defaultExtra, funcName ) { + // margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); + + return jQuery.access( this, function( elem, type, value ) { + var doc; + + if ( jQuery.isWindow( elem ) ) { + // As of 5/8/2012 this will yield incorrect results for Mobile Safari, but there + // isn't a whole lot we can do. See pull request at this URL for discussion: + // https://github.com/jquery/jquery/pull/764 + return elem.document.documentElement[ "client" + name ]; + } + + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; + + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], whichever is greatest + // unfortunately, this causes bug #3838 in IE6/8 only, but there is currently no good, small way to fix it. + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } + + return value === undefined ? + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, value, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable, null ); + }; + }); +}); +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +// Do this after creating the global so that if an AMD module wants to call +// noConflict to hide this version of jQuery, it will work. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + +})( window ); diff --git a/resources/lib/jquery/jquery.json.js b/resources/lib/jquery/jquery.json.js new file mode 100644 index 000000000000..75953f4d23b7 --- /dev/null +++ b/resources/lib/jquery/jquery.json.js @@ -0,0 +1,199 @@ +/** + * jQuery JSON plugin 2.4.0 + * + * @author Brantley Harris, 2009-2011 + * @author Timo Tijhof, 2011-2012 + * @source This plugin is heavily influenced by MochiKit's serializeJSON, which is + * copyrighted 2005 by Bob Ippolito. + * @source Brantley Harris wrote this plugin. It is based somewhat on the JSON.org + * website's http://www.json.org/json2.js, which proclaims: + * "NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.", a sentiment that + * I uphold. + * @license MIT License <http://www.opensource.org/licenses/mit-license.php> + */ +(function ($) { + 'use strict'; + + var escape = /["\\\x00-\x1f\x7f-\x9f]/g, + meta = { + '\b': '\\b', + '\t': '\\t', + '\n': '\\n', + '\f': '\\f', + '\r': '\\r', + '"' : '\\"', + '\\': '\\\\' + }, + hasOwn = Object.prototype.hasOwnProperty; + + /** + * jQuery.toJSON + * Converts the given argument into a JSON representation. + * + * @param o {Mixed} The json-serializable *thing* to be converted + * + * If an object has a toJSON prototype, that will be used to get the representation. + * Non-integer/string keys are skipped in the object, as are keys that point to a + * function. + * + */ + $.toJSON = typeof JSON === 'object' && JSON.stringify ? JSON.stringify : function (o) { + if (o === null) { + return 'null'; + } + + var pairs, k, name, val, + type = $.type(o); + + if (type === 'undefined') { + return undefined; + } + + // Also covers instantiated Number and Boolean objects, + // which are typeof 'object' but thanks to $.type, we + // catch them here. I don't know whether it is right + // or wrong that instantiated primitives are not + // exported to JSON as an {"object":..}. + // We choose this path because that's what the browsers did. + if (type === 'number' || type === 'boolean') { + return String(o); + } + if (type === 'string') { + return $.quoteString(o); + } + if (typeof o.toJSON === 'function') { + return $.toJSON(o.toJSON()); + } + if (type === 'date') { + var month = o.getUTCMonth() + 1, + day = o.getUTCDate(), + year = o.getUTCFullYear(), + hours = o.getUTCHours(), + minutes = o.getUTCMinutes(), + seconds = o.getUTCSeconds(), + milli = o.getUTCMilliseconds(); + + if (month < 10) { + month = '0' + month; + } + if (day < 10) { + day = '0' + day; + } + if (hours < 10) { + hours = '0' + hours; + } + if (minutes < 10) { + minutes = '0' + minutes; + } + if (seconds < 10) { + seconds = '0' + seconds; + } + if (milli < 100) { + milli = '0' + milli; + } + if (milli < 10) { + milli = '0' + milli; + } + return '"' + year + '-' + month + '-' + day + 'T' + + hours + ':' + minutes + ':' + seconds + + '.' + milli + 'Z"'; + } + + pairs = []; + + if ($.isArray(o)) { + for (k = 0; k < o.length; k++) { + pairs.push($.toJSON(o[k]) || 'null'); + } + return '[' + pairs.join(',') + ']'; + } + + // Any other object (plain object, RegExp, ..) + // Need to do typeof instead of $.type, because we also + // want to catch non-plain objects. + if (typeof o === 'object') { + for (k in o) { + // Only include own properties, + // Filter out inherited prototypes + if (hasOwn.call(o, k)) { + // Keys must be numerical or string. Skip others + type = typeof k; + if (type === 'number') { + name = '"' + k + '"'; + } else if (type === 'string') { + name = $.quoteString(k); + } else { + continue; + } + type = typeof o[k]; + + // Invalid values like these return undefined + // from toJSON, however those object members + // shouldn't be included in the JSON string at all. + if (type !== 'function' && type !== 'undefined') { + val = $.toJSON(o[k]); + pairs.push(name + ':' + val); + } + } + } + return '{' + pairs.join(',') + '}'; + } + }; + + /** + * jQuery.evalJSON + * Evaluates a given json string. + * + * @param str {String} + */ + $.evalJSON = typeof JSON === 'object' && JSON.parse ? JSON.parse : function (str) { + /*jshint evil: true */ + return eval('(' + str + ')'); + }; + + /** + * jQuery.secureEvalJSON + * Evals JSON in a way that is *more* secure. + * + * @param str {String} + */ + $.secureEvalJSON = typeof JSON === 'object' && JSON.parse ? JSON.parse : function (str) { + var filtered = + str + .replace(/\\["\\\/bfnrtu]/g, '@') + .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']') + .replace(/(?:^|:|,)(?:\s*\[)+/g, ''); + + if (/^[\],:{}\s]*$/.test(filtered)) { + /*jshint evil: true */ + return eval('(' + str + ')'); + } + throw new SyntaxError('Error parsing JSON, source is not valid.'); + }; + + /** + * jQuery.quoteString + * Returns a string-repr of a string, escaping quotes intelligently. + * Mostly a support function for toJSON. + * Examples: + * >>> jQuery.quoteString('apple') + * "apple" + * + * >>> jQuery.quoteString('"Where are we going?", she asked.') + * "\"Where are we going?\", she asked." + */ + $.quoteString = function (str) { + if (str.match(escape)) { + return '"' + str.replace(escape, function (a) { + var c = meta[a]; + if (typeof c === 'string') { + return c; + } + c = a.charCodeAt(); + return '\\u00' + Math.floor(c / 16).toString(16) + (c % 16).toString(16); + }) + '"'; + } + return '"' + str + '"'; + }; + +}(jQuery)); diff --git a/resources/lib/jquery/jquery.mockjax.js b/resources/lib/jquery/jquery.mockjax.js new file mode 100644 index 000000000000..5f6e130643dd --- /dev/null +++ b/resources/lib/jquery/jquery.mockjax.js @@ -0,0 +1,382 @@ +/*! + * MockJax - jQuery Plugin to Mock Ajax requests + * + * Version: 1.4.0 + * Released: 2011-02-04 + * Source: http://github.com/appendto/jquery-mockjax + * Docs: http://enterprisejquery.com/2010/07/mock-your-ajax-requests-with-mockjax-for-rapid-development + * Plugin: mockjax + * Author: Jonathan Sharp (http://jdsharp.com) + * License: MIT,GPL + * + * Copyright (c) 2010 appendTo LLC. + * Dual licensed under the MIT or GPL licenses. + * http://appendto.com/open-source-licenses + */ +(function($) { + var _ajax = $.ajax, + mockHandlers = []; + + function parseXML(xml) { + if ( window['DOMParser'] == undefined && window.ActiveXObject ) { + DOMParser = function() { }; + DOMParser.prototype.parseFromString = function( xmlString ) { + var doc = new ActiveXObject('Microsoft.XMLDOM'); + doc.async = 'false'; + doc.loadXML( xmlString ); + return doc; + }; + } + + try { + var xmlDoc = ( new DOMParser() ).parseFromString( xml, 'text/xml' ); + if ( $.isXMLDoc( xmlDoc ) ) { + var err = $('parsererror', xmlDoc); + if ( err.length == 1 ) { + throw('Error: ' + $(xmlDoc).text() ); + } + } else { + throw('Unable to parse XML'); + } + } catch( e ) { + var msg = ( e.name == undefined ? e : e.name + ': ' + e.message ); + $(document).trigger('xmlParseError', [ msg ]); + return undefined; + } + return xmlDoc; + } + + $.extend({ + ajax: function(origSettings) { + var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings), + mock = false; + // Iterate over our mock handlers (in registration order) until we find + // one that is willing to intercept the request + $.each(mockHandlers, function(k, v) { + if ( !mockHandlers[k] ) { + return; + } + var m = null; + // If the mock was registered with a function, let the function decide if we + // want to mock this request + if ( $.isFunction(mockHandlers[k]) ) { + m = mockHandlers[k](s); + } else { + m = mockHandlers[k]; + // Inspect the URL of the request and check if the mock handler's url + // matches the url for this ajax request + if ( $.isFunction(m.url.test) ) { + // The user provided a regex for the url, test it + if ( !m.url.test( s.url ) ) { + m = null; + } + } else { + // Look for a simple wildcard '*' or a direct URL match + var star = m.url.indexOf('*'); + if ( ( m.url != '*' && m.url != s.url && star == -1 ) || + ( star > -1 && m.url.substr(0, star) != s.url.substr(0, star) ) ) { + // The url we tested did not match the wildcard * + m = null; + } + } + if ( m ) { + // Inspect the data submitted in the request (either POST body or GET query string) + if ( m.data && s.data ) { + var identical = false; + // Deep inspect the identity of the objects + (function ident(mock, live) { + // Test for situations where the data is a querystring (not an object) + if (typeof live === 'string') { + // Querystring may be a regex + identical = $.isFunction( mock.test ) ? mock.test(live) : mock == live; + return identical; + } + $.each(mock, function(k, v) { + if ( live[k] === undefined ) { + identical = false; + return false; + } else { + identical = true; + if ( typeof live[k] == 'object' ) { + return ident(mock[k], live[k]); + } else { + if ( $.isFunction( mock[k].test ) ) { + identical = mock[k].test(live[k]); + } else { + identical = ( mock[k] == live[k] ); + } + return identical; + } + } + }); + })(m.data, s.data); + // They're not identical, do not mock this request + if ( identical == false ) { + m = null; + } + } + // Inspect the request type + if ( m && m.type && m.type != s.type ) { + // The request type doesn't match (GET vs. POST) + m = null; + } + } + } + if ( m ) { + mock = true; + + // Handle console logging + var c = $.extend({}, $.mockjaxSettings, m); + if ( c.log && $.isFunction(c.log) ) { + c.log('MOCK ' + s.type.toUpperCase() + ': ' + s.url, $.extend({}, s)); + } + + var jsre = /=\?(&|$)/, jsc = (new Date()).getTime(); + + // Handle JSONP Parameter Callbacks, we need to replicate some of the jQuery core here + // because there isn't an easy hook for the cross domain script tag of jsonp + if ( s.dataType === "jsonp" ) { + if ( s.type.toUpperCase() === "GET" ) { + if ( !jsre.test( s.url ) ) { + s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?"; + } + } else if ( !s.data || !jsre.test(s.data) ) { + s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?"; + } + s.dataType = "json"; + } + + // Build temporary JSONP function + if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) { + jsonp = s.jsonpCallback || ("jsonp" + jsc++); + + // Replace the =? sequence both in the query string and the data + if ( s.data ) { + s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1"); + } + + s.url = s.url.replace(jsre, "=" + jsonp + "$1"); + + // We need to make sure + // that a JSONP style response is executed properly + s.dataType = "script"; + + // Handle JSONP-style loading + window[ jsonp ] = window[ jsonp ] || function( tmp ) { + data = tmp; + success(); + complete(); + // Garbage collect + window[ jsonp ] = undefined; + + try { + delete window[ jsonp ]; + } catch(e) {} + + if ( head ) { + head.removeChild( script ); + } + }; + } + + var rurl = /^(\w+:)?\/\/([^\/?#]+)/, + parts = rurl.exec( s.url ), + remote = parts && (parts[1] && parts[1] !== location.protocol || parts[2] !== location.host); + + // Test if we are going to create a script tag (if so, intercept & mock) + if ( s.dataType === "script" && s.type.toUpperCase() === "GET" && remote ) { + // Synthesize the mock request for adding a script tag + var callbackContext = origSettings && origSettings.context || s; + + function success() { + // If a local callback was specified, fire it and pass it the data + if ( s.success ) { + s.success.call( callbackContext, ( m.response ? m.response.toString() : m.responseText || ''), status, {} ); + } + + // Fire the global callback + if ( s.global ) { + trigger( "ajaxSuccess", [{}, s] ); + } + } + + function complete() { + // Process result + if ( s.complete ) { + s.complete.call( callbackContext, {} , status ); + } + + // The request was completed + if ( s.global ) { + trigger( "ajaxComplete", [{}, s] ); + } + + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + + function trigger(type, args) { + (s.context ? jQuery(s.context) : jQuery.event).trigger(type, args); + } + + if ( m.response && $.isFunction(m.response) ) { + m.response(origSettings); + } else { + $.globalEval(m.responseText); + } + success(); + complete(); + return false; + } + mock = _ajax.call($, $.extend(true, {}, origSettings, { + // Mock the XHR object + xhr: function() { + // Extend with our default mockjax settings + m = $.extend({}, $.mockjaxSettings, m); + + if ( m.contentType ) { + m.headers['content-type'] = m.contentType; + } + + // Return our mock xhr object + return { + status: m.status, + readyState: 1, + open: function() { }, + send: function() { + // This is a substitute for < 1.4 which lacks $.proxy + var process = (function(that) { + return function() { + return (function() { + // The request has returned + this.status = m.status; + this.readyState = 4; + + // We have an executable function, call it to give + // the mock handler a chance to update it's data + if ( $.isFunction(m.response) ) { + m.response(origSettings); + } + // Copy over our mock to our xhr object before passing control back to + // jQuery's onreadystatechange callback + if ( s.dataType == 'json' && ( typeof m.responseText == 'object' ) ) { + this.responseText = JSON.stringify(m.responseText); + } else if ( s.dataType == 'xml' ) { + if ( typeof m.responseXML == 'string' ) { + this.responseXML = parseXML(m.responseXML); + } else { + this.responseXML = m.responseXML; + } + } else { + this.responseText = m.responseText; + } + // jQuery < 1.4 doesn't have onreadystate change for xhr + if ( $.isFunction(this.onreadystatechange) ) { + this.onreadystatechange( m.isTimeout ? 'timeout' : undefined ); + } + }).apply(that); + }; + })(this); + + if ( m.proxy ) { + // We're proxying this request and loading in an external file instead + _ajax({ + global: false, + url: m.proxy, + type: m.proxyType, + data: m.data, + dataType: s.dataType, + complete: function(xhr, txt) { + m.responseXML = xhr.responseXML; + m.responseText = xhr.responseText; + this.responseTimer = setTimeout(process, m.responseTime || 0); + } + }); + } else { + // type == 'POST' || 'GET' || 'DELETE' + if ( s.async === false ) { + // TODO: Blocking delay + process(); + } else { + this.responseTimer = setTimeout(process, m.responseTime || 50); + } + } + }, + abort: function() { + clearTimeout(this.responseTimer); + }, + setRequestHeader: function() { }, + getResponseHeader: function(header) { + // 'Last-modified', 'Etag', 'content-type' are all checked by jQuery + if ( m.headers && m.headers[header] ) { + // Return arbitrary headers + return m.headers[header]; + } else if ( header.toLowerCase() == 'last-modified' ) { + return m.lastModified || (new Date()).toString(); + } else if ( header.toLowerCase() == 'etag' ) { + return m.etag || ''; + } else if ( header.toLowerCase() == 'content-type' ) { + return m.contentType || 'text/plain'; + } + }, + getAllResponseHeaders: function() { + var headers = ''; + $.each(m.headers, function(k, v) { + headers += k + ': ' + v + "\n"; + }); + return headers; + } + }; + } + })); + return false; + } + }); + // We don't have a mock request, trigger a normal request + if ( !mock ) { + return _ajax.apply($, arguments); + } else { + return mock; + } + } + }); + + $.mockjaxSettings = { + //url: null, + //type: 'GET', + log: function(msg) { + window['console'] && window.console.log && window.console.log(msg); + }, + status: 200, + responseTime: 500, + isTimeout: false, + contentType: 'text/plain', + response: '', + responseText: '', + responseXML: '', + proxy: '', + proxyType: 'GET', + + lastModified: null, + etag: '', + headers: { + etag: 'IJF@H#@923uf8023hFO@I#H#', + 'content-type' : 'text/plain' + } + }; + + $.mockjax = function(settings) { + var i = mockHandlers.length; + mockHandlers[i] = settings; + return i; + }; + $.mockjaxClear = function(i) { + if ( arguments.length == 1 ) { + mockHandlers[i] = null; + } else { + mockHandlers = []; + } + }; +})(jQuery); diff --git a/resources/lib/jquery/jquery.qunit.css b/resources/lib/jquery/jquery.qunit.css new file mode 100644 index 000000000000..d7fc0c8eccbf --- /dev/null +++ b/resources/lib/jquery/jquery.qunit.css @@ -0,0 +1,244 @@ +/** + * QUnit v1.11.0 - A JavaScript Unit Testing Framework + * + * http://qunitjs.com + * + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +/** Font Family and Sizes */ + +#qunit-tests, #qunit-header, #qunit-banner, #qunit-testrunner-toolbar, #qunit-userAgent, #qunit-testresult { + font-family: "Helvetica Neue Light", "HelveticaNeue-Light", "Helvetica Neue", Calibri, Helvetica, Arial, sans-serif; +} + +#qunit-testrunner-toolbar, #qunit-userAgent, #qunit-testresult, #qunit-tests li { font-size: small; } +#qunit-tests { font-size: smaller; } + + +/** Resets */ + +#qunit-tests, #qunit-header, #qunit-banner, #qunit-userAgent, #qunit-testresult, #qunit-modulefilter { + margin: 0; + padding: 0; +} + + +/** Header */ + +#qunit-header { + padding: 0.5em 0 0.5em 1em; + + color: #8699a4; + background-color: #0d3349; + + font-size: 1.5em; + line-height: 1em; + font-weight: normal; + + border-radius: 5px 5px 0 0; + -moz-border-radius: 5px 5px 0 0; + -webkit-border-top-right-radius: 5px; + -webkit-border-top-left-radius: 5px; +} + +#qunit-header a { + text-decoration: none; + color: #c2ccd1; +} + +#qunit-header a:hover, +#qunit-header a:focus { + color: #fff; +} + +#qunit-testrunner-toolbar label { + display: inline-block; + padding: 0 .5em 0 .1em; +} + +#qunit-banner { + height: 5px; +} + +#qunit-testrunner-toolbar { + padding: 0.5em 0 0.5em 2em; + color: #5E740B; + background-color: #eee; + overflow: hidden; +} + +#qunit-userAgent { + padding: 0.5em 0 0.5em 2.5em; + background-color: #2b81af; + color: #fff; + text-shadow: rgba(0, 0, 0, 0.5) 2px 2px 1px; +} + +#qunit-modulefilter-container { + float: right; +} + +/** Tests: Pass/Fail */ + +#qunit-tests { + list-style-position: inside; +} + +#qunit-tests li { + padding: 0.4em 0.5em 0.4em 2.5em; + border-bottom: 1px solid #fff; + list-style-position: inside; +} + +#qunit-tests.hidepass li.pass, #qunit-tests.hidepass li.running { + display: none; +} + +#qunit-tests li strong { + cursor: pointer; +} + +#qunit-tests li a { + padding: 0.5em; + color: #c2ccd1; + text-decoration: none; +} +#qunit-tests li a:hover, +#qunit-tests li a:focus { + color: #000; +} + +#qunit-tests li .runtime { + float: right; + font-size: smaller; +} + +.qunit-assert-list { + margin-top: 0.5em; + padding: 0.5em; + + background-color: #fff; + + border-radius: 5px; + -moz-border-radius: 5px; + -webkit-border-radius: 5px; +} + +.qunit-collapsed { + display: none; +} + +#qunit-tests table { + border-collapse: collapse; + margin-top: .2em; +} + +#qunit-tests th { + text-align: right; + vertical-align: top; + padding: 0 .5em 0 0; +} + +#qunit-tests td { + vertical-align: top; +} + +#qunit-tests pre { + margin: 0; + white-space: pre-wrap; + word-wrap: break-word; +} + +#qunit-tests del { + background-color: #e0f2be; + color: #374e0c; + text-decoration: none; +} + +#qunit-tests ins { + background-color: #ffcaca; + color: #500; + text-decoration: none; +} + +/*** Test Counts */ + +#qunit-tests b.counts { color: black; } +#qunit-tests b.passed { color: #5E740B; } +#qunit-tests b.failed { color: #710909; } + +#qunit-tests li li { + padding: 5px; + background-color: #fff; + border-bottom: none; + list-style-position: inside; +} + +/*** Passing Styles */ + +#qunit-tests li li.pass { + color: #3c510c; + background-color: #fff; + border-left: 10px solid #C6E746; +} + +#qunit-tests .pass { color: #528CE0; background-color: #D2E0E6; } +#qunit-tests .pass .test-name { color: #366097; } + +#qunit-tests .pass .test-actual, +#qunit-tests .pass .test-expected { color: #999999; } + +#qunit-banner.qunit-pass { background-color: #C6E746; } + +/*** Failing Styles */ + +#qunit-tests li li.fail { + color: #710909; + background-color: #fff; + border-left: 10px solid #EE5757; + white-space: pre; +} + +#qunit-tests > li:last-child { + border-radius: 0 0 5px 5px; + -moz-border-radius: 0 0 5px 5px; + -webkit-border-bottom-right-radius: 5px; + -webkit-border-bottom-left-radius: 5px; +} + +#qunit-tests .fail { color: #000000; background-color: #EE5757; } +#qunit-tests .fail .test-name, +#qunit-tests .fail .module-name { color: #000000; } + +#qunit-tests .fail .test-actual { color: #EE5757; } +#qunit-tests .fail .test-expected { color: green; } + +#qunit-banner.qunit-fail { background-color: #EE5757; } + + +/** Result */ + +#qunit-testresult { + padding: 0.5em 0.5em 0.5em 2.5em; + + color: #2b81af; + background-color: #D2E0E6; + + border-bottom: 1px solid white; +} +#qunit-testresult .module-name { + font-weight: bold; +} + +/** Fixture */ + +#qunit-fixture { + position: absolute; + top: -10000px; + left: -10000px; + width: 1000px; + height: 1000px; +} diff --git a/resources/lib/jquery/jquery.qunit.js b/resources/lib/jquery/jquery.qunit.js new file mode 100644 index 000000000000..302545f4038e --- /dev/null +++ b/resources/lib/jquery/jquery.qunit.js @@ -0,0 +1,2152 @@ +/** + * QUnit v1.11.0 - A JavaScript Unit Testing Framework + * + * http://qunitjs.com + * + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + */ + +(function( window ) { + +var QUnit, + assert, + config, + onErrorFnPrev, + testId = 0, + fileName = (sourceFromStacktrace( 0 ) || "" ).replace(/(:\d+)+\)?/, "").replace(/.+\//, ""), + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + // Keep a local reference to Date (GH-283) + Date = window.Date, + defined = { + setTimeout: typeof window.setTimeout !== "undefined", + sessionStorage: (function() { + var x = "qunit-test-string"; + try { + sessionStorage.setItem( x, x ); + sessionStorage.removeItem( x ); + return true; + } catch( e ) { + return false; + } + }()) + }, + /** + * Provides a normalized error string, correcting an issue + * with IE 7 (and prior) where Error.prototype.toString is + * not properly implemented + * + * Based on http://es5.github.com/#x15.11.4.4 + * + * @param {String|Error} error + * @return {String} error message + */ + errorString = function( error ) { + var name, message, + errorString = error.toString(); + if ( errorString.substring( 0, 7 ) === "[object" ) { + name = error.name ? error.name.toString() : "Error"; + message = error.message ? error.message.toString() : ""; + if ( name && message ) { + return name + ": " + message; + } else if ( name ) { + return name; + } else if ( message ) { + return message; + } else { + return "Error"; + } + } else { + return errorString; + } + }, + /** + * Makes a clone of an object using only Array or Object as base, + * and copies over the own enumerable properties. + * + * @param {Object} obj + * @return {Object} New object with only the own properties (recursively). + */ + objectValues = function( obj ) { + // Grunt 0.3.x uses an older version of jshint that still has jshint/jshint#392. + /*jshint newcap: false */ + var key, val, + vals = QUnit.is( "array", obj ) ? [] : {}; + for ( key in obj ) { + if ( hasOwn.call( obj, key ) ) { + val = obj[key]; + vals[key] = val === Object(val) ? objectValues(val) : val; + } + } + return vals; + }; + +function Test( settings ) { + extend( this, settings ); + this.assertions = []; + this.testNumber = ++Test.count; +} + +Test.count = 0; + +Test.prototype = { + init: function() { + var a, b, li, + tests = id( "qunit-tests" ); + + if ( tests ) { + b = document.createElement( "strong" ); + b.innerHTML = this.nameHtml; + + // `a` initialized at top of scope + a = document.createElement( "a" ); + a.innerHTML = "Rerun"; + a.href = QUnit.url({ testNumber: this.testNumber }); + + li = document.createElement( "li" ); + li.appendChild( b ); + li.appendChild( a ); + li.className = "running"; + li.id = this.id = "qunit-test-output" + testId++; + + tests.appendChild( li ); + } + }, + setup: function() { + if ( this.module !== config.previousModule ) { + if ( config.previousModule ) { + runLoggingCallbacks( "moduleDone", QUnit, { + name: config.previousModule, + failed: config.moduleStats.bad, + passed: config.moduleStats.all - config.moduleStats.bad, + total: config.moduleStats.all + }); + } + config.previousModule = this.module; + config.moduleStats = { all: 0, bad: 0 }; + runLoggingCallbacks( "moduleStart", QUnit, { + name: this.module + }); + } else if ( config.autorun ) { + runLoggingCallbacks( "moduleStart", QUnit, { + name: this.module + }); + } + + config.current = this; + + this.testEnvironment = extend({ + setup: function() {}, + teardown: function() {} + }, this.moduleTestEnvironment ); + + this.started = +new Date(); + runLoggingCallbacks( "testStart", QUnit, { + name: this.testName, + module: this.module + }); + + // allow utility functions to access the current test environment + // TODO why?? + QUnit.current_testEnvironment = this.testEnvironment; + + if ( !config.pollution ) { + saveGlobal(); + } + if ( config.notrycatch ) { + this.testEnvironment.setup.call( this.testEnvironment ); + return; + } + try { + this.testEnvironment.setup.call( this.testEnvironment ); + } catch( e ) { + QUnit.pushFailure( "Setup failed on " + this.testName + ": " + ( e.message || e ), extractStacktrace( e, 1 ) ); + } + }, + run: function() { + config.current = this; + + var running = id( "qunit-testresult" ); + + if ( running ) { + running.innerHTML = "Running: <br/>" + this.nameHtml; + } + + if ( this.async ) { + QUnit.stop(); + } + + this.callbackStarted = +new Date(); + + if ( config.notrycatch ) { + this.callback.call( this.testEnvironment, QUnit.assert ); + this.callbackRuntime = +new Date() - this.callbackStarted; + return; + } + + try { + this.callback.call( this.testEnvironment, QUnit.assert ); + this.callbackRuntime = +new Date() - this.callbackStarted; + } catch( e ) { + this.callbackRuntime = +new Date() - this.callbackStarted; + + QUnit.pushFailure( "Died on test #" + (this.assertions.length + 1) + " " + this.stack + ": " + ( e.message || e ), extractStacktrace( e, 0 ) ); + // else next test will carry the responsibility + saveGlobal(); + + // Restart the tests if they're blocking + if ( config.blocking ) { + QUnit.start(); + } + } + }, + teardown: function() { + config.current = this; + if ( config.notrycatch ) { + if ( typeof this.callbackRuntime === "undefined" ) { + this.callbackRuntime = +new Date() - this.callbackStarted; + } + this.testEnvironment.teardown.call( this.testEnvironment ); + return; + } else { + try { + this.testEnvironment.teardown.call( this.testEnvironment ); + } catch( e ) { + QUnit.pushFailure( "Teardown failed on " + this.testName + ": " + ( e.message || e ), extractStacktrace( e, 1 ) ); + } + } + checkPollution(); + }, + finish: function() { + config.current = this; + if ( config.requireExpects && this.expected === null ) { + QUnit.pushFailure( "Expected number of assertions to be defined, but expect() was not called.", this.stack ); + } else if ( this.expected !== null && this.expected !== this.assertions.length ) { + QUnit.pushFailure( "Expected " + this.expected + " assertions, but " + this.assertions.length + " were run", this.stack ); + } else if ( this.expected === null && !this.assertions.length ) { + QUnit.pushFailure( "Expected at least one assertion, but none were run - call expect(0) to accept zero assertions.", this.stack ); + } + + var i, assertion, a, b, time, li, ol, + test = this, + good = 0, + bad = 0, + tests = id( "qunit-tests" ); + + this.runtime = +new Date() - this.started; + config.stats.all += this.assertions.length; + config.moduleStats.all += this.assertions.length; + + if ( tests ) { + ol = document.createElement( "ol" ); + ol.className = "qunit-assert-list"; + + for ( i = 0; i < this.assertions.length; i++ ) { + assertion = this.assertions[i]; + + li = document.createElement( "li" ); + li.className = assertion.result ? "pass" : "fail"; + li.innerHTML = assertion.message || ( assertion.result ? "okay" : "failed" ); + ol.appendChild( li ); + + if ( assertion.result ) { + good++; + } else { + bad++; + config.stats.bad++; + config.moduleStats.bad++; + } + } + + // store result when possible + if ( QUnit.config.reorder && defined.sessionStorage ) { + if ( bad ) { + sessionStorage.setItem( "qunit-test-" + this.module + "-" + this.testName, bad ); + } else { + sessionStorage.removeItem( "qunit-test-" + this.module + "-" + this.testName ); + } + } + + if ( bad === 0 ) { + addClass( ol, "qunit-collapsed" ); + } + + // `b` initialized at top of scope + b = document.createElement( "strong" ); + b.innerHTML = this.nameHtml + " <b class='counts'>(<b class='failed'>" + bad + "</b>, <b class='passed'>" + good + "</b>, " + this.assertions.length + ")</b>"; + + addEvent(b, "click", function() { + var next = b.parentNode.lastChild, + collapsed = hasClass( next, "qunit-collapsed" ); + ( collapsed ? removeClass : addClass )( next, "qunit-collapsed" ); + }); + + addEvent(b, "dblclick", function( e ) { + var target = e && e.target ? e.target : window.event.srcElement; + if ( target.nodeName.toLowerCase() === "span" || target.nodeName.toLowerCase() === "b" ) { + target = target.parentNode; + } + if ( window.location && target.nodeName.toLowerCase() === "strong" ) { + window.location = QUnit.url({ testNumber: test.testNumber }); + } + }); + + // `time` initialized at top of scope + time = document.createElement( "span" ); + time.className = "runtime"; + time.innerHTML = this.runtime + " ms"; + + // `li` initialized at top of scope + li = id( this.id ); + li.className = bad ? "fail" : "pass"; + li.removeChild( li.firstChild ); + a = li.firstChild; + li.appendChild( b ); + li.appendChild( a ); + li.appendChild( time ); + li.appendChild( ol ); + + } else { + for ( i = 0; i < this.assertions.length; i++ ) { + if ( !this.assertions[i].result ) { + bad++; + config.stats.bad++; + config.moduleStats.bad++; + } + } + } + + runLoggingCallbacks( "testDone", QUnit, { + name: this.testName, + module: this.module, + failed: bad, + passed: this.assertions.length - bad, + total: this.assertions.length, + duration: this.runtime + }); + + QUnit.reset(); + + config.current = undefined; + }, + + queue: function() { + var bad, + test = this; + + synchronize(function() { + test.init(); + }); + function run() { + // each of these can by async + synchronize(function() { + test.setup(); + }); + synchronize(function() { + test.run(); + }); + synchronize(function() { + test.teardown(); + }); + synchronize(function() { + test.finish(); + }); + } + + // `bad` initialized at top of scope + // defer when previous test run passed, if storage is available + bad = QUnit.config.reorder && defined.sessionStorage && + +sessionStorage.getItem( "qunit-test-" + this.module + "-" + this.testName ); + + if ( bad ) { + run(); + } else { + synchronize( run, true ); + } + } +}; + +// Root QUnit object. +// `QUnit` initialized at top of scope +QUnit = { + + // call on start of module test to prepend name to all tests + module: function( name, testEnvironment ) { + config.currentModule = name; + config.currentModuleTestEnvironment = testEnvironment; + config.modules[name] = true; + }, + + asyncTest: function( testName, expected, callback ) { + if ( arguments.length === 2 ) { + callback = expected; + expected = null; + } + + QUnit.test( testName, expected, callback, true ); + }, + + test: function( testName, expected, callback, async ) { + var test, + nameHtml = "<span class='test-name'>" + escapeText( testName ) + "</span>"; + + if ( arguments.length === 2 ) { + callback = expected; + expected = null; + } + + if ( config.currentModule ) { + nameHtml = "<span class='module-name'>" + escapeText( config.currentModule ) + "</span>: " + nameHtml; + } + + test = new Test({ + nameHtml: nameHtml, + testName: testName, + expected: expected, + async: async, + callback: callback, + module: config.currentModule, + moduleTestEnvironment: config.currentModuleTestEnvironment, + stack: sourceFromStacktrace( 2 ) + }); + + if ( !validTest( test ) ) { + return; + } + + test.queue(); + }, + + // Specify the number of expected assertions to gurantee that failed test (no assertions are run at all) don't slip through. + expect: function( asserts ) { + if (arguments.length === 1) { + config.current.expected = asserts; + } else { + return config.current.expected; + } + }, + + start: function( count ) { + // QUnit hasn't been initialized yet. + // Note: RequireJS (et al) may delay onLoad + if ( config.semaphore === undefined ) { + QUnit.begin(function() { + // This is triggered at the top of QUnit.load, push start() to the event loop, to allow QUnit.load to finish first + setTimeout(function() { + QUnit.start( count ); + }); + }); + return; + } + + config.semaphore -= count || 1; + // don't start until equal number of stop-calls + if ( config.semaphore > 0 ) { + return; + } + // ignore if start is called more often then stop + if ( config.semaphore < 0 ) { + config.semaphore = 0; + QUnit.pushFailure( "Called start() while already started (QUnit.config.semaphore was 0 already)", null, sourceFromStacktrace(2) ); + return; + } + // A slight delay, to avoid any current callbacks + if ( defined.setTimeout ) { + window.setTimeout(function() { + if ( config.semaphore > 0 ) { + return; + } + if ( config.timeout ) { + clearTimeout( config.timeout ); + } + + config.blocking = false; + process( true ); + }, 13); + } else { + config.blocking = false; + process( true ); + } + }, + + stop: function( count ) { + config.semaphore += count || 1; + config.blocking = true; + + if ( config.testTimeout && defined.setTimeout ) { + clearTimeout( config.timeout ); + config.timeout = window.setTimeout(function() { + QUnit.ok( false, "Test timed out" ); + config.semaphore = 1; + QUnit.start(); + }, config.testTimeout ); + } + } +}; + +// `assert` initialized at top of scope +// Asssert helpers +// All of these must either call QUnit.push() or manually do: +// - runLoggingCallbacks( "log", .. ); +// - config.current.assertions.push({ .. }); +// We attach it to the QUnit object *after* we expose the public API, +// otherwise `assert` will become a global variable in browsers (#341). +assert = { + /** + * Asserts rough true-ish result. + * @name ok + * @function + * @example ok( "asdfasdf".length > 5, "There must be at least 5 chars" ); + */ + ok: function( result, msg ) { + if ( !config.current ) { + throw new Error( "ok() assertion outside test context, was " + sourceFromStacktrace(2) ); + } + result = !!result; + + var source, + details = { + module: config.current.module, + name: config.current.testName, + result: result, + message: msg + }; + + msg = escapeText( msg || (result ? "okay" : "failed" ) ); + msg = "<span class='test-message'>" + msg + "</span>"; + + if ( !result ) { + source = sourceFromStacktrace( 2 ); + if ( source ) { + details.source = source; + msg += "<table><tr class='test-source'><th>Source: </th><td><pre>" + escapeText( source ) + "</pre></td></tr></table>"; + } + } + runLoggingCallbacks( "log", QUnit, details ); + config.current.assertions.push({ + result: result, + message: msg + }); + }, + + /** + * Assert that the first two arguments are equal, with an optional message. + * Prints out both actual and expected values. + * @name equal + * @function + * @example equal( format( "Received {0} bytes.", 2), "Received 2 bytes.", "format() replaces {0} with next argument" ); + */ + equal: function( actual, expected, message ) { + /*jshint eqeqeq:false */ + QUnit.push( expected == actual, actual, expected, message ); + }, + + /** + * @name notEqual + * @function + */ + notEqual: function( actual, expected, message ) { + /*jshint eqeqeq:false */ + QUnit.push( expected != actual, actual, expected, message ); + }, + + /** + * @name propEqual + * @function + */ + propEqual: function( actual, expected, message ) { + actual = objectValues(actual); + expected = objectValues(expected); + QUnit.push( QUnit.equiv(actual, expected), actual, expected, message ); + }, + + /** + * @name notPropEqual + * @function + */ + notPropEqual: function( actual, expected, message ) { + actual = objectValues(actual); + expected = objectValues(expected); + QUnit.push( !QUnit.equiv(actual, expected), actual, expected, message ); + }, + + /** + * @name deepEqual + * @function + */ + deepEqual: function( actual, expected, message ) { + QUnit.push( QUnit.equiv(actual, expected), actual, expected, message ); + }, + + /** + * @name notDeepEqual + * @function + */ + notDeepEqual: function( actual, expected, message ) { + QUnit.push( !QUnit.equiv(actual, expected), actual, expected, message ); + }, + + /** + * @name strictEqual + * @function + */ + strictEqual: function( actual, expected, message ) { + QUnit.push( expected === actual, actual, expected, message ); + }, + + /** + * @name notStrictEqual + * @function + */ + notStrictEqual: function( actual, expected, message ) { + QUnit.push( expected !== actual, actual, expected, message ); + }, + + "throws": function( block, expected, message ) { + var actual, + expectedOutput = expected, + ok = false; + + // 'expected' is optional + if ( typeof expected === "string" ) { + message = expected; + expected = null; + } + + config.current.ignoreGlobalErrors = true; + try { + block.call( config.current.testEnvironment ); + } catch (e) { + actual = e; + } + config.current.ignoreGlobalErrors = false; + + if ( actual ) { + // we don't want to validate thrown error + if ( !expected ) { + ok = true; + expectedOutput = null; + // expected is a regexp + } else if ( QUnit.objectType( expected ) === "regexp" ) { + ok = expected.test( errorString( actual ) ); + // expected is a constructor + } else if ( actual instanceof expected ) { + ok = true; + // expected is a validation function which returns true is validation passed + } else if ( expected.call( {}, actual ) === true ) { + expectedOutput = null; + ok = true; + } + + QUnit.push( ok, actual, expectedOutput, message ); + } else { + QUnit.pushFailure( message, null, 'No exception was thrown.' ); + } + } +}; + +/** + * @deprecate since 1.8.0 + * Kept assertion helpers in root for backwards compatibility. + */ +extend( QUnit, assert ); + +/** + * @deprecated since 1.9.0 + * Kept root "raises()" for backwards compatibility. + * (Note that we don't introduce assert.raises). + */ +QUnit.raises = assert[ "throws" ]; + +/** + * @deprecated since 1.0.0, replaced with error pushes since 1.3.0 + * Kept to avoid TypeErrors for undefined methods. + */ +QUnit.equals = function() { + QUnit.push( false, false, false, "QUnit.equals has been deprecated since 2009 (e88049a0), use QUnit.equal instead" ); +}; +QUnit.same = function() { + QUnit.push( false, false, false, "QUnit.same has been deprecated since 2009 (e88049a0), use QUnit.deepEqual instead" ); +}; + +// We want access to the constructor's prototype +(function() { + function F() {} + F.prototype = QUnit; + QUnit = new F(); + // Make F QUnit's constructor so that we can add to the prototype later + QUnit.constructor = F; +}()); + +/** + * Config object: Maintain internal state + * Later exposed as QUnit.config + * `config` initialized at top of scope + */ +config = { + // The queue of tests to run + queue: [], + + // block until document ready + blocking: true, + + // when enabled, show only failing tests + // gets persisted through sessionStorage and can be changed in UI via checkbox + hidepassed: false, + + // by default, run previously failed tests first + // very useful in combination with "Hide passed tests" checked + reorder: true, + + // by default, modify document.title when suite is done + altertitle: true, + + // when enabled, all tests must call expect() + requireExpects: false, + + // add checkboxes that are persisted in the query-string + // when enabled, the id is set to `true` as a `QUnit.config` property + urlConfig: [ + { + id: "noglobals", + label: "Check for Globals", + tooltip: "Enabling this will test if any test introduces new properties on the `window` object. Stored as query-strings." + }, + { + id: "notrycatch", + label: "No try-catch", + tooltip: "Enabling this will run tests outside of a try-catch block. Makes debugging exceptions in IE reasonable. Stored as query-strings." + } + ], + + // Set of all modules. + modules: {}, + + // logging callback queues + begin: [], + done: [], + log: [], + testStart: [], + testDone: [], + moduleStart: [], + moduleDone: [] +}; + +// Export global variables, unless an 'exports' object exists, +// in that case we assume we're in CommonJS (dealt with on the bottom of the script) +if ( typeof exports === "undefined" ) { + extend( window, QUnit ); + + // Expose QUnit object + window.QUnit = QUnit; +} + +// Initialize more QUnit.config and QUnit.urlParams +(function() { + var i, + location = window.location || { search: "", protocol: "file:" }, + params = location.search.slice( 1 ).split( "&" ), + length = params.length, + urlParams = {}, + current; + + if ( params[ 0 ] ) { + for ( i = 0; i < length; i++ ) { + current = params[ i ].split( "=" ); + current[ 0 ] = decodeURIComponent( current[ 0 ] ); + // allow just a key to turn on a flag, e.g., test.html?noglobals + current[ 1 ] = current[ 1 ] ? decodeURIComponent( current[ 1 ] ) : true; + urlParams[ current[ 0 ] ] = current[ 1 ]; + } + } + + QUnit.urlParams = urlParams; + + // String search anywhere in moduleName+testName + config.filter = urlParams.filter; + + // Exact match of the module name + config.module = urlParams.module; + + config.testNumber = parseInt( urlParams.testNumber, 10 ) || null; + + // Figure out if we're running the tests from a server or not + QUnit.isLocal = location.protocol === "file:"; +}()); + +// Extend QUnit object, +// these after set here because they should not be exposed as global functions +extend( QUnit, { + assert: assert, + + config: config, + + // Initialize the configuration options + init: function() { + extend( config, { + stats: { all: 0, bad: 0 }, + moduleStats: { all: 0, bad: 0 }, + started: +new Date(), + updateRate: 1000, + blocking: false, + autostart: true, + autorun: false, + filter: "", + queue: [], + semaphore: 1 + }); + + var tests, banner, result, + qunit = id( "qunit" ); + + if ( qunit ) { + qunit.innerHTML = + "<h1 id='qunit-header'>" + escapeText( document.title ) + "</h1>" + + "<h2 id='qunit-banner'></h2>" + + "<div id='qunit-testrunner-toolbar'></div>" + + "<h2 id='qunit-userAgent'></h2>" + + "<ol id='qunit-tests'></ol>"; + } + + tests = id( "qunit-tests" ); + banner = id( "qunit-banner" ); + result = id( "qunit-testresult" ); + + if ( tests ) { + tests.innerHTML = ""; + } + + if ( banner ) { + banner.className = ""; + } + + if ( result ) { + result.parentNode.removeChild( result ); + } + + if ( tests ) { + result = document.createElement( "p" ); + result.id = "qunit-testresult"; + result.className = "result"; + tests.parentNode.insertBefore( result, tests ); + result.innerHTML = "Running...<br/> "; + } + }, + + // Resets the test setup. Useful for tests that modify the DOM. + reset: function() { + var fixture = id( "qunit-fixture" ); + if ( fixture ) { + fixture.innerHTML = config.fixture; + } + }, + + // Trigger an event on an element. + // @example triggerEvent( document.body, "click" ); + triggerEvent: function( elem, type, event ) { + if ( document.createEvent ) { + event = document.createEvent( "MouseEvents" ); + event.initMouseEvent(type, true, true, elem.ownerDocument.defaultView, + 0, 0, 0, 0, 0, false, false, false, false, 0, null); + + elem.dispatchEvent( event ); + } else if ( elem.fireEvent ) { + elem.fireEvent( "on" + type ); + } + }, + + // Safe object type checking + is: function( type, obj ) { + return QUnit.objectType( obj ) === type; + }, + + objectType: function( obj ) { + if ( typeof obj === "undefined" ) { + return "undefined"; + // consider: typeof null === object + } + if ( obj === null ) { + return "null"; + } + + var match = toString.call( obj ).match(/^\[object\s(.*)\]$/), + type = match && match[1] || ""; + + switch ( type ) { + case "Number": + if ( isNaN(obj) ) { + return "nan"; + } + return "number"; + case "String": + case "Boolean": + case "Array": + case "Date": + case "RegExp": + case "Function": + return type.toLowerCase(); + } + if ( typeof obj === "object" ) { + return "object"; + } + return undefined; + }, + + push: function( result, actual, expected, message ) { + if ( !config.current ) { + throw new Error( "assertion outside test context, was " + sourceFromStacktrace() ); + } + + var output, source, + details = { + module: config.current.module, + name: config.current.testName, + result: result, + message: message, + actual: actual, + expected: expected + }; + + message = escapeText( message ) || ( result ? "okay" : "failed" ); + message = "<span class='test-message'>" + message + "</span>"; + output = message; + + if ( !result ) { + expected = escapeText( QUnit.jsDump.parse(expected) ); + actual = escapeText( QUnit.jsDump.parse(actual) ); + output += "<table><tr class='test-expected'><th>Expected: </th><td><pre>" + expected + "</pre></td></tr>"; + + if ( actual !== expected ) { + output += "<tr class='test-actual'><th>Result: </th><td><pre>" + actual + "</pre></td></tr>"; + output += "<tr class='test-diff'><th>Diff: </th><td><pre>" + QUnit.diff( expected, actual ) + "</pre></td></tr>"; + } + + source = sourceFromStacktrace(); + + if ( source ) { + details.source = source; + output += "<tr class='test-source'><th>Source: </th><td><pre>" + escapeText( source ) + "</pre></td></tr>"; + } + + output += "</table>"; + } + + runLoggingCallbacks( "log", QUnit, details ); + + config.current.assertions.push({ + result: !!result, + message: output + }); + }, + + pushFailure: function( message, source, actual ) { + if ( !config.current ) { + throw new Error( "pushFailure() assertion outside test context, was " + sourceFromStacktrace(2) ); + } + + var output, + details = { + module: config.current.module, + name: config.current.testName, + result: false, + message: message + }; + + message = escapeText( message ) || "error"; + message = "<span class='test-message'>" + message + "</span>"; + output = message; + + output += "<table>"; + + if ( actual ) { + output += "<tr class='test-actual'><th>Result: </th><td><pre>" + escapeText( actual ) + "</pre></td></tr>"; + } + + if ( source ) { + details.source = source; + output += "<tr class='test-source'><th>Source: </th><td><pre>" + escapeText( source ) + "</pre></td></tr>"; + } + + output += "</table>"; + + runLoggingCallbacks( "log", QUnit, details ); + + config.current.assertions.push({ + result: false, + message: output + }); + }, + + url: function( params ) { + params = extend( extend( {}, QUnit.urlParams ), params ); + var key, + querystring = "?"; + + for ( key in params ) { + if ( !hasOwn.call( params, key ) ) { + continue; + } + querystring += encodeURIComponent( key ) + "=" + + encodeURIComponent( params[ key ] ) + "&"; + } + return window.location.protocol + "//" + window.location.host + + window.location.pathname + querystring.slice( 0, -1 ); + }, + + extend: extend, + id: id, + addEvent: addEvent + // load, equiv, jsDump, diff: Attached later +}); + +/** + * @deprecated: Created for backwards compatibility with test runner that set the hook function + * into QUnit.{hook}, instead of invoking it and passing the hook function. + * QUnit.constructor is set to the empty F() above so that we can add to it's prototype here. + * Doing this allows us to tell if the following methods have been overwritten on the actual + * QUnit object. + */ +extend( QUnit.constructor.prototype, { + + // Logging callbacks; all receive a single argument with the listed properties + // run test/logs.html for any related changes + begin: registerLoggingCallback( "begin" ), + + // done: { failed, passed, total, runtime } + done: registerLoggingCallback( "done" ), + + // log: { result, actual, expected, message } + log: registerLoggingCallback( "log" ), + + // testStart: { name } + testStart: registerLoggingCallback( "testStart" ), + + // testDone: { name, failed, passed, total, duration } + testDone: registerLoggingCallback( "testDone" ), + + // moduleStart: { name } + moduleStart: registerLoggingCallback( "moduleStart" ), + + // moduleDone: { name, failed, passed, total } + moduleDone: registerLoggingCallback( "moduleDone" ) +}); + +if ( typeof document === "undefined" || document.readyState === "complete" ) { + config.autorun = true; +} + +QUnit.load = function() { + runLoggingCallbacks( "begin", QUnit, {} ); + + // Initialize the config, saving the execution queue + var banner, filter, i, label, len, main, ol, toolbar, userAgent, val, + urlConfigCheckboxesContainer, urlConfigCheckboxes, moduleFilter, + numModules = 0, + moduleFilterHtml = "", + urlConfigHtml = "", + oldconfig = extend( {}, config ); + + QUnit.init(); + extend(config, oldconfig); + + config.blocking = false; + + len = config.urlConfig.length; + + for ( i = 0; i < len; i++ ) { + val = config.urlConfig[i]; + if ( typeof val === "string" ) { + val = { + id: val, + label: val, + tooltip: "[no tooltip available]" + }; + } + config[ val.id ] = QUnit.urlParams[ val.id ]; + urlConfigHtml += "<input id='qunit-urlconfig-" + escapeText( val.id ) + + "' name='" + escapeText( val.id ) + + "' type='checkbox'" + ( config[ val.id ] ? " checked='checked'" : "" ) + + " title='" + escapeText( val.tooltip ) + + "'><label for='qunit-urlconfig-" + escapeText( val.id ) + + "' title='" + escapeText( val.tooltip ) + "'>" + val.label + "</label>"; + } + + moduleFilterHtml += "<label for='qunit-modulefilter'>Module: </label><select id='qunit-modulefilter' name='modulefilter'><option value='' " + + ( config.module === undefined ? "selected='selected'" : "" ) + + ">< All Modules ></option>"; + + for ( i in config.modules ) { + if ( config.modules.hasOwnProperty( i ) ) { + numModules += 1; + moduleFilterHtml += "<option value='" + escapeText( encodeURIComponent(i) ) + "' " + + ( config.module === i ? "selected='selected'" : "" ) + + ">" + escapeText(i) + "</option>"; + } + } + moduleFilterHtml += "</select>"; + + // `userAgent` initialized at top of scope + userAgent = id( "qunit-userAgent" ); + if ( userAgent ) { + userAgent.innerHTML = navigator.userAgent; + } + + // `banner` initialized at top of scope + banner = id( "qunit-header" ); + if ( banner ) { + banner.innerHTML = "<a href='" + QUnit.url({ filter: undefined, module: undefined, testNumber: undefined }) + "'>" + banner.innerHTML + "</a> "; + } + + // `toolbar` initialized at top of scope + toolbar = id( "qunit-testrunner-toolbar" ); + if ( toolbar ) { + // `filter` initialized at top of scope + filter = document.createElement( "input" ); + filter.type = "checkbox"; + filter.id = "qunit-filter-pass"; + + addEvent( filter, "click", function() { + var tmp, + ol = document.getElementById( "qunit-tests" ); + + if ( filter.checked ) { + ol.className = ol.className + " hidepass"; + } else { + tmp = " " + ol.className.replace( /[\n\t\r]/g, " " ) + " "; + ol.className = tmp.replace( / hidepass /, " " ); + } + if ( defined.sessionStorage ) { + if (filter.checked) { + sessionStorage.setItem( "qunit-filter-passed-tests", "true" ); + } else { + sessionStorage.removeItem( "qunit-filter-passed-tests" ); + } + } + }); + + if ( config.hidepassed || defined.sessionStorage && sessionStorage.getItem( "qunit-filter-passed-tests" ) ) { + filter.checked = true; + // `ol` initialized at top of scope + ol = document.getElementById( "qunit-tests" ); + ol.className = ol.className + " hidepass"; + } + toolbar.appendChild( filter ); + + // `label` initialized at top of scope + label = document.createElement( "label" ); + label.setAttribute( "for", "qunit-filter-pass" ); + label.setAttribute( "title", "Only show tests and assertons that fail. Stored in sessionStorage." ); + label.innerHTML = "Hide passed tests"; + toolbar.appendChild( label ); + + urlConfigCheckboxesContainer = document.createElement("span"); + urlConfigCheckboxesContainer.innerHTML = urlConfigHtml; + urlConfigCheckboxes = urlConfigCheckboxesContainer.getElementsByTagName("input"); + // For oldIE support: + // * Add handlers to the individual elements instead of the container + // * Use "click" instead of "change" + // * Fallback from event.target to event.srcElement + addEvents( urlConfigCheckboxes, "click", function( event ) { + var params = {}, + target = event.target || event.srcElement; + params[ target.name ] = target.checked ? true : undefined; + window.location = QUnit.url( params ); + }); + toolbar.appendChild( urlConfigCheckboxesContainer ); + + if (numModules > 1) { + moduleFilter = document.createElement( 'span' ); + moduleFilter.setAttribute( 'id', 'qunit-modulefilter-container' ); + moduleFilter.innerHTML = moduleFilterHtml; + addEvent( moduleFilter.lastChild, "change", function() { + var selectBox = moduleFilter.getElementsByTagName("select")[0], + selectedModule = decodeURIComponent(selectBox.options[selectBox.selectedIndex].value); + + window.location = QUnit.url( { module: ( selectedModule === "" ) ? undefined : selectedModule } ); + }); + toolbar.appendChild(moduleFilter); + } + } + + // `main` initialized at top of scope + main = id( "qunit-fixture" ); + if ( main ) { + config.fixture = main.innerHTML; + } + + if ( config.autostart ) { + QUnit.start(); + } +}; + +addEvent( window, "load", QUnit.load ); + +// `onErrorFnPrev` initialized at top of scope +// Preserve other handlers +onErrorFnPrev = window.onerror; + +// Cover uncaught exceptions +// Returning true will surpress the default browser handler, +// returning false will let it run. +window.onerror = function ( error, filePath, linerNr ) { + var ret = false; + if ( onErrorFnPrev ) { + ret = onErrorFnPrev( error, filePath, linerNr ); + } + + // Treat return value as window.onerror itself does, + // Only do our handling if not surpressed. + if ( ret !== true ) { + if ( QUnit.config.current ) { + if ( QUnit.config.current.ignoreGlobalErrors ) { + return true; + } + QUnit.pushFailure( error, filePath + ":" + linerNr ); + } else { + QUnit.test( "global failure", extend( function() { + QUnit.pushFailure( error, filePath + ":" + linerNr ); + }, { validTest: validTest } ) ); + } + return false; + } + + return ret; +}; + +function done() { + config.autorun = true; + + // Log the last module results + if ( config.currentModule ) { + runLoggingCallbacks( "moduleDone", QUnit, { + name: config.currentModule, + failed: config.moduleStats.bad, + passed: config.moduleStats.all - config.moduleStats.bad, + total: config.moduleStats.all + }); + } + + var i, key, + banner = id( "qunit-banner" ), + tests = id( "qunit-tests" ), + runtime = +new Date() - config.started, + passed = config.stats.all - config.stats.bad, + html = [ + "Tests completed in ", + runtime, + " milliseconds.<br/>", + "<span class='passed'>", + passed, + "</span> assertions of <span class='total'>", + config.stats.all, + "</span> passed, <span class='failed'>", + config.stats.bad, + "</span> failed." + ].join( "" ); + + if ( banner ) { + banner.className = ( config.stats.bad ? "qunit-fail" : "qunit-pass" ); + } + + if ( tests ) { + id( "qunit-testresult" ).innerHTML = html; + } + + if ( config.altertitle && typeof document !== "undefined" && document.title ) { + // show ✖ for good, ✔ for bad suite result in title + // use escape sequences in case file gets loaded with non-utf-8-charset + document.title = [ + ( config.stats.bad ? "\u2716" : "\u2714" ), + document.title.replace( /^[\u2714\u2716] /i, "" ) + ].join( " " ); + } + + // clear own sessionStorage items if all tests passed + if ( config.reorder && defined.sessionStorage && config.stats.bad === 0 ) { + // `key` & `i` initialized at top of scope + for ( i = 0; i < sessionStorage.length; i++ ) { + key = sessionStorage.key( i++ ); + if ( key.indexOf( "qunit-test-" ) === 0 ) { + sessionStorage.removeItem( key ); + } + } + } + + // scroll back to top to show results + if ( window.scrollTo ) { + window.scrollTo(0, 0); + } + + runLoggingCallbacks( "done", QUnit, { + failed: config.stats.bad, + passed: passed, + total: config.stats.all, + runtime: runtime + }); +} + +/** @return Boolean: true if this test should be ran */ +function validTest( test ) { + var include, + filter = config.filter && config.filter.toLowerCase(), + module = config.module && config.module.toLowerCase(), + fullName = (test.module + ": " + test.testName).toLowerCase(); + + // Internally-generated tests are always valid + if ( test.callback && test.callback.validTest === validTest ) { + delete test.callback.validTest; + return true; + } + + if ( config.testNumber ) { + return test.testNumber === config.testNumber; + } + + if ( module && ( !test.module || test.module.toLowerCase() !== module ) ) { + return false; + } + + if ( !filter ) { + return true; + } + + include = filter.charAt( 0 ) !== "!"; + if ( !include ) { + filter = filter.slice( 1 ); + } + + // If the filter matches, we need to honour include + if ( fullName.indexOf( filter ) !== -1 ) { + return include; + } + + // Otherwise, do the opposite + return !include; +} + +// so far supports only Firefox, Chrome and Opera (buggy), Safari (for real exceptions) +// Later Safari and IE10 are supposed to support error.stack as well +// See also https://developer.mozilla.org/en/JavaScript/Reference/Global_Objects/Error/Stack +function extractStacktrace( e, offset ) { + offset = offset === undefined ? 3 : offset; + + var stack, include, i; + + if ( e.stacktrace ) { + // Opera + return e.stacktrace.split( "\n" )[ offset + 3 ]; + } else if ( e.stack ) { + // Firefox, Chrome + stack = e.stack.split( "\n" ); + if (/^error$/i.test( stack[0] ) ) { + stack.shift(); + } + if ( fileName ) { + include = []; + for ( i = offset; i < stack.length; i++ ) { + if ( stack[ i ].indexOf( fileName ) !== -1 ) { + break; + } + include.push( stack[ i ] ); + } + if ( include.length ) { + return include.join( "\n" ); + } + } + return stack[ offset ]; + } else if ( e.sourceURL ) { + // Safari, PhantomJS + // hopefully one day Safari provides actual stacktraces + // exclude useless self-reference for generated Error objects + if ( /qunit.js$/.test( e.sourceURL ) ) { + return; + } + // for actual exceptions, this is useful + return e.sourceURL + ":" + e.line; + } +} +function sourceFromStacktrace( offset ) { + try { + throw new Error(); + } catch ( e ) { + return extractStacktrace( e, offset ); + } +} + +/** + * Escape text for attribute or text content. + */ +function escapeText( s ) { + if ( !s ) { + return ""; + } + s = s + ""; + // Both single quotes and double quotes (for attributes) + return s.replace( /['"<>&]/g, function( s ) { + switch( s ) { + case '\'': + return '''; + case '"': + return '"'; + case '<': + return '<'; + case '>': + return '>'; + case '&': + return '&'; + } + }); +} + +function synchronize( callback, last ) { + config.queue.push( callback ); + + if ( config.autorun && !config.blocking ) { + process( last ); + } +} + +function process( last ) { + function next() { + process( last ); + } + var start = new Date().getTime(); + config.depth = config.depth ? config.depth + 1 : 1; + + while ( config.queue.length && !config.blocking ) { + if ( !defined.setTimeout || config.updateRate <= 0 || ( ( new Date().getTime() - start ) < config.updateRate ) ) { + config.queue.shift()(); + } else { + window.setTimeout( next, 13 ); + break; + } + } + config.depth--; + if ( last && !config.blocking && !config.queue.length && config.depth === 0 ) { + done(); + } +} + +function saveGlobal() { + config.pollution = []; + + if ( config.noglobals ) { + for ( var key in window ) { + // in Opera sometimes DOM element ids show up here, ignore them + if ( !hasOwn.call( window, key ) || /^qunit-test-output/.test( key ) ) { + continue; + } + config.pollution.push( key ); + } + } +} + +function checkPollution() { + var newGlobals, + deletedGlobals, + old = config.pollution; + + saveGlobal(); + + newGlobals = diff( config.pollution, old ); + if ( newGlobals.length > 0 ) { + QUnit.pushFailure( "Introduced global variable(s): " + newGlobals.join(", ") ); + } + + deletedGlobals = diff( old, config.pollution ); + if ( deletedGlobals.length > 0 ) { + QUnit.pushFailure( "Deleted global variable(s): " + deletedGlobals.join(", ") ); + } +} + +// returns a new Array with the elements that are in a but not in b +function diff( a, b ) { + var i, j, + result = a.slice(); + + for ( i = 0; i < result.length; i++ ) { + for ( j = 0; j < b.length; j++ ) { + if ( result[i] === b[j] ) { + result.splice( i, 1 ); + i--; + break; + } + } + } + return result; +} + +function extend( a, b ) { + for ( var prop in b ) { + if ( b[ prop ] === undefined ) { + delete a[ prop ]; + + // Avoid "Member not found" error in IE8 caused by setting window.constructor + } else if ( prop !== "constructor" || a !== window ) { + a[ prop ] = b[ prop ]; + } + } + + return a; +} + +/** + * @param {HTMLElement} elem + * @param {string} type + * @param {Function} fn + */ +function addEvent( elem, type, fn ) { + // Standards-based browsers + if ( elem.addEventListener ) { + elem.addEventListener( type, fn, false ); + // IE + } else { + elem.attachEvent( "on" + type, fn ); + } +} + +/** + * @param {Array|NodeList} elems + * @param {string} type + * @param {Function} fn + */ +function addEvents( elems, type, fn ) { + var i = elems.length; + while ( i-- ) { + addEvent( elems[i], type, fn ); + } +} + +function hasClass( elem, name ) { + return (" " + elem.className + " ").indexOf(" " + name + " ") > -1; +} + +function addClass( elem, name ) { + if ( !hasClass( elem, name ) ) { + elem.className += (elem.className ? " " : "") + name; + } +} + +function removeClass( elem, name ) { + var set = " " + elem.className + " "; + // Class name may appear multiple times + while ( set.indexOf(" " + name + " ") > -1 ) { + set = set.replace(" " + name + " " , " "); + } + // If possible, trim it for prettiness, but not neccecarily + elem.className = window.jQuery ? jQuery.trim( set ) : ( set.trim ? set.trim() : set ); +} + +function id( name ) { + return !!( typeof document !== "undefined" && document && document.getElementById ) && + document.getElementById( name ); +} + +function registerLoggingCallback( key ) { + return function( callback ) { + config[key].push( callback ); + }; +} + +// Supports deprecated method of completely overwriting logging callbacks +function runLoggingCallbacks( key, scope, args ) { + var i, callbacks; + if ( QUnit.hasOwnProperty( key ) ) { + QUnit[ key ].call(scope, args ); + } else { + callbacks = config[ key ]; + for ( i = 0; i < callbacks.length; i++ ) { + callbacks[ i ].call( scope, args ); + } + } +} + +// Test for equality any JavaScript type. +// Author: Philippe Rathé <prathe@gmail.com> +QUnit.equiv = (function() { + + // Call the o related callback with the given arguments. + function bindCallbacks( o, callbacks, args ) { + var prop = QUnit.objectType( o ); + if ( prop ) { + if ( QUnit.objectType( callbacks[ prop ] ) === "function" ) { + return callbacks[ prop ].apply( callbacks, args ); + } else { + return callbacks[ prop ]; // or undefined + } + } + } + + // the real equiv function + var innerEquiv, + // stack to decide between skip/abort functions + callers = [], + // stack to avoiding loops from circular referencing + parents = [], + + getProto = Object.getPrototypeOf || function ( obj ) { + return obj.__proto__; + }, + callbacks = (function () { + + // for string, boolean, number and null + function useStrictEquality( b, a ) { + /*jshint eqeqeq:false */ + if ( b instanceof a.constructor || a instanceof b.constructor ) { + // to catch short annotaion VS 'new' annotation of a + // declaration + // e.g. var i = 1; + // var j = new Number(1); + return a == b; + } else { + return a === b; + } + } + + return { + "string": useStrictEquality, + "boolean": useStrictEquality, + "number": useStrictEquality, + "null": useStrictEquality, + "undefined": useStrictEquality, + + "nan": function( b ) { + return isNaN( b ); + }, + + "date": function( b, a ) { + return QUnit.objectType( b ) === "date" && a.valueOf() === b.valueOf(); + }, + + "regexp": function( b, a ) { + return QUnit.objectType( b ) === "regexp" && + // the regex itself + a.source === b.source && + // and its modifers + a.global === b.global && + // (gmi) ... + a.ignoreCase === b.ignoreCase && + a.multiline === b.multiline && + a.sticky === b.sticky; + }, + + // - skip when the property is a method of an instance (OOP) + // - abort otherwise, + // initial === would have catch identical references anyway + "function": function() { + var caller = callers[callers.length - 1]; + return caller !== Object && typeof caller !== "undefined"; + }, + + "array": function( b, a ) { + var i, j, len, loop; + + // b could be an object literal here + if ( QUnit.objectType( b ) !== "array" ) { + return false; + } + + len = a.length; + if ( len !== b.length ) { + // safe and faster + return false; + } + + // track reference to avoid circular references + parents.push( a ); + for ( i = 0; i < len; i++ ) { + loop = false; + for ( j = 0; j < parents.length; j++ ) { + if ( parents[j] === a[i] ) { + loop = true;// dont rewalk array + } + } + if ( !loop && !innerEquiv(a[i], b[i]) ) { + parents.pop(); + return false; + } + } + parents.pop(); + return true; + }, + + "object": function( b, a ) { + var i, j, loop, + // Default to true + eq = true, + aProperties = [], + bProperties = []; + + // comparing constructors is more strict than using + // instanceof + if ( a.constructor !== b.constructor ) { + // Allow objects with no prototype to be equivalent to + // objects with Object as their constructor. + if ( !(( getProto(a) === null && getProto(b) === Object.prototype ) || + ( getProto(b) === null && getProto(a) === Object.prototype ) ) ) { + return false; + } + } + + // stack constructor before traversing properties + callers.push( a.constructor ); + // track reference to avoid circular references + parents.push( a ); + + for ( i in a ) { // be strict: don't ensures hasOwnProperty + // and go deep + loop = false; + for ( j = 0; j < parents.length; j++ ) { + if ( parents[j] === a[i] ) { + // don't go down the same path twice + loop = true; + } + } + aProperties.push(i); // collect a's properties + + if (!loop && !innerEquiv( a[i], b[i] ) ) { + eq = false; + break; + } + } + + callers.pop(); // unstack, we are done + parents.pop(); + + for ( i in b ) { + bProperties.push( i ); // collect b's properties + } + + // Ensures identical properties name + return eq && innerEquiv( aProperties.sort(), bProperties.sort() ); + } + }; + }()); + + innerEquiv = function() { // can take multiple arguments + var args = [].slice.apply( arguments ); + if ( args.length < 2 ) { + return true; // end transition + } + + return (function( a, b ) { + if ( a === b ) { + return true; // catch the most you can + } else if ( a === null || b === null || typeof a === "undefined" || + typeof b === "undefined" || + QUnit.objectType(a) !== QUnit.objectType(b) ) { + return false; // don't lose time with error prone cases + } else { + return bindCallbacks(a, callbacks, [ b, a ]); + } + + // apply transition with (1..n) arguments + }( args[0], args[1] ) && arguments.callee.apply( this, args.splice(1, args.length - 1 )) ); + }; + + return innerEquiv; +}()); + +/** + * jsDump Copyright (c) 2008 Ariel Flesler - aflesler(at)gmail(dot)com | + * http://flesler.blogspot.com Licensed under BSD + * (http://www.opensource.org/licenses/bsd-license.php) Date: 5/15/2008 + * + * @projectDescription Advanced and extensible data dumping for Javascript. + * @version 1.0.0 + * @author Ariel Flesler + * @link {http://flesler.blogspot.com/2008/05/jsdump-pretty-dump-of-any-javascript.html} + */ +QUnit.jsDump = (function() { + function quote( str ) { + return '"' + str.toString().replace( /"/g, '\\"' ) + '"'; + } + function literal( o ) { + return o + ""; + } + function join( pre, arr, post ) { + var s = jsDump.separator(), + base = jsDump.indent(), + inner = jsDump.indent(1); + if ( arr.join ) { + arr = arr.join( "," + s + inner ); + } + if ( !arr ) { + return pre + post; + } + return [ pre, inner + arr, base + post ].join(s); + } + function array( arr, stack ) { + var i = arr.length, ret = new Array(i); + this.up(); + while ( i-- ) { + ret[i] = this.parse( arr[i] , undefined , stack); + } + this.down(); + return join( "[", ret, "]" ); + } + + var reName = /^function (\w+)/, + jsDump = { + // type is used mostly internally, you can fix a (custom)type in advance + parse: function( obj, type, stack ) { + stack = stack || [ ]; + var inStack, res, + parser = this.parsers[ type || this.typeOf(obj) ]; + + type = typeof parser; + inStack = inArray( obj, stack ); + + if ( inStack !== -1 ) { + return "recursion(" + (inStack - stack.length) + ")"; + } + if ( type === "function" ) { + stack.push( obj ); + res = parser.call( this, obj, stack ); + stack.pop(); + return res; + } + return ( type === "string" ) ? parser : this.parsers.error; + }, + typeOf: function( obj ) { + var type; + if ( obj === null ) { + type = "null"; + } else if ( typeof obj === "undefined" ) { + type = "undefined"; + } else if ( QUnit.is( "regexp", obj) ) { + type = "regexp"; + } else if ( QUnit.is( "date", obj) ) { + type = "date"; + } else if ( QUnit.is( "function", obj) ) { + type = "function"; + } else if ( typeof obj.setInterval !== undefined && typeof obj.document !== "undefined" && typeof obj.nodeType === "undefined" ) { + type = "window"; + } else if ( obj.nodeType === 9 ) { + type = "document"; + } else if ( obj.nodeType ) { + type = "node"; + } else if ( + // native arrays + toString.call( obj ) === "[object Array]" || + // NodeList objects + ( typeof obj.length === "number" && typeof obj.item !== "undefined" && ( obj.length ? obj.item(0) === obj[0] : ( obj.item( 0 ) === null && typeof obj[0] === "undefined" ) ) ) + ) { + type = "array"; + } else if ( obj.constructor === Error.prototype.constructor ) { + type = "error"; + } else { + type = typeof obj; + } + return type; + }, + separator: function() { + return this.multiline ? this.HTML ? "<br />" : "\n" : this.HTML ? " " : " "; + }, + // extra can be a number, shortcut for increasing-calling-decreasing + indent: function( extra ) { + if ( !this.multiline ) { + return ""; + } + var chr = this.indentChar; + if ( this.HTML ) { + chr = chr.replace( /\t/g, " " ).replace( / /g, " " ); + } + return new Array( this._depth_ + (extra||0) ).join(chr); + }, + up: function( a ) { + this._depth_ += a || 1; + }, + down: function( a ) { + this._depth_ -= a || 1; + }, + setParser: function( name, parser ) { + this.parsers[name] = parser; + }, + // The next 3 are exposed so you can use them + quote: quote, + literal: literal, + join: join, + // + _depth_: 1, + // This is the list of parsers, to modify them, use jsDump.setParser + parsers: { + window: "[Window]", + document: "[Document]", + error: function(error) { + return "Error(\"" + error.message + "\")"; + }, + unknown: "[Unknown]", + "null": "null", + "undefined": "undefined", + "function": function( fn ) { + var ret = "function", + // functions never have name in IE + name = "name" in fn ? fn.name : (reName.exec(fn) || [])[1]; + + if ( name ) { + ret += " " + name; + } + ret += "( "; + + ret = [ ret, QUnit.jsDump.parse( fn, "functionArgs" ), "){" ].join( "" ); + return join( ret, QUnit.jsDump.parse(fn,"functionCode" ), "}" ); + }, + array: array, + nodelist: array, + "arguments": array, + object: function( map, stack ) { + var ret = [ ], keys, key, val, i; + QUnit.jsDump.up(); + keys = []; + for ( key in map ) { + keys.push( key ); + } + keys.sort(); + for ( i = 0; i < keys.length; i++ ) { + key = keys[ i ]; + val = map[ key ]; + ret.push( QUnit.jsDump.parse( key, "key" ) + ": " + QUnit.jsDump.parse( val, undefined, stack ) ); + } + QUnit.jsDump.down(); + return join( "{", ret, "}" ); + }, + node: function( node ) { + var len, i, val, + open = QUnit.jsDump.HTML ? "<" : "<", + close = QUnit.jsDump.HTML ? ">" : ">", + tag = node.nodeName.toLowerCase(), + ret = open + tag, + attrs = node.attributes; + + if ( attrs ) { + for ( i = 0, len = attrs.length; i < len; i++ ) { + val = attrs[i].nodeValue; + // IE6 includes all attributes in .attributes, even ones not explicitly set. + // Those have values like undefined, null, 0, false, "" or "inherit". + if ( val && val !== "inherit" ) { + ret += " " + attrs[i].nodeName + "=" + QUnit.jsDump.parse( val, "attribute" ); + } + } + } + ret += close; + + // Show content of TextNode or CDATASection + if ( node.nodeType === 3 || node.nodeType === 4 ) { + ret += node.nodeValue; + } + + return ret + open + "/" + tag + close; + }, + // function calls it internally, it's the arguments part of the function + functionArgs: function( fn ) { + var args, + l = fn.length; + + if ( !l ) { + return ""; + } + + args = new Array(l); + while ( l-- ) { + // 97 is 'a' + args[l] = String.fromCharCode(97+l); + } + return " " + args.join( ", " ) + " "; + }, + // object calls it internally, the key part of an item in a map + key: quote, + // function calls it internally, it's the content of the function + functionCode: "[code]", + // node calls it internally, it's an html attribute value + attribute: quote, + string: quote, + date: quote, + regexp: literal, + number: literal, + "boolean": literal + }, + // if true, entities are escaped ( <, >, \t, space and \n ) + HTML: false, + // indentation unit + indentChar: " ", + // if true, items in a collection, are separated by a \n, else just a space. + multiline: true + }; + + return jsDump; +}()); + +// from jquery.js +function inArray( elem, array ) { + if ( array.indexOf ) { + return array.indexOf( elem ); + } + + for ( var i = 0, length = array.length; i < length; i++ ) { + if ( array[ i ] === elem ) { + return i; + } + } + + return -1; +} + +/* + * Javascript Diff Algorithm + * By John Resig (http://ejohn.org/) + * Modified by Chu Alan "sprite" + * + * Released under the MIT license. + * + * More Info: + * http://ejohn.org/projects/javascript-diff-algorithm/ + * + * Usage: QUnit.diff(expected, actual) + * + * QUnit.diff( "the quick brown fox jumped over", "the quick fox jumps over" ) == "the quick <del>brown </del> fox <del>jumped </del><ins>jumps </ins> over" + */ +QUnit.diff = (function() { + /*jshint eqeqeq:false, eqnull:true */ + function diff( o, n ) { + var i, + ns = {}, + os = {}; + + for ( i = 0; i < n.length; i++ ) { + if ( !hasOwn.call( ns, n[i] ) ) { + ns[ n[i] ] = { + rows: [], + o: null + }; + } + ns[ n[i] ].rows.push( i ); + } + + for ( i = 0; i < o.length; i++ ) { + if ( !hasOwn.call( os, o[i] ) ) { + os[ o[i] ] = { + rows: [], + n: null + }; + } + os[ o[i] ].rows.push( i ); + } + + for ( i in ns ) { + if ( !hasOwn.call( ns, i ) ) { + continue; + } + if ( ns[i].rows.length === 1 && hasOwn.call( os, i ) && os[i].rows.length === 1 ) { + n[ ns[i].rows[0] ] = { + text: n[ ns[i].rows[0] ], + row: os[i].rows[0] + }; + o[ os[i].rows[0] ] = { + text: o[ os[i].rows[0] ], + row: ns[i].rows[0] + }; + } + } + + for ( i = 0; i < n.length - 1; i++ ) { + if ( n[i].text != null && n[ i + 1 ].text == null && n[i].row + 1 < o.length && o[ n[i].row + 1 ].text == null && + n[ i + 1 ] == o[ n[i].row + 1 ] ) { + + n[ i + 1 ] = { + text: n[ i + 1 ], + row: n[i].row + 1 + }; + o[ n[i].row + 1 ] = { + text: o[ n[i].row + 1 ], + row: i + 1 + }; + } + } + + for ( i = n.length - 1; i > 0; i-- ) { + if ( n[i].text != null && n[ i - 1 ].text == null && n[i].row > 0 && o[ n[i].row - 1 ].text == null && + n[ i - 1 ] == o[ n[i].row - 1 ]) { + + n[ i - 1 ] = { + text: n[ i - 1 ], + row: n[i].row - 1 + }; + o[ n[i].row - 1 ] = { + text: o[ n[i].row - 1 ], + row: i - 1 + }; + } + } + + return { + o: o, + n: n + }; + } + + return function( o, n ) { + o = o.replace( /\s+$/, "" ); + n = n.replace( /\s+$/, "" ); + + var i, pre, + str = "", + out = diff( o === "" ? [] : o.split(/\s+/), n === "" ? [] : n.split(/\s+/) ), + oSpace = o.match(/\s+/g), + nSpace = n.match(/\s+/g); + + if ( oSpace == null ) { + oSpace = [ " " ]; + } + else { + oSpace.push( " " ); + } + + if ( nSpace == null ) { + nSpace = [ " " ]; + } + else { + nSpace.push( " " ); + } + + if ( out.n.length === 0 ) { + for ( i = 0; i < out.o.length; i++ ) { + str += "<del>" + out.o[i] + oSpace[i] + "</del>"; + } + } + else { + if ( out.n[0].text == null ) { + for ( n = 0; n < out.o.length && out.o[n].text == null; n++ ) { + str += "<del>" + out.o[n] + oSpace[n] + "</del>"; + } + } + + for ( i = 0; i < out.n.length; i++ ) { + if (out.n[i].text == null) { + str += "<ins>" + out.n[i] + nSpace[i] + "</ins>"; + } + else { + // `pre` initialized at top of scope + pre = ""; + + for ( n = out.n[i].row + 1; n < out.o.length && out.o[n].text == null; n++ ) { + pre += "<del>" + out.o[n] + oSpace[n] + "</del>"; + } + str += " " + out.n[i].text + nSpace[i] + pre; + } + } + } + + return str; + }; +}()); + +// for CommonJS enviroments, export everything +if ( typeof exports !== "undefined" ) { + extend( exports, QUnit ); +} + +// get at whatever the global object is, like window in browsers +}( (function() {return this;}.call()) )); diff --git a/resources/lib/jquery/jquery.validate.js b/resources/lib/jquery/jquery.validate.js new file mode 100644 index 000000000000..72296a61f208 --- /dev/null +++ b/resources/lib/jquery/jquery.validate.js @@ -0,0 +1,1166 @@ +/** + * jQuery Validation Plugin 1.8.1 + * + * http://bassistance.de/jquery-plugins/jquery-plugin-validation/ + * http://docs.jquery.com/Plugins/Validation + * + * Copyright (c) 2006 - 2011 Jörn Zaefferer + * + * Dual licensed under the MIT and GPL licenses: + * http://www.opensource.org/licenses/mit-license.php + * http://www.gnu.org/licenses/gpl.html + */ + +(function($) { + +$.extend($.fn, { + // http://docs.jquery.com/Plugins/Validation/validate + validate: function( options ) { + + // if nothing is selected, return nothing; can't chain anyway + if (!this.length) { + options && options.debug && window.console && console.warn( "nothing selected, can't validate, returning nothing" ); + return; + } + + // check if a validator for this form was already created + var validator = $.data(this[0], 'validator'); + if ( validator ) { + return validator; + } + + validator = new $.validator( options, this[0] ); + $.data(this[0], 'validator', validator); + + if ( validator.settings.onsubmit ) { + + // allow suppresing validation by adding a cancel class to the submit button + this.find("input, button").filter(".cancel").click(function() { + validator.cancelSubmit = true; + }); + + // when a submitHandler is used, capture the submitting button + if (validator.settings.submitHandler) { + this.find("input, button").filter(":submit").click(function() { + validator.submitButton = this; + }); + } + + // validate the form on submit + this.submit( function( event ) { + if ( validator.settings.debug ) + // prevent form submit to be able to see console output + event.preventDefault(); + + function handle() { + if ( validator.settings.submitHandler ) { + if (validator.submitButton) { + // insert a hidden input as a replacement for the missing submit button + var hidden = $("<input type='hidden'/>").attr("name", validator.submitButton.name).val(validator.submitButton.value).appendTo(validator.currentForm); + } + validator.settings.submitHandler.call( validator, validator.currentForm ); + if (validator.submitButton) { + // and clean up afterwards; thanks to no-block-scope, hidden can be referenced + hidden.remove(); + } + return false; + } + return true; + } + + // prevent submit for invalid forms or custom submit handlers + if ( validator.cancelSubmit ) { + validator.cancelSubmit = false; + return handle(); + } + if ( validator.form() ) { + if ( validator.pendingRequest ) { + validator.formSubmitted = true; + return false; + } + return handle(); + } else { + validator.focusInvalid(); + return false; + } + }); + } + + return validator; + }, + // http://docs.jquery.com/Plugins/Validation/valid + valid: function() { + if ( $(this[0]).is('form')) { + return this.validate().form(); + } else { + var valid = true; + var validator = $(this[0].form).validate(); + this.each(function() { + valid &= validator.element(this); + }); + return valid; + } + }, + // attributes: space seperated list of attributes to retrieve and remove + removeAttrs: function(attributes) { + var result = {}, + $element = this; + $.each(attributes.split(/\s/), function(index, value) { + result[value] = $element.attr(value); + $element.removeAttr(value); + }); + return result; + }, + // http://docs.jquery.com/Plugins/Validation/rules + rules: function(command, argument) { + var element = this[0]; + + if (command) { + var settings = $.data(element.form, 'validator').settings; + var staticRules = settings.rules; + var existingRules = $.validator.staticRules(element); + switch(command) { + case "add": + $.extend(existingRules, $.validator.normalizeRule(argument)); + staticRules[element.name] = existingRules; + if (argument.messages) + settings.messages[element.name] = $.extend( settings.messages[element.name], argument.messages ); + break; + case "remove": + if (!argument) { + delete staticRules[element.name]; + return existingRules; + } + var filtered = {}; + $.each(argument.split(/\s/), function(index, method) { + filtered[method] = existingRules[method]; + delete existingRules[method]; + }); + return filtered; + } + } + + var data = $.validator.normalizeRules( + $.extend( + {}, + $.validator.metadataRules(element), + $.validator.classRules(element), + $.validator.attributeRules(element), + $.validator.staticRules(element) + ), element); + + // make sure required is at front + if (data.required) { + var param = data.required; + delete data.required; + data = $.extend({required: param}, data); + } + + return data; + } +}); + +// Custom selectors +$.extend($.expr[":"], { + // http://docs.jquery.com/Plugins/Validation/blank + blank: function(a) {return !$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/filled + filled: function(a) {return !!$.trim("" + a.value);}, + // http://docs.jquery.com/Plugins/Validation/unchecked + unchecked: function(a) {return !a.checked;} +}); + +// constructor for validator +$.validator = function( options, form ) { + this.settings = $.extend( true, {}, $.validator.defaults, options ); + this.currentForm = form; + this.init(); +}; + +$.validator.format = function(source, params) { + if ( arguments.length == 1 ) + return function() { + var args = $.makeArray(arguments); + args.unshift(source); + return $.validator.format.apply( this, args ); + }; + if ( arguments.length > 2 && params.constructor != Array ) { + params = $.makeArray(arguments).slice(1); + } + if ( params.constructor != Array ) { + params = [ params ]; + } + $.each(params, function(i, n) { + source = source.replace(new RegExp("\\{" + i + "\\}", "g"), n); + }); + return source; +}; + +$.extend($.validator, { + + defaults: { + messages: {}, + groups: {}, + rules: {}, + errorClass: "error", + validClass: "valid", + errorElement: "label", + focusInvalid: true, + errorContainer: $( [] ), + errorLabelContainer: $( [] ), + onsubmit: true, + ignore: [], + ignoreTitle: false, + onfocusin: function(element) { + this.lastActive = element; + + // hide error label and remove error class on focus if enabled + if ( this.settings.focusCleanup && !this.blockFocusCleanup ) { + this.settings.unhighlight && this.settings.unhighlight.call( this, element, this.settings.errorClass, this.settings.validClass ); + this.addWrapper(this.errorsFor(element)).hide(); + } + }, + onfocusout: function(element) { + if ( !this.checkable(element) && (element.name in this.submitted || !this.optional(element)) ) { + this.element(element); + } + }, + onkeyup: function(element) { + if ( element.name in this.submitted || element == this.lastElement ) { + this.element(element); + } + }, + onclick: function(element) { + // click on selects, radiobuttons and checkboxes + if ( element.name in this.submitted ) + this.element(element); + // or option elements, check parent select in that case + else if (element.parentNode.name in this.submitted) + this.element(element.parentNode); + }, + highlight: function(element, errorClass, validClass) { + if (element.type === 'radio') { + this.findByName(element.name).addClass(errorClass).removeClass(validClass); + } else { + $(element).addClass(errorClass).removeClass(validClass); + } + }, + unhighlight: function(element, errorClass, validClass) { + if (element.type === 'radio') { + this.findByName(element.name).removeClass(errorClass).addClass(validClass); + } else { + $(element).removeClass(errorClass).addClass(validClass); + } + } + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/setDefaults + setDefaults: function(settings) { + $.extend( $.validator.defaults, settings ); + }, + + messages: { + required: "This field is required.", + remote: "Please fix this field.", + email: "Please enter a valid email address.", + url: "Please enter a valid URL.", + date: "Please enter a valid date.", + dateISO: "Please enter a valid date (ISO).", + number: "Please enter a valid number.", + digits: "Please enter only digits.", + creditcard: "Please enter a valid credit card number.", + equalTo: "Please enter the same value again.", + accept: "Please enter a value with a valid extension.", + maxlength: $.validator.format("Please enter no more than {0} characters."), + minlength: $.validator.format("Please enter at least {0} characters."), + rangelength: $.validator.format("Please enter a value between {0} and {1} characters long."), + range: $.validator.format("Please enter a value between {0} and {1}."), + max: $.validator.format("Please enter a value less than or equal to {0}."), + min: $.validator.format("Please enter a value greater than or equal to {0}.") + }, + + autoCreateRanges: false, + + prototype: { + + init: function() { + this.labelContainer = $(this.settings.errorLabelContainer); + this.errorContext = this.labelContainer.length && this.labelContainer || $(this.currentForm); + this.containers = $(this.settings.errorContainer).add( this.settings.errorLabelContainer ); + this.submitted = {}; + this.valueCache = {}; + this.pendingRequest = 0; + this.pending = {}; + this.invalid = {}; + this.reset(); + + var groups = (this.groups = {}); + $.each(this.settings.groups, function(key, value) { + $.each(value.split(/\s/), function(index, name) { + groups[name] = key; + }); + }); + var rules = this.settings.rules; + $.each(rules, function(key, value) { + rules[key] = $.validator.normalizeRule(value); + }); + + function delegate(event) { + var validator = $.data(this[0].form, "validator"), + eventType = "on" + event.type.replace(/^validate/, ""); + validator.settings[eventType] && validator.settings[eventType].call(validator, this[0] ); + } + $(this.currentForm) + .validateDelegate(":text, :password, :file, select, textarea", "focusin focusout keyup", delegate) + .validateDelegate(":radio, :checkbox, select, option", "click", delegate); + + if (this.settings.invalidHandler) + $(this.currentForm).bind("invalid-form.validate", this.settings.invalidHandler); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/form + form: function() { + this.checkForm(); + $.extend(this.submitted, this.errorMap); + this.invalid = $.extend({}, this.errorMap); + if (!this.valid()) + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.showErrors(); + return this.valid(); + }, + + checkForm: function() { + this.prepareForm(); + for ( var i = 0, elements = (this.currentElements = this.elements()); elements[i]; i++ ) { + this.check( elements[i] ); + } + return this.valid(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/element + element: function( element ) { + element = this.clean( element ); + this.lastElement = element; + this.prepareElement( element ); + this.currentElements = $(element); + var result = this.check( element ); + if ( result ) { + delete this.invalid[element.name]; + } else { + this.invalid[element.name] = true; + } + if ( !this.numberOfInvalids() ) { + // Hide error containers on last error + this.toHide = this.toHide.add( this.containers ); + } + this.showErrors(); + return result; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/showErrors + showErrors: function(errors) { + if(errors) { + // add items to error list and map + $.extend( this.errorMap, errors ); + this.errorList = []; + for ( var name in errors ) { + this.errorList.push({ + message: errors[name], + element: this.findByName(name)[0] + }); + } + // remove items from success list + this.successList = $.grep( this.successList, function(element) { + return !(element.name in errors); + }); + } + this.settings.showErrors + ? this.settings.showErrors.call( this, this.errorMap, this.errorList ) + : this.defaultShowErrors(); + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/resetForm + resetForm: function() { + if ( $.fn.resetForm ) + $( this.currentForm ).resetForm(); + this.submitted = {}; + this.prepareForm(); + this.hideErrors(); + this.elements().removeClass( this.settings.errorClass ); + }, + + numberOfInvalids: function() { + return this.objectLength(this.invalid); + }, + + objectLength: function( obj ) { + var count = 0; + for ( var i in obj ) + count++; + return count; + }, + + hideErrors: function() { + this.addWrapper( this.toHide ).hide(); + }, + + valid: function() { + return this.size() == 0; + }, + + size: function() { + return this.errorList.length; + }, + + focusInvalid: function() { + if( this.settings.focusInvalid ) { + try { + $(this.findLastActive() || this.errorList.length && this.errorList[0].element || []) + .filter(":visible") + .focus() + // manually trigger focusin event; without it, focusin handler isn't called, findLastActive won't have anything to find + .trigger("focusin"); + } catch(e) { + // ignore IE throwing errors when focusing hidden elements + } + } + }, + + findLastActive: function() { + var lastActive = this.lastActive; + return lastActive && $.grep(this.errorList, function(n) { + return n.element.name == lastActive.name; + }).length == 1 && lastActive; + }, + + elements: function() { + var validator = this, + rulesCache = {}; + + // select all valid inputs inside the form (no submit or reset buttons) + return $(this.currentForm) + .find("input, select, textarea") + .not(":submit, :reset, :image, [disabled]") + .not( this.settings.ignore ) + .filter(function() { + !this.name && validator.settings.debug && window.console && console.error( "%o has no name assigned", this); + + // select only the first element for each name, and only those with rules specified + if ( this.name in rulesCache || !validator.objectLength($(this).rules()) ) + return false; + + rulesCache[this.name] = true; + return true; + }); + }, + + clean: function( selector ) { + return $( selector )[0]; + }, + + errors: function() { + return $( this.settings.errorElement + "." + this.settings.errorClass, this.errorContext ); + }, + + reset: function() { + this.successList = []; + this.errorList = []; + this.errorMap = {}; + this.toShow = $([]); + this.toHide = $([]); + this.currentElements = $([]); + }, + + prepareForm: function() { + this.reset(); + this.toHide = this.errors().add( this.containers ); + }, + + prepareElement: function( element ) { + this.reset(); + this.toHide = this.errorsFor(element); + }, + + check: function( element ) { + element = this.clean( element ); + + // if radio/checkbox, validate first element in group instead + if (this.checkable(element)) { + element = this.findByName( element.name ).not(this.settings.ignore)[0]; + } + + var rules = $(element).rules(); + var dependencyMismatch = false; + for (var method in rules ) { + var rule = { method: method, parameters: rules[method] }; + try { + var result = $.validator.methods[method].call( this, element.value.replace(/\r/g, ""), element, rule.parameters ); + + // if a method indicates that the field is optional and therefore valid, + // don't mark it as valid when there are no other rules + if ( result == "dependency-mismatch" ) { + dependencyMismatch = true; + continue; + } + dependencyMismatch = false; + + if ( result == "pending" ) { + this.toHide = this.toHide.not( this.errorsFor(element) ); + return; + } + + if( !result ) { + this.formatAndAdd( element, rule ); + return false; + } + } catch(e) { + this.settings.debug && window.console && console.log("exception occured when checking element " + element.id + + ", check the '" + rule.method + "' method", e); + throw e; + } + } + if (dependencyMismatch) + return; + if ( this.objectLength(rules) ) + this.successList.push(element); + return true; + }, + + // return the custom message for the given element and validation method + // specified in the element's "messages" metadata + customMetaMessage: function(element, method) { + if (!$.metadata) + return; + + var meta = this.settings.meta + ? $(element).metadata()[this.settings.meta] + : $(element).metadata(); + + return meta && meta.messages && meta.messages[method]; + }, + + // return the custom message for the given element name and validation method + customMessage: function( name, method ) { + var m = this.settings.messages[name]; + return m && (m.constructor == String + ? m + : m[method]); + }, + + // return the first defined argument, allowing empty strings + findDefined: function() { + for(var i = 0; i < arguments.length; i++) { + if (arguments[i] !== undefined) + return arguments[i]; + } + return undefined; + }, + + defaultMessage: function( element, method) { + return this.findDefined( + this.customMessage( element.name, method ), + this.customMetaMessage( element, method ), + // title is never undefined, so handle empty string as undefined + !this.settings.ignoreTitle && element.title || undefined, + $.validator.messages[method], + "<strong>Warning: No message defined for " + element.name + "</strong>" + ); + }, + + formatAndAdd: function( element, rule ) { + var message = this.defaultMessage( element, rule.method ), + theregex = /\$?\{(\d+)\}/g; + if ( typeof message == "function" ) { + message = message.call(this, rule.parameters, element); + } else if (theregex.test(message)) { + message = jQuery.format(message.replace(theregex, '{$1}'), rule.parameters); + } + this.errorList.push({ + message: message, + element: element + }); + + this.errorMap[element.name] = message; + this.submitted[element.name] = message; + }, + + addWrapper: function(toToggle) { + if ( this.settings.wrapper ) + toToggle = toToggle.add( toToggle.parent( this.settings.wrapper ) ); + return toToggle; + }, + + defaultShowErrors: function() { + for ( var i = 0; this.errorList[i]; i++ ) { + var error = this.errorList[i]; + this.settings.highlight && this.settings.highlight.call( this, error.element, this.settings.errorClass, this.settings.validClass ); + this.showLabel( error.element, error.message ); + } + if( this.errorList.length ) { + this.toShow = this.toShow.add( this.containers ); + } + if (this.settings.success) { + for ( var i = 0; this.successList[i]; i++ ) { + this.showLabel( this.successList[i] ); + } + } + if (this.settings.unhighlight) { + for ( var i = 0, elements = this.validElements(); elements[i]; i++ ) { + this.settings.unhighlight.call( this, elements[i], this.settings.errorClass, this.settings.validClass ); + } + } + this.toHide = this.toHide.not( this.toShow ); + this.hideErrors(); + this.addWrapper( this.toShow ).show(); + }, + + validElements: function() { + return this.currentElements.not(this.invalidElements()); + }, + + invalidElements: function() { + return $(this.errorList).map(function() { + return this.element; + }); + }, + + showLabel: function(element, message) { + var label = this.errorsFor( element ); + if ( label.length ) { + // refresh error/success class + label.removeClass().addClass( this.settings.errorClass ); + + // check if we have a generated label, replace the message then + label.attr("generated") && label.html(message); + } else { + // create label + label = $("<" + this.settings.errorElement + "/>") + .attr({"for": this.idOrName(element), generated: true}) + .addClass(this.settings.errorClass) + .html(message || ""); + if ( this.settings.wrapper ) { + // make sure the element is visible, even in IE + // actually showing the wrapped element is handled elsewhere + label = label.hide().show().wrap("<" + this.settings.wrapper + "/>").parent(); + } + if ( !this.labelContainer.append(label).length ) + this.settings.errorPlacement + ? this.settings.errorPlacement(label, $(element) ) + : label.insertAfter(element); + } + if ( !message && this.settings.success ) { + label.text(""); + typeof this.settings.success == "string" + ? label.addClass( this.settings.success ) + : this.settings.success( label ); + } + this.toShow = this.toShow.add(label); + }, + + errorsFor: function(element) { + var name = this.idOrName(element); + return this.errors().filter(function() { + return $(this).attr('for') == name; + }); + }, + + idOrName: function(element) { + return this.groups[element.name] || (this.checkable(element) ? element.name : element.id || element.name); + }, + + checkable: function( element ) { + return /radio|checkbox/i.test(element.type); + }, + + findByName: function( name ) { + // select by name and filter by form for performance over form.find("[name=...]") + var form = this.currentForm; + return $(document.getElementsByName(name)).map(function(index, element) { + return element.form == form && element.name == name && element || null; + }); + }, + + getLength: function(value, element) { + switch( element.nodeName.toLowerCase() ) { + case 'select': + return $("option:selected", element).length; + case 'input': + if( this.checkable( element) ) + return this.findByName(element.name).filter(':checked').length; + } + return value.length; + }, + + depend: function(param, element) { + return this.dependTypes[typeof param] + ? this.dependTypes[typeof param](param, element) + : true; + }, + + dependTypes: { + "boolean": function(param, element) { + return param; + }, + "string": function(param, element) { + return !!$(param, element.form).length; + }, + "function": function(param, element) { + return param(element); + } + }, + + optional: function(element) { + return !$.validator.methods.required.call(this, $.trim(element.value), element) && "dependency-mismatch"; + }, + + startRequest: function(element) { + if (!this.pending[element.name]) { + this.pendingRequest++; + this.pending[element.name] = true; + } + }, + + stopRequest: function(element, valid) { + this.pendingRequest--; + // sometimes synchronization fails, make sure pendingRequest is never < 0 + if (this.pendingRequest < 0) + this.pendingRequest = 0; + delete this.pending[element.name]; + if ( valid && this.pendingRequest == 0 && this.formSubmitted && this.form() ) { + $(this.currentForm).submit(); + this.formSubmitted = false; + } else if (!valid && this.pendingRequest == 0 && this.formSubmitted) { + $(this.currentForm).triggerHandler("invalid-form", [this]); + this.formSubmitted = false; + } + }, + + previousValue: function(element) { + return $.data(element, "previousValue") || $.data(element, "previousValue", { + old: null, + valid: true, + message: this.defaultMessage( element, "remote" ) + }); + } + + }, + + classRuleSettings: { + required: {required: true}, + email: {email: true}, + url: {url: true}, + date: {date: true}, + dateISO: {dateISO: true}, + dateDE: {dateDE: true}, + number: {number: true}, + numberDE: {numberDE: true}, + digits: {digits: true}, + creditcard: {creditcard: true} + }, + + addClassRules: function(className, rules) { + className.constructor == String ? + this.classRuleSettings[className] = rules : + $.extend(this.classRuleSettings, className); + }, + + classRules: function(element) { + var rules = {}; + var classes = $(element).attr('class'); + classes && $.each(classes.split(' '), function() { + if (this in $.validator.classRuleSettings) { + $.extend(rules, $.validator.classRuleSettings[this]); + } + }); + return rules; + }, + + attributeRules: function(element) { + var rules = {}; + var $element = $(element); + + for (var method in $.validator.methods) { + var value = $element.attr(method); + if (value) { + rules[method] = value; + } + } + + // maxlength may be returned as -1, 2147483647 (IE) and 524288 (safari) for text inputs + if (rules.maxlength && /-1|2147483647|524288/.test(rules.maxlength)) { + delete rules.maxlength; + } + + return rules; + }, + + metadataRules: function(element) { + if (!$.metadata) return {}; + + var meta = $.data(element.form, 'validator').settings.meta; + return meta ? + $(element).metadata()[meta] : + $(element).metadata(); + }, + + staticRules: function(element) { + var rules = {}; + var validator = $.data(element.form, 'validator'); + if (validator.settings.rules) { + rules = $.validator.normalizeRule(validator.settings.rules[element.name]) || {}; + } + return rules; + }, + + normalizeRules: function(rules, element) { + // handle dependency check + $.each(rules, function(prop, val) { + // ignore rule when param is explicitly false, eg. required:false + if (val === false) { + delete rules[prop]; + return; + } + if (val.param || val.depends) { + var keepRule = true; + switch (typeof val.depends) { + case "string": + keepRule = !!$(val.depends, element.form).length; + break; + case "function": + keepRule = val.depends.call(element, element); + break; + } + if (keepRule) { + rules[prop] = val.param !== undefined ? val.param : true; + } else { + delete rules[prop]; + } + } + }); + + // evaluate parameters + $.each(rules, function(rule, parameter) { + rules[rule] = $.isFunction(parameter) ? parameter(element) : parameter; + }); + + // clean number parameters + $.each(['minlength', 'maxlength', 'min', 'max'], function() { + if (rules[this]) { + rules[this] = Number(rules[this]); + } + }); + $.each(['rangelength', 'range'], function() { + if (rules[this]) { + rules[this] = [Number(rules[this][0]), Number(rules[this][1])]; + } + }); + + if ($.validator.autoCreateRanges) { + // auto-create ranges + if (rules.min && rules.max) { + rules.range = [rules.min, rules.max]; + delete rules.min; + delete rules.max; + } + if (rules.minlength && rules.maxlength) { + rules.rangelength = [rules.minlength, rules.maxlength]; + delete rules.minlength; + delete rules.maxlength; + } + } + + // To support custom messages in metadata ignore rule methods titled "messages" + if (rules.messages) { + delete rules.messages; + } + + return rules; + }, + + // Converts a simple string to a {string: true} rule, e.g., "required" to {required:true} + normalizeRule: function(data) { + if( typeof data == "string" ) { + var transformed = {}; + $.each(data.split(/\s/), function() { + transformed[this] = true; + }); + data = transformed; + } + return data; + }, + + // http://docs.jquery.com/Plugins/Validation/Validator/addMethod + addMethod: function(name, method, message) { + $.validator.methods[name] = method; + $.validator.messages[name] = message != undefined ? message : $.validator.messages[name]; + if (method.length < 3) { + $.validator.addClassRules(name, $.validator.normalizeRule(name)); + } + }, + + methods: { + + // http://docs.jquery.com/Plugins/Validation/Methods/required + required: function(value, element, param) { + // check if dependency is met + if ( !this.depend(param, element) ) + return "dependency-mismatch"; + switch( element.nodeName.toLowerCase() ) { + case 'select': + // could be an array for select-multiple or a string, both are fine this way + var val = $(element).val(); + return val && val.length > 0; + case 'input': + if ( this.checkable(element) ) + return this.getLength(value, element) > 0; + default: + return $.trim(value).length > 0; + } + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/remote + remote: function(value, element, param) { + if ( this.optional(element) ) + return "dependency-mismatch"; + + var previous = this.previousValue(element); + if (!this.settings.messages[element.name] ) + this.settings.messages[element.name] = {}; + previous.originalMessage = this.settings.messages[element.name].remote; + this.settings.messages[element.name].remote = previous.message; + + param = typeof param == "string" && {url:param} || param; + + if ( this.pending[element.name] ) { + return "pending"; + } + if ( previous.old === value ) { + return previous.valid; + } + + previous.old = value; + var validator = this; + this.startRequest(element); + var data = {}; + data[element.name] = value; + $.ajax($.extend(true, { + url: param, + mode: "abort", + port: "validate" + element.name, + dataType: "json", + data: data, + success: function(response) { + validator.settings.messages[element.name].remote = previous.originalMessage; + var valid = response === true; + if ( valid ) { + var submitted = validator.formSubmitted; + validator.prepareElement(element); + validator.formSubmitted = submitted; + validator.successList.push(element); + validator.showErrors(); + } else { + var errors = {}; + var message = response || validator.defaultMessage( element, "remote" ); + errors[element.name] = previous.message = $.isFunction(message) ? message(value) : message; + validator.showErrors(errors); + } + previous.valid = valid; + validator.stopRequest(element, valid); + } + }, param)); + return "pending"; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/minlength + minlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/maxlength + maxlength: function(value, element, param) { + return this.optional(element) || this.getLength($.trim(value), element) <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/rangelength + rangelength: function(value, element, param) { + var length = this.getLength($.trim(value), element); + return this.optional(element) || ( length >= param[0] && length <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/min + min: function( value, element, param ) { + return this.optional(element) || value >= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/max + max: function( value, element, param ) { + return this.optional(element) || value <= param; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/range + range: function( value, element, param ) { + return this.optional(element) || ( value >= param[0] && value <= param[1] ); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/email + email: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/ + return this.optional(element) || /^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/url + url: function(value, element) { + // contributed by Scott Gonzalez: http://projects.scottsplayground.com/iri/ + return this.optional(element) || /^(https?|ftp):\/\/(((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?$/i.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/date + date: function(value, element) { + return this.optional(element) || !/Invalid|NaN/.test(new Date(value)); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/dateISO + dateISO: function(value, element) { + return this.optional(element) || /^\d{4}[\/-]\d{1,2}[\/-]\d{1,2}$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/number + number: function(value, element) { + return this.optional(element) || /^-?(?:\d+|\d{1,3}(?:,\d{3})+)(?:\.\d+)?$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/digits + digits: function(value, element) { + return this.optional(element) || /^\d+$/.test(value); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/creditcard + // based on http://en.wikipedia.org/wiki/Luhn + creditcard: function(value, element) { + if ( this.optional(element) ) + return "dependency-mismatch"; + // accept only digits and dashes + if (/[^0-9-]+/.test(value)) + return false; + var nCheck = 0, + nDigit = 0, + bEven = false; + + value = value.replace(/\D/g, ""); + + for (var n = value.length - 1; n >= 0; n--) { + var cDigit = value.charAt(n); + var nDigit = parseInt(cDigit, 10); + if (bEven) { + if ((nDigit *= 2) > 9) + nDigit -= 9; + } + nCheck += nDigit; + bEven = !bEven; + } + + return (nCheck % 10) == 0; + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/accept + accept: function(value, element, param) { + param = typeof param == "string" ? param.replace(/,/g, '|') : "png|jpe?g|gif"; + return this.optional(element) || value.match(new RegExp(".(" + param + ")$", "i")); + }, + + // http://docs.jquery.com/Plugins/Validation/Methods/equalTo + equalTo: function(value, element, param) { + // bind to the blur event of the target in order to revalidate whenever the target field is updated + // TODO find a way to bind the event just once, avoiding the unbind-rebind overhead + var target = $(param).unbind(".validate-equalTo").bind("blur.validate-equalTo", function() { + $(element).valid(); + }); + return value == target.val(); + } + + } + +}); + +// deprecated, use $.validator.format instead +$.format = $.validator.format; + +})(jQuery); + +// ajax mode: abort +// usage: $.ajax({ mode: "abort"[, port: "uniqueport"]}); +// if mode:"abort" is used, the previous request on that port (port can be undefined) is aborted via XMLHttpRequest.abort() +;(function($) { + var pendingRequests = {}; + // Use a prefilter if available (1.5+) + if ( $.ajaxPrefilter ) { + $.ajaxPrefilter(function(settings, _, xhr) { + var port = settings.port; + if (settings.mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + pendingRequests[port] = xhr; + } + }); + } else { + // Proxy ajax + var ajax = $.ajax; + $.ajax = function(settings) { + var mode = ( "mode" in settings ? settings : $.ajaxSettings ).mode, + port = ( "port" in settings ? settings : $.ajaxSettings ).port; + if (mode == "abort") { + if ( pendingRequests[port] ) { + pendingRequests[port].abort(); + } + return (pendingRequests[port] = ajax.apply(this, arguments)); + } + return ajax.apply(this, arguments); + }; + } +})(jQuery); + +// provides cross-browser focusin and focusout events +// IE has native support, in other browsers, use event caputuring (neither bubbles) + +// provides delegate(type: String, delegate: Selector, handler: Callback) plugin for easier event delegation +// handler is only called when $(event.target).is(delegate), in the scope of the jquery-object for event.target +;(function($) { + // only implement if not provided by jQuery core (since 1.4) + // TODO verify if jQuery 1.4's implementation is compatible with older jQuery special-event APIs + if (!jQuery.event.special.focusin && !jQuery.event.special.focusout && document.addEventListener) { + $.each({ + focus: 'focusin', + blur: 'focusout' + }, function( original, fix ){ + $.event.special[fix] = { + setup:function() { + this.addEventListener( original, handler, true ); + }, + teardown:function() { + this.removeEventListener( original, handler, true ); + }, + handler: function(e) { + arguments[0] = $.event.fix(e); + arguments[0].type = fix; + return $.event.handle.apply(this, arguments); + } + }; + function handler(e) { + e = $.event.fix(e); + e.type = fix; + return $.event.handle.call(this, e); + } + }); + }; + $.extend($.fn, { + validateDelegate: function(delegate, type, handler) { + return this.bind(type, function(event) { + var target = $(event.target); + if (target.is(delegate)) { + return handler.apply(target, arguments); + } + }); + } + }); +})(jQuery); diff --git a/resources/lib/jquery/jquery.xmldom.js b/resources/lib/jquery/jquery.xmldom.js new file mode 100644 index 000000000000..85d0083d22ed --- /dev/null +++ b/resources/lib/jquery/jquery.xmldom.js @@ -0,0 +1,46 @@ +/*! + * jQuery xmlDOM Plugin v1.0 + * http://outwestmedia.com/jquery-plugins/xmldom/ + * + * Released: 2009-04-06 + * Version: 1.0 + * + * Copyright (c) 2009 Jonathan Sharp, Out West Media LLC. + * Dual licensed under the MIT and GPL licenses. + * http://docs.jquery.com/License + */ +(function($) { + // IE DOMParser wrapper + if ( window['DOMParser'] == undefined && window.ActiveXObject ) { + DOMParser = function() { }; + DOMParser.prototype.parseFromString = function( xmlString ) { + var doc = new ActiveXObject('Microsoft.XMLDOM'); + doc.async = 'false'; + doc.loadXML( xmlString ); + return doc; + }; + } + + $.xmlDOM = function(xml, onErrorFn) { + try { + var xmlDoc = ( new DOMParser() ).parseFromString( xml, 'text/xml' ); + if ( $.isXMLDoc( xmlDoc ) ) { + var err = $('parsererror', xmlDoc); + if ( err.length == 1 ) { + throw('Error: ' + $(xmlDoc).text() ); + } + } else { + throw('Unable to parse XML'); + } + } catch( e ) { + var msg = ( e.name == undefined ? e : e.name + ': ' + e.message ); + if ( $.isFunction( onErrorFn ) ) { + onErrorFn( msg ); + } else { + $(document).trigger('xmlParseError', [ msg ]); + } + return $([]); + } + return $( xmlDoc ); + }; +})(jQuery);
\ No newline at end of file diff --git a/resources/lib/moment/LICENSE b/resources/lib/moment/LICENSE new file mode 100644 index 000000000000..b44e3a68ce1e --- /dev/null +++ b/resources/lib/moment/LICENSE @@ -0,0 +1,22 @@ +Copyright (c) 2011-2013 Tim Wood, Iskren Chernev, Moment.js contributors + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/resources/lib/moment/lang/ar-ma.js b/resources/lib/moment/lang/ar-ma.js new file mode 100644 index 000000000000..1c159f1029c1 --- /dev/null +++ b/resources/lib/moment/lang/ar-ma.js @@ -0,0 +1,56 @@ +// moment.js language configuration +// language : Moroccan Arabic (ar-ma) +// author : ElFadili Yassine : https://github.com/ElFadiliY +// author : Abdel Said : https://github.com/abdelsaid + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('ar-ma', { + months : "يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر".split("_"), + monthsShort : "يناير_فبراير_مارس_أبريل_ماي_يونيو_يوليوز_غشت_شتنبر_أكتوبر_نونبر_دجنبر".split("_"), + weekdays : "الأحد_الإتنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت".split("_"), + weekdaysShort : "احد_اتنين_ثلاثاء_اربعاء_خميس_جمعة_سبت".split("_"), + weekdaysMin : "ح_ن_ث_ر_خ_ج_س".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: "[اليوم على الساعة] LT", + nextDay: '[غدا على الساعة] LT', + nextWeek: 'dddd [على الساعة] LT', + lastDay: '[أمس على الساعة] LT', + lastWeek: 'dddd [على الساعة] LT', + sameElse: 'L' + }, + relativeTime : { + future : "في %s", + past : "منذ %s", + s : "ثوان", + m : "دقيقة", + mm : "%d دقائق", + h : "ساعة", + hh : "%d ساعات", + d : "يوم", + dd : "%d أيام", + M : "شهر", + MM : "%d أشهر", + y : "سنة", + yy : "%d سنوات" + }, + week : { + dow : 6, // Saturday is the first day of the week. + doy : 12 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ar.js b/resources/lib/moment/lang/ar.js new file mode 100644 index 000000000000..6e27d29a930c --- /dev/null +++ b/resources/lib/moment/lang/ar.js @@ -0,0 +1,56 @@ +// moment.js language configuration +// language : Arabic (ar) +// author : Abdel Said : https://github.com/abdelsaid +// changes in months, weekdays : Ahmed Elkhatib + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('ar', { + months : "يناير/ كانون الثاني_فبراير/ شباط_مارس/ آذار_أبريل/ نيسان_مايو/ أيار_يونيو/ حزيران_يوليو/ تموز_أغسطس/ آب_سبتمبر/ أيلول_أكتوبر/ تشرين الأول_نوفمبر/ تشرين الثاني_ديسمبر/ كانون الأول".split("_"), + monthsShort : "يناير/ كانون الثاني_فبراير/ شباط_مارس/ آذار_أبريل/ نيسان_مايو/ أيار_يونيو/ حزيران_يوليو/ تموز_أغسطس/ آب_سبتمبر/ أيلول_أكتوبر/ تشرين الأول_نوفمبر/ تشرين الثاني_ديسمبر/ كانون الأول".split("_"), + weekdays : "الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت".split("_"), + weekdaysShort : "الأحد_الإثنين_الثلاثاء_الأربعاء_الخميس_الجمعة_السبت".split("_"), + weekdaysMin : "ح_ن_ث_ر_خ_ج_س".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: "[اليوم على الساعة] LT", + nextDay: '[غدا على الساعة] LT', + nextWeek: 'dddd [على الساعة] LT', + lastDay: '[أمس على الساعة] LT', + lastWeek: 'dddd [على الساعة] LT', + sameElse: 'L' + }, + relativeTime : { + future : "في %s", + past : "منذ %s", + s : "ثوان", + m : "دقيقة", + mm : "%d دقائق", + h : "ساعة", + hh : "%d ساعات", + d : "يوم", + dd : "%d أيام", + M : "شهر", + MM : "%d أشهر", + y : "سنة", + yy : "%d سنوات" + }, + week : { + dow : 6, // Saturday is the first day of the week. + doy : 12 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/bg.js b/resources/lib/moment/lang/bg.js new file mode 100644 index 000000000000..f47ed65a9858 --- /dev/null +++ b/resources/lib/moment/lang/bg.js @@ -0,0 +1,86 @@ +// moment.js language configuration +// language : bulgarian (bg) +// author : Krasen Borisov : https://github.com/kraz + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('bg', { + months : "януари_февруари_март_април_май_юни_юли_август_септември_октомври_ноември_декември".split("_"), + monthsShort : "янр_фев_мар_апр_май_юни_юли_авг_сеп_окт_ное_дек".split("_"), + weekdays : "неделя_понеделник_вторник_сряда_четвъртък_петък_събота".split("_"), + weekdaysShort : "нед_пон_вто_сря_чет_пет_съб".split("_"), + weekdaysMin : "нд_пн_вт_ср_чт_пт_сб".split("_"), + longDateFormat : { + LT : "H:mm", + L : "D.MM.YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay : '[Днес в] LT', + nextDay : '[Утре в] LT', + nextWeek : 'dddd [в] LT', + lastDay : '[Вчера в] LT', + lastWeek : function () { + switch (this.day()) { + case 0: + case 3: + case 6: + return '[В изминалата] dddd [в] LT'; + case 1: + case 2: + case 4: + case 5: + return '[В изминалия] dddd [в] LT'; + } + }, + sameElse : 'L' + }, + relativeTime : { + future : "след %s", + past : "преди %s", + s : "няколко секунди", + m : "минута", + mm : "%d минути", + h : "час", + hh : "%d часа", + d : "ден", + dd : "%d дни", + M : "месец", + MM : "%d месеца", + y : "година", + yy : "%d години" + }, + ordinal : function (number) { + var lastDigit = number % 10, + last2Digits = number % 100; + if (number === 0) { + return number + '-ев'; + } else if (last2Digits === 0) { + return number + '-ен'; + } else if (last2Digits > 10 && last2Digits < 20) { + return number + '-ти'; + } else if (lastDigit === 1) { + return number + '-ви'; + } else if (lastDigit === 2) { + return number + '-ри'; + } else if (lastDigit === 7 || lastDigit === 8) { + return number + '-ми'; + } else { + return number + '-ти'; + } + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/br.js b/resources/lib/moment/lang/br.js new file mode 100644 index 000000000000..39c60df07612 --- /dev/null +++ b/resources/lib/moment/lang/br.js @@ -0,0 +1,107 @@ +// moment.js language configuration +// language : breton (br) +// author : Jean-Baptiste Le Duigou : https://github.com/jbleduigou + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function relativeTimeWithMutation(number, withoutSuffix, key) { + var format = { + 'mm': "munutenn", + 'MM': "miz", + 'dd': "devezh" + }; + return number + ' ' + mutation(format[key], number); + } + + function specialMutationForYears(number) { + switch (lastNumber(number)) { + case 1: + case 3: + case 4: + case 5: + case 9: + return number + ' bloaz'; + default: + return number + ' vloaz'; + } + } + + function lastNumber(number) { + if (number > 9) { + return lastNumber(number % 10); + } + return number; + } + + function mutation(text, number) { + if (number === 2) { + return softMutation(text); + } + return text; + } + + function softMutation(text) { + var mutationTable = { + 'm': 'v', + 'b': 'v', + 'd': 'z' + }; + if (mutationTable[text.charAt(0)] === undefined) { + return text; + } + return mutationTable[text.charAt(0)] + text.substring(1); + } + + return moment.lang('br', { + months : "Genver_C'hwevrer_Meurzh_Ebrel_Mae_Mezheven_Gouere_Eost_Gwengolo_Here_Du_Kerzu".split("_"), + monthsShort : "Gen_C'hwe_Meu_Ebr_Mae_Eve_Gou_Eos_Gwe_Her_Du_Ker".split("_"), + weekdays : "Sul_Lun_Meurzh_Merc'her_Yaou_Gwener_Sadorn".split("_"), + weekdaysShort : "Sul_Lun_Meu_Mer_Yao_Gwe_Sad".split("_"), + weekdaysMin : "Su_Lu_Me_Mer_Ya_Gw_Sa".split("_"), + longDateFormat : { + LT : "h[e]mm A", + L : "DD/MM/YYYY", + LL : "D [a viz] MMMM YYYY", + LLL : "D [a viz] MMMM YYYY LT", + LLLL : "dddd, D [a viz] MMMM YYYY LT" + }, + calendar : { + sameDay : '[Hiziv da] LT', + nextDay : '[Warc\'hoazh da] LT', + nextWeek : 'dddd [da] LT', + lastDay : '[Dec\'h da] LT', + lastWeek : 'dddd [paset da] LT', + sameElse : 'L' + }, + relativeTime : { + future : "a-benn %s", + past : "%s 'zo", + s : "un nebeud segondennoù", + m : "ur vunutenn", + mm : relativeTimeWithMutation, + h : "un eur", + hh : "%d eur", + d : "un devezh", + dd : relativeTimeWithMutation, + M : "ur miz", + MM : relativeTimeWithMutation, + y : "ur bloaz", + yy : specialMutationForYears + }, + ordinal : function (number) { + var output = (number === 1) ? 'añ' : 'vet'; + return number + output; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/bs.js b/resources/lib/moment/lang/bs.js new file mode 100644 index 000000000000..83a9b4c0736d --- /dev/null +++ b/resources/lib/moment/lang/bs.js @@ -0,0 +1,139 @@ +// moment.js language configuration +// language : bosnian (bs) +// author : Nedim Cholich : https://github.com/frontyard +// based on (hr) translation by Bojan Marković + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + + function translate(number, withoutSuffix, key) { + var result = number + " "; + switch (key) { + case 'm': + return withoutSuffix ? 'jedna minuta' : 'jedne minute'; + case 'mm': + if (number === 1) { + result += 'minuta'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'minute'; + } else { + result += 'minuta'; + } + return result; + case 'h': + return withoutSuffix ? 'jedan sat' : 'jednog sata'; + case 'hh': + if (number === 1) { + result += 'sat'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'sata'; + } else { + result += 'sati'; + } + return result; + case 'dd': + if (number === 1) { + result += 'dan'; + } else { + result += 'dana'; + } + return result; + case 'MM': + if (number === 1) { + result += 'mjesec'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'mjeseca'; + } else { + result += 'mjeseci'; + } + return result; + case 'yy': + if (number === 1) { + result += 'godina'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'godine'; + } else { + result += 'godina'; + } + return result; + } + } + + return moment.lang('bs', { + months : "januar_februar_mart_april_maj_juni_juli_avgust_septembar_oktobar_novembar_decembar".split("_"), + monthsShort : "jan._feb._mar._apr._maj._jun._jul._avg._sep._okt._nov._dec.".split("_"), + weekdays : "nedjelja_ponedjeljak_utorak_srijeda_četvrtak_petak_subota".split("_"), + weekdaysShort : "ned._pon._uto._sri._čet._pet._sub.".split("_"), + weekdaysMin : "ne_po_ut_sr_če_pe_su".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD. MM. YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd, D. MMMM YYYY LT" + }, + calendar : { + sameDay : '[danas u] LT', + nextDay : '[sutra u] LT', + + nextWeek : function () { + switch (this.day()) { + case 0: + return '[u] [nedjelju] [u] LT'; + case 3: + return '[u] [srijedu] [u] LT'; + case 6: + return '[u] [subotu] [u] LT'; + case 1: + case 2: + case 4: + case 5: + return '[u] dddd [u] LT'; + } + }, + lastDay : '[jučer u] LT', + lastWeek : function () { + switch (this.day()) { + case 0: + case 3: + return '[prošlu] dddd [u] LT'; + case 6: + return '[prošle] [subote] [u] LT'; + case 1: + case 2: + case 4: + case 5: + return '[prošli] dddd [u] LT'; + } + }, + sameElse : 'L' + }, + relativeTime : { + future : "za %s", + past : "prije %s", + s : "par sekundi", + m : translate, + mm : translate, + h : translate, + hh : translate, + d : "dan", + dd : translate, + M : "mjesec", + MM : translate, + y : "godinu", + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ca.js b/resources/lib/moment/lang/ca.js new file mode 100644 index 000000000000..cf471130d09b --- /dev/null +++ b/resources/lib/moment/lang/ca.js @@ -0,0 +1,66 @@ +// moment.js language configuration +// language : catalan (ca) +// author : Juan G. Hurtado : https://github.com/juanghurtado + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('ca', { + months : "gener_febrer_març_abril_maig_juny_juliol_agost_setembre_octubre_novembre_desembre".split("_"), + monthsShort : "gen._febr._mar._abr._mai._jun._jul._ag._set._oct._nov._des.".split("_"), + weekdays : "diumenge_dilluns_dimarts_dimecres_dijous_divendres_dissabte".split("_"), + weekdaysShort : "dg._dl._dt._dc._dj._dv._ds.".split("_"), + weekdaysMin : "Dg_Dl_Dt_Dc_Dj_Dv_Ds".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay : function () { + return '[avui a ' + ((this.hours() !== 1) ? 'les' : 'la') + '] LT'; + }, + nextDay : function () { + return '[demà a ' + ((this.hours() !== 1) ? 'les' : 'la') + '] LT'; + }, + nextWeek : function () { + return 'dddd [a ' + ((this.hours() !== 1) ? 'les' : 'la') + '] LT'; + }, + lastDay : function () { + return '[ahir a ' + ((this.hours() !== 1) ? 'les' : 'la') + '] LT'; + }, + lastWeek : function () { + return '[el] dddd [passat a ' + ((this.hours() !== 1) ? 'les' : 'la') + '] LT'; + }, + sameElse : 'L' + }, + relativeTime : { + future : "en %s", + past : "fa %s", + s : "uns segons", + m : "un minut", + mm : "%d minuts", + h : "una hora", + hh : "%d hores", + d : "un dia", + dd : "%d dies", + M : "un mes", + MM : "%d mesos", + y : "un any", + yy : "%d anys" + }, + ordinal : '%dº', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/cs.js b/resources/lib/moment/lang/cs.js new file mode 100644 index 000000000000..c1396cfbf689 --- /dev/null +++ b/resources/lib/moment/lang/cs.js @@ -0,0 +1,155 @@ +// moment.js language configuration +// language : czech (cs) +// author : petrbela : https://github.com/petrbela + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var months = "leden_únor_březen_duben_květen_červen_červenec_srpen_září_říjen_listopad_prosinec".split("_"), + monthsShort = "led_úno_bře_dub_kvě_čvn_čvc_srp_zář_říj_lis_pro".split("_"); + + function plural(n) { + return (n > 1) && (n < 5) && (~~(n / 10) !== 1); + } + + function translate(number, withoutSuffix, key, isFuture) { + var result = number + " "; + switch (key) { + case 's': // a few seconds / in a few seconds / a few seconds ago + return (withoutSuffix || isFuture) ? 'pár vteřin' : 'pár vteřinami'; + case 'm': // a minute / in a minute / a minute ago + return withoutSuffix ? 'minuta' : (isFuture ? 'minutu' : 'minutou'); + case 'mm': // 9 minutes / in 9 minutes / 9 minutes ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'minuty' : 'minut'); + } else { + return result + 'minutami'; + } + break; + case 'h': // an hour / in an hour / an hour ago + return withoutSuffix ? 'hodina' : (isFuture ? 'hodinu' : 'hodinou'); + case 'hh': // 9 hours / in 9 hours / 9 hours ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'hodiny' : 'hodin'); + } else { + return result + 'hodinami'; + } + break; + case 'd': // a day / in a day / a day ago + return (withoutSuffix || isFuture) ? 'den' : 'dnem'; + case 'dd': // 9 days / in 9 days / 9 days ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'dny' : 'dní'); + } else { + return result + 'dny'; + } + break; + case 'M': // a month / in a month / a month ago + return (withoutSuffix || isFuture) ? 'měsíc' : 'měsícem'; + case 'MM': // 9 months / in 9 months / 9 months ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'měsíce' : 'měsíců'); + } else { + return result + 'měsíci'; + } + break; + case 'y': // a year / in a year / a year ago + return (withoutSuffix || isFuture) ? 'rok' : 'rokem'; + case 'yy': // 9 years / in 9 years / 9 years ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'roky' : 'let'); + } else { + return result + 'lety'; + } + break; + } + } + + return moment.lang('cs', { + months : months, + monthsShort : monthsShort, + monthsParse : (function (months, monthsShort) { + var i, _monthsParse = []; + for (i = 0; i < 12; i++) { + // use custom parser to solve problem with July (červenec) + _monthsParse[i] = new RegExp('^' + months[i] + '$|^' + monthsShort[i] + '$', 'i'); + } + return _monthsParse; + }(months, monthsShort)), + weekdays : "neděle_pondělí_úterý_středa_čtvrtek_pátek_sobota".split("_"), + weekdaysShort : "ne_po_út_st_čt_pá_so".split("_"), + weekdaysMin : "ne_po_út_st_čt_pá_so".split("_"), + longDateFormat : { + LT: "H:mm", + L : "DD.MM.YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd D. MMMM YYYY LT" + }, + calendar : { + sameDay: "[dnes v] LT", + nextDay: '[zítra v] LT', + nextWeek: function () { + switch (this.day()) { + case 0: + return '[v neděli v] LT'; + case 1: + case 2: + return '[v] dddd [v] LT'; + case 3: + return '[ve středu v] LT'; + case 4: + return '[ve čtvrtek v] LT'; + case 5: + return '[v pátek v] LT'; + case 6: + return '[v sobotu v] LT'; + } + }, + lastDay: '[včera v] LT', + lastWeek: function () { + switch (this.day()) { + case 0: + return '[minulou neděli v] LT'; + case 1: + case 2: + return '[minulé] dddd [v] LT'; + case 3: + return '[minulou středu v] LT'; + case 4: + case 5: + return '[minulý] dddd [v] LT'; + case 6: + return '[minulou sobotu v] LT'; + } + }, + sameElse: "L" + }, + relativeTime : { + future : "za %s", + past : "před %s", + s : translate, + m : translate, + mm : translate, + h : translate, + hh : translate, + d : translate, + dd : translate, + M : translate, + MM : translate, + y : translate, + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/cv.js b/resources/lib/moment/lang/cv.js new file mode 100644 index 000000000000..a5812debab5d --- /dev/null +++ b/resources/lib/moment/lang/cv.js @@ -0,0 +1,59 @@ +// moment.js language configuration +// language : chuvash (cv) +// author : Anatoly Mironov : https://github.com/mirontoli + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('cv', { + months : "кăрлач_нарăс_пуш_ака_май_çĕртме_утă_çурла_авăн_юпа_чӳк_раштав".split("_"), + monthsShort : "кăр_нар_пуш_ака_май_çĕр_утă_çур_ав_юпа_чӳк_раш".split("_"), + weekdays : "вырсарникун_тунтикун_ытларикун_юнкун_кĕçнерникун_эрнекун_шăматкун".split("_"), + weekdaysShort : "выр_тун_ытл_юн_кĕç_эрн_шăм".split("_"), + weekdaysMin : "вр_тн_ыт_юн_кç_эр_шм".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD-MM-YYYY", + LL : "YYYY [çулхи] MMMM [уйăхĕн] D[-мĕшĕ]", + LLL : "YYYY [çулхи] MMMM [уйăхĕн] D[-мĕшĕ], LT", + LLLL : "dddd, YYYY [çулхи] MMMM [уйăхĕн] D[-мĕшĕ], LT" + }, + calendar : { + sameDay: '[Паян] LT [сехетре]', + nextDay: '[Ыран] LT [сехетре]', + lastDay: '[Ĕнер] LT [сехетре]', + nextWeek: '[Çитес] dddd LT [сехетре]', + lastWeek: '[Иртнĕ] dddd LT [сехетре]', + sameElse: 'L' + }, + relativeTime : { + future : function (output) { + var affix = /сехет$/i.exec(output) ? "рен" : /çул$/i.exec(output) ? "тан" : "ран"; + return output + affix; + }, + past : "%s каялла", + s : "пĕр-ик çеккунт", + m : "пĕр минут", + mm : "%d минут", + h : "пĕр сехет", + hh : "%d сехет", + d : "пĕр кун", + dd : "%d кун", + M : "пĕр уйăх", + MM : "%d уйăх", + y : "пĕр çул", + yy : "%d çул" + }, + ordinal : '%d-мĕш', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/cy.js b/resources/lib/moment/lang/cy.js new file mode 100644 index 000000000000..b47d7c2751ad --- /dev/null +++ b/resources/lib/moment/lang/cy.js @@ -0,0 +1,77 @@ +// moment.js language configuration +// language : Welsh (cy) +// author : Robert Allen + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang("cy", { + months: "Ionawr_Chwefror_Mawrth_Ebrill_Mai_Mehefin_Gorffennaf_Awst_Medi_Hydref_Tachwedd_Rhagfyr".split("_"), + monthsShort: "Ion_Chwe_Maw_Ebr_Mai_Meh_Gor_Aws_Med_Hyd_Tach_Rhag".split("_"), + weekdays: "Dydd Sul_Dydd Llun_Dydd Mawrth_Dydd Mercher_Dydd Iau_Dydd Gwener_Dydd Sadwrn".split("_"), + weekdaysShort: "Sul_Llun_Maw_Mer_Iau_Gwe_Sad".split("_"), + weekdaysMin: "Su_Ll_Ma_Me_Ia_Gw_Sa".split("_"), + // time formats are the same as en-gb + longDateFormat: { + LT: "HH:mm", + L: "DD/MM/YYYY", + LL: "D MMMM YYYY", + LLL: "D MMMM YYYY LT", + LLLL: "dddd, D MMMM YYYY LT" + }, + calendar: { + sameDay: '[Heddiw am] LT', + nextDay: '[Yfory am] LT', + nextWeek: 'dddd [am] LT', + lastDay: '[Ddoe am] LT', + lastWeek: 'dddd [diwethaf am] LT', + sameElse: 'L' + }, + relativeTime: { + future: "mewn %s", + past: "%s yn àl", + s: "ychydig eiliadau", + m: "munud", + mm: "%d munud", + h: "awr", + hh: "%d awr", + d: "diwrnod", + dd: "%d diwrnod", + M: "mis", + MM: "%d mis", + y: "blwyddyn", + yy: "%d flynedd" + }, + // traditional ordinal numbers above 31 are not commonly used in colloquial Welsh + ordinal: function (number) { + var b = number, + output = '', + lookup = [ + '', 'af', 'il', 'ydd', 'ydd', 'ed', 'ed', 'ed', 'fed', 'fed', 'fed', // 1af to 10fed + 'eg', 'fed', 'eg', 'eg', 'fed', 'eg', 'eg', 'fed', 'eg', 'fed' // 11eg to 20fed + ]; + + if (b > 20) { + if (b === 40 || b === 50 || b === 60 || b === 80 || b === 100) { + output = 'fed'; // not 30ain, 70ain or 90ain + } else { + output = 'ain'; + } + } else if (b > 0) { + output = lookup[b]; + } + + return number + output; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/da.js b/resources/lib/moment/lang/da.js new file mode 100644 index 000000000000..2fa8244c0155 --- /dev/null +++ b/resources/lib/moment/lang/da.js @@ -0,0 +1,56 @@ +// moment.js language configuration +// language : danish (da) +// author : Ulrik Nielsen : https://github.com/mrbase + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('da', { + months : "januar_februar_marts_april_maj_juni_juli_august_september_oktober_november_december".split("_"), + monthsShort : "jan_feb_mar_apr_maj_jun_jul_aug_sep_okt_nov_dec".split("_"), + weekdays : "søndag_mandag_tirsdag_onsdag_torsdag_fredag_lørdag".split("_"), + weekdaysShort : "søn_man_tir_ons_tor_fre_lør".split("_"), + weekdaysMin : "sø_ma_ti_on_to_fr_lø".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D. MMMM, YYYY LT" + }, + calendar : { + sameDay : '[I dag kl.] LT', + nextDay : '[I morgen kl.] LT', + nextWeek : 'dddd [kl.] LT', + lastDay : '[I går kl.] LT', + lastWeek : '[sidste] dddd [kl] LT', + sameElse : 'L' + }, + relativeTime : { + future : "om %s", + past : "%s siden", + s : "få sekunder", + m : "et minut", + mm : "%d minutter", + h : "en time", + hh : "%d timer", + d : "en dag", + dd : "%d dage", + M : "en måned", + MM : "%d måneder", + y : "et år", + yy : "%d år" + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/de.js b/resources/lib/moment/lang/de.js new file mode 100644 index 000000000000..988f3288204c --- /dev/null +++ b/resources/lib/moment/lang/de.js @@ -0,0 +1,71 @@ +// moment.js language configuration +// language : german (de) +// author : lluchs : https://github.com/lluchs +// author: Menelion Elensúle: https://github.com/Oire + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function processRelativeTime(number, withoutSuffix, key, isFuture) { + var format = { + 'm': ['eine Minute', 'einer Minute'], + 'h': ['eine Stunde', 'einer Stunde'], + 'd': ['ein Tag', 'einem Tag'], + 'dd': [number + ' Tage', number + ' Tagen'], + 'M': ['ein Monat', 'einem Monat'], + 'MM': [number + ' Monate', number + ' Monaten'], + 'y': ['ein Jahr', 'einem Jahr'], + 'yy': [number + ' Jahre', number + ' Jahren'] + }; + return withoutSuffix ? format[key][0] : format[key][1]; + } + + return moment.lang('de', { + months : "Januar_Februar_März_April_Mai_Juni_Juli_August_September_Oktober_November_Dezember".split("_"), + monthsShort : "Jan._Febr._Mrz._Apr._Mai_Jun._Jul._Aug._Sept._Okt._Nov._Dez.".split("_"), + weekdays : "Sonntag_Montag_Dienstag_Mittwoch_Donnerstag_Freitag_Samstag".split("_"), + weekdaysShort : "So._Mo._Di._Mi._Do._Fr._Sa.".split("_"), + weekdaysMin : "So_Mo_Di_Mi_Do_Fr_Sa".split("_"), + longDateFormat : { + LT: "H:mm [Uhr]", + L : "DD.MM.YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd, D. MMMM YYYY LT" + }, + calendar : { + sameDay: "[Heute um] LT", + sameElse: "L", + nextDay: '[Morgen um] LT', + nextWeek: 'dddd [um] LT', + lastDay: '[Gestern um] LT', + lastWeek: '[letzten] dddd [um] LT' + }, + relativeTime : { + future : "in %s", + past : "vor %s", + s : "ein paar Sekunden", + m : processRelativeTime, + mm : "%d Minuten", + h : processRelativeTime, + hh : "%d Stunden", + d : processRelativeTime, + dd : processRelativeTime, + M : processRelativeTime, + MM : processRelativeTime, + y : processRelativeTime, + yy : processRelativeTime + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/el.js b/resources/lib/moment/lang/el.js new file mode 100644 index 000000000000..9dfea239d8be --- /dev/null +++ b/resources/lib/moment/lang/el.js @@ -0,0 +1,79 @@ +// moment.js language configuration +// language : modern greek (el) +// author : Aggelos Karalias : https://github.com/mehiel + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('el', { + monthsNominativeEl : "Ιανουάριος_Φεβρουάριος_Μάρτιος_Απρίλιος_Μάιος_Ιούνιος_Ιούλιος_Αύγουστος_Σεπτέμβριος_Οκτώβριος_Νοέμβριος_Δεκέμβριος".split("_"), + monthsGenitiveEl : "Ιανουαρίου_Φεβρουαρίου_Μαρτίου_Απριλίου_Μαΐου_Ιουνίου_Ιουλίου_Αυγούστου_Σεπτεμβρίου_Οκτωβρίου_Νοεμβρίου_Δεκεμβρίου".split("_"), + months : function (momentToFormat, format) { + if (/D/.test(format.substring(0, format.indexOf("MMMM")))) { // if there is a day number before 'MMMM' + return this._monthsGenitiveEl[momentToFormat.month()]; + } else { + return this._monthsNominativeEl[momentToFormat.month()]; + } + }, + monthsShort : "Ιαν_Φεβ_Μαρ_Απρ_Μαϊ_Ιουν_Ιουλ_Αυγ_Σεπ_Οκτ_Νοε_Δεκ".split("_"), + weekdays : "Κυριακή_Δευτέρα_Τρίτη_Τετάρτη_Πέμπτη_Παρασκευή_Σάββατο".split("_"), + weekdaysShort : "Κυρ_Δευ_Τρι_Τετ_Πεμ_Παρ_Σαβ".split("_"), + weekdaysMin : "Κυ_Δε_Τρ_Τε_Πε_Πα_Σα".split("_"), + meridiem : function (hours, minutes, isLower) { + if (hours > 11) { + return isLower ? 'μμ' : 'ΜΜ'; + } else { + return isLower ? 'πμ' : 'ΠΜ'; + } + }, + longDateFormat : { + LT : "h:mm A", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendarEl : { + sameDay : '[Σήμερα {}] LT', + nextDay : '[Αύριο {}] LT', + nextWeek : 'dddd [{}] LT', + lastDay : '[Χθες {}] LT', + lastWeek : '[την προηγούμενη] dddd [{}] LT', + sameElse : 'L' + }, + calendar : function (key, mom) { + var output = this._calendarEl[key], + hours = mom && mom.hours(); + + return output.replace("{}", (hours % 12 === 1 ? "στη" : "στις")); + }, + relativeTime : { + future : "σε %s", + past : "%s πριν", + s : "δευτερόλεπτα", + m : "ένα λεπτό", + mm : "%d λεπτά", + h : "μία ώρα", + hh : "%d ώρες", + d : "μία μέρα", + dd : "%d μέρες", + M : "ένας μήνας", + MM : "%d μήνες", + y : "ένας χρόνος", + yy : "%d χρόνια" + }, + ordinal : function (number) { + return number + 'η'; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/en-au.js b/resources/lib/moment/lang/en-au.js new file mode 100644 index 000000000000..4d91e2569941 --- /dev/null +++ b/resources/lib/moment/lang/en-au.js @@ -0,0 +1,62 @@ +// moment.js language configuration +// language : australian english (en-au) + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('en-au', { + months : "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), + monthsShort : "Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"), + weekdays : "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), + weekdaysShort : "Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"), + weekdaysMin : "Su_Mo_Tu_We_Th_Fr_Sa".split("_"), + longDateFormat : { + LT : "h:mm A", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay : '[Today at] LT', + nextDay : '[Tomorrow at] LT', + nextWeek : 'dddd [at] LT', + lastDay : '[Yesterday at] LT', + lastWeek : '[Last] dddd [at] LT', + sameElse : 'L' + }, + relativeTime : { + future : "in %s", + past : "%s ago", + s : "a few seconds", + m : "a minute", + mm : "%d minutes", + h : "an hour", + hh : "%d hours", + d : "a day", + dd : "%d days", + M : "a month", + MM : "%d months", + y : "a year", + yy : "%d years" + }, + ordinal : function (number) { + var b = number % 10, + output = (~~ (number % 100 / 10) === 1) ? 'th' : + (b === 1) ? 'st' : + (b === 2) ? 'nd' : + (b === 3) ? 'rd' : 'th'; + return number + output; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/en-ca.js b/resources/lib/moment/lang/en-ca.js new file mode 100644 index 000000000000..a97e9f396253 --- /dev/null +++ b/resources/lib/moment/lang/en-ca.js @@ -0,0 +1,59 @@ +// moment.js language configuration +// language : canadian english (en-ca) +// author : Jonathan Abourbih : https://github.com/jonbca + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('en-ca', { + months : "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), + monthsShort : "Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"), + weekdays : "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), + weekdaysShort : "Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"), + weekdaysMin : "Su_Mo_Tu_We_Th_Fr_Sa".split("_"), + longDateFormat : { + LT : "h:mm A", + L : "YYYY-MM-DD", + LL : "D MMMM, YYYY", + LLL : "D MMMM, YYYY LT", + LLLL : "dddd, D MMMM, YYYY LT" + }, + calendar : { + sameDay : '[Today at] LT', + nextDay : '[Tomorrow at] LT', + nextWeek : 'dddd [at] LT', + lastDay : '[Yesterday at] LT', + lastWeek : '[Last] dddd [at] LT', + sameElse : 'L' + }, + relativeTime : { + future : "in %s", + past : "%s ago", + s : "a few seconds", + m : "a minute", + mm : "%d minutes", + h : "an hour", + hh : "%d hours", + d : "a day", + dd : "%d days", + M : "a month", + MM : "%d months", + y : "a year", + yy : "%d years" + }, + ordinal : function (number) { + var b = number % 10, + output = (~~ (number % 100 / 10) === 1) ? 'th' : + (b === 1) ? 'st' : + (b === 2) ? 'nd' : + (b === 3) ? 'rd' : 'th'; + return number + output; + } + }); +})); diff --git a/resources/lib/moment/lang/en-gb.js b/resources/lib/moment/lang/en-gb.js new file mode 100644 index 000000000000..3a7907be5926 --- /dev/null +++ b/resources/lib/moment/lang/en-gb.js @@ -0,0 +1,63 @@ +// moment.js language configuration +// language : great britain english (en-gb) +// author : Chris Gedrim : https://github.com/chrisgedrim + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('en-gb', { + months : "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), + monthsShort : "Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"), + weekdays : "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), + weekdaysShort : "Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"), + weekdaysMin : "Su_Mo_Tu_We_Th_Fr_Sa".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay : '[Today at] LT', + nextDay : '[Tomorrow at] LT', + nextWeek : 'dddd [at] LT', + lastDay : '[Yesterday at] LT', + lastWeek : '[Last] dddd [at] LT', + sameElse : 'L' + }, + relativeTime : { + future : "in %s", + past : "%s ago", + s : "a few seconds", + m : "a minute", + mm : "%d minutes", + h : "an hour", + hh : "%d hours", + d : "a day", + dd : "%d days", + M : "a month", + MM : "%d months", + y : "a year", + yy : "%d years" + }, + ordinal : function (number) { + var b = number % 10, + output = (~~ (number % 100 / 10) === 1) ? 'th' : + (b === 1) ? 'st' : + (b === 2) ? 'nd' : + (b === 3) ? 'rd' : 'th'; + return number + output; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/eo.js b/resources/lib/moment/lang/eo.js new file mode 100644 index 000000000000..03b1abff1455 --- /dev/null +++ b/resources/lib/moment/lang/eo.js @@ -0,0 +1,65 @@ +// moment.js language configuration +// language : esperanto (eo) +// author : Colin Dean : https://github.com/colindean +// komento: Mi estas malcerta se mi korekte traktis akuzativojn en tiu traduko. +// Se ne, bonvolu korekti kaj avizi min por ke mi povas lerni! + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('eo', { + months : "januaro_februaro_marto_aprilo_majo_junio_julio_aŭgusto_septembro_oktobro_novembro_decembro".split("_"), + monthsShort : "jan_feb_mar_apr_maj_jun_jul_aŭg_sep_okt_nov_dec".split("_"), + weekdays : "Dimanĉo_Lundo_Mardo_Merkredo_Ĵaŭdo_Vendredo_Sabato".split("_"), + weekdaysShort : "Dim_Lun_Mard_Merk_Ĵaŭ_Ven_Sab".split("_"), + weekdaysMin : "Di_Lu_Ma_Me_Ĵa_Ve_Sa".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "YYYY-MM-DD", + LL : "D[-an de] MMMM, YYYY", + LLL : "D[-an de] MMMM, YYYY LT", + LLLL : "dddd, [la] D[-an de] MMMM, YYYY LT" + }, + meridiem : function (hours, minutes, isLower) { + if (hours > 11) { + return isLower ? 'p.t.m.' : 'P.T.M.'; + } else { + return isLower ? 'a.t.m.' : 'A.T.M.'; + } + }, + calendar : { + sameDay : '[Hodiaŭ je] LT', + nextDay : '[Morgaŭ je] LT', + nextWeek : 'dddd [je] LT', + lastDay : '[Hieraŭ je] LT', + lastWeek : '[pasinta] dddd [je] LT', + sameElse : 'L' + }, + relativeTime : { + future : "je %s", + past : "antaŭ %s", + s : "sekundoj", + m : "minuto", + mm : "%d minutoj", + h : "horo", + hh : "%d horoj", + d : "tago",//ne 'diurno', ĉar estas uzita por proksimumo + dd : "%d tagoj", + M : "monato", + MM : "%d monatoj", + y : "jaro", + yy : "%d jaroj" + }, + ordinal : "%da", + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/es.js b/resources/lib/moment/lang/es.js new file mode 100644 index 000000000000..0a38396d3ed5 --- /dev/null +++ b/resources/lib/moment/lang/es.js @@ -0,0 +1,66 @@ +// moment.js language configuration +// language : spanish (es) +// author : Julio Napurí : https://github.com/julionc + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('es', { + months : "enero_febrero_marzo_abril_mayo_junio_julio_agosto_septiembre_octubre_noviembre_diciembre".split("_"), + monthsShort : "ene._feb._mar._abr._may._jun._jul._ago._sep._oct._nov._dic.".split("_"), + weekdays : "domingo_lunes_martes_miércoles_jueves_viernes_sábado".split("_"), + weekdaysShort : "dom._lun._mar._mié._jue._vie._sáb.".split("_"), + weekdaysMin : "Do_Lu_Ma_Mi_Ju_Vi_Sá".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD/MM/YYYY", + LL : "D [de] MMMM [de] YYYY", + LLL : "D [de] MMMM [de] YYYY LT", + LLLL : "dddd, D [de] MMMM [de] YYYY LT" + }, + calendar : { + sameDay : function () { + return '[hoy a la' + ((this.hours() !== 1) ? 's' : '') + '] LT'; + }, + nextDay : function () { + return '[mañana a la' + ((this.hours() !== 1) ? 's' : '') + '] LT'; + }, + nextWeek : function () { + return 'dddd [a la' + ((this.hours() !== 1) ? 's' : '') + '] LT'; + }, + lastDay : function () { + return '[ayer a la' + ((this.hours() !== 1) ? 's' : '') + '] LT'; + }, + lastWeek : function () { + return '[el] dddd [pasado a la' + ((this.hours() !== 1) ? 's' : '') + '] LT'; + }, + sameElse : 'L' + }, + relativeTime : { + future : "en %s", + past : "hace %s", + s : "unos segundos", + m : "un minuto", + mm : "%d minutos", + h : "una hora", + hh : "%d horas", + d : "un día", + dd : "%d días", + M : "un mes", + MM : "%d meses", + y : "un año", + yy : "%d años" + }, + ordinal : '%dº', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/et.js b/resources/lib/moment/lang/et.js new file mode 100644 index 000000000000..fb410ef44821 --- /dev/null +++ b/resources/lib/moment/lang/et.js @@ -0,0 +1,76 @@ +// moment.js language configuration +// language : estonian (et) +// author : Henry Kehlmann : https://github.com/madhenry +// improvements : Illimar Tambek : https://github.com/ragulka + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function processRelativeTime(number, withoutSuffix, key, isFuture) { + var format = { + 's' : ['mõne sekundi', 'mõni sekund', 'paar sekundit'], + 'm' : ['ühe minuti', 'üks minut'], + 'mm': [number + ' minuti', number + ' minutit'], + 'h' : ['ühe tunni', 'tund aega', 'üks tund'], + 'hh': [number + ' tunni', number + ' tundi'], + 'd' : ['ühe päeva', 'üks päev'], + 'M' : ['kuu aja', 'kuu aega', 'üks kuu'], + 'MM': [number + ' kuu', number + ' kuud'], + 'y' : ['ühe aasta', 'aasta', 'üks aasta'], + 'yy': [number + ' aasta', number + ' aastat'] + }; + if (withoutSuffix) { + return format[key][2] ? format[key][2] : format[key][1]; + } + return isFuture ? format[key][0] : format[key][1]; + } + + return moment.lang('et', { + months : "jaanuar_veebruar_märts_aprill_mai_juuni_juuli_august_september_oktoober_november_detsember".split("_"), + monthsShort : "jaan_veebr_märts_apr_mai_juuni_juuli_aug_sept_okt_nov_dets".split("_"), + weekdays : "pühapäev_esmaspäev_teisipäev_kolmapäev_neljapäev_reede_laupäev".split("_"), + weekdaysShort : "P_E_T_K_N_R_L".split("_"), + weekdaysMin : "P_E_T_K_N_R_L".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD.MM.YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd, D. MMMM YYYY LT" + }, + calendar : { + sameDay : '[Täna,] LT', + nextDay : '[Homme,] LT', + nextWeek : '[Järgmine] dddd LT', + lastDay : '[Eile,] LT', + lastWeek : '[Eelmine] dddd LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s pärast", + past : "%s tagasi", + s : processRelativeTime, + m : processRelativeTime, + mm : processRelativeTime, + h : processRelativeTime, + hh : processRelativeTime, + d : processRelativeTime, + dd : '%d päeva', + M : processRelativeTime, + MM : processRelativeTime, + y : processRelativeTime, + yy : processRelativeTime + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/eu.js b/resources/lib/moment/lang/eu.js new file mode 100644 index 000000000000..659b739bf734 --- /dev/null +++ b/resources/lib/moment/lang/eu.js @@ -0,0 +1,60 @@ +// moment.js language configuration +// language : euskara (eu) +// author : Eneko Illarramendi : https://github.com/eillarra + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('eu', { + months : "urtarrila_otsaila_martxoa_apirila_maiatza_ekaina_uztaila_abuztua_iraila_urria_azaroa_abendua".split("_"), + monthsShort : "urt._ots._mar._api._mai._eka._uzt._abu._ira._urr._aza._abe.".split("_"), + weekdays : "igandea_astelehena_asteartea_asteazkena_osteguna_ostirala_larunbata".split("_"), + weekdaysShort : "ig._al._ar._az._og._ol._lr.".split("_"), + weekdaysMin : "ig_al_ar_az_og_ol_lr".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "YYYY-MM-DD", + LL : "YYYY[ko] MMMM[ren] D[a]", + LLL : "YYYY[ko] MMMM[ren] D[a] LT", + LLLL : "dddd, YYYY[ko] MMMM[ren] D[a] LT", + l : "YYYY-M-D", + ll : "YYYY[ko] MMM D[a]", + lll : "YYYY[ko] MMM D[a] LT", + llll : "ddd, YYYY[ko] MMM D[a] LT" + }, + calendar : { + sameDay : '[gaur] LT[etan]', + nextDay : '[bihar] LT[etan]', + nextWeek : 'dddd LT[etan]', + lastDay : '[atzo] LT[etan]', + lastWeek : '[aurreko] dddd LT[etan]', + sameElse : 'L' + }, + relativeTime : { + future : "%s barru", + past : "duela %s", + s : "segundo batzuk", + m : "minutu bat", + mm : "%d minutu", + h : "ordu bat", + hh : "%d ordu", + d : "egun bat", + dd : "%d egun", + M : "hilabete bat", + MM : "%d hilabete", + y : "urte bat", + yy : "%d urte" + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/fa.js b/resources/lib/moment/lang/fa.js new file mode 100644 index 000000000000..4a690c4072c9 --- /dev/null +++ b/resources/lib/moment/lang/fa.js @@ -0,0 +1,97 @@ +// moment.js language configuration +// language : Persian Language +// author : Ebrahim Byagowi : https://github.com/ebraminio + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var symbolMap = { + '1': '۱', + '2': '۲', + '3': '۳', + '4': '۴', + '5': '۵', + '6': '۶', + '7': '۷', + '8': '۸', + '9': '۹', + '0': '۰' + }, numberMap = { + '۱': '1', + '۲': '2', + '۳': '3', + '۴': '4', + '۵': '5', + '۶': '6', + '۷': '7', + '۸': '8', + '۹': '9', + '۰': '0' + }; + + return moment.lang('fa', { + months : 'ژانویه_فوریه_مارس_آوریل_مه_ژوئن_ژوئیه_اوت_سپتامبر_اکتبر_نوامبر_دسامبر'.split('_'), + monthsShort : 'ژانویه_فوریه_مارس_آوریل_مه_ژوئن_ژوئیه_اوت_سپتامبر_اکتبر_نوامبر_دسامبر'.split('_'), + weekdays : 'یک\u200cشنبه_دوشنبه_سه\u200cشنبه_چهارشنبه_پنج\u200cشنبه_جمعه_شنبه'.split('_'), + weekdaysShort : 'یک\u200cشنبه_دوشنبه_سه\u200cشنبه_چهارشنبه_پنج\u200cشنبه_جمعه_شنبه'.split('_'), + weekdaysMin : 'ی_د_س_چ_پ_ج_ش'.split('_'), + longDateFormat : { + LT : 'HH:mm', + L : 'DD/MM/YYYY', + LL : 'D MMMM YYYY', + LLL : 'D MMMM YYYY LT', + LLLL : 'dddd, D MMMM YYYY LT' + }, + meridiem : function (hour, minute, isLower) { + if (hour < 12) { + return "قبل از ظهر"; + } else { + return "بعد از ظهر"; + } + }, + calendar : { + sameDay : '[امروز ساعت] LT', + nextDay : '[فردا ساعت] LT', + nextWeek : 'dddd [ساعت] LT', + lastDay : '[دیروز ساعت] LT', + lastWeek : 'dddd [پیش] [ساعت] LT', + sameElse : 'L' + }, + relativeTime : { + future : 'در %s', + past : '%s پیش', + s : 'چندین ثانیه', + m : 'یک دقیقه', + mm : '%d دقیقه', + h : 'یک ساعت', + hh : '%d ساعت', + d : 'یک روز', + dd : '%d روز', + M : 'یک ماه', + MM : '%d ماه', + y : 'یک سال', + yy : '%d سال' + }, + preparse: function (string) { + return string.replace(/[۰-۹]/g, function (match) { + return numberMap[match]; + }).replace(/،/g, ','); + }, + postformat: function (string) { + return string.replace(/\d/g, function (match) { + return symbolMap[match]; + }).replace(/,/g, '،'); + }, + ordinal : '%dم', + week : { + dow : 6, // Saturday is the first day of the week. + doy : 12 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/fi.js b/resources/lib/moment/lang/fi.js new file mode 100644 index 000000000000..18529c10d539 --- /dev/null +++ b/resources/lib/moment/lang/fi.js @@ -0,0 +1,103 @@ +// moment.js language configuration +// language : finnish (fi) +// author : Tarmo Aidantausta : https://github.com/bleadof + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var numbers_past = 'nolla yksi kaksi kolme neljä viisi kuusi seitsemän kahdeksan yhdeksän'.split(' '), + numbers_future = ['nolla', 'yhden', 'kahden', 'kolmen', 'neljän', 'viiden', 'kuuden', + numbers_past[7], numbers_past[8], numbers_past[9]]; + + function translate(number, withoutSuffix, key, isFuture) { + var result = ""; + switch (key) { + case 's': + return isFuture ? 'muutaman sekunnin' : 'muutama sekunti'; + case 'm': + return isFuture ? 'minuutin' : 'minuutti'; + case 'mm': + result = isFuture ? 'minuutin' : 'minuuttia'; + break; + case 'h': + return isFuture ? 'tunnin' : 'tunti'; + case 'hh': + result = isFuture ? 'tunnin' : 'tuntia'; + break; + case 'd': + return isFuture ? 'päivän' : 'päivä'; + case 'dd': + result = isFuture ? 'päivän' : 'päivää'; + break; + case 'M': + return isFuture ? 'kuukauden' : 'kuukausi'; + case 'MM': + result = isFuture ? 'kuukauden' : 'kuukautta'; + break; + case 'y': + return isFuture ? 'vuoden' : 'vuosi'; + case 'yy': + result = isFuture ? 'vuoden' : 'vuotta'; + break; + } + result = verbal_number(number, isFuture) + " " + result; + return result; + } + + function verbal_number(number, isFuture) { + return number < 10 ? (isFuture ? numbers_future[number] : numbers_past[number]) : number; + } + + return moment.lang('fi', { + months : "tammikuu_helmikuu_maaliskuu_huhtikuu_toukokuu_kesäkuu_heinäkuu_elokuu_syyskuu_lokakuu_marraskuu_joulukuu".split("_"), + monthsShort : "tammi_helmi_maalis_huhti_touko_kesä_heinä_elo_syys_loka_marras_joulu".split("_"), + weekdays : "sunnuntai_maanantai_tiistai_keskiviikko_torstai_perjantai_lauantai".split("_"), + weekdaysShort : "su_ma_ti_ke_to_pe_la".split("_"), + weekdaysMin : "su_ma_ti_ke_to_pe_la".split("_"), + longDateFormat : { + LT : "HH.mm", + L : "DD.MM.YYYY", + LL : "Do MMMM[ta] YYYY", + LLL : "Do MMMM[ta] YYYY, [klo] LT", + LLLL : "dddd, Do MMMM[ta] YYYY, [klo] LT", + l : "D.M.YYYY", + ll : "Do MMM YYYY", + lll : "Do MMM YYYY, [klo] LT", + llll : "ddd, Do MMM YYYY, [klo] LT" + }, + calendar : { + sameDay : '[tänään] [klo] LT', + nextDay : '[huomenna] [klo] LT', + nextWeek : 'dddd [klo] LT', + lastDay : '[eilen] [klo] LT', + lastWeek : '[viime] dddd[na] [klo] LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s päästä", + past : "%s sitten", + s : translate, + m : translate, + mm : translate, + h : translate, + hh : translate, + d : translate, + dd : translate, + M : translate, + MM : translate, + y : translate, + yy : translate + }, + ordinal : "%d.", + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/fo.js b/resources/lib/moment/lang/fo.js new file mode 100644 index 000000000000..2f1cbb81538a --- /dev/null +++ b/resources/lib/moment/lang/fo.js @@ -0,0 +1,56 @@ +// moment.js language configuration +// language : faroese (fo) +// author : Ragnar Johannesen : https://github.com/ragnar123 + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('fo', { + months : "januar_februar_mars_apríl_mai_juni_juli_august_september_oktober_november_desember".split("_"), + monthsShort : "jan_feb_mar_apr_mai_jun_jul_aug_sep_okt_nov_des".split("_"), + weekdays : "sunnudagur_mánadagur_týsdagur_mikudagur_hósdagur_fríggjadagur_leygardagur".split("_"), + weekdaysShort : "sun_mán_týs_mik_hós_frí_ley".split("_"), + weekdaysMin : "su_má_tý_mi_hó_fr_le".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D. MMMM, YYYY LT" + }, + calendar : { + sameDay : '[Í dag kl.] LT', + nextDay : '[Í morgin kl.] LT', + nextWeek : 'dddd [kl.] LT', + lastDay : '[Í gjár kl.] LT', + lastWeek : '[síðstu] dddd [kl] LT', + sameElse : 'L' + }, + relativeTime : { + future : "um %s", + past : "%s síðani", + s : "fá sekund", + m : "ein minutt", + mm : "%d minuttir", + h : "ein tími", + hh : "%d tímar", + d : "ein dagur", + dd : "%d dagar", + M : "ein mánaði", + MM : "%d mánaðir", + y : "eitt ár", + yy : "%d ár" + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/fr-ca.js b/resources/lib/moment/lang/fr-ca.js new file mode 100644 index 000000000000..3280d79455ec --- /dev/null +++ b/resources/lib/moment/lang/fr-ca.js @@ -0,0 +1,54 @@ +// moment.js language configuration +// language : canadian french (fr-ca) +// author : Jonathan Abourbih : https://github.com/jonbca + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('fr-ca', { + months : "janvier_février_mars_avril_mai_juin_juillet_août_septembre_octobre_novembre_décembre".split("_"), + monthsShort : "janv._févr._mars_avr._mai_juin_juil._août_sept._oct._nov._déc.".split("_"), + weekdays : "dimanche_lundi_mardi_mercredi_jeudi_vendredi_samedi".split("_"), + weekdaysShort : "dim._lun._mar._mer._jeu._ven._sam.".split("_"), + weekdaysMin : "Di_Lu_Ma_Me_Je_Ve_Sa".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "YYYY-MM-DD", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: "[Aujourd'hui à] LT", + nextDay: '[Demain à] LT', + nextWeek: 'dddd [à] LT', + lastDay: '[Hier à] LT', + lastWeek: 'dddd [dernier à] LT', + sameElse: 'L' + }, + relativeTime : { + future : "dans %s", + past : "il y a %s", + s : "quelques secondes", + m : "une minute", + mm : "%d minutes", + h : "une heure", + hh : "%d heures", + d : "un jour", + dd : "%d jours", + M : "un mois", + MM : "%d mois", + y : "un an", + yy : "%d ans" + }, + ordinal : function (number) { + return number + (number === 1 ? 'er' : ''); + } + }); +})); diff --git a/resources/lib/moment/lang/fr.js b/resources/lib/moment/lang/fr.js new file mode 100644 index 000000000000..6b3dc526edc9 --- /dev/null +++ b/resources/lib/moment/lang/fr.js @@ -0,0 +1,58 @@ +// moment.js language configuration +// language : french (fr) +// author : John Fischer : https://github.com/jfroffice + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('fr', { + months : "janvier_février_mars_avril_mai_juin_juillet_août_septembre_octobre_novembre_décembre".split("_"), + monthsShort : "janv._févr._mars_avr._mai_juin_juil._août_sept._oct._nov._déc.".split("_"), + weekdays : "dimanche_lundi_mardi_mercredi_jeudi_vendredi_samedi".split("_"), + weekdaysShort : "dim._lun._mar._mer._jeu._ven._sam.".split("_"), + weekdaysMin : "Di_Lu_Ma_Me_Je_Ve_Sa".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: "[Aujourd'hui à] LT", + nextDay: '[Demain à] LT', + nextWeek: 'dddd [à] LT', + lastDay: '[Hier à] LT', + lastWeek: 'dddd [dernier à] LT', + sameElse: 'L' + }, + relativeTime : { + future : "dans %s", + past : "il y a %s", + s : "quelques secondes", + m : "une minute", + mm : "%d minutes", + h : "une heure", + hh : "%d heures", + d : "un jour", + dd : "%d jours", + M : "un mois", + MM : "%d mois", + y : "un an", + yy : "%d ans" + }, + ordinal : function (number) { + return number + (number === 1 ? 'er' : ''); + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/gl.js b/resources/lib/moment/lang/gl.js new file mode 100644 index 000000000000..8b141278eb86 --- /dev/null +++ b/resources/lib/moment/lang/gl.js @@ -0,0 +1,71 @@ +// moment.js language configuration +// language : galician (gl) +// author : Juan G. Hurtado : https://github.com/juanghurtado + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('gl', { + months : "Xaneiro_Febreiro_Marzo_Abril_Maio_Xuño_Xullo_Agosto_Setembro_Outubro_Novembro_Decembro".split("_"), + monthsShort : "Xan._Feb._Mar._Abr._Mai._Xuñ._Xul._Ago._Set._Out._Nov._Dec.".split("_"), + weekdays : "Domingo_Luns_Martes_Mércores_Xoves_Venres_Sábado".split("_"), + weekdaysShort : "Dom._Lun._Mar._Mér._Xov._Ven._Sáb.".split("_"), + weekdaysMin : "Do_Lu_Ma_Mé_Xo_Ve_Sá".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay : function () { + return '[hoxe ' + ((this.hours() !== 1) ? 'ás' : 'á') + '] LT'; + }, + nextDay : function () { + return '[mañá ' + ((this.hours() !== 1) ? 'ás' : 'á') + '] LT'; + }, + nextWeek : function () { + return 'dddd [' + ((this.hours() !== 1) ? 'ás' : 'a') + '] LT'; + }, + lastDay : function () { + return '[onte ' + ((this.hours() !== 1) ? 'á' : 'a') + '] LT'; + }, + lastWeek : function () { + return '[o] dddd [pasado ' + ((this.hours() !== 1) ? 'ás' : 'a') + '] LT'; + }, + sameElse : 'L' + }, + relativeTime : { + future : function (str) { + if (str === "uns segundos") { + return "nuns segundos"; + } + return "en " + str; + }, + past : "hai %s", + s : "uns segundos", + m : "un minuto", + mm : "%d minutos", + h : "unha hora", + hh : "%d horas", + d : "un día", + dd : "%d días", + M : "un mes", + MM : "%d meses", + y : "un ano", + yy : "%d anos" + }, + ordinal : '%dº', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/he.js b/resources/lib/moment/lang/he.js new file mode 100644 index 000000000000..b85dbe858a18 --- /dev/null +++ b/resources/lib/moment/lang/he.js @@ -0,0 +1,77 @@ +// moment.js language configuration +// language : Hebrew (he) +// author : Tomer Cohen : https://github.com/tomer +// author : Moshe Simantov : https://github.com/DevelopmentIL +// author : Tal Ater : https://github.com/TalAter + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('he', { + months : "ינואר_פברואר_מרץ_אפריל_מאי_יוני_יולי_אוגוסט_ספטמבר_אוקטובר_נובמבר_דצמבר".split("_"), + monthsShort : "ינו׳_פבר׳_מרץ_אפר׳_מאי_יוני_יולי_אוג׳_ספט׳_אוק׳_נוב׳_דצמ׳".split("_"), + weekdays : "ראשון_שני_שלישי_רביעי_חמישי_שישי_שבת".split("_"), + weekdaysShort : "א׳_ב׳_ג׳_ד׳_ה׳_ו׳_ש׳".split("_"), + weekdaysMin : "א_ב_ג_ד_ה_ו_ש".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D [ב]MMMM YYYY", + LLL : "D [ב]MMMM YYYY LT", + LLLL : "dddd, D [ב]MMMM YYYY LT", + l : "D/M/YYYY", + ll : "D MMM YYYY", + lll : "D MMM YYYY LT", + llll : "ddd, D MMM YYYY LT" + }, + calendar : { + sameDay : '[היום ב־]LT', + nextDay : '[מחר ב־]LT', + nextWeek : 'dddd [בשעה] LT', + lastDay : '[אתמול ב־]LT', + lastWeek : '[ביום] dddd [האחרון בשעה] LT', + sameElse : 'L' + }, + relativeTime : { + future : "בעוד %s", + past : "לפני %s", + s : "מספר שניות", + m : "דקה", + mm : "%d דקות", + h : "שעה", + hh : function (number) { + if (number === 2) { + return "שעתיים"; + } + return number + " שעות"; + }, + d : "יום", + dd : function (number) { + if (number === 2) { + return "יומיים"; + } + return number + " ימים"; + }, + M : "חודש", + MM : function (number) { + if (number === 2) { + return "חודשיים"; + } + return number + " חודשים"; + }, + y : "שנה", + yy : function (number) { + if (number === 2) { + return "שנתיים"; + } + return number + " שנים"; + } + } + }); +})); diff --git a/resources/lib/moment/lang/hi.js b/resources/lib/moment/lang/hi.js new file mode 100644 index 000000000000..8e6e99c19ec7 --- /dev/null +++ b/resources/lib/moment/lang/hi.js @@ -0,0 +1,105 @@ +// moment.js language configuration +// language : hindi (hi) +// author : Mayank Singhal : https://github.com/mayanksinghal + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var symbolMap = { + '1': '१', + '2': '२', + '3': '३', + '4': '४', + '5': '५', + '6': '६', + '7': '७', + '8': '८', + '9': '९', + '0': '०' + }, + numberMap = { + '१': '1', + '२': '2', + '३': '3', + '४': '4', + '५': '5', + '६': '6', + '७': '7', + '८': '8', + '९': '9', + '०': '0' + }; + + return moment.lang('hi', { + months : 'जनवरी_फ़रवरी_मार्च_अप्रैल_मई_जून_जुलाई_अगस्त_सितम्बर_अक्टूबर_नवम्बर_दिसम्बर'.split("_"), + monthsShort : 'जन._फ़र._मार्च_अप्रै._मई_जून_जुल._अग._सित._अक्टू._नव._दिस.'.split("_"), + weekdays : 'रविवार_सोमवार_मंगलवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split("_"), + weekdaysShort : 'रवि_सोम_मंगल_बुध_गुरू_शुक्र_शनि'.split("_"), + weekdaysMin : 'र_सो_मं_बु_गु_शु_श'.split("_"), + longDateFormat : { + LT : "A h:mm बजे", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY, LT", + LLLL : "dddd, D MMMM YYYY, LT" + }, + calendar : { + sameDay : '[आज] LT', + nextDay : '[कल] LT', + nextWeek : 'dddd, LT', + lastDay : '[कल] LT', + lastWeek : '[पिछले] dddd, LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s में", + past : "%s पहले", + s : "कुछ ही क्षण", + m : "एक मिनट", + mm : "%d मिनट", + h : "एक घंटा", + hh : "%d घंटे", + d : "एक दिन", + dd : "%d दिन", + M : "एक महीने", + MM : "%d महीने", + y : "एक वर्ष", + yy : "%d वर्ष" + }, + preparse: function (string) { + return string.replace(/[१२३४५६७८९०]/g, function (match) { + return numberMap[match]; + }); + }, + postformat: function (string) { + return string.replace(/\d/g, function (match) { + return symbolMap[match]; + }); + }, + // Hindi notation for meridiems are quite fuzzy in practice. While there exists + // a rigid notion of a 'Pahar' it is not used as rigidly in modern Hindi. + meridiem : function (hour, minute, isLower) { + if (hour < 4) { + return "रात"; + } else if (hour < 10) { + return "सुबह"; + } else if (hour < 17) { + return "दोपहर"; + } else if (hour < 20) { + return "शाम"; + } else { + return "रात"; + } + }, + week : { + dow : 0, // Sunday is the first day of the week. + doy : 6 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/hr.js b/resources/lib/moment/lang/hr.js new file mode 100644 index 000000000000..2e3bf11283f1 --- /dev/null +++ b/resources/lib/moment/lang/hr.js @@ -0,0 +1,140 @@ +// moment.js language configuration +// language : hrvatski (hr) +// author : Bojan Marković : https://github.com/bmarkovic + +// based on (sl) translation by Robert Sedovšek + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + + function translate(number, withoutSuffix, key) { + var result = number + " "; + switch (key) { + case 'm': + return withoutSuffix ? 'jedna minuta' : 'jedne minute'; + case 'mm': + if (number === 1) { + result += 'minuta'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'minute'; + } else { + result += 'minuta'; + } + return result; + case 'h': + return withoutSuffix ? 'jedan sat' : 'jednog sata'; + case 'hh': + if (number === 1) { + result += 'sat'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'sata'; + } else { + result += 'sati'; + } + return result; + case 'dd': + if (number === 1) { + result += 'dan'; + } else { + result += 'dana'; + } + return result; + case 'MM': + if (number === 1) { + result += 'mjesec'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'mjeseca'; + } else { + result += 'mjeseci'; + } + return result; + case 'yy': + if (number === 1) { + result += 'godina'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'godine'; + } else { + result += 'godina'; + } + return result; + } + } + + return moment.lang('hr', { + months : "sječanj_veljača_ožujak_travanj_svibanj_lipanj_srpanj_kolovoz_rujan_listopad_studeni_prosinac".split("_"), + monthsShort : "sje._vel._ožu._tra._svi._lip._srp._kol._ruj._lis._stu._pro.".split("_"), + weekdays : "nedjelja_ponedjeljak_utorak_srijeda_četvrtak_petak_subota".split("_"), + weekdaysShort : "ned._pon._uto._sri._čet._pet._sub.".split("_"), + weekdaysMin : "ne_po_ut_sr_če_pe_su".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD. MM. YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd, D. MMMM YYYY LT" + }, + calendar : { + sameDay : '[danas u] LT', + nextDay : '[sutra u] LT', + + nextWeek : function () { + switch (this.day()) { + case 0: + return '[u] [nedjelju] [u] LT'; + case 3: + return '[u] [srijedu] [u] LT'; + case 6: + return '[u] [subotu] [u] LT'; + case 1: + case 2: + case 4: + case 5: + return '[u] dddd [u] LT'; + } + }, + lastDay : '[jučer u] LT', + lastWeek : function () { + switch (this.day()) { + case 0: + case 3: + return '[prošlu] dddd [u] LT'; + case 6: + return '[prošle] [subote] [u] LT'; + case 1: + case 2: + case 4: + case 5: + return '[prošli] dddd [u] LT'; + } + }, + sameElse : 'L' + }, + relativeTime : { + future : "za %s", + past : "prije %s", + s : "par sekundi", + m : translate, + mm : translate, + h : translate, + hh : translate, + d : "dan", + dd : translate, + M : "mjesec", + MM : translate, + y : "godinu", + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/hu.js b/resources/lib/moment/lang/hu.js new file mode 100644 index 000000000000..4d84ebdf6be1 --- /dev/null +++ b/resources/lib/moment/lang/hu.js @@ -0,0 +1,98 @@ +// moment.js language configuration +// language : hungarian (hu) +// author : Adam Brunner : https://github.com/adambrunner + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var weekEndings = 'vasárnap hétfőn kedden szerdán csütörtökön pénteken szombaton'.split(' '); + + function translate(number, withoutSuffix, key, isFuture) { + var num = number, + suffix; + + switch (key) { + case 's': + return (isFuture || withoutSuffix) ? 'néhány másodperc' : 'néhány másodperce'; + case 'm': + return 'egy' + (isFuture || withoutSuffix ? ' perc' : ' perce'); + case 'mm': + return num + (isFuture || withoutSuffix ? ' perc' : ' perce'); + case 'h': + return 'egy' + (isFuture || withoutSuffix ? ' óra' : ' órája'); + case 'hh': + return num + (isFuture || withoutSuffix ? ' óra' : ' órája'); + case 'd': + return 'egy' + (isFuture || withoutSuffix ? ' nap' : ' napja'); + case 'dd': + return num + (isFuture || withoutSuffix ? ' nap' : ' napja'); + case 'M': + return 'egy' + (isFuture || withoutSuffix ? ' hónap' : ' hónapja'); + case 'MM': + return num + (isFuture || withoutSuffix ? ' hónap' : ' hónapja'); + case 'y': + return 'egy' + (isFuture || withoutSuffix ? ' év' : ' éve'); + case 'yy': + return num + (isFuture || withoutSuffix ? ' év' : ' éve'); + } + + return ''; + } + + function week(isFuture) { + return (isFuture ? '' : '[múlt] ') + '[' + weekEndings[this.day()] + '] LT[-kor]'; + } + + return moment.lang('hu', { + months : "január_február_március_április_május_június_július_augusztus_szeptember_október_november_december".split("_"), + monthsShort : "jan_feb_márc_ápr_máj_jún_júl_aug_szept_okt_nov_dec".split("_"), + weekdays : "vasárnap_hétfő_kedd_szerda_csütörtök_péntek_szombat".split("_"), + weekdaysShort : "vas_hét_kedd_sze_csüt_pén_szo".split("_"), + weekdaysMin : "v_h_k_sze_cs_p_szo".split("_"), + longDateFormat : { + LT : "H:mm", + L : "YYYY.MM.DD.", + LL : "YYYY. MMMM D.", + LLL : "YYYY. MMMM D., LT", + LLLL : "YYYY. MMMM D., dddd LT" + }, + calendar : { + sameDay : '[ma] LT[-kor]', + nextDay : '[holnap] LT[-kor]', + nextWeek : function () { + return week.call(this, true); + }, + lastDay : '[tegnap] LT[-kor]', + lastWeek : function () { + return week.call(this, false); + }, + sameElse : 'L' + }, + relativeTime : { + future : "%s múlva", + past : "%s", + s : translate, + m : translate, + mm : translate, + h : translate, + hh : translate, + d : translate, + dd : translate, + M : translate, + MM : translate, + y : translate, + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/hy-am.js b/resources/lib/moment/lang/hy-am.js new file mode 100644 index 000000000000..951655bc2136 --- /dev/null +++ b/resources/lib/moment/lang/hy-am.js @@ -0,0 +1,113 @@ +// moment.js language configuration +// language : Armenian (hy-am) +// author : Armendarabyan : https://github.com/armendarabyan + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + + function monthsCaseReplace(m, format) { + var months = { + 'nominative': 'հունվար_փետրվար_մարտ_ապրիլ_մայիս_հունիս_հուլիս_օգոստոս_սեպտեմբեր_հոկտեմբեր_նոյեմբեր_դեկտեմբեր'.split('_'), + 'accusative': 'հունվարի_փետրվարի_մարտի_ապրիլի_մայիսի_հունիսի_հուլիսի_օգոստոսի_սեպտեմբերի_հոկտեմբերի_նոյեմբերի_դեկտեմբերի'.split('_') + }, + + nounCase = (/D[oD]?(\[[^\[\]]*\]|\s+)+MMMM?/).test(format) ? + 'accusative' : + 'nominative'; + + return months[nounCase][m.month()]; + } + + function monthsShortCaseReplace(m, format) { + var monthsShort = 'հնվ_փտր_մրտ_ապր_մյս_հնս_հլս_օգս_սպտ_հկտ_նմբ_դկտ'.split('_'); + + return monthsShort[m.month()]; + } + + function weekdaysCaseReplace(m, format) { + var weekdays = 'կիրակի_երկուշաբթի_երեքշաբթի_չորեքշաբթի_հինգշաբթի_ուրբաթ_շաբաթ'.split('_'); + + return weekdays[m.day()]; + } + + return moment.lang('hy-am', { + months : monthsCaseReplace, + monthsShort : monthsShortCaseReplace, + weekdays : weekdaysCaseReplace, + weekdaysShort : "կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ".split("_"), + weekdaysMin : "կրկ_երկ_երք_չրք_հնգ_ուրբ_շբթ".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD.MM.YYYY", + LL : "D MMMM YYYY թ.", + LLL : "D MMMM YYYY թ., LT", + LLLL : "dddd, D MMMM YYYY թ., LT" + }, + calendar : { + sameDay: '[այսօր] LT', + nextDay: '[վաղը] LT', + lastDay: '[երեկ] LT', + nextWeek: function () { + return 'dddd [օրը ժամը] LT'; + }, + lastWeek: function () { + return '[անցած] dddd [օրը ժամը] LT'; + }, + sameElse: 'L' + }, + relativeTime : { + future : "%s հետո", + past : "%s առաջ", + s : "մի քանի վայրկյան", + m : "րոպե", + mm : "%d րոպե", + h : "ժամ", + hh : "%d ժամ", + d : "օր", + dd : "%d օր", + M : "ամիս", + MM : "%d ամիս", + y : "տարի", + yy : "%d տարի" + }, + + meridiem : function (hour) { + if (hour < 4) { + return "գիշերվա"; + } else if (hour < 12) { + return "առավոտվա"; + } else if (hour < 17) { + return "ցերեկվա"; + } else { + return "երեկոյան"; + } + }, + + ordinal: function (number, period) { + switch (period) { + case 'DDD': + case 'w': + case 'W': + case 'DDDo': + if (number === 1) { + return number + '-ին'; + } + return number + '-րդ'; + default: + return number; + } + }, + + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/id.js b/resources/lib/moment/lang/id.js new file mode 100644 index 000000000000..f186280d850c --- /dev/null +++ b/resources/lib/moment/lang/id.js @@ -0,0 +1,67 @@ +// moment.js language configuration +// language : Bahasa Indonesia (id) +// author : Mohammad Satrio Utomo : https://github.com/tyok +// reference: http://id.wikisource.org/wiki/Pedoman_Umum_Ejaan_Bahasa_Indonesia_yang_Disempurnakan + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('id', { + months : "Januari_Februari_Maret_April_Mei_Juni_Juli_Agustus_September_Oktober_November_Desember".split("_"), + monthsShort : "Jan_Feb_Mar_Apr_Mei_Jun_Jul_Ags_Sep_Okt_Nov_Des".split("_"), + weekdays : "Minggu_Senin_Selasa_Rabu_Kamis_Jumat_Sabtu".split("_"), + weekdaysShort : "Min_Sen_Sel_Rab_Kam_Jum_Sab".split("_"), + weekdaysMin : "Mg_Sn_Sl_Rb_Km_Jm_Sb".split("_"), + longDateFormat : { + LT : "HH.mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY [pukul] LT", + LLLL : "dddd, D MMMM YYYY [pukul] LT" + }, + meridiem : function (hours, minutes, isLower) { + if (hours < 11) { + return 'pagi'; + } else if (hours < 15) { + return 'siang'; + } else if (hours < 19) { + return 'sore'; + } else { + return 'malam'; + } + }, + calendar : { + sameDay : '[Hari ini pukul] LT', + nextDay : '[Besok pukul] LT', + nextWeek : 'dddd [pukul] LT', + lastDay : '[Kemarin pukul] LT', + lastWeek : 'dddd [lalu pukul] LT', + sameElse : 'L' + }, + relativeTime : { + future : "dalam %s", + past : "%s yang lalu", + s : "beberapa detik", + m : "semenit", + mm : "%d menit", + h : "sejam", + hh : "%d jam", + d : "sehari", + dd : "%d hari", + M : "sebulan", + MM : "%d bulan", + y : "setahun", + yy : "%d tahun" + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/is.js b/resources/lib/moment/lang/is.js new file mode 100644 index 000000000000..5b6b2a821f71 --- /dev/null +++ b/resources/lib/moment/lang/is.js @@ -0,0 +1,124 @@ +// moment.js language configuration +// language : icelandic (is) +// author : Hinrik Örn Sigurðsson : https://github.com/hinrik + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function plural(n) { + if (n % 100 === 11) { + return true; + } else if (n % 10 === 1) { + return false; + } + return true; + } + + function translate(number, withoutSuffix, key, isFuture) { + var result = number + " "; + switch (key) { + case 's': + return withoutSuffix || isFuture ? 'nokkrar sekúndur' : 'nokkrum sekúndum'; + case 'm': + return withoutSuffix ? 'mínúta' : 'mínútu'; + case 'mm': + if (plural(number)) { + return result + (withoutSuffix || isFuture ? 'mínútur' : 'mínútum'); + } else if (withoutSuffix) { + return result + 'mínúta'; + } + return result + 'mínútu'; + case 'hh': + if (plural(number)) { + return result + (withoutSuffix || isFuture ? 'klukkustundir' : 'klukkustundum'); + } + return result + 'klukkustund'; + case 'd': + if (withoutSuffix) { + return 'dagur'; + } + return isFuture ? 'dag' : 'degi'; + case 'dd': + if (plural(number)) { + if (withoutSuffix) { + return result + 'dagar'; + } + return result + (isFuture ? 'daga' : 'dögum'); + } else if (withoutSuffix) { + return result + 'dagur'; + } + return result + (isFuture ? 'dag' : 'degi'); + case 'M': + if (withoutSuffix) { + return 'mánuður'; + } + return isFuture ? 'mánuð' : 'mánuði'; + case 'MM': + if (plural(number)) { + if (withoutSuffix) { + return result + 'mánuðir'; + } + return result + (isFuture ? 'mánuði' : 'mánuðum'); + } else if (withoutSuffix) { + return result + 'mánuður'; + } + return result + (isFuture ? 'mánuð' : 'mánuði'); + case 'y': + return withoutSuffix || isFuture ? 'ár' : 'ári'; + case 'yy': + if (plural(number)) { + return result + (withoutSuffix || isFuture ? 'ár' : 'árum'); + } + return result + (withoutSuffix || isFuture ? 'ár' : 'ári'); + } + } + + return moment.lang('is', { + months : "janúar_febrúar_mars_apríl_maí_júní_júlí_ágúst_september_október_nóvember_desember".split("_"), + monthsShort : "jan_feb_mar_apr_maí_jún_júl_ágú_sep_okt_nóv_des".split("_"), + weekdays : "sunnudagur_mánudagur_þriðjudagur_miðvikudagur_fimmtudagur_föstudagur_laugardagur".split("_"), + weekdaysShort : "sun_mán_þri_mið_fim_fös_lau".split("_"), + weekdaysMin : "Su_Má_Þr_Mi_Fi_Fö_La".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD/MM/YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY [kl.] LT", + LLLL : "dddd, D. MMMM YYYY [kl.] LT" + }, + calendar : { + sameDay : '[í dag kl.] LT', + nextDay : '[á morgun kl.] LT', + nextWeek : 'dddd [kl.] LT', + lastDay : '[í gær kl.] LT', + lastWeek : '[síðasta] dddd [kl.] LT', + sameElse : 'L' + }, + relativeTime : { + future : "eftir %s", + past : "fyrir %s síðan", + s : translate, + m : translate, + mm : translate, + h : "klukkustund", + hh : translate, + d : translate, + dd : translate, + M : translate, + MM : translate, + y : translate, + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/it.js b/resources/lib/moment/lang/it.js new file mode 100644 index 000000000000..84b7698be5b4 --- /dev/null +++ b/resources/lib/moment/lang/it.js @@ -0,0 +1,59 @@ +// moment.js language configuration +// language : italian (it) +// author : Lorenzo : https://github.com/aliem +// author: Mattia Larentis: https://github.com/nostalgiaz + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('it', { + months : "Gennaio_Febbraio_Marzo_Aprile_Maggio_Giugno_Luglio_Agosto_Settembre_Ottobre_Novembre_Dicembre".split("_"), + monthsShort : "Gen_Feb_Mar_Apr_Mag_Giu_Lug_Ago_Set_Ott_Nov_Dic".split("_"), + weekdays : "Domenica_Lunedì_Martedì_Mercoledì_Giovedì_Venerdì_Sabato".split("_"), + weekdaysShort : "Dom_Lun_Mar_Mer_Gio_Ven_Sab".split("_"), + weekdaysMin : "D_L_Ma_Me_G_V_S".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay: '[Oggi alle] LT', + nextDay: '[Domani alle] LT', + nextWeek: 'dddd [alle] LT', + lastDay: '[Ieri alle] LT', + lastWeek: '[lo scorso] dddd [alle] LT', + sameElse: 'L' + }, + relativeTime : { + future : function (s) { + return ((/^[0-9].+$/).test(s) ? "tra" : "in") + " " + s; + }, + past : "%s fa", + s : "alcuni secondi", + m : "un minuto", + mm : "%d minuti", + h : "un'ora", + hh : "%d ore", + d : "un giorno", + dd : "%d giorni", + M : "un mese", + MM : "%d mesi", + y : "un anno", + yy : "%d anni" + }, + ordinal: '%dº', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ja.js b/resources/lib/moment/lang/ja.js new file mode 100644 index 000000000000..9cd7e9e98be9 --- /dev/null +++ b/resources/lib/moment/lang/ja.js @@ -0,0 +1,58 @@ +// moment.js language configuration +// language : japanese (ja) +// author : LI Long : https://github.com/baryon + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('ja', { + months : "1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月".split("_"), + monthsShort : "1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月".split("_"), + weekdays : "日曜日_月曜日_火曜日_水曜日_木曜日_金曜日_土曜日".split("_"), + weekdaysShort : "日_月_火_水_木_金_土".split("_"), + weekdaysMin : "日_月_火_水_木_金_土".split("_"), + longDateFormat : { + LT : "Ah時m分", + L : "YYYY/MM/DD", + LL : "YYYY年M月D日", + LLL : "YYYY年M月D日LT", + LLLL : "YYYY年M月D日LT dddd" + }, + meridiem : function (hour, minute, isLower) { + if (hour < 12) { + return "午前"; + } else { + return "午後"; + } + }, + calendar : { + sameDay : '[今日] LT', + nextDay : '[明日] LT', + nextWeek : '[来週]dddd LT', + lastDay : '[昨日] LT', + lastWeek : '[前週]dddd LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s後", + past : "%s前", + s : "数秒", + m : "1分", + mm : "%d分", + h : "1時間", + hh : "%d時間", + d : "1日", + dd : "%d日", + M : "1ヶ月", + MM : "%dヶ月", + y : "1年", + yy : "%d年" + } + }); +})); diff --git a/resources/lib/moment/lang/ka.js b/resources/lib/moment/lang/ka.js new file mode 100644 index 000000000000..0cebdaae22c3 --- /dev/null +++ b/resources/lib/moment/lang/ka.js @@ -0,0 +1,108 @@ +// moment.js language configuration +// language : Georgian (ka) +// author : Irakli Janiashvili : https://github.com/irakli-janiashvili + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + + function monthsCaseReplace(m, format) { + var months = { + 'nominative': 'იანვარი_თებერვალი_მარტი_აპრილი_მაისი_ივნისი_ივლისი_აგვისტო_სექტემბერი_ოქტომბერი_ნოემბერი_დეკემბერი'.split('_'), + 'accusative': 'იანვარს_თებერვალს_მარტს_აპრილის_მაისს_ივნისს_ივლისს_აგვისტს_სექტემბერს_ოქტომბერს_ნოემბერს_დეკემბერს'.split('_') + }, + + nounCase = (/D[oD] *MMMM?/).test(format) ? + 'accusative' : + 'nominative'; + + return months[nounCase][m.month()]; + } + + function weekdaysCaseReplace(m, format) { + var weekdays = { + 'nominative': 'კვირა_ორშაბათი_სამშაბათი_ოთხშაბათი_ხუთშაბათი_პარასკევი_შაბათი'.split('_'), + 'accusative': 'კვირას_ორშაბათს_სამშაბათს_ოთხშაბათს_ხუთშაბათს_პარასკევს_შაბათს'.split('_') + }, + + nounCase = (/(წინა|შემდეგ)/).test(format) ? + 'accusative' : + 'nominative'; + + return weekdays[nounCase][m.day()]; + } + + return moment.lang('ka', { + months : monthsCaseReplace, + monthsShort : "იან_თებ_მარ_აპრ_მაი_ივნ_ივლ_აგვ_სექ_ოქტ_ნოე_დეკ".split("_"), + weekdays : weekdaysCaseReplace, + weekdaysShort : "კვი_ორშ_სამ_ოთხ_ხუთ_პარ_შაბ".split("_"), + weekdaysMin : "კვ_ორ_სა_ოთ_ხუ_პა_შა".split("_"), + longDateFormat : { + LT : "h:mm A", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay : '[დღეს] LT[-ზე]', + nextDay : '[ხვალ] LT[-ზე]', + lastDay : '[გუშინ] LT[-ზე]', + nextWeek : '[შემდეგ] dddd LT[-ზე]', + lastWeek : '[წინა] dddd LT-ზე', + sameElse : 'L' + }, + relativeTime : { + future : function (s) { + return (/(წამი|წუთი|საათი|წელი)/).test(s) ? + s.replace(/ი$/, "ში") : + s + "ში"; + }, + past : function (s) { + if ((/(წამი|წუთი|საათი|დღე|თვე)/).test(s)) { + return s.replace(/(ი|ე)$/, "ის წინ"); + } + if ((/წელი/).test(s)) { + return s.replace(/წელი$/, "წლის წინ"); + } + }, + s : "რამდენიმე წამი", + m : "წუთი", + mm : "%d წუთი", + h : "საათი", + hh : "%d საათი", + d : "დღე", + dd : "%d დღე", + M : "თვე", + MM : "%d თვე", + y : "წელი", + yy : "%d წელი" + }, + ordinal : function (number) { + if (number === 0) { + return number; + } + + if (number === 1) { + return number + "-ლი"; + } + + if ((number < 20) || (number <= 100 && (number % 20 === 0)) || (number % 100 === 0)) { + return "მე-" + number; + } + + return number + "-ე"; + }, + week : { + dow : 1, + doy : 7 + } + }); +})); diff --git a/resources/lib/moment/lang/ko.js b/resources/lib/moment/lang/ko.js new file mode 100644 index 000000000000..3b469df33bd1 --- /dev/null +++ b/resources/lib/moment/lang/ko.js @@ -0,0 +1,63 @@ +// moment.js language configuration +// language : korean (ko) +// +// authors +// +// - Kyungwook, Park : https://github.com/kyungw00k +// - Jeeeyul Lee <jeeeyul@gmail.com> +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('ko', { + months : "1월_2월_3월_4월_5월_6월_7월_8월_9월_10월_11월_12월".split("_"), + monthsShort : "1월_2월_3월_4월_5월_6월_7월_8월_9월_10월_11월_12월".split("_"), + weekdays : "일요일_월요일_화요일_수요일_목요일_금요일_토요일".split("_"), + weekdaysShort : "일_월_화_수_목_금_토".split("_"), + weekdaysMin : "일_월_화_수_목_금_토".split("_"), + longDateFormat : { + LT : "A h시 mm분", + L : "YYYY.MM.DD", + LL : "YYYY년 MMMM D일", + LLL : "YYYY년 MMMM D일 LT", + LLLL : "YYYY년 MMMM D일 dddd LT" + }, + meridiem : function (hour, minute, isUpper) { + return hour < 12 ? '오전' : '오후'; + }, + calendar : { + sameDay : '오늘 LT', + nextDay : '내일 LT', + nextWeek : 'dddd LT', + lastDay : '어제 LT', + lastWeek : '지난주 dddd LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s 후", + past : "%s 전", + s : "몇초", + ss : "%d초", + m : "일분", + mm : "%d분", + h : "한시간", + hh : "%d시간", + d : "하루", + dd : "%d일", + M : "한달", + MM : "%d달", + y : "일년", + yy : "%d년" + }, + ordinal : '%d일', + meridiemParse : /(오전|오후)/, + isPM : function (token) { + return token === "오후"; + } + }); +})); diff --git a/resources/lib/moment/lang/lb.js b/resources/lib/moment/lang/lb.js new file mode 100644 index 000000000000..946ba13c2fb7 --- /dev/null +++ b/resources/lib/moment/lang/lb.js @@ -0,0 +1,160 @@ +// moment.js language configuration +// language : Luxembourgish (lb) +// author : mweimerskirch : https://github.com/mweimerskirch + +// Note: Luxembourgish has a very particular phonological rule ("Eifeler Regel") that causes the +// deletion of the final "n" in certain contexts. That's what the "eifelerRegelAppliesToWeekday" +// and "eifelerRegelAppliesToNumber" methods are meant for + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function processRelativeTime(number, withoutSuffix, key, isFuture) { + var format = { + 'm': ['eng Minutt', 'enger Minutt'], + 'h': ['eng Stonn', 'enger Stonn'], + 'd': ['een Dag', 'engem Dag'], + 'dd': [number + ' Deeg', number + ' Deeg'], + 'M': ['ee Mount', 'engem Mount'], + 'MM': [number + ' Méint', number + ' Méint'], + 'y': ['ee Joer', 'engem Joer'], + 'yy': [number + ' Joer', number + ' Joer'] + }; + return withoutSuffix ? format[key][0] : format[key][1]; + } + + function processFutureTime(string) { + var number = string.substr(0, string.indexOf(' ')); + if (eifelerRegelAppliesToNumber(number)) { + return "a " + string; + } + return "an " + string; + } + + function processPastTime(string) { + var number = string.substr(0, string.indexOf(' ')); + if (eifelerRegelAppliesToNumber(number)) { + return "viru " + string; + } + return "virun " + string; + } + + function processLastWeek(string1) { + var weekday = this.format('d'); + if (eifelerRegelAppliesToWeekday(weekday)) { + return '[Leschte] dddd [um] LT'; + } + return '[Leschten] dddd [um] LT'; + } + + /** + * Returns true if the word before the given week day loses the "-n" ending. + * e.g. "Leschten Dënschdeg" but "Leschte Méindeg" + * + * @param weekday {integer} + * @returns {boolean} + */ + function eifelerRegelAppliesToWeekday(weekday) { + weekday = parseInt(weekday, 10); + switch (weekday) { + case 0: // Sonndeg + case 1: // Méindeg + case 3: // Mëttwoch + case 5: // Freideg + case 6: // Samschdeg + return true; + default: // 2 Dënschdeg, 4 Donneschdeg + return false; + } + } + + /** + * Returns true if the word before the given number loses the "-n" ending. + * e.g. "an 10 Deeg" but "a 5 Deeg" + * + * @param number {integer} + * @returns {boolean} + */ + function eifelerRegelAppliesToNumber(number) { + number = parseInt(number, 10); + if (isNaN(number)) { + return false; + } + if (number < 0) { + // Negative Number --> always true + return true; + } else if (number < 10) { + // Only 1 digit + if (4 <= number && number <= 7) { + return true; + } + return false; + } else if (number < 100) { + // 2 digits + var lastDigit = number % 10, firstDigit = number / 10; + if (lastDigit === 0) { + return eifelerRegelAppliesToNumber(firstDigit); + } + return eifelerRegelAppliesToNumber(lastDigit); + } else if (number < 10000) { + // 3 or 4 digits --> recursively check first digit + while (number >= 10) { + number = number / 10; + } + return eifelerRegelAppliesToNumber(number); + } else { + // Anything larger than 4 digits: recursively check first n-3 digits + number = number / 1000; + return eifelerRegelAppliesToNumber(number); + } + } + + return moment.lang('lb', { + months: "Januar_Februar_Mäerz_Abrëll_Mee_Juni_Juli_August_September_Oktober_November_Dezember".split("_"), + monthsShort: "Jan._Febr._Mrz._Abr._Mee_Jun._Jul._Aug._Sept._Okt._Nov._Dez.".split("_"), + weekdays: "Sonndeg_Méindeg_Dënschdeg_Mëttwoch_Donneschdeg_Freideg_Samschdeg".split("_"), + weekdaysShort: "So._Mé._Dë._Më._Do._Fr._Sa.".split("_"), + weekdaysMin: "So_Mé_Dë_Më_Do_Fr_Sa".split("_"), + longDateFormat: { + LT: "H:mm [Auer]", + L: "DD.MM.YYYY", + LL: "D. MMMM YYYY", + LLL: "D. MMMM YYYY LT", + LLLL: "dddd, D. MMMM YYYY LT" + }, + calendar: { + sameDay: "[Haut um] LT", + sameElse: "L", + nextDay: '[Muer um] LT', + nextWeek: 'dddd [um] LT', + lastDay: '[Gëschter um] LT', + lastWeek: processLastWeek + }, + relativeTime: { + future: processFutureTime, + past: processPastTime, + s: "e puer Sekonnen", + m: processRelativeTime, + mm: "%d Minutten", + h: processRelativeTime, + hh: "%d Stonnen", + d: processRelativeTime, + dd: processRelativeTime, + M: processRelativeTime, + MM: processRelativeTime, + y: processRelativeTime, + yy: processRelativeTime + }, + ordinal: '%d.', + week: { + dow: 1, // Monday is the first day of the week. + doy: 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/lt.js b/resources/lib/moment/lang/lt.js new file mode 100644 index 000000000000..1cf6457d20b1 --- /dev/null +++ b/resources/lib/moment/lang/lt.js @@ -0,0 +1,118 @@ +// moment.js language configuration +// language : Lithuanian (lt) +// author : Mindaugas Mozūras : https://github.com/mmozuras + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var units = { + "m" : "minutė_minutės_minutę", + "mm": "minutės_minučių_minutes", + "h" : "valanda_valandos_valandą", + "hh": "valandos_valandų_valandas", + "d" : "diena_dienos_dieną", + "dd": "dienos_dienų_dienas", + "M" : "mėnuo_mėnesio_mėnesį", + "MM": "mėnesiai_mėnesių_mėnesius", + "y" : "metai_metų_metus", + "yy": "metai_metų_metus" + }, + weekDays = "pirmadienis_antradienis_trečiadienis_ketvirtadienis_penktadienis_šeštadienis_sekmadienis".split("_"); + + function translateSeconds(number, withoutSuffix, key, isFuture) { + if (withoutSuffix) { + return "kelios sekundės"; + } else { + return isFuture ? "kelių sekundžių" : "kelias sekundes"; + } + } + + function translateSingular(number, withoutSuffix, key, isFuture) { + return withoutSuffix ? forms(key)[0] : (isFuture ? forms(key)[1] : forms(key)[2]); + } + + function special(number) { + return number % 10 === 0 || (number > 10 && number < 20); + } + + function forms(key) { + return units[key].split("_"); + } + + function translate(number, withoutSuffix, key, isFuture) { + var result = number + " "; + if (number === 1) { + return result + translateSingular(number, withoutSuffix, key[0], isFuture); + } else if (withoutSuffix) { + return result + (special(number) ? forms(key)[1] : forms(key)[0]); + } else { + if (isFuture) { + return result + forms(key)[1]; + } else { + return result + (special(number) ? forms(key)[1] : forms(key)[2]); + } + } + } + + function relativeWeekDay(moment, format) { + var nominative = format.indexOf('dddd LT') === -1, + weekDay = weekDays[moment.weekday()]; + + return nominative ? weekDay : weekDay.substring(0, weekDay.length - 2) + "į"; + } + + return moment.lang("lt", { + months : "sausio_vasario_kovo_balandžio_gegužės_biržėlio_liepos_rugpjūčio_rugsėjo_spalio_lapkričio_gruodžio".split("_"), + monthsShort : "sau_vas_kov_bal_geg_bir_lie_rgp_rgs_spa_lap_grd".split("_"), + weekdays : relativeWeekDay, + weekdaysShort : "Sek_Pir_Ant_Tre_Ket_Pen_Šeš".split("_"), + weekdaysMin : "S_P_A_T_K_Pn_Š".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "YYYY-MM-DD", + LL : "YYYY [m.] MMMM D [d.]", + LLL : "YYYY [m.] MMMM D [d.], LT [val.]", + LLLL : "YYYY [m.] MMMM D [d.], dddd, LT [val.]", + l : "YYYY-MM-DD", + ll : "YYYY [m.] MMMM D [d.]", + lll : "YYYY [m.] MMMM D [d.], LT [val.]", + llll : "YYYY [m.] MMMM D [d.], ddd, LT [val.]" + }, + calendar : { + sameDay : "[Šiandien] LT", + nextDay : "[Rytoj] LT", + nextWeek : "dddd LT", + lastDay : "[Vakar] LT", + lastWeek : "[Praėjusį] dddd LT", + sameElse : "L" + }, + relativeTime : { + future : "po %s", + past : "prieš %s", + s : translateSeconds, + m : translateSingular, + mm : translate, + h : translateSingular, + hh : translate, + d : translateSingular, + dd : translate, + M : translateSingular, + MM : translate, + y : translateSingular, + yy : translate + }, + ordinal : function (number) { + return number + '-oji'; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/lv.js b/resources/lib/moment/lang/lv.js new file mode 100644 index 000000000000..ffe25cfe4e5e --- /dev/null +++ b/resources/lib/moment/lang/lv.js @@ -0,0 +1,77 @@ +// moment.js language configuration +// language : latvian (lv) +// author : Kristaps Karlsons : https://github.com/skakri + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var units = { + 'mm': 'minūti_minūtes_minūte_minūtes', + 'hh': 'stundu_stundas_stunda_stundas', + 'dd': 'dienu_dienas_diena_dienas', + 'MM': 'mēnesi_mēnešus_mēnesis_mēneši', + 'yy': 'gadu_gadus_gads_gadi' + }; + + function format(word, number, withoutSuffix) { + var forms = word.split('_'); + if (withoutSuffix) { + return number % 10 === 1 && number !== 11 ? forms[2] : forms[3]; + } else { + return number % 10 === 1 && number !== 11 ? forms[0] : forms[1]; + } + } + + function relativeTimeWithPlural(number, withoutSuffix, key) { + return number + ' ' + format(units[key], number, withoutSuffix); + } + + return moment.lang('lv', { + months : "janvāris_februāris_marts_aprīlis_maijs_jūnijs_jūlijs_augusts_septembris_oktobris_novembris_decembris".split("_"), + monthsShort : "jan_feb_mar_apr_mai_jūn_jūl_aug_sep_okt_nov_dec".split("_"), + weekdays : "svētdiena_pirmdiena_otrdiena_trešdiena_ceturtdiena_piektdiena_sestdiena".split("_"), + weekdaysShort : "Sv_P_O_T_C_Pk_S".split("_"), + weekdaysMin : "Sv_P_O_T_C_Pk_S".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD.MM.YYYY", + LL : "YYYY. [gada] D. MMMM", + LLL : "YYYY. [gada] D. MMMM, LT", + LLLL : "YYYY. [gada] D. MMMM, dddd, LT" + }, + calendar : { + sameDay : '[Šodien pulksten] LT', + nextDay : '[Rīt pulksten] LT', + nextWeek : 'dddd [pulksten] LT', + lastDay : '[Vakar pulksten] LT', + lastWeek : '[Pagājušā] dddd [pulksten] LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s vēlāk", + past : "%s agrāk", + s : "dažas sekundes", + m : "minūti", + mm : relativeTimeWithPlural, + h : "stundu", + hh : relativeTimeWithPlural, + d : "dienu", + dd : relativeTimeWithPlural, + M : "mēnesi", + MM : relativeTimeWithPlural, + y : "gadu", + yy : relativeTimeWithPlural + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/mk.js b/resources/lib/moment/lang/mk.js new file mode 100644 index 000000000000..5f272fa2db5f --- /dev/null +++ b/resources/lib/moment/lang/mk.js @@ -0,0 +1,86 @@ +// moment.js language configuration +// language : macedonian (mk) +// author : Borislav Mickov : https://github.com/B0k0 + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('mk', { + months : "јануари_февруари_март_април_мај_јуни_јули_август_септември_октомври_ноември_декември".split("_"), + monthsShort : "јан_фев_мар_апр_мај_јун_јул_авг_сеп_окт_ное_дек".split("_"), + weekdays : "недела_понеделник_вторник_среда_четврток_петок_сабота".split("_"), + weekdaysShort : "нед_пон_вто_сре_чет_пет_саб".split("_"), + weekdaysMin : "нe_пo_вт_ср_че_пе_сa".split("_"), + longDateFormat : { + LT : "H:mm", + L : "D.MM.YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay : '[Денес во] LT', + nextDay : '[Утре во] LT', + nextWeek : 'dddd [во] LT', + lastDay : '[Вчера во] LT', + lastWeek : function () { + switch (this.day()) { + case 0: + case 3: + case 6: + return '[Во изминатата] dddd [во] LT'; + case 1: + case 2: + case 4: + case 5: + return '[Во изминатиот] dddd [во] LT'; + } + }, + sameElse : 'L' + }, + relativeTime : { + future : "после %s", + past : "пред %s", + s : "неколку секунди", + m : "минута", + mm : "%d минути", + h : "час", + hh : "%d часа", + d : "ден", + dd : "%d дена", + M : "месец", + MM : "%d месеци", + y : "година", + yy : "%d години" + }, + ordinal : function (number) { + var lastDigit = number % 10, + last2Digits = number % 100; + if (number === 0) { + return number + '-ев'; + } else if (last2Digits === 0) { + return number + '-ен'; + } else if (last2Digits > 10 && last2Digits < 20) { + return number + '-ти'; + } else if (lastDigit === 1) { + return number + '-ви'; + } else if (lastDigit === 2) { + return number + '-ри'; + } else if (lastDigit === 7 || lastDigit === 8) { + return number + '-ми'; + } else { + return number + '-ти'; + } + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ml.js b/resources/lib/moment/lang/ml.js new file mode 100644 index 000000000000..cc7db9a30936 --- /dev/null +++ b/resources/lib/moment/lang/ml.js @@ -0,0 +1,64 @@ +// moment.js language configuration +// language : malayalam (ml) +// author : Floyd Pink : https://github.com/floydpink + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('ml', { + months : 'ജനുവരി_ഫെബ്രുവരി_മാർച്ച്_ഏപ്രിൽ_മേയ്_ജൂൺ_ജൂലൈ_ഓഗസ്റ്റ്_സെപ്റ്റംബർ_ഒക്ടോബർ_നവംബർ_ഡിസംബർ'.split("_"), + monthsShort : 'ജനു._ഫെബ്രു._മാർ._ഏപ്രി._മേയ്_ജൂൺ_ജൂലൈ._ഓഗ._സെപ്റ്റ._ഒക്ടോ._നവം._ഡിസം.'.split("_"), + weekdays : 'ഞായറാഴ്ച_തിങ്കളാഴ്ച_ചൊവ്വാഴ്ച_ബുധനാഴ്ച_വ്യാഴാഴ്ച_വെള്ളിയാഴ്ച_ശനിയാഴ്ച'.split("_"), + weekdaysShort : 'ഞായർ_തിങ്കൾ_ചൊവ്വ_ബുധൻ_വ്യാഴം_വെള്ളി_ശനി'.split("_"), + weekdaysMin : 'ഞാ_തി_ചൊ_ബു_വ്യാ_വെ_ശ'.split("_"), + longDateFormat : { + LT : "A h:mm -നു", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY, LT", + LLLL : "dddd, D MMMM YYYY, LT" + }, + calendar : { + sameDay : '[ഇന്ന്] LT', + nextDay : '[നാളെ] LT', + nextWeek : 'dddd, LT', + lastDay : '[ഇന്നലെ] LT', + lastWeek : '[കഴിഞ്ഞ] dddd, LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s കഴിഞ്ഞ്", + past : "%s മുൻപ്", + s : "അൽപ നിമിഷങ്ങൾ", + m : "ഒരു മിനിറ്റ്", + mm : "%d മിനിറ്റ്", + h : "ഒരു മണിക്കൂർ", + hh : "%d മണിക്കൂർ", + d : "ഒരു ദിവസം", + dd : "%d ദിവസം", + M : "ഒരു മാസം", + MM : "%d മാസം", + y : "ഒരു വർഷം", + yy : "%d വർഷം" + }, + meridiem : function (hour, minute, isLower) { + if (hour < 4) { + return "രാത്രി"; + } else if (hour < 12) { + return "രാവിലെ"; + } else if (hour < 17) { + return "ഉച്ച കഴിഞ്ഞ്"; + } else if (hour < 20) { + return "വൈകുന്നേരം"; + } else { + return "രാത്രി"; + } + } + }); +})); diff --git a/resources/lib/moment/lang/mr.js b/resources/lib/moment/lang/mr.js new file mode 100644 index 000000000000..0d1adfd64f43 --- /dev/null +++ b/resources/lib/moment/lang/mr.js @@ -0,0 +1,104 @@ +// moment.js language configuration +// language : Marathi (mr) +// author : Harshad Kale : https://github.com/kalehv + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var symbolMap = { + '1': '१', + '2': '२', + '3': '३', + '4': '४', + '5': '५', + '6': '६', + '7': '७', + '8': '८', + '9': '९', + '0': '०' + }, + numberMap = { + '१': '1', + '२': '2', + '३': '3', + '४': '4', + '५': '5', + '६': '6', + '७': '7', + '८': '8', + '९': '9', + '०': '0' + }; + + return moment.lang('mr', { + months : 'जानेवारी_फेब्रुवारी_मार्च_एप्रिल_मे_जून_जुलै_ऑगस्ट_सप्टेंबर_ऑक्टोबर_नोव्हेंबर_डिसेंबर'.split("_"), + monthsShort: 'जाने._फेब्रु._मार्च._एप्रि._मे._जून._जुलै._ऑग._सप्टें._ऑक्टो._नोव्हें._डिसें.'.split("_"), + weekdays : 'रविवार_सोमवार_मंगळवार_बुधवार_गुरूवार_शुक्रवार_शनिवार'.split("_"), + weekdaysShort : 'रवि_सोम_मंगळ_बुध_गुरू_शुक्र_शनि'.split("_"), + weekdaysMin : 'र_सो_मं_बु_गु_शु_श'.split("_"), + longDateFormat : { + LT : "A h:mm वाजता", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY, LT", + LLLL : "dddd, D MMMM YYYY, LT" + }, + calendar : { + sameDay : '[आज] LT', + nextDay : '[उद्या] LT', + nextWeek : 'dddd, LT', + lastDay : '[काल] LT', + lastWeek: '[मागील] dddd, LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s नंतर", + past : "%s पूर्वी", + s : "सेकंद", + m: "एक मिनिट", + mm: "%d मिनिटे", + h : "एक तास", + hh : "%d तास", + d : "एक दिवस", + dd : "%d दिवस", + M : "एक महिना", + MM : "%d महिने", + y : "एक वर्ष", + yy : "%d वर्षे" + }, + preparse: function (string) { + return string.replace(/[१२३४५६७८९०]/g, function (match) { + return numberMap[match]; + }); + }, + postformat: function (string) { + return string.replace(/\d/g, function (match) { + return symbolMap[match]; + }); + }, + meridiem: function (hour, minute, isLower) + { + if (hour < 4) { + return "रात्री"; + } else if (hour < 10) { + return "सकाळी"; + } else if (hour < 17) { + return "दुपारी"; + } else if (hour < 20) { + return "सायंकाळी"; + } else { + return "रात्री"; + } + }, + week : { + dow : 0, // Sunday is the first day of the week. + doy : 6 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ms-my.js b/resources/lib/moment/lang/ms-my.js new file mode 100644 index 000000000000..501d5aaa0285 --- /dev/null +++ b/resources/lib/moment/lang/ms-my.js @@ -0,0 +1,66 @@ +// moment.js language configuration +// language : Bahasa Malaysia (ms-MY) +// author : Weldan Jamili : https://github.com/weldan + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('ms-my', { + months : "Januari_Februari_Mac_April_Mei_Jun_Julai_Ogos_September_Oktober_November_Disember".split("_"), + monthsShort : "Jan_Feb_Mac_Apr_Mei_Jun_Jul_Ogs_Sep_Okt_Nov_Dis".split("_"), + weekdays : "Ahad_Isnin_Selasa_Rabu_Khamis_Jumaat_Sabtu".split("_"), + weekdaysShort : "Ahd_Isn_Sel_Rab_Kha_Jum_Sab".split("_"), + weekdaysMin : "Ah_Is_Sl_Rb_Km_Jm_Sb".split("_"), + longDateFormat : { + LT : "HH.mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY [pukul] LT", + LLLL : "dddd, D MMMM YYYY [pukul] LT" + }, + meridiem : function (hours, minutes, isLower) { + if (hours < 11) { + return 'pagi'; + } else if (hours < 15) { + return 'tengahari'; + } else if (hours < 19) { + return 'petang'; + } else { + return 'malam'; + } + }, + calendar : { + sameDay : '[Hari ini pukul] LT', + nextDay : '[Esok pukul] LT', + nextWeek : 'dddd [pukul] LT', + lastDay : '[Kelmarin pukul] LT', + lastWeek : 'dddd [lepas pukul] LT', + sameElse : 'L' + }, + relativeTime : { + future : "dalam %s", + past : "%s yang lepas", + s : "beberapa saat", + m : "seminit", + mm : "%d minit", + h : "sejam", + hh : "%d jam", + d : "sehari", + dd : "%d hari", + M : "sebulan", + MM : "%d bulan", + y : "setahun", + yy : "%d tahun" + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/nb.js b/resources/lib/moment/lang/nb.js new file mode 100644 index 000000000000..2f652efd1f47 --- /dev/null +++ b/resources/lib/moment/lang/nb.js @@ -0,0 +1,57 @@ +// moment.js language configuration +// language : norwegian bokmål (nb) +// authors : Espen Hovlandsdal : https://github.com/rexxars +// Sigurd Gartmann : https://github.com/sigurdga + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('nb', { + months : "januar_februar_mars_april_mai_juni_juli_august_september_oktober_november_desember".split("_"), + monthsShort : "jan._feb._mars_april_mai_juni_juli_aug._sep._okt._nov._des.".split("_"), + weekdays : "søndag_mandag_tirsdag_onsdag_torsdag_fredag_lørdag".split("_"), + weekdaysShort : "sø._ma._ti._on._to._fr._lø.".split("_"), + weekdaysMin : "sø_ma_ti_on_to_fr_lø".split("_"), + longDateFormat : { + LT : "H.mm", + L : "DD.MM.YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY [kl.] LT", + LLLL : "dddd D. MMMM YYYY [kl.] LT" + }, + calendar : { + sameDay: '[i dag kl.] LT', + nextDay: '[i morgen kl.] LT', + nextWeek: 'dddd [kl.] LT', + lastDay: '[i går kl.] LT', + lastWeek: '[forrige] dddd [kl.] LT', + sameElse: 'L' + }, + relativeTime : { + future : "om %s", + past : "for %s siden", + s : "noen sekunder", + m : "ett minutt", + mm : "%d minutter", + h : "en time", + hh : "%d timer", + d : "en dag", + dd : "%d dager", + M : "en måned", + MM : "%d måneder", + y : "ett år", + yy : "%d år" + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ne.js b/resources/lib/moment/lang/ne.js new file mode 100644 index 000000000000..1d57b8cbfe56 --- /dev/null +++ b/resources/lib/moment/lang/ne.js @@ -0,0 +1,105 @@ +// moment.js language configuration +// language : nepali/nepalese +// author : suvash : https://github.com/suvash + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var symbolMap = { + '1': '१', + '2': '२', + '3': '३', + '4': '४', + '5': '५', + '6': '६', + '7': '७', + '8': '८', + '9': '९', + '0': '०' + }, + numberMap = { + '१': '1', + '२': '2', + '३': '3', + '४': '4', + '५': '5', + '६': '6', + '७': '7', + '८': '8', + '९': '9', + '०': '0' + }; + + return moment.lang('ne', { + months : 'जनवरी_फेब्रुवरी_मार्च_अप्रिल_मई_जुन_जुलाई_अगष्ट_सेप्टेम्बर_अक्टोबर_नोभेम्बर_डिसेम्बर'.split("_"), + monthsShort : 'जन._फेब्रु._मार्च_अप्रि._मई_जुन_जुलाई._अग._सेप्ट._अक्टो._नोभे._डिसे.'.split("_"), + weekdays : 'आइतबार_सोमबार_मङ्गलबार_बुधबार_बिहिबार_शुक्रबार_शनिबार'.split("_"), + weekdaysShort : 'आइत._सोम._मङ्गल._बुध._बिहि._शुक्र._शनि.'.split("_"), + weekdaysMin : 'आइ._सो._मङ्_बु._बि._शु._श.'.split("_"), + longDateFormat : { + LT : "Aको h:mm बजे", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY, LT", + LLLL : "dddd, D MMMM YYYY, LT" + }, + preparse: function (string) { + return string.replace(/[१२३४५६७८९०]/g, function (match) { + return numberMap[match]; + }); + }, + postformat: function (string) { + return string.replace(/\d/g, function (match) { + return symbolMap[match]; + }); + }, + meridiem : function (hour, minute, isLower) { + if (hour < 3) { + return "राती"; + } else if (hour < 10) { + return "बिहान"; + } else if (hour < 15) { + return "दिउँसो"; + } else if (hour < 18) { + return "बेलुका"; + } else if (hour < 20) { + return "साँझ"; + } else { + return "राती"; + } + }, + calendar : { + sameDay : '[आज] LT', + nextDay : '[भोली] LT', + nextWeek : '[आउँदो] dddd[,] LT', + lastDay : '[हिजो] LT', + lastWeek : '[गएको] dddd[,] LT', + sameElse : 'L' + }, + relativeTime : { + future : "%sमा", + past : "%s अगाडी", + s : "केही समय", + m : "एक मिनेट", + mm : "%d मिनेट", + h : "एक घण्टा", + hh : "%d घण्टा", + d : "एक दिन", + dd : "%d दिन", + M : "एक महिना", + MM : "%d महिना", + y : "एक बर्ष", + yy : "%d बर्ष" + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/nl.js b/resources/lib/moment/lang/nl.js new file mode 100644 index 000000000000..ffd454faf91f --- /dev/null +++ b/resources/lib/moment/lang/nl.js @@ -0,0 +1,67 @@ +// moment.js language configuration +// language : dutch (nl) +// author : Joris Röling : https://github.com/jjupiter + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var monthsShortWithDots = "jan._feb._mrt._apr._mei_jun._jul._aug._sep._okt._nov._dec.".split("_"), + monthsShortWithoutDots = "jan_feb_mrt_apr_mei_jun_jul_aug_sep_okt_nov_dec".split("_"); + + return moment.lang('nl', { + months : "januari_februari_maart_april_mei_juni_juli_augustus_september_oktober_november_december".split("_"), + monthsShort : function (m, format) { + if (/-MMM-/.test(format)) { + return monthsShortWithoutDots[m.month()]; + } else { + return monthsShortWithDots[m.month()]; + } + }, + weekdays : "zondag_maandag_dinsdag_woensdag_donderdag_vrijdag_zaterdag".split("_"), + weekdaysShort : "zo._ma._di._wo._do._vr._za.".split("_"), + weekdaysMin : "Zo_Ma_Di_Wo_Do_Vr_Za".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD-MM-YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: '[vandaag om] LT', + nextDay: '[morgen om] LT', + nextWeek: 'dddd [om] LT', + lastDay: '[gisteren om] LT', + lastWeek: '[afgelopen] dddd [om] LT', + sameElse: 'L' + }, + relativeTime : { + future : "over %s", + past : "%s geleden", + s : "een paar seconden", + m : "één minuut", + mm : "%d minuten", + h : "één uur", + hh : "%d uur", + d : "één dag", + dd : "%d dagen", + M : "één maand", + MM : "%d maanden", + y : "één jaar", + yy : "%d jaar" + }, + ordinal : function (number) { + return number + ((number === 1 || number === 8 || number >= 20) ? 'ste' : 'de'); + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/nn.js b/resources/lib/moment/lang/nn.js new file mode 100644 index 000000000000..f59c4153b43c --- /dev/null +++ b/resources/lib/moment/lang/nn.js @@ -0,0 +1,56 @@ +// moment.js language configuration +// language : norwegian nynorsk (nn) +// author : https://github.com/mechuwind + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('nn', { + months : "januar_februar_mars_april_mai_juni_juli_august_september_oktober_november_desember".split("_"), + monthsShort : "jan_feb_mar_apr_mai_jun_jul_aug_sep_okt_nov_des".split("_"), + weekdays : "sundag_måndag_tysdag_onsdag_torsdag_fredag_laurdag".split("_"), + weekdaysShort : "sun_mån_tys_ons_tor_fre_lau".split("_"), + weekdaysMin : "su_må_ty_on_to_fr_lø".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD.MM.YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: '[I dag klokka] LT', + nextDay: '[I morgon klokka] LT', + nextWeek: 'dddd [klokka] LT', + lastDay: '[I går klokka] LT', + lastWeek: '[Føregående] dddd [klokka] LT', + sameElse: 'L' + }, + relativeTime : { + future : "om %s", + past : "for %s siden", + s : "noen sekund", + m : "ett minutt", + mm : "%d minutt", + h : "en time", + hh : "%d timar", + d : "en dag", + dd : "%d dagar", + M : "en månad", + MM : "%d månader", + y : "ett år", + yy : "%d år" + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/pl.js b/resources/lib/moment/lang/pl.js new file mode 100644 index 000000000000..97770d2ad273 --- /dev/null +++ b/resources/lib/moment/lang/pl.js @@ -0,0 +1,98 @@ +// moment.js language configuration +// language : polish (pl) +// author : Rafal Hirsz : https://github.com/evoL + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var monthsNominative = "styczeń_luty_marzec_kwiecień_maj_czerwiec_lipiec_sierpień_wrzesień_październik_listopad_grudzień".split("_"), + monthsSubjective = "stycznia_lutego_marca_kwietnia_maja_czerwca_lipca_sierpnia_września_października_listopada_grudnia".split("_"); + + function plural(n) { + return (n % 10 < 5) && (n % 10 > 1) && ((~~(n / 10) % 10) !== 1); + } + + function translate(number, withoutSuffix, key) { + var result = number + " "; + switch (key) { + case 'm': + return withoutSuffix ? 'minuta' : 'minutę'; + case 'mm': + return result + (plural(number) ? 'minuty' : 'minut'); + case 'h': + return withoutSuffix ? 'godzina' : 'godzinę'; + case 'hh': + return result + (plural(number) ? 'godziny' : 'godzin'); + case 'MM': + return result + (plural(number) ? 'miesiące' : 'miesięcy'); + case 'yy': + return result + (plural(number) ? 'lata' : 'lat'); + } + } + + return moment.lang('pl', { + months : function (momentToFormat, format) { + if (/D MMMM/.test(format)) { + return monthsSubjective[momentToFormat.month()]; + } else { + return monthsNominative[momentToFormat.month()]; + } + }, + monthsShort : "sty_lut_mar_kwi_maj_cze_lip_sie_wrz_paź_lis_gru".split("_"), + weekdays : "niedziela_poniedziałek_wtorek_środa_czwartek_piątek_sobota".split("_"), + weekdaysShort : "nie_pon_wt_śr_czw_pt_sb".split("_"), + weekdaysMin : "N_Pn_Wt_Śr_Cz_Pt_So".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD.MM.YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay: '[Dziś o] LT', + nextDay: '[Jutro o] LT', + nextWeek: '[W] dddd [o] LT', + lastDay: '[Wczoraj o] LT', + lastWeek: function () { + switch (this.day()) { + case 0: + return '[W zeszłą niedzielę o] LT'; + case 3: + return '[W zeszłą środę o] LT'; + case 6: + return '[W zeszłą sobotę o] LT'; + default: + return '[W zeszły] dddd [o] LT'; + } + }, + sameElse: 'L' + }, + relativeTime : { + future : "za %s", + past : "%s temu", + s : "kilka sekund", + m : translate, + mm : translate, + h : translate, + hh : translate, + d : "1 dzień", + dd : '%d dni', + M : "miesiąc", + MM : translate, + y : "rok", + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/pt-br.js b/resources/lib/moment/lang/pt-br.js new file mode 100644 index 000000000000..5cac19b69160 --- /dev/null +++ b/resources/lib/moment/lang/pt-br.js @@ -0,0 +1,56 @@ +// moment.js language configuration +// language : brazilian portuguese (pt-br) +// author : Caio Ribeiro Pereira : https://github.com/caio-ribeiro-pereira + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('pt-br', { + months : "Janeiro_Fevereiro_Março_Abril_Maio_Junho_Julho_Agosto_Setembro_Outubro_Novembro_Dezembro".split("_"), + monthsShort : "Jan_Fev_Mar_Abr_Mai_Jun_Jul_Ago_Set_Out_Nov_Dez".split("_"), + weekdays : "Domingo_Segunda-feira_Terça-feira_Quarta-feira_Quinta-feira_Sexta-feira_Sábado".split("_"), + weekdaysShort : "Dom_Seg_Ter_Qua_Qui_Sex_Sáb".split("_"), + weekdaysMin : "Dom_2ª_3ª_4ª_5ª_6ª_Sáb".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D [de] MMMM [de] YYYY", + LLL : "D [de] MMMM [de] YYYY LT", + LLLL : "dddd, D [de] MMMM [de] YYYY LT" + }, + calendar : { + sameDay: '[Hoje às] LT', + nextDay: '[Amanhã às] LT', + nextWeek: 'dddd [às] LT', + lastDay: '[Ontem às] LT', + lastWeek: function () { + return (this.day() === 0 || this.day() === 6) ? + '[Último] dddd [às] LT' : // Saturday + Sunday + '[Última] dddd [às] LT'; // Monday - Friday + }, + sameElse: 'L' + }, + relativeTime : { + future : "em %s", + past : "%s atrás", + s : "segundos", + m : "um minuto", + mm : "%d minutos", + h : "uma hora", + hh : "%d horas", + d : "um dia", + dd : "%d dias", + M : "um mês", + MM : "%d meses", + y : "um ano", + yy : "%d anos" + }, + ordinal : '%dº' + }); +})); diff --git a/resources/lib/moment/lang/pt.js b/resources/lib/moment/lang/pt.js new file mode 100644 index 000000000000..7c1f2b5ce5a8 --- /dev/null +++ b/resources/lib/moment/lang/pt.js @@ -0,0 +1,60 @@ +// moment.js language configuration +// language : portuguese (pt) +// author : Jefferson : https://github.com/jalex79 + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('pt', { + months : "Janeiro_Fevereiro_Março_Abril_Maio_Junho_Julho_Agosto_Setembro_Outubro_Novembro_Dezembro".split("_"), + monthsShort : "Jan_Fev_Mar_Abr_Mai_Jun_Jul_Ago_Set_Out_Nov_Dez".split("_"), + weekdays : "Domingo_Segunda-feira_Terça-feira_Quarta-feira_Quinta-feira_Sexta-feira_Sábado".split("_"), + weekdaysShort : "Dom_Seg_Ter_Qua_Qui_Sex_Sáb".split("_"), + weekdaysMin : "Dom_2ª_3ª_4ª_5ª_6ª_Sáb".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D [de] MMMM [de] YYYY", + LLL : "D [de] MMMM [de] YYYY LT", + LLLL : "dddd, D [de] MMMM [de] YYYY LT" + }, + calendar : { + sameDay: '[Hoje às] LT', + nextDay: '[Amanhã às] LT', + nextWeek: 'dddd [às] LT', + lastDay: '[Ontem às] LT', + lastWeek: function () { + return (this.day() === 0 || this.day() === 6) ? + '[Último] dddd [às] LT' : // Saturday + Sunday + '[Última] dddd [às] LT'; // Monday - Friday + }, + sameElse: 'L' + }, + relativeTime : { + future : "em %s", + past : "%s atrás", + s : "segundos", + m : "um minuto", + mm : "%d minutos", + h : "uma hora", + hh : "%d horas", + d : "um dia", + dd : "%d dias", + M : "um mês", + MM : "%d meses", + y : "um ano", + yy : "%d anos" + }, + ordinal : '%dº', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ro.js b/resources/lib/moment/lang/ro.js new file mode 100644 index 000000000000..77d735558b1b --- /dev/null +++ b/resources/lib/moment/lang/ro.js @@ -0,0 +1,72 @@ +// moment.js language configuration +// language : romanian (ro) +// author : Vlad Gurdiga : https://github.com/gurdiga +// author : Valentin Agachi : https://github.com/avaly + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function relativeTimeWithPlural(number, withoutSuffix, key) { + var format = { + 'mm': 'minute', + 'hh': 'ore', + 'dd': 'zile', + 'MM': 'luni', + 'yy': 'ani' + }, + separator = ' '; + if (number % 100 >= 20 || (number >= 100 && number % 100 === 0)) { + separator = ' de '; + } + + return number + separator + format[key]; + } + + return moment.lang('ro', { + months : "ianuarie_februarie_martie_aprilie_mai_iunie_iulie_august_septembrie_octombrie_noiembrie_decembrie".split("_"), + monthsShort : "ian_feb_mar_apr_mai_iun_iul_aug_sep_oct_noi_dec".split("_"), + weekdays : "duminică_luni_marți_miercuri_joi_vineri_sâmbătă".split("_"), + weekdaysShort : "Dum_Lun_Mar_Mie_Joi_Vin_Sâm".split("_"), + weekdaysMin : "Du_Lu_Ma_Mi_Jo_Vi_Sâ".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD.MM.YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY H:mm", + LLLL : "dddd, D MMMM YYYY H:mm" + }, + calendar : { + sameDay: "[azi la] LT", + nextDay: '[mâine la] LT', + nextWeek: 'dddd [la] LT', + lastDay: '[ieri la] LT', + lastWeek: '[fosta] dddd [la] LT', + sameElse: 'L' + }, + relativeTime : { + future : "peste %s", + past : "%s în urmă", + s : "câteva secunde", + m : "un minut", + mm : relativeTimeWithPlural, + h : "o oră", + hh : relativeTimeWithPlural, + d : "o zi", + dd : relativeTimeWithPlural, + M : "o lună", + MM : relativeTimeWithPlural, + y : "un an", + yy : relativeTimeWithPlural + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/rs.js b/resources/lib/moment/lang/rs.js new file mode 100644 index 000000000000..86275536e9eb --- /dev/null +++ b/resources/lib/moment/lang/rs.js @@ -0,0 +1,139 @@ +// moment.js language configuration +// language : serbian (rs) +// author : Limon Monte : https://github.com/limonte +// based on (bs) translation by Nedim Cholich + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + + function translate(number, withoutSuffix, key) { + var result = number + " "; + switch (key) { + case 'm': + return withoutSuffix ? 'jedna minuta' : 'jedne minute'; + case 'mm': + if (number === 1) { + result += 'minuta'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'minute'; + } else { + result += 'minuta'; + } + return result; + case 'h': + return withoutSuffix ? 'jedan sat' : 'jednog sata'; + case 'hh': + if (number === 1) { + result += 'sat'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'sata'; + } else { + result += 'sati'; + } + return result; + case 'dd': + if (number === 1) { + result += 'dan'; + } else { + result += 'dana'; + } + return result; + case 'MM': + if (number === 1) { + result += 'mesec'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'meseca'; + } else { + result += 'meseci'; + } + return result; + case 'yy': + if (number === 1) { + result += 'godina'; + } else if (number === 2 || number === 3 || number === 4) { + result += 'godine'; + } else { + result += 'godina'; + } + return result; + } + } + + return moment.lang('rs', { + months : "januar_februar_mart_april_maj_jun_jul_avgust_septembar_oktobar_novembar_decembar".split("_"), + monthsShort : "jan._feb._mar._apr._maj._jun._jul._avg._sep._okt._nov._dec.".split("_"), + weekdays : "nedelja_ponedeljak_utorak_sreda_četvrtak_petak_subota".split("_"), + weekdaysShort : "ned._pon._uto._sre._čet._pet._sub.".split("_"), + weekdaysMin : "ne_po_ut_sr_če_pe_su".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD. MM. YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd, D. MMMM YYYY LT" + }, + calendar : { + sameDay : '[danas u] LT', + nextDay : '[sutra u] LT', + + nextWeek : function () { + switch (this.day()) { + case 0: + return '[u] [nedelju] [u] LT'; + case 3: + return '[u] [sredu] [u] LT'; + case 6: + return '[u] [subotu] [u] LT'; + case 1: + case 2: + case 4: + case 5: + return '[u] dddd [u] LT'; + } + }, + lastDay : '[juče u] LT', + lastWeek : function () { + switch (this.day()) { + case 0: + case 3: + return '[prošlu] dddd [u] LT'; + case 6: + return '[prošle] [subote] [u] LT'; + case 1: + case 2: + case 4: + case 5: + return '[prošli] dddd [u] LT'; + } + }, + sameElse : 'L' + }, + relativeTime : { + future : "za %s", + past : "pre %s", + s : "par sekundi", + m : translate, + mm : translate, + h : translate, + hh : translate, + d : "dan", + dd : translate, + M : "mesec", + MM : translate, + y : "godinu", + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ru.js b/resources/lib/moment/lang/ru.js new file mode 100644 index 000000000000..1d1816ce9ef5 --- /dev/null +++ b/resources/lib/moment/lang/ru.js @@ -0,0 +1,163 @@ +// moment.js language configuration +// language : russian (ru) +// author : Viktorminator : https://github.com/Viktorminator +// Author : Menelion Elensúle : https://github.com/Oire + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function plural(word, num) { + var forms = word.split('_'); + return num % 10 === 1 && num % 100 !== 11 ? forms[0] : (num % 10 >= 2 && num % 10 <= 4 && (num % 100 < 10 || num % 100 >= 20) ? forms[1] : forms[2]); + } + + function relativeTimeWithPlural(number, withoutSuffix, key) { + var format = { + 'mm': 'минута_минуты_минут', + 'hh': 'час_часа_часов', + 'dd': 'день_дня_дней', + 'MM': 'месяц_месяца_месяцев', + 'yy': 'год_года_лет' + }; + if (key === 'm') { + return withoutSuffix ? 'минута' : 'минуту'; + } + else { + return number + ' ' + plural(format[key], +number); + } + } + + function monthsCaseReplace(m, format) { + var months = { + 'nominative': 'январь_февраль_март_апрель_май_июнь_июль_август_сентябрь_октябрь_ноябрь_декабрь'.split('_'), + 'accusative': 'января_февраля_марта_апреля_мая_июня_июля_августа_сентября_октября_ноября_декабря'.split('_') + }, + + nounCase = (/D[oD]?(\[[^\[\]]*\]|\s+)+MMMM?/).test(format) ? + 'accusative' : + 'nominative'; + + return months[nounCase][m.month()]; + } + + function monthsShortCaseReplace(m, format) { + var monthsShort = { + 'nominative': 'янв_фев_мар_апр_май_июнь_июль_авг_сен_окт_ноя_дек'.split('_'), + 'accusative': 'янв_фев_мар_апр_мая_июня_июля_авг_сен_окт_ноя_дек'.split('_') + }, + + nounCase = (/D[oD]?(\[[^\[\]]*\]|\s+)+MMMM?/).test(format) ? + 'accusative' : + 'nominative'; + + return monthsShort[nounCase][m.month()]; + } + + function weekdaysCaseReplace(m, format) { + var weekdays = { + 'nominative': 'воскресенье_понедельник_вторник_среда_четверг_пятница_суббота'.split('_'), + 'accusative': 'воскресенье_понедельник_вторник_среду_четверг_пятницу_субботу'.split('_') + }, + + nounCase = (/\[ ?[Вв] ?(?:прошлую|следующую)? ?\] ?dddd/).test(format) ? + 'accusative' : + 'nominative'; + + return weekdays[nounCase][m.day()]; + } + + return moment.lang('ru', { + months : monthsCaseReplace, + monthsShort : monthsShortCaseReplace, + weekdays : weekdaysCaseReplace, + weekdaysShort : "вс_пн_вт_ср_чт_пт_сб".split("_"), + weekdaysMin : "вс_пн_вт_ср_чт_пт_сб".split("_"), + monthsParse : [/^янв/i, /^фев/i, /^мар/i, /^апр/i, /^ма[й|я]/i, /^июн/i, /^июл/i, /^авг/i, /^сен/i, /^окт/i, /^ноя/i, /^дек/i], + longDateFormat : { + LT : "HH:mm", + L : "DD.MM.YYYY", + LL : "D MMMM YYYY г.", + LLL : "D MMMM YYYY г., LT", + LLLL : "dddd, D MMMM YYYY г., LT" + }, + calendar : { + sameDay: '[Сегодня в] LT', + nextDay: '[Завтра в] LT', + lastDay: '[Вчера в] LT', + nextWeek: function () { + return this.day() === 2 ? '[Во] dddd [в] LT' : '[В] dddd [в] LT'; + }, + lastWeek: function () { + switch (this.day()) { + case 0: + return '[В прошлое] dddd [в] LT'; + case 1: + case 2: + case 4: + return '[В прошлый] dddd [в] LT'; + case 3: + case 5: + case 6: + return '[В прошлую] dddd [в] LT'; + } + }, + sameElse: 'L' + }, + relativeTime : { + future : "через %s", + past : "%s назад", + s : "несколько секунд", + m : relativeTimeWithPlural, + mm : relativeTimeWithPlural, + h : "час", + hh : relativeTimeWithPlural, + d : "день", + dd : relativeTimeWithPlural, + M : "месяц", + MM : relativeTimeWithPlural, + y : "год", + yy : relativeTimeWithPlural + }, + + // M. E.: those two are virtually unused but a user might want to implement them for his/her website for some reason + + meridiem : function (hour, minute, isLower) { + if (hour < 4) { + return "ночи"; + } else if (hour < 12) { + return "утра"; + } else if (hour < 17) { + return "дня"; + } else { + return "вечера"; + } + }, + + ordinal: function (number, period) { + switch (period) { + case 'M': + case 'd': + case 'DDD': + return number + '-й'; + case 'D': + return number + '-го'; + case 'w': + case 'W': + return number + '-я'; + default: + return number; + } + }, + + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/sk.js b/resources/lib/moment/lang/sk.js new file mode 100644 index 000000000000..ed8a41d4866e --- /dev/null +++ b/resources/lib/moment/lang/sk.js @@ -0,0 +1,156 @@ +// moment.js language configuration +// language : slovak (sk) +// author : Martin Minka : https://github.com/k2s +// based on work of petrbela : https://github.com/petrbela + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + var months = "január_február_marec_apríl_máj_jún_júl_august_september_október_november_december".split("_"), + monthsShort = "jan_feb_mar_apr_máj_jún_júl_aug_sep_okt_nov_dec".split("_"); + + function plural(n) { + return (n > 1) && (n < 5); + } + + function translate(number, withoutSuffix, key, isFuture) { + var result = number + " "; + switch (key) { + case 's': // a few seconds / in a few seconds / a few seconds ago + return (withoutSuffix || isFuture) ? 'pár sekúnd' : 'pár sekundami'; + case 'm': // a minute / in a minute / a minute ago + return withoutSuffix ? 'minúta' : (isFuture ? 'minútu' : 'minútou'); + case 'mm': // 9 minutes / in 9 minutes / 9 minutes ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'minúty' : 'minút'); + } else { + return result + 'minútami'; + } + break; + case 'h': // an hour / in an hour / an hour ago + return withoutSuffix ? 'hodina' : (isFuture ? 'hodinu' : 'hodinou'); + case 'hh': // 9 hours / in 9 hours / 9 hours ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'hodiny' : 'hodín'); + } else { + return result + 'hodinami'; + } + break; + case 'd': // a day / in a day / a day ago + return (withoutSuffix || isFuture) ? 'deň' : 'dňom'; + case 'dd': // 9 days / in 9 days / 9 days ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'dni' : 'dní'); + } else { + return result + 'dňami'; + } + break; + case 'M': // a month / in a month / a month ago + return (withoutSuffix || isFuture) ? 'mesiac' : 'mesiacom'; + case 'MM': // 9 months / in 9 months / 9 months ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'mesiace' : 'mesiacov'); + } else { + return result + 'mesiacmi'; + } + break; + case 'y': // a year / in a year / a year ago + return (withoutSuffix || isFuture) ? 'rok' : 'rokom'; + case 'yy': // 9 years / in 9 years / 9 years ago + if (withoutSuffix || isFuture) { + return result + (plural(number) ? 'roky' : 'rokov'); + } else { + return result + 'rokmi'; + } + break; + } + } + + return moment.lang('sk', { + months : months, + monthsShort : monthsShort, + monthsParse : (function (months, monthsShort) { + var i, _monthsParse = []; + for (i = 0; i < 12; i++) { + // use custom parser to solve problem with July (červenec) + _monthsParse[i] = new RegExp('^' + months[i] + '$|^' + monthsShort[i] + '$', 'i'); + } + return _monthsParse; + }(months, monthsShort)), + weekdays : "nedeľa_pondelok_utorok_streda_štvrtok_piatok_sobota".split("_"), + weekdaysShort : "ne_po_ut_st_št_pi_so".split("_"), + weekdaysMin : "ne_po_ut_st_št_pi_so".split("_"), + longDateFormat : { + LT: "H:mm", + L : "DD.MM.YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd D. MMMM YYYY LT" + }, + calendar : { + sameDay: "[dnes o] LT", + nextDay: '[zajtra o] LT', + nextWeek: function () { + switch (this.day()) { + case 0: + return '[v nedeľu o] LT'; + case 1: + case 2: + return '[v] dddd [o] LT'; + case 3: + return '[v stredu o] LT'; + case 4: + return '[vo štvrtok o] LT'; + case 5: + return '[v piatok o] LT'; + case 6: + return '[v sobotu o] LT'; + } + }, + lastDay: '[včera o] LT', + lastWeek: function () { + switch (this.day()) { + case 0: + return '[minulú nedeľu o] LT'; + case 1: + case 2: + return '[minulý] dddd [o] LT'; + case 3: + return '[minulú stredu o] LT'; + case 4: + case 5: + return '[minulý] dddd [o] LT'; + case 6: + return '[minulú sobotu o] LT'; + } + }, + sameElse: "L" + }, + relativeTime : { + future : "za %s", + past : "pred %s", + s : translate, + m : translate, + mm : translate, + h : translate, + hh : translate, + d : translate, + dd : translate, + M : translate, + MM : translate, + y : translate, + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/sl.js b/resources/lib/moment/lang/sl.js new file mode 100644 index 000000000000..d260f80d96c1 --- /dev/null +++ b/resources/lib/moment/lang/sl.js @@ -0,0 +1,144 @@ +// moment.js language configuration +// language : slovenian (sl) +// author : Robert Sedovšek : https://github.com/sedovsek + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function translate(number, withoutSuffix, key) { + var result = number + " "; + switch (key) { + case 'm': + return withoutSuffix ? 'ena minuta' : 'eno minuto'; + case 'mm': + if (number === 1) { + result += 'minuta'; + } else if (number === 2) { + result += 'minuti'; + } else if (number === 3 || number === 4) { + result += 'minute'; + } else { + result += 'minut'; + } + return result; + case 'h': + return withoutSuffix ? 'ena ura' : 'eno uro'; + case 'hh': + if (number === 1) { + result += 'ura'; + } else if (number === 2) { + result += 'uri'; + } else if (number === 3 || number === 4) { + result += 'ure'; + } else { + result += 'ur'; + } + return result; + case 'dd': + if (number === 1) { + result += 'dan'; + } else { + result += 'dni'; + } + return result; + case 'MM': + if (number === 1) { + result += 'mesec'; + } else if (number === 2) { + result += 'meseca'; + } else if (number === 3 || number === 4) { + result += 'mesece'; + } else { + result += 'mesecev'; + } + return result; + case 'yy': + if (number === 1) { + result += 'leto'; + } else if (number === 2) { + result += 'leti'; + } else if (number === 3 || number === 4) { + result += 'leta'; + } else { + result += 'let'; + } + return result; + } + } + + return moment.lang('sl', { + months : "januar_februar_marec_april_maj_junij_julij_avgust_september_oktober_november_december".split("_"), + monthsShort : "jan._feb._mar._apr._maj._jun._jul._avg._sep._okt._nov._dec.".split("_"), + weekdays : "nedelja_ponedeljek_torek_sreda_četrtek_petek_sobota".split("_"), + weekdaysShort : "ned._pon._tor._sre._čet._pet._sob.".split("_"), + weekdaysMin : "ne_po_to_sr_če_pe_so".split("_"), + longDateFormat : { + LT : "H:mm", + L : "DD. MM. YYYY", + LL : "D. MMMM YYYY", + LLL : "D. MMMM YYYY LT", + LLLL : "dddd, D. MMMM YYYY LT" + }, + calendar : { + sameDay : '[danes ob] LT', + nextDay : '[jutri ob] LT', + + nextWeek : function () { + switch (this.day()) { + case 0: + return '[v] [nedeljo] [ob] LT'; + case 3: + return '[v] [sredo] [ob] LT'; + case 6: + return '[v] [soboto] [ob] LT'; + case 1: + case 2: + case 4: + case 5: + return '[v] dddd [ob] LT'; + } + }, + lastDay : '[včeraj ob] LT', + lastWeek : function () { + switch (this.day()) { + case 0: + case 3: + case 6: + return '[prejšnja] dddd [ob] LT'; + case 1: + case 2: + case 4: + case 5: + return '[prejšnji] dddd [ob] LT'; + } + }, + sameElse : 'L' + }, + relativeTime : { + future : "čez %s", + past : "%s nazaj", + s : "nekaj sekund", + m : translate, + mm : translate, + h : translate, + hh : translate, + d : "en dan", + dd : translate, + M : "en mesec", + MM : translate, + y : "eno leto", + yy : translate + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/sq.js b/resources/lib/moment/lang/sq.js new file mode 100644 index 000000000000..a5e44b5a5aa4 --- /dev/null +++ b/resources/lib/moment/lang/sq.js @@ -0,0 +1,57 @@ +// moment.js language configuration +// language : Albanian (sq) +// author : Flakërim Ismani : https://github.com/flakerimi +// author: Menelion Elensúle: https://github.com/Oire (tests) + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('sq', { + months : "Janar_Shkurt_Mars_Prill_Maj_Qershor_Korrik_Gusht_Shtator_Tetor_Nëntor_Dhjetor".split("_"), + monthsShort : "Jan_Shk_Mar_Pri_Maj_Qer_Kor_Gus_Sht_Tet_Nën_Dhj".split("_"), + weekdays : "E Diel_E Hënë_E Marte_E Mërkure_E Enjte_E Premte_E Shtunë".split("_"), + weekdaysShort : "Die_Hën_Mar_Mër_Enj_Pre_Sht".split("_"), + weekdaysMin : "D_H_Ma_Më_E_P_Sh".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay : '[Sot në] LT', + nextDay : '[Neser në] LT', + nextWeek : 'dddd [në] LT', + lastDay : '[Dje në] LT', + lastWeek : 'dddd [e kaluar në] LT', + sameElse : 'L' + }, + relativeTime : { + future : "në %s", + past : "%s me parë", + s : "disa sekonda", + m : "një minut", + mm : "%d minuta", + h : "një orë", + hh : "%d orë", + d : "një ditë", + dd : "%d ditë", + M : "një muaj", + MM : "%d muaj", + y : "një vit", + yy : "%d vite" + }, + ordinal : '%d.', + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/sv.js b/resources/lib/moment/lang/sv.js new file mode 100644 index 000000000000..0de8c40ba79e --- /dev/null +++ b/resources/lib/moment/lang/sv.js @@ -0,0 +1,63 @@ +// moment.js language configuration +// language : swedish (sv) +// author : Jens Alm : https://github.com/ulmus + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('sv', { + months : "januari_februari_mars_april_maj_juni_juli_augusti_september_oktober_november_december".split("_"), + monthsShort : "jan_feb_mar_apr_maj_jun_jul_aug_sep_okt_nov_dec".split("_"), + weekdays : "söndag_måndag_tisdag_onsdag_torsdag_fredag_lördag".split("_"), + weekdaysShort : "sön_mån_tis_ons_tor_fre_lör".split("_"), + weekdaysMin : "sö_må_ti_on_to_fr_lö".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "YYYY-MM-DD", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: '[Idag] LT', + nextDay: '[Imorgon] LT', + lastDay: '[Igår] LT', + nextWeek: 'dddd LT', + lastWeek: '[Förra] dddd[en] LT', + sameElse: 'L' + }, + relativeTime : { + future : "om %s", + past : "för %s sedan", + s : "några sekunder", + m : "en minut", + mm : "%d minuter", + h : "en timme", + hh : "%d timmar", + d : "en dag", + dd : "%d dagar", + M : "en månad", + MM : "%d månader", + y : "ett år", + yy : "%d år" + }, + ordinal : function (number) { + var b = number % 10, + output = (~~ (number % 100 / 10) === 1) ? 'e' : + (b === 1) ? 'a' : + (b === 2) ? 'a' : + (b === 3) ? 'e' : 'e'; + return number + output; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/ta.js b/resources/lib/moment/lang/ta.js new file mode 100644 index 000000000000..cc742c989b61 --- /dev/null +++ b/resources/lib/moment/lang/ta.js @@ -0,0 +1,112 @@ +// moment.js language configuration +// language : tamil (ta) +// author : Arjunkumar Krishnamoorthy : https://github.com/tk120404 + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + /*var symbolMap = { + '1': '௧', + '2': '௨', + '3': '௩', + '4': '௪', + '5': '௫', + '6': '௬', + '7': '௭', + '8': '௮', + '9': '௯', + '0': '௦' + }, + numberMap = { + '௧': '1', + '௨': '2', + '௩': '3', + '௪': '4', + '௫': '5', + '௬': '6', + '௭': '7', + '௮': '8', + '௯': '9', + '௦': '0' + }; */ + + return moment.lang('ta', { + months : 'ஜனவரி_பிப்ரவரி_மார்ச்_ஏப்ரல்_மே_ஜூன்_ஜூலை_ஆகஸ்ட்_செப்டெம்பர்_அக்டோபர்_நவம்பர்_டிசம்பர்'.split("_"), + monthsShort : 'ஜனவரி_பிப்ரவரி_மார்ச்_ஏப்ரல்_மே_ஜூன்_ஜூலை_ஆகஸ்ட்_செப்டெம்பர்_அக்டோபர்_நவம்பர்_டிசம்பர்'.split("_"), + weekdays : 'ஞாயிற்றுக்கிழமை_திங்கட்கிழமை_செவ்வாய்கிழமை_புதன்கிழமை_வியாழக்கிழமை_வெள்ளிக்கிழமை_சனிக்கிழமை'.split("_"), + weekdaysShort : 'ஞாயிறு_திங்கள்_செவ்வாய்_புதன்_வியாழன்_வெள்ளி_சனி'.split("_"), + weekdaysMin : 'ஞா_தி_செ_பு_வி_வெ_ச'.split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY, LT", + LLLL : "dddd, D MMMM YYYY, LT" + }, + calendar : { + sameDay : '[இன்று] LT', + nextDay : '[நாளை] LT', + nextWeek : 'dddd, LT', + lastDay : '[நேற்று] LT', + lastWeek : '[கடந்த வாரம்] dddd, LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s இல்", + past : "%s முன்", + s : "ஒரு சில விநாடிகள்", + m : "ஒரு நிமிடம்", + mm : "%d நிமிடங்கள்", + h : "ஒரு மணி நேரம்", + hh : "%d மணி நேரம்", + d : "ஒரு நாள்", + dd : "%d நாட்கள்", + M : "ஒரு மாதம்", + MM : "%d மாதங்கள்", + y : "ஒரு வருடம்", + yy : "%d ஆண்டுகள்" + }, +/* preparse: function (string) { + return string.replace(/[௧௨௩௪௫௬௭௮௯௦]/g, function (match) { + return numberMap[match]; + }); + }, + postformat: function (string) { + return string.replace(/\d/g, function (match) { + return symbolMap[match]; + }); + },*/ + ordinal : function (number) { + return number + 'வது'; + }, + + +// refer http://ta.wikipedia.org/s/1er1 + + meridiem : function (hour, minute, isLower) { + if (hour >= 6 && hour <= 10) { + return " காலை"; + } else if (hour >= 10 && hour <= 14) { + return " நண்பகல்"; + } else if (hour >= 14 && hour <= 18) { + return " எற்பாடு"; + } else if (hour >= 18 && hour <= 20) { + return " மாலை"; + } else if (hour >= 20 && hour <= 24) { + return " இரவு"; + } else if (hour >= 0 && hour <= 6) { + return " வைகறை"; + } + }, + week : { + dow : 0, // Sunday is the first day of the week. + doy : 6 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/th.js b/resources/lib/moment/lang/th.js new file mode 100644 index 000000000000..70336c87e4ae --- /dev/null +++ b/resources/lib/moment/lang/th.js @@ -0,0 +1,58 @@ +// moment.js language configuration +// language : thai (th) +// author : Kridsada Thanabulpong : https://github.com/sirn + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('th', { + months : "มกราคม_กุมภาพันธ์_มีนาคม_เมษายน_พฤษภาคม_มิถุนายน_กรกฎาคม_สิงหาคม_กันยายน_ตุลาคม_พฤศจิกายน_ธันวาคม".split("_"), + monthsShort : "มกรา_กุมภา_มีนา_เมษา_พฤษภา_มิถุนา_กรกฎา_สิงหา_กันยา_ตุลา_พฤศจิกา_ธันวา".split("_"), + weekdays : "อาทิตย์_จันทร์_อังคาร_พุธ_พฤหัสบดี_ศุกร์_เสาร์".split("_"), + weekdaysShort : "อาทิตย์_จันทร์_อังคาร_พุธ_พฤหัส_ศุกร์_เสาร์".split("_"), // yes, three characters difference + weekdaysMin : "อา._จ._อ._พ._พฤ._ศ._ส.".split("_"), + longDateFormat : { + LT : "H นาฬิกา m นาที", + L : "YYYY/MM/DD", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY เวลา LT", + LLLL : "วันddddที่ D MMMM YYYY เวลา LT" + }, + meridiem : function (hour, minute, isLower) { + if (hour < 12) { + return "ก่อนเที่ยง"; + } else { + return "หลังเที่ยง"; + } + }, + calendar : { + sameDay : '[วันนี้ เวลา] LT', + nextDay : '[พรุ่งนี้ เวลา] LT', + nextWeek : 'dddd[หน้า เวลา] LT', + lastDay : '[เมื่อวานนี้ เวลา] LT', + lastWeek : '[วัน]dddd[ที่แล้ว เวลา] LT', + sameElse : 'L' + }, + relativeTime : { + future : "อีก %s", + past : "%sที่แล้ว", + s : "ไม่กี่วินาที", + m : "1 นาที", + mm : "%d นาที", + h : "1 ชั่วโมง", + hh : "%d ชั่วโมง", + d : "1 วัน", + dd : "%d วัน", + M : "1 เดือน", + MM : "%d เดือน", + y : "1 ปี", + yy : "%d ปี" + } + }); +})); diff --git a/resources/lib/moment/lang/tl-ph.js b/resources/lib/moment/lang/tl-ph.js new file mode 100644 index 000000000000..80444830641e --- /dev/null +++ b/resources/lib/moment/lang/tl-ph.js @@ -0,0 +1,58 @@ +// moment.js language configuration +// language : Tagalog/Filipino (tl-ph) +// author : Dan Hagman + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('tl-ph', { + months : "Enero_Pebrero_Marso_Abril_Mayo_Hunyo_Hulyo_Agosto_Setyembre_Oktubre_Nobyembre_Disyembre".split("_"), + monthsShort : "Ene_Peb_Mar_Abr_May_Hun_Hul_Ago_Set_Okt_Nob_Dis".split("_"), + weekdays : "Linggo_Lunes_Martes_Miyerkules_Huwebes_Biyernes_Sabado".split("_"), + weekdaysShort : "Lin_Lun_Mar_Miy_Huw_Biy_Sab".split("_"), + weekdaysMin : "Li_Lu_Ma_Mi_Hu_Bi_Sab".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "MM/D/YYYY", + LL : "MMMM D, YYYY", + LLL : "MMMM D, YYYY LT", + LLLL : "dddd, MMMM DD, YYYY LT" + }, + calendar : { + sameDay: "[Ngayon sa] LT", + nextDay: '[Bukas sa] LT', + nextWeek: 'dddd [sa] LT', + lastDay: '[Kahapon sa] LT', + lastWeek: 'dddd [huling linggo] LT', + sameElse: 'L' + }, + relativeTime : { + future : "sa loob ng %s", + past : "%s ang nakalipas", + s : "ilang segundo", + m : "isang minuto", + mm : "%d minuto", + h : "isang oras", + hh : "%d oras", + d : "isang araw", + dd : "%d araw", + M : "isang buwan", + MM : "%d buwan", + y : "isang taon", + yy : "%d taon" + }, + ordinal : function (number) { + return number; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/tr.js b/resources/lib/moment/lang/tr.js new file mode 100644 index 000000000000..e90f250e5902 --- /dev/null +++ b/resources/lib/moment/lang/tr.js @@ -0,0 +1,93 @@ +// moment.js language configuration +// language : turkish (tr) +// authors : Erhan Gundogan : https://github.com/erhangundogan, +// Burak Yiğit Kaya: https://github.com/BYK + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + + var suffixes = { + 1: "'inci", + 5: "'inci", + 8: "'inci", + 70: "'inci", + 80: "'inci", + + 2: "'nci", + 7: "'nci", + 20: "'nci", + 50: "'nci", + + 3: "'üncü", + 4: "'üncü", + 100: "'üncü", + + 6: "'ncı", + + 9: "'uncu", + 10: "'uncu", + 30: "'uncu", + + 60: "'ıncı", + 90: "'ıncı" + }; + + return moment.lang('tr', { + months : "Ocak_Şubat_Mart_Nisan_Mayıs_Haziran_Temmuz_Ağustos_Eylül_Ekim_Kasım_Aralık".split("_"), + monthsShort : "Oca_Şub_Mar_Nis_May_Haz_Tem_Ağu_Eyl_Eki_Kas_Ara".split("_"), + weekdays : "Pazar_Pazartesi_Salı_Çarşamba_Perşembe_Cuma_Cumartesi".split("_"), + weekdaysShort : "Paz_Pts_Sal_Çar_Per_Cum_Cts".split("_"), + weekdaysMin : "Pz_Pt_Sa_Ça_Pe_Cu_Ct".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD.MM.YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd, D MMMM YYYY LT" + }, + calendar : { + sameDay : '[bugün saat] LT', + nextDay : '[yarın saat] LT', + nextWeek : '[haftaya] dddd [saat] LT', + lastDay : '[dün] LT', + lastWeek : '[geçen hafta] dddd [saat] LT', + sameElse : 'L' + }, + relativeTime : { + future : "%s sonra", + past : "%s önce", + s : "birkaç saniye", + m : "bir dakika", + mm : "%d dakika", + h : "bir saat", + hh : "%d saat", + d : "bir gün", + dd : "%d gün", + M : "bir ay", + MM : "%d ay", + y : "bir yıl", + yy : "%d yıl" + }, + ordinal : function (number) { + if (number === 0) { // special case for zero + return number + "'ıncı"; + } + var a = number % 10, + b = number % 100 - a, + c = number >= 100 ? 100 : null; + + return number + (suffixes[a] || suffixes[b] || suffixes[c]); + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/tzm-la.js b/resources/lib/moment/lang/tzm-la.js new file mode 100644 index 000000000000..be1d878ddf8d --- /dev/null +++ b/resources/lib/moment/lang/tzm-la.js @@ -0,0 +1,55 @@ +// moment.js language configuration +// language : Morocco Central Atlas Tamaziɣt in Latin (tzm-la) +// author : Abdel Said : https://github.com/abdelsaid + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('tzm-la', { + months : "innayr_brˤayrˤ_marˤsˤ_ibrir_mayyw_ywnyw_ywlywz_ɣwšt_šwtanbir_ktˤwbrˤ_nwwanbir_dwjnbir".split("_"), + monthsShort : "innayr_brˤayrˤ_marˤsˤ_ibrir_mayyw_ywnyw_ywlywz_ɣwšt_šwtanbir_ktˤwbrˤ_nwwanbir_dwjnbir".split("_"), + weekdays : "asamas_aynas_asinas_akras_akwas_asimwas_asiḍyas".split("_"), + weekdaysShort : "asamas_aynas_asinas_akras_akwas_asimwas_asiḍyas".split("_"), + weekdaysMin : "asamas_aynas_asinas_akras_akwas_asimwas_asiḍyas".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: "[asdkh g] LT", + nextDay: '[aska g] LT', + nextWeek: 'dddd [g] LT', + lastDay: '[assant g] LT', + lastWeek: 'dddd [g] LT', + sameElse: 'L' + }, + relativeTime : { + future : "dadkh s yan %s", + past : "yan %s", + s : "imik", + m : "minuḍ", + mm : "%d minuḍ", + h : "saɛa", + hh : "%d tassaɛin", + d : "ass", + dd : "%d ossan", + M : "ayowr", + MM : "%d iyyirn", + y : "asgas", + yy : "%d isgasn" + }, + week : { + dow : 6, // Saturday is the first day of the week. + doy : 12 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/tzm.js b/resources/lib/moment/lang/tzm.js new file mode 100644 index 000000000000..c7c76bdc6500 --- /dev/null +++ b/resources/lib/moment/lang/tzm.js @@ -0,0 +1,55 @@ +// moment.js language configuration +// language : Morocco Central Atlas Tamaziɣt (tzm) +// author : Abdel Said : https://github.com/abdelsaid + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('tzm', { + months : "ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ".split("_"), + monthsShort : "ⵉⵏⵏⴰⵢⵔ_ⴱⵕⴰⵢⵕ_ⵎⴰⵕⵚ_ⵉⴱⵔⵉⵔ_ⵎⴰⵢⵢⵓ_ⵢⵓⵏⵢⵓ_ⵢⵓⵍⵢⵓⵣ_ⵖⵓⵛⵜ_ⵛⵓⵜⴰⵏⴱⵉⵔ_ⴽⵟⵓⴱⵕ_ⵏⵓⵡⴰⵏⴱⵉⵔ_ⴷⵓⵊⵏⴱⵉⵔ".split("_"), + weekdays : "ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ".split("_"), + weekdaysShort : "ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ".split("_"), + weekdaysMin : "ⴰⵙⴰⵎⴰⵙ_ⴰⵢⵏⴰⵙ_ⴰⵙⵉⵏⴰⵙ_ⴰⴽⵔⴰⵙ_ⴰⴽⵡⴰⵙ_ⴰⵙⵉⵎⵡⴰⵙ_ⴰⵙⵉⴹⵢⴰⵙ".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "dddd D MMMM YYYY LT" + }, + calendar : { + sameDay: "[ⴰⵙⴷⵅ ⴴ] LT", + nextDay: '[ⴰⵙⴽⴰ ⴴ] LT', + nextWeek: 'dddd [ⴴ] LT', + lastDay: '[ⴰⵚⴰⵏⵜ ⴴ] LT', + lastWeek: 'dddd [ⴴ] LT', + sameElse: 'L' + }, + relativeTime : { + future : "ⴷⴰⴷⵅ ⵙ ⵢⴰⵏ %s", + past : "ⵢⴰⵏ %s", + s : "ⵉⵎⵉⴽ", + m : "ⵎⵉⵏⵓⴺ", + mm : "%d ⵎⵉⵏⵓⴺ", + h : "ⵙⴰⵄⴰ", + hh : "%d ⵜⴰⵙⵙⴰⵄⵉⵏ", + d : "ⴰⵙⵙ", + dd : "%d oⵙⵙⴰⵏ", + M : "ⴰⵢoⵓⵔ", + MM : "%d ⵉⵢⵢⵉⵔⵏ", + y : "ⴰⵙⴳⴰⵙ", + yy : "%d ⵉⵙⴳⴰⵙⵏ" + }, + week : { + dow : 6, // Saturday is the first day of the week. + doy : 12 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/uk.js b/resources/lib/moment/lang/uk.js new file mode 100644 index 000000000000..47056cb641eb --- /dev/null +++ b/resources/lib/moment/lang/uk.js @@ -0,0 +1,157 @@ +// moment.js language configuration +// language : ukrainian (uk) +// author : zemlanin : https://github.com/zemlanin +// Author : Menelion Elensúle : https://github.com/Oire + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + function plural(word, num) { + var forms = word.split('_'); + return num % 10 === 1 && num % 100 !== 11 ? forms[0] : (num % 10 >= 2 && num % 10 <= 4 && (num % 100 < 10 || num % 100 >= 20) ? forms[1] : forms[2]); + } + + function relativeTimeWithPlural(number, withoutSuffix, key) { + var format = { + 'mm': 'хвилина_хвилини_хвилин', + 'hh': 'година_години_годин', + 'dd': 'день_дні_днів', + 'MM': 'місяць_місяці_місяців', + 'yy': 'рік_роки_років' + }; + if (key === 'm') { + return withoutSuffix ? 'хвилина' : 'хвилину'; + } + else if (key === 'h') { + return withoutSuffix ? 'година' : 'годину'; + } + else { + return number + ' ' + plural(format[key], +number); + } + } + + function monthsCaseReplace(m, format) { + var months = { + 'nominative': 'січень_лютий_березень_квітень_травень_червень_липень_серпень_вересень_жовтень_листопад_грудень'.split('_'), + 'accusative': 'січня_лютого_березня_квітня_травня_червня_липня_серпня_вересня_жовтня_листопада_грудня'.split('_') + }, + + nounCase = (/D[oD]? *MMMM?/).test(format) ? + 'accusative' : + 'nominative'; + + return months[nounCase][m.month()]; + } + + function weekdaysCaseReplace(m, format) { + var weekdays = { + 'nominative': 'неділя_понеділок_вівторок_середа_четвер_п’ятниця_субота'.split('_'), + 'accusative': 'неділю_понеділок_вівторок_середу_четвер_п’ятницю_суботу'.split('_'), + 'genitive': 'неділі_понеділка_вівторка_середи_четверга_п’ятниці_суботи'.split('_') + }, + + nounCase = (/(\[[ВвУу]\]) ?dddd/).test(format) ? + 'accusative' : + ((/\[?(?:минулої|наступної)? ?\] ?dddd/).test(format) ? + 'genitive' : + 'nominative'); + + return weekdays[nounCase][m.day()]; + } + + function processHoursFunction(str) { + return function () { + return str + 'о' + (this.hours() === 11 ? 'б' : '') + '] LT'; + }; + } + + return moment.lang('uk', { + months : monthsCaseReplace, + monthsShort : "січ_лют_бер_квіт_трав_черв_лип_серп_вер_жовт_лист_груд".split("_"), + weekdays : weekdaysCaseReplace, + weekdaysShort : "нд_пн_вт_ср_чт_пт_сб".split("_"), + weekdaysMin : "нд_пн_вт_ср_чт_пт_сб".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD.MM.YYYY", + LL : "D MMMM YYYY р.", + LLL : "D MMMM YYYY р., LT", + LLLL : "dddd, D MMMM YYYY р., LT" + }, + calendar : { + sameDay: processHoursFunction('[Сьогодні '), + nextDay: processHoursFunction('[Завтра '), + lastDay: processHoursFunction('[Вчора '), + nextWeek: processHoursFunction('[У] dddd ['), + lastWeek: function () { + switch (this.day()) { + case 0: + case 3: + case 5: + case 6: + return processHoursFunction('[Минулої] dddd [').call(this); + case 1: + case 2: + case 4: + return processHoursFunction('[Минулого] dddd [').call(this); + } + }, + sameElse: 'L' + }, + relativeTime : { + future : "за %s", + past : "%s тому", + s : "декілька секунд", + m : relativeTimeWithPlural, + mm : relativeTimeWithPlural, + h : "годину", + hh : relativeTimeWithPlural, + d : "день", + dd : relativeTimeWithPlural, + M : "місяць", + MM : relativeTimeWithPlural, + y : "рік", + yy : relativeTimeWithPlural + }, + + // M. E.: those two are virtually unused but a user might want to implement them for his/her website for some reason + + meridiem : function (hour, minute, isLower) { + if (hour < 4) { + return "ночі"; + } else if (hour < 12) { + return "ранку"; + } else if (hour < 17) { + return "дня"; + } else { + return "вечора"; + } + }, + + ordinal: function (number, period) { + switch (period) { + case 'M': + case 'd': + case 'DDD': + case 'w': + case 'W': + return number + '-й'; + case 'D': + return number + '-го'; + default: + return number; + } + }, + + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 1st is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/uz.js b/resources/lib/moment/lang/uz.js new file mode 100644 index 000000000000..a5b06fa9ff2b --- /dev/null +++ b/resources/lib/moment/lang/uz.js @@ -0,0 +1,55 @@ +// moment.js language configuration +// language : uzbek +// author : Sardor Muminov : https://github.com/muminoff + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('uz', { + months : "январь_февраль_март_апрель_май_июнь_июль_август_сентябрь_октябрь_ноябрь_декабрь".split("_"), + monthsShort : "янв_фев_мар_апр_май_июн_июл_авг_сен_окт_ноя_дек".split("_"), + weekdays : "Якшанба_Душанба_Сешанба_Чоршанба_Пайшанба_Жума_Шанба".split("_"), + weekdaysShort : "Якш_Душ_Сеш_Чор_Пай_Жум_Шан".split("_"), + weekdaysMin : "Як_Ду_Се_Чо_Па_Жу_Ша".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM YYYY", + LLL : "D MMMM YYYY LT", + LLLL : "D MMMM YYYY, dddd LT" + }, + calendar : { + sameDay : '[Бугун соат] LT [да]', + nextDay : '[Эртага] LT [да]', + nextWeek : 'dddd [куни соат] LT [да]', + lastDay : '[Кеча соат] LT [да]', + lastWeek : '[Утган] dddd [куни соат] LT [да]', + sameElse : 'L' + }, + relativeTime : { + future : "Якин %s ичида", + past : "Бир неча %s олдин", + s : "фурсат", + m : "бир дакика", + mm : "%d дакика", + h : "бир соат", + hh : "%d соат", + d : "бир кун", + dd : "%d кун", + M : "бир ой", + MM : "%d ой", + y : "бир йил", + yy : "%d йил" + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 7 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/vn.js b/resources/lib/moment/lang/vn.js new file mode 100644 index 000000000000..f28e7c3b3a36 --- /dev/null +++ b/resources/lib/moment/lang/vn.js @@ -0,0 +1,62 @@ +// moment.js language configuration +// language : vietnamese (vn) +// author : Bang Nguyen : https://github.com/bangnk + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('vn', { + months : "tháng 1_tháng 2_tháng 3_tháng 4_tháng 5_tháng 6_tháng 7_tháng 8_tháng 9_tháng 10_tháng 11_tháng 12".split("_"), + monthsShort : "Th01_Th02_Th03_Th04_Th05_Th06_Th07_Th08_Th09_Th10_Th11_Th12".split("_"), + weekdays : "chủ nhật_thứ hai_thứ ba_thứ tư_thứ năm_thứ sáu_thứ bảy".split("_"), + weekdaysShort : "CN_T2_T3_T4_T5_T6_T7".split("_"), + weekdaysMin : "CN_T2_T3_T4_T5_T6_T7".split("_"), + longDateFormat : { + LT : "HH:mm", + L : "DD/MM/YYYY", + LL : "D MMMM [năm] YYYY", + LLL : "D MMMM [năm] YYYY LT", + LLLL : "dddd, D MMMM [năm] YYYY LT", + l : "DD/M/YYYY", + ll : "D MMM YYYY", + lll : "D MMM YYYY LT", + llll : "ddd, D MMM YYYY LT" + }, + calendar : { + sameDay: "[Hôm nay lúc] LT", + nextDay: '[Ngày mai lúc] LT', + nextWeek: 'dddd [tuần tới lúc] LT', + lastDay: '[Hôm qua lúc] LT', + lastWeek: 'dddd [tuần rồi lúc] LT', + sameElse: 'L' + }, + relativeTime : { + future : "%s tới", + past : "%s trước", + s : "vài giây", + m : "một phút", + mm : "%d phút", + h : "một giờ", + hh : "%d giờ", + d : "một ngày", + dd : "%d ngày", + M : "một tháng", + MM : "%d tháng", + y : "một năm", + yy : "%d năm" + }, + ordinal : function (number) { + return number; + }, + week : { + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/zh-cn.js b/resources/lib/moment/lang/zh-cn.js new file mode 100644 index 000000000000..50a3ed93fbc9 --- /dev/null +++ b/resources/lib/moment/lang/zh-cn.js @@ -0,0 +1,108 @@ +// moment.js language configuration +// language : chinese +// author : suupic : https://github.com/suupic +// author : Zeno Zeng : https://github.com/zenozeng + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('zh-cn', { + months : "一月_二月_三月_四月_五月_六月_七月_八月_九月_十月_十一月_十二月".split("_"), + monthsShort : "1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月".split("_"), + weekdays : "星期日_星期一_星期二_星期三_星期四_星期五_星期六".split("_"), + weekdaysShort : "周日_周一_周二_周三_周四_周五_周六".split("_"), + weekdaysMin : "日_一_二_三_四_五_六".split("_"), + longDateFormat : { + LT : "Ah点mm", + L : "YYYY-MM-DD", + LL : "YYYY年MMMD日", + LLL : "YYYY年MMMD日LT", + LLLL : "YYYY年MMMD日ddddLT", + l : "YYYY-MM-DD", + ll : "YYYY年MMMD日", + lll : "YYYY年MMMD日LT", + llll : "YYYY年MMMD日ddddLT" + }, + meridiem : function (hour, minute, isLower) { + var hm = hour * 100 + minute; + if (hm < 600) { + return "凌晨"; + } else if (hm < 900) { + return "早上"; + } else if (hm < 1130) { + return "上午"; + } else if (hm < 1230) { + return "中午"; + } else if (hm < 1800) { + return "下午"; + } else { + return "晚上"; + } + }, + calendar : { + sameDay : function () { + return this.minutes() === 0 ? "[今天]Ah[点整]" : "[今天]LT"; + }, + nextDay : function () { + return this.minutes() === 0 ? "[明天]Ah[点整]" : "[明天]LT"; + }, + lastDay : function () { + return this.minutes() === 0 ? "[昨天]Ah[点整]" : "[昨天]LT"; + }, + nextWeek : function () { + var startOfWeek, prefix; + startOfWeek = moment().startOf('week'); + prefix = this.unix() - startOfWeek.unix() >= 7 * 24 * 3600 ? '[下]' : '[本]'; + return this.minutes() === 0 ? prefix + "dddAh点整" : prefix + "dddAh点mm"; + }, + lastWeek : function () { + var startOfWeek, prefix; + startOfWeek = moment().startOf('week'); + prefix = this.unix() < startOfWeek.unix() ? '[上]' : '[本]'; + return this.minutes() === 0 ? prefix + "dddAh点整" : prefix + "dddAh点mm"; + }, + sameElse : 'LL' + }, + ordinal : function (number, period) { + switch (period) { + case "d": + case "D": + case "DDD": + return number + "日"; + case "M": + return number + "月"; + case "w": + case "W": + return number + "周"; + default: + return number; + } + }, + relativeTime : { + future : "%s内", + past : "%s前", + s : "几秒", + m : "1分钟", + mm : "%d分钟", + h : "1小时", + hh : "%d小时", + d : "1天", + dd : "%d天", + M : "1个月", + MM : "%d个月", + y : "1年", + yy : "%d年" + }, + week : { + // GB/T 7408-1994《数据元和交换格式·信息交换·日期和时间表示法》与ISO 8601:1988等效 + dow : 1, // Monday is the first day of the week. + doy : 4 // The week that contains Jan 4th is the first week of the year. + } + }); +})); diff --git a/resources/lib/moment/lang/zh-tw.js b/resources/lib/moment/lang/zh-tw.js new file mode 100644 index 000000000000..bbb07376eaeb --- /dev/null +++ b/resources/lib/moment/lang/zh-tw.js @@ -0,0 +1,84 @@ +// moment.js language configuration +// language : traditional chinese (zh-tw) +// author : Ben : https://github.com/ben-lin + +(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['moment'], factory); // AMD + } else if (typeof exports === 'object') { + module.exports = factory(require('../moment')); // Node + } else { + factory(window.moment); // Browser global + } +}(function (moment) { + return moment.lang('zh-tw', { + months : "一月_二月_三月_四月_五月_六月_七月_八月_九月_十月_十一月_十二月".split("_"), + monthsShort : "1月_2月_3月_4月_5月_6月_7月_8月_9月_10月_11月_12月".split("_"), + weekdays : "星期日_星期一_星期二_星期三_星期四_星期五_星期六".split("_"), + weekdaysShort : "週日_週一_週二_週三_週四_週五_週六".split("_"), + weekdaysMin : "日_一_二_三_四_五_六".split("_"), + longDateFormat : { + LT : "Ah點mm", + L : "YYYY年MMMD日", + LL : "YYYY年MMMD日", + LLL : "YYYY年MMMD日LT", + LLLL : "YYYY年MMMD日ddddLT", + l : "YYYY年MMMD日", + ll : "YYYY年MMMD日", + lll : "YYYY年MMMD日LT", + llll : "YYYY年MMMD日ddddLT" + }, + meridiem : function (hour, minute, isLower) { + var hm = hour * 100 + minute; + if (hm < 900) { + return "早上"; + } else if (hm < 1130) { + return "上午"; + } else if (hm < 1230) { + return "中午"; + } else if (hm < 1800) { + return "下午"; + } else { + return "晚上"; + } + }, + calendar : { + sameDay : '[今天]LT', + nextDay : '[明天]LT', + nextWeek : '[下]ddddLT', + lastDay : '[昨天]LT', + lastWeek : '[上]ddddLT', + sameElse : 'L' + }, + ordinal : function (number, period) { + switch (period) { + case "d" : + case "D" : + case "DDD" : + return number + "日"; + case "M" : + return number + "月"; + case "w" : + case "W" : + return number + "週"; + default : + return number; + } + }, + relativeTime : { + future : "%s內", + past : "%s前", + s : "幾秒", + m : "一分鐘", + mm : "%d分鐘", + h : "一小時", + hh : "%d小時", + d : "一天", + dd : "%d天", + M : "一個月", + MM : "%d個月", + y : "一年", + yy : "%d年" + } + }); +})); diff --git a/resources/lib/moment/moment.js b/resources/lib/moment/moment.js new file mode 100644 index 000000000000..b79da7f26046 --- /dev/null +++ b/resources/lib/moment/moment.js @@ -0,0 +1,2400 @@ +//! moment.js +//! version : 2.5.1 +//! authors : Tim Wood, Iskren Chernev, Moment.js contributors +//! license : MIT +//! momentjs.com + +(function (undefined) { + + /************************************ + Constants + ************************************/ + + var moment, + VERSION = "2.5.1", + global = this, + round = Math.round, + i, + + YEAR = 0, + MONTH = 1, + DATE = 2, + HOUR = 3, + MINUTE = 4, + SECOND = 5, + MILLISECOND = 6, + + // internal storage for language config files + languages = {}, + + // moment internal properties + momentProperties = { + _isAMomentObject: null, + _i : null, + _f : null, + _l : null, + _strict : null, + _isUTC : null, + _offset : null, // optional. Combine with _isUTC + _pf : null, + _lang : null // optional + }, + + // check for nodeJS + hasModule = (typeof module !== 'undefined' && module.exports && typeof require !== 'undefined'), + + // ASP.NET json date format regex + aspNetJsonRegex = /^\/?Date\((\-?\d+)/i, + aspNetTimeSpanJsonRegex = /(\-)?(?:(\d*)\.)?(\d+)\:(\d+)(?:\:(\d+)\.?(\d{3})?)?/, + + // from http://docs.closure-library.googlecode.com/git/closure_goog_date_date.js.source.html + // somewhat more in line with 4.4.3.2 2004 spec, but allows decimal anywhere + isoDurationRegex = /^(-)?P(?:(?:([0-9,.]*)Y)?(?:([0-9,.]*)M)?(?:([0-9,.]*)D)?(?:T(?:([0-9,.]*)H)?(?:([0-9,.]*)M)?(?:([0-9,.]*)S)?)?|([0-9,.]*)W)$/, + + // format tokens + formattingTokens = /(\[[^\[]*\])|(\\)?(Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|W[o|W]?|YYYYYY|YYYYY|YYYY|YY|gg(ggg?)?|GG(GGG?)?|e|E|a|A|hh?|HH?|mm?|ss?|S{1,4}|X|zz?|ZZ?|.)/g, + localFormattingTokens = /(\[[^\[]*\])|(\\)?(LT|LL?L?L?|l{1,4})/g, + + // parsing token regexes + parseTokenOneOrTwoDigits = /\d\d?/, // 0 - 99 + parseTokenOneToThreeDigits = /\d{1,3}/, // 0 - 999 + parseTokenOneToFourDigits = /\d{1,4}/, // 0 - 9999 + parseTokenOneToSixDigits = /[+\-]?\d{1,6}/, // -999,999 - 999,999 + parseTokenDigits = /\d+/, // nonzero number of digits + parseTokenWord = /[0-9]*['a-z\u00A0-\u05FF\u0700-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+|[\u0600-\u06FF\/]+(\s*?[\u0600-\u06FF]+){1,2}/i, // any word (or two) characters or numbers including two/three word month in arabic. + parseTokenTimezone = /Z|[\+\-]\d\d:?\d\d/gi, // +00:00 -00:00 +0000 -0000 or Z + parseTokenT = /T/i, // T (ISO separator) + parseTokenTimestampMs = /[\+\-]?\d+(\.\d{1,3})?/, // 123456789 123456789.123 + + //strict parsing regexes + parseTokenOneDigit = /\d/, // 0 - 9 + parseTokenTwoDigits = /\d\d/, // 00 - 99 + parseTokenThreeDigits = /\d{3}/, // 000 - 999 + parseTokenFourDigits = /\d{4}/, // 0000 - 9999 + parseTokenSixDigits = /[+-]?\d{6}/, // -999,999 - 999,999 + parseTokenSignedNumber = /[+-]?\d+/, // -inf - inf + + // iso 8601 regex + // 0000-00-00 0000-W00 or 0000-W00-0 + T + 00 or 00:00 or 00:00:00 or 00:00:00.000 + +00:00 or +0000 or +00) + isoRegex = /^\s*(?:[+-]\d{6}|\d{4})-(?:(\d\d-\d\d)|(W\d\d$)|(W\d\d-\d)|(\d\d\d))((T| )(\d\d(:\d\d(:\d\d(\.\d+)?)?)?)?([\+\-]\d\d(?::?\d\d)?|\s*Z)?)?$/, + + isoFormat = 'YYYY-MM-DDTHH:mm:ssZ', + + isoDates = [ + ['YYYYYY-MM-DD', /[+-]\d{6}-\d{2}-\d{2}/], + ['YYYY-MM-DD', /\d{4}-\d{2}-\d{2}/], + ['GGGG-[W]WW-E', /\d{4}-W\d{2}-\d/], + ['GGGG-[W]WW', /\d{4}-W\d{2}/], + ['YYYY-DDD', /\d{4}-\d{3}/] + ], + + // iso time formats and regexes + isoTimes = [ + ['HH:mm:ss.SSSS', /(T| )\d\d:\d\d:\d\d\.\d{1,3}/], + ['HH:mm:ss', /(T| )\d\d:\d\d:\d\d/], + ['HH:mm', /(T| )\d\d:\d\d/], + ['HH', /(T| )\d\d/] + ], + + // timezone chunker "+10:00" > ["10", "00"] or "-1530" > ["-15", "30"] + parseTimezoneChunker = /([\+\-]|\d\d)/gi, + + // getter and setter names + proxyGettersAndSetters = 'Date|Hours|Minutes|Seconds|Milliseconds'.split('|'), + unitMillisecondFactors = { + 'Milliseconds' : 1, + 'Seconds' : 1e3, + 'Minutes' : 6e4, + 'Hours' : 36e5, + 'Days' : 864e5, + 'Months' : 2592e6, + 'Years' : 31536e6 + }, + + unitAliases = { + ms : 'millisecond', + s : 'second', + m : 'minute', + h : 'hour', + d : 'day', + D : 'date', + w : 'week', + W : 'isoWeek', + M : 'month', + y : 'year', + DDD : 'dayOfYear', + e : 'weekday', + E : 'isoWeekday', + gg: 'weekYear', + GG: 'isoWeekYear' + }, + + camelFunctions = { + dayofyear : 'dayOfYear', + isoweekday : 'isoWeekday', + isoweek : 'isoWeek', + weekyear : 'weekYear', + isoweekyear : 'isoWeekYear' + }, + + // format function strings + formatFunctions = {}, + + // tokens to ordinalize and pad + ordinalizeTokens = 'DDD w W M D d'.split(' '), + paddedTokens = 'M D H h m s w W'.split(' '), + + formatTokenFunctions = { + M : function () { + return this.month() + 1; + }, + MMM : function (format) { + return this.lang().monthsShort(this, format); + }, + MMMM : function (format) { + return this.lang().months(this, format); + }, + D : function () { + return this.date(); + }, + DDD : function () { + return this.dayOfYear(); + }, + d : function () { + return this.day(); + }, + dd : function (format) { + return this.lang().weekdaysMin(this, format); + }, + ddd : function (format) { + return this.lang().weekdaysShort(this, format); + }, + dddd : function (format) { + return this.lang().weekdays(this, format); + }, + w : function () { + return this.week(); + }, + W : function () { + return this.isoWeek(); + }, + YY : function () { + return leftZeroFill(this.year() % 100, 2); + }, + YYYY : function () { + return leftZeroFill(this.year(), 4); + }, + YYYYY : function () { + return leftZeroFill(this.year(), 5); + }, + YYYYYY : function () { + var y = this.year(), sign = y >= 0 ? '+' : '-'; + return sign + leftZeroFill(Math.abs(y), 6); + }, + gg : function () { + return leftZeroFill(this.weekYear() % 100, 2); + }, + gggg : function () { + return leftZeroFill(this.weekYear(), 4); + }, + ggggg : function () { + return leftZeroFill(this.weekYear(), 5); + }, + GG : function () { + return leftZeroFill(this.isoWeekYear() % 100, 2); + }, + GGGG : function () { + return leftZeroFill(this.isoWeekYear(), 4); + }, + GGGGG : function () { + return leftZeroFill(this.isoWeekYear(), 5); + }, + e : function () { + return this.weekday(); + }, + E : function () { + return this.isoWeekday(); + }, + a : function () { + return this.lang().meridiem(this.hours(), this.minutes(), true); + }, + A : function () { + return this.lang().meridiem(this.hours(), this.minutes(), false); + }, + H : function () { + return this.hours(); + }, + h : function () { + return this.hours() % 12 || 12; + }, + m : function () { + return this.minutes(); + }, + s : function () { + return this.seconds(); + }, + S : function () { + return toInt(this.milliseconds() / 100); + }, + SS : function () { + return leftZeroFill(toInt(this.milliseconds() / 10), 2); + }, + SSS : function () { + return leftZeroFill(this.milliseconds(), 3); + }, + SSSS : function () { + return leftZeroFill(this.milliseconds(), 3); + }, + Z : function () { + var a = -this.zone(), + b = "+"; + if (a < 0) { + a = -a; + b = "-"; + } + return b + leftZeroFill(toInt(a / 60), 2) + ":" + leftZeroFill(toInt(a) % 60, 2); + }, + ZZ : function () { + var a = -this.zone(), + b = "+"; + if (a < 0) { + a = -a; + b = "-"; + } + return b + leftZeroFill(toInt(a / 60), 2) + leftZeroFill(toInt(a) % 60, 2); + }, + z : function () { + return this.zoneAbbr(); + }, + zz : function () { + return this.zoneName(); + }, + X : function () { + return this.unix(); + }, + Q : function () { + return this.quarter(); + } + }, + + lists = ['months', 'monthsShort', 'weekdays', 'weekdaysShort', 'weekdaysMin']; + + function defaultParsingFlags() { + // We need to deep clone this object, and es5 standard is not very + // helpful. + return { + empty : false, + unusedTokens : [], + unusedInput : [], + overflow : -2, + charsLeftOver : 0, + nullInput : false, + invalidMonth : null, + invalidFormat : false, + userInvalidated : false, + iso: false + }; + } + + function padToken(func, count) { + return function (a) { + return leftZeroFill(func.call(this, a), count); + }; + } + function ordinalizeToken(func, period) { + return function (a) { + return this.lang().ordinal(func.call(this, a), period); + }; + } + + while (ordinalizeTokens.length) { + i = ordinalizeTokens.pop(); + formatTokenFunctions[i + 'o'] = ordinalizeToken(formatTokenFunctions[i], i); + } + while (paddedTokens.length) { + i = paddedTokens.pop(); + formatTokenFunctions[i + i] = padToken(formatTokenFunctions[i], 2); + } + formatTokenFunctions.DDDD = padToken(formatTokenFunctions.DDD, 3); + + + /************************************ + Constructors + ************************************/ + + function Language() { + + } + + // Moment prototype object + function Moment(config) { + checkOverflow(config); + extend(this, config); + } + + // Duration Constructor + function Duration(duration) { + var normalizedInput = normalizeObjectUnits(duration), + years = normalizedInput.year || 0, + months = normalizedInput.month || 0, + weeks = normalizedInput.week || 0, + days = normalizedInput.day || 0, + hours = normalizedInput.hour || 0, + minutes = normalizedInput.minute || 0, + seconds = normalizedInput.second || 0, + milliseconds = normalizedInput.millisecond || 0; + + // representation for dateAddRemove + this._milliseconds = +milliseconds + + seconds * 1e3 + // 1000 + minutes * 6e4 + // 1000 * 60 + hours * 36e5; // 1000 * 60 * 60 + // Because of dateAddRemove treats 24 hours as different from a + // day when working around DST, we need to store them separately + this._days = +days + + weeks * 7; + // It is impossible translate months into days without knowing + // which months you are are talking about, so we have to store + // it separately. + this._months = +months + + years * 12; + + this._data = {}; + + this._bubble(); + } + + /************************************ + Helpers + ************************************/ + + + function extend(a, b) { + for (var i in b) { + if (b.hasOwnProperty(i)) { + a[i] = b[i]; + } + } + + if (b.hasOwnProperty("toString")) { + a.toString = b.toString; + } + + if (b.hasOwnProperty("valueOf")) { + a.valueOf = b.valueOf; + } + + return a; + } + + function cloneMoment(m) { + var result = {}, i; + for (i in m) { + if (m.hasOwnProperty(i) && momentProperties.hasOwnProperty(i)) { + result[i] = m[i]; + } + } + + return result; + } + + function absRound(number) { + if (number < 0) { + return Math.ceil(number); + } else { + return Math.floor(number); + } + } + + // left zero fill a number + // see http://jsperf.com/left-zero-filling for performance comparison + function leftZeroFill(number, targetLength, forceSign) { + var output = '' + Math.abs(number), + sign = number >= 0; + + while (output.length < targetLength) { + output = '0' + output; + } + return (sign ? (forceSign ? '+' : '') : '-') + output; + } + + // helper function for _.addTime and _.subtractTime + function addOrSubtractDurationFromMoment(mom, duration, isAdding, ignoreUpdateOffset) { + var milliseconds = duration._milliseconds, + days = duration._days, + months = duration._months, + minutes, + hours; + + if (milliseconds) { + mom._d.setTime(+mom._d + milliseconds * isAdding); + } + // store the minutes and hours so we can restore them + if (days || months) { + minutes = mom.minute(); + hours = mom.hour(); + } + if (days) { + mom.date(mom.date() + days * isAdding); + } + if (months) { + mom.month(mom.month() + months * isAdding); + } + if (milliseconds && !ignoreUpdateOffset) { + moment.updateOffset(mom); + } + // restore the minutes and hours after possibly changing dst + if (days || months) { + mom.minute(minutes); + mom.hour(hours); + } + } + + // check if is an array + function isArray(input) { + return Object.prototype.toString.call(input) === '[object Array]'; + } + + function isDate(input) { + return Object.prototype.toString.call(input) === '[object Date]' || + input instanceof Date; + } + + // compare two arrays, return the number of differences + function compareArrays(array1, array2, dontConvert) { + var len = Math.min(array1.length, array2.length), + lengthDiff = Math.abs(array1.length - array2.length), + diffs = 0, + i; + for (i = 0; i < len; i++) { + if ((dontConvert && array1[i] !== array2[i]) || + (!dontConvert && toInt(array1[i]) !== toInt(array2[i]))) { + diffs++; + } + } + return diffs + lengthDiff; + } + + function normalizeUnits(units) { + if (units) { + var lowered = units.toLowerCase().replace(/(.)s$/, '$1'); + units = unitAliases[units] || camelFunctions[lowered] || lowered; + } + return units; + } + + function normalizeObjectUnits(inputObject) { + var normalizedInput = {}, + normalizedProp, + prop; + + for (prop in inputObject) { + if (inputObject.hasOwnProperty(prop)) { + normalizedProp = normalizeUnits(prop); + if (normalizedProp) { + normalizedInput[normalizedProp] = inputObject[prop]; + } + } + } + + return normalizedInput; + } + + function makeList(field) { + var count, setter; + + if (field.indexOf('week') === 0) { + count = 7; + setter = 'day'; + } + else if (field.indexOf('month') === 0) { + count = 12; + setter = 'month'; + } + else { + return; + } + + moment[field] = function (format, index) { + var i, getter, + method = moment.fn._lang[field], + results = []; + + if (typeof format === 'number') { + index = format; + format = undefined; + } + + getter = function (i) { + var m = moment().utc().set(setter, i); + return method.call(moment.fn._lang, m, format || ''); + }; + + if (index != null) { + return getter(index); + } + else { + for (i = 0; i < count; i++) { + results.push(getter(i)); + } + return results; + } + }; + } + + function toInt(argumentForCoercion) { + var coercedNumber = +argumentForCoercion, + value = 0; + + if (coercedNumber !== 0 && isFinite(coercedNumber)) { + if (coercedNumber >= 0) { + value = Math.floor(coercedNumber); + } else { + value = Math.ceil(coercedNumber); + } + } + + return value; + } + + function daysInMonth(year, month) { + return new Date(Date.UTC(year, month + 1, 0)).getUTCDate(); + } + + function daysInYear(year) { + return isLeapYear(year) ? 366 : 365; + } + + function isLeapYear(year) { + return (year % 4 === 0 && year % 100 !== 0) || year % 400 === 0; + } + + function checkOverflow(m) { + var overflow; + if (m._a && m._pf.overflow === -2) { + overflow = + m._a[MONTH] < 0 || m._a[MONTH] > 11 ? MONTH : + m._a[DATE] < 1 || m._a[DATE] > daysInMonth(m._a[YEAR], m._a[MONTH]) ? DATE : + m._a[HOUR] < 0 || m._a[HOUR] > 23 ? HOUR : + m._a[MINUTE] < 0 || m._a[MINUTE] > 59 ? MINUTE : + m._a[SECOND] < 0 || m._a[SECOND] > 59 ? SECOND : + m._a[MILLISECOND] < 0 || m._a[MILLISECOND] > 999 ? MILLISECOND : + -1; + + if (m._pf._overflowDayOfYear && (overflow < YEAR || overflow > DATE)) { + overflow = DATE; + } + + m._pf.overflow = overflow; + } + } + + function isValid(m) { + if (m._isValid == null) { + m._isValid = !isNaN(m._d.getTime()) && + m._pf.overflow < 0 && + !m._pf.empty && + !m._pf.invalidMonth && + !m._pf.nullInput && + !m._pf.invalidFormat && + !m._pf.userInvalidated; + + if (m._strict) { + m._isValid = m._isValid && + m._pf.charsLeftOver === 0 && + m._pf.unusedTokens.length === 0; + } + } + return m._isValid; + } + + function normalizeLanguage(key) { + return key ? key.toLowerCase().replace('_', '-') : key; + } + + // Return a moment from input, that is local/utc/zone equivalent to model. + function makeAs(input, model) { + return model._isUTC ? moment(input).zone(model._offset || 0) : + moment(input).local(); + } + + /************************************ + Languages + ************************************/ + + + extend(Language.prototype, { + + set : function (config) { + var prop, i; + for (i in config) { + prop = config[i]; + if (typeof prop === 'function') { + this[i] = prop; + } else { + this['_' + i] = prop; + } + } + }, + + _months : "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), + months : function (m) { + return this._months[m.month()]; + }, + + _monthsShort : "Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec".split("_"), + monthsShort : function (m) { + return this._monthsShort[m.month()]; + }, + + monthsParse : function (monthName) { + var i, mom, regex; + + if (!this._monthsParse) { + this._monthsParse = []; + } + + for (i = 0; i < 12; i++) { + // make the regex if we don't have it already + if (!this._monthsParse[i]) { + mom = moment.utc([2000, i]); + regex = '^' + this.months(mom, '') + '|^' + this.monthsShort(mom, ''); + this._monthsParse[i] = new RegExp(regex.replace('.', ''), 'i'); + } + // test the regex + if (this._monthsParse[i].test(monthName)) { + return i; + } + } + }, + + _weekdays : "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), + weekdays : function (m) { + return this._weekdays[m.day()]; + }, + + _weekdaysShort : "Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"), + weekdaysShort : function (m) { + return this._weekdaysShort[m.day()]; + }, + + _weekdaysMin : "Su_Mo_Tu_We_Th_Fr_Sa".split("_"), + weekdaysMin : function (m) { + return this._weekdaysMin[m.day()]; + }, + + weekdaysParse : function (weekdayName) { + var i, mom, regex; + + if (!this._weekdaysParse) { + this._weekdaysParse = []; + } + + for (i = 0; i < 7; i++) { + // make the regex if we don't have it already + if (!this._weekdaysParse[i]) { + mom = moment([2000, 1]).day(i); + regex = '^' + this.weekdays(mom, '') + '|^' + this.weekdaysShort(mom, '') + '|^' + this.weekdaysMin(mom, ''); + this._weekdaysParse[i] = new RegExp(regex.replace('.', ''), 'i'); + } + // test the regex + if (this._weekdaysParse[i].test(weekdayName)) { + return i; + } + } + }, + + _longDateFormat : { + LT : "h:mm A", + L : "MM/DD/YYYY", + LL : "MMMM D YYYY", + LLL : "MMMM D YYYY LT", + LLLL : "dddd, MMMM D YYYY LT" + }, + longDateFormat : function (key) { + var output = this._longDateFormat[key]; + if (!output && this._longDateFormat[key.toUpperCase()]) { + output = this._longDateFormat[key.toUpperCase()].replace(/MMMM|MM|DD|dddd/g, function (val) { + return val.slice(1); + }); + this._longDateFormat[key] = output; + } + return output; + }, + + isPM : function (input) { + // IE8 Quirks Mode & IE7 Standards Mode do not allow accessing strings like arrays + // Using charAt should be more compatible. + return ((input + '').toLowerCase().charAt(0) === 'p'); + }, + + _meridiemParse : /[ap]\.?m?\.?/i, + meridiem : function (hours, minutes, isLower) { + if (hours > 11) { + return isLower ? 'pm' : 'PM'; + } else { + return isLower ? 'am' : 'AM'; + } + }, + + _calendar : { + sameDay : '[Today at] LT', + nextDay : '[Tomorrow at] LT', + nextWeek : 'dddd [at] LT', + lastDay : '[Yesterday at] LT', + lastWeek : '[Last] dddd [at] LT', + sameElse : 'L' + }, + calendar : function (key, mom) { + var output = this._calendar[key]; + return typeof output === 'function' ? output.apply(mom) : output; + }, + + _relativeTime : { + future : "in %s", + past : "%s ago", + s : "a few seconds", + m : "a minute", + mm : "%d minutes", + h : "an hour", + hh : "%d hours", + d : "a day", + dd : "%d days", + M : "a month", + MM : "%d months", + y : "a year", + yy : "%d years" + }, + relativeTime : function (number, withoutSuffix, string, isFuture) { + var output = this._relativeTime[string]; + return (typeof output === 'function') ? + output(number, withoutSuffix, string, isFuture) : + output.replace(/%d/i, number); + }, + pastFuture : function (diff, output) { + var format = this._relativeTime[diff > 0 ? 'future' : 'past']; + return typeof format === 'function' ? format(output) : format.replace(/%s/i, output); + }, + + ordinal : function (number) { + return this._ordinal.replace("%d", number); + }, + _ordinal : "%d", + + preparse : function (string) { + return string; + }, + + postformat : function (string) { + return string; + }, + + week : function (mom) { + return weekOfYear(mom, this._week.dow, this._week.doy).week; + }, + + _week : { + dow : 0, // Sunday is the first day of the week. + doy : 6 // The week that contains Jan 1st is the first week of the year. + }, + + _invalidDate: 'Invalid date', + invalidDate: function () { + return this._invalidDate; + } + }); + + // Loads a language definition into the `languages` cache. The function + // takes a key and optionally values. If not in the browser and no values + // are provided, it will load the language file module. As a convenience, + // this function also returns the language values. + function loadLang(key, values) { + values.abbr = key; + if (!languages[key]) { + languages[key] = new Language(); + } + languages[key].set(values); + return languages[key]; + } + + // Remove a language from the `languages` cache. Mostly useful in tests. + function unloadLang(key) { + delete languages[key]; + } + + // Determines which language definition to use and returns it. + // + // With no parameters, it will return the global language. If you + // pass in a language key, such as 'en', it will return the + // definition for 'en', so long as 'en' has already been loaded using + // moment.lang. + function getLangDefinition(key) { + var i = 0, j, lang, next, split, + get = function (k) { + if (!languages[k] && hasModule) { + try { + require('./lang/' + k); + } catch (e) { } + } + return languages[k]; + }; + + if (!key) { + return moment.fn._lang; + } + + if (!isArray(key)) { + //short-circuit everything else + lang = get(key); + if (lang) { + return lang; + } + key = [key]; + } + + //pick the language from the array + //try ['en-au', 'en-gb'] as 'en-au', 'en-gb', 'en', as in move through the list trying each + //substring from most specific to least, but move to the next array item if it's a more specific variant than the current root + while (i < key.length) { + split = normalizeLanguage(key[i]).split('-'); + j = split.length; + next = normalizeLanguage(key[i + 1]); + next = next ? next.split('-') : null; + while (j > 0) { + lang = get(split.slice(0, j).join('-')); + if (lang) { + return lang; + } + if (next && next.length >= j && compareArrays(split, next, true) >= j - 1) { + //the next array item is better than a shallower substring of this one + break; + } + j--; + } + i++; + } + return moment.fn._lang; + } + + /************************************ + Formatting + ************************************/ + + + function removeFormattingTokens(input) { + if (input.match(/\[[\s\S]/)) { + return input.replace(/^\[|\]$/g, ""); + } + return input.replace(/\\/g, ""); + } + + function makeFormatFunction(format) { + var array = format.match(formattingTokens), i, length; + + for (i = 0, length = array.length; i < length; i++) { + if (formatTokenFunctions[array[i]]) { + array[i] = formatTokenFunctions[array[i]]; + } else { + array[i] = removeFormattingTokens(array[i]); + } + } + + return function (mom) { + var output = ""; + for (i = 0; i < length; i++) { + output += array[i] instanceof Function ? array[i].call(mom, format) : array[i]; + } + return output; + }; + } + + // format date using native date object + function formatMoment(m, format) { + + if (!m.isValid()) { + return m.lang().invalidDate(); + } + + format = expandFormat(format, m.lang()); + + if (!formatFunctions[format]) { + formatFunctions[format] = makeFormatFunction(format); + } + + return formatFunctions[format](m); + } + + function expandFormat(format, lang) { + var i = 5; + + function replaceLongDateFormatTokens(input) { + return lang.longDateFormat(input) || input; + } + + localFormattingTokens.lastIndex = 0; + while (i >= 0 && localFormattingTokens.test(format)) { + format = format.replace(localFormattingTokens, replaceLongDateFormatTokens); + localFormattingTokens.lastIndex = 0; + i -= 1; + } + + return format; + } + + + /************************************ + Parsing + ************************************/ + + + // get the regex to find the next token + function getParseRegexForToken(token, config) { + var a, strict = config._strict; + switch (token) { + case 'DDDD': + return parseTokenThreeDigits; + case 'YYYY': + case 'GGGG': + case 'gggg': + return strict ? parseTokenFourDigits : parseTokenOneToFourDigits; + case 'Y': + case 'G': + case 'g': + return parseTokenSignedNumber; + case 'YYYYYY': + case 'YYYYY': + case 'GGGGG': + case 'ggggg': + return strict ? parseTokenSixDigits : parseTokenOneToSixDigits; + case 'S': + if (strict) { return parseTokenOneDigit; } + /* falls through */ + case 'SS': + if (strict) { return parseTokenTwoDigits; } + /* falls through */ + case 'SSS': + if (strict) { return parseTokenThreeDigits; } + /* falls through */ + case 'DDD': + return parseTokenOneToThreeDigits; + case 'MMM': + case 'MMMM': + case 'dd': + case 'ddd': + case 'dddd': + return parseTokenWord; + case 'a': + case 'A': + return getLangDefinition(config._l)._meridiemParse; + case 'X': + return parseTokenTimestampMs; + case 'Z': + case 'ZZ': + return parseTokenTimezone; + case 'T': + return parseTokenT; + case 'SSSS': + return parseTokenDigits; + case 'MM': + case 'DD': + case 'YY': + case 'GG': + case 'gg': + case 'HH': + case 'hh': + case 'mm': + case 'ss': + case 'ww': + case 'WW': + return strict ? parseTokenTwoDigits : parseTokenOneOrTwoDigits; + case 'M': + case 'D': + case 'd': + case 'H': + case 'h': + case 'm': + case 's': + case 'w': + case 'W': + case 'e': + case 'E': + return parseTokenOneOrTwoDigits; + default : + a = new RegExp(regexpEscape(unescapeFormat(token.replace('\\', '')), "i")); + return a; + } + } + + function timezoneMinutesFromString(string) { + string = string || ""; + var possibleTzMatches = (string.match(parseTokenTimezone) || []), + tzChunk = possibleTzMatches[possibleTzMatches.length - 1] || [], + parts = (tzChunk + '').match(parseTimezoneChunker) || ['-', 0, 0], + minutes = +(parts[1] * 60) + toInt(parts[2]); + + return parts[0] === '+' ? -minutes : minutes; + } + + // function to convert string input to date + function addTimeToArrayFromToken(token, input, config) { + var a, datePartArray = config._a; + + switch (token) { + // MONTH + case 'M' : // fall through to MM + case 'MM' : + if (input != null) { + datePartArray[MONTH] = toInt(input) - 1; + } + break; + case 'MMM' : // fall through to MMMM + case 'MMMM' : + a = getLangDefinition(config._l).monthsParse(input); + // if we didn't find a month name, mark the date as invalid. + if (a != null) { + datePartArray[MONTH] = a; + } else { + config._pf.invalidMonth = input; + } + break; + // DAY OF MONTH + case 'D' : // fall through to DD + case 'DD' : + if (input != null) { + datePartArray[DATE] = toInt(input); + } + break; + // DAY OF YEAR + case 'DDD' : // fall through to DDDD + case 'DDDD' : + if (input != null) { + config._dayOfYear = toInt(input); + } + + break; + // YEAR + case 'YY' : + datePartArray[YEAR] = toInt(input) + (toInt(input) > 68 ? 1900 : 2000); + break; + case 'YYYY' : + case 'YYYYY' : + case 'YYYYYY' : + datePartArray[YEAR] = toInt(input); + break; + // AM / PM + case 'a' : // fall through to A + case 'A' : + config._isPm = getLangDefinition(config._l).isPM(input); + break; + // 24 HOUR + case 'H' : // fall through to hh + case 'HH' : // fall through to hh + case 'h' : // fall through to hh + case 'hh' : + datePartArray[HOUR] = toInt(input); + break; + // MINUTE + case 'm' : // fall through to mm + case 'mm' : + datePartArray[MINUTE] = toInt(input); + break; + // SECOND + case 's' : // fall through to ss + case 'ss' : + datePartArray[SECOND] = toInt(input); + break; + // MILLISECOND + case 'S' : + case 'SS' : + case 'SSS' : + case 'SSSS' : + datePartArray[MILLISECOND] = toInt(('0.' + input) * 1000); + break; + // UNIX TIMESTAMP WITH MS + case 'X': + config._d = new Date(parseFloat(input) * 1000); + break; + // TIMEZONE + case 'Z' : // fall through to ZZ + case 'ZZ' : + config._useUTC = true; + config._tzm = timezoneMinutesFromString(input); + break; + case 'w': + case 'ww': + case 'W': + case 'WW': + case 'd': + case 'dd': + case 'ddd': + case 'dddd': + case 'e': + case 'E': + token = token.substr(0, 1); + /* falls through */ + case 'gg': + case 'gggg': + case 'GG': + case 'GGGG': + case 'GGGGG': + token = token.substr(0, 2); + if (input) { + config._w = config._w || {}; + config._w[token] = input; + } + break; + } + } + + // convert an array to a date. + // the array should mirror the parameters below + // note: all values past the year are optional and will default to the lowest possible value. + // [year, month, day , hour, minute, second, millisecond] + function dateFromConfig(config) { + var i, date, input = [], currentDate, + yearToUse, fixYear, w, temp, lang, weekday, week; + + if (config._d) { + return; + } + + currentDate = currentDateArray(config); + + //compute day of the year from weeks and weekdays + if (config._w && config._a[DATE] == null && config._a[MONTH] == null) { + fixYear = function (val) { + var int_val = parseInt(val, 10); + return val ? + (val.length < 3 ? (int_val > 68 ? 1900 + int_val : 2000 + int_val) : int_val) : + (config._a[YEAR] == null ? moment().weekYear() : config._a[YEAR]); + }; + + w = config._w; + if (w.GG != null || w.W != null || w.E != null) { + temp = dayOfYearFromWeeks(fixYear(w.GG), w.W || 1, w.E, 4, 1); + } + else { + lang = getLangDefinition(config._l); + weekday = w.d != null ? parseWeekday(w.d, lang) : + (w.e != null ? parseInt(w.e, 10) + lang._week.dow : 0); + + week = parseInt(w.w, 10) || 1; + + //if we're parsing 'd', then the low day numbers may be next week + if (w.d != null && weekday < lang._week.dow) { + week++; + } + + temp = dayOfYearFromWeeks(fixYear(w.gg), week, weekday, lang._week.doy, lang._week.dow); + } + + config._a[YEAR] = temp.year; + config._dayOfYear = temp.dayOfYear; + } + + //if the day of the year is set, figure out what it is + if (config._dayOfYear) { + yearToUse = config._a[YEAR] == null ? currentDate[YEAR] : config._a[YEAR]; + + if (config._dayOfYear > daysInYear(yearToUse)) { + config._pf._overflowDayOfYear = true; + } + + date = makeUTCDate(yearToUse, 0, config._dayOfYear); + config._a[MONTH] = date.getUTCMonth(); + config._a[DATE] = date.getUTCDate(); + } + + // Default to current date. + // * if no year, month, day of month are given, default to today + // * if day of month is given, default month and year + // * if month is given, default only year + // * if year is given, don't default anything + for (i = 0; i < 3 && config._a[i] == null; ++i) { + config._a[i] = input[i] = currentDate[i]; + } + + // Zero out whatever was not defaulted, including time + for (; i < 7; i++) { + config._a[i] = input[i] = (config._a[i] == null) ? (i === 2 ? 1 : 0) : config._a[i]; + } + + // add the offsets to the time to be parsed so that we can have a clean array for checking isValid + input[HOUR] += toInt((config._tzm || 0) / 60); + input[MINUTE] += toInt((config._tzm || 0) % 60); + + config._d = (config._useUTC ? makeUTCDate : makeDate).apply(null, input); + } + + function dateFromObject(config) { + var normalizedInput; + + if (config._d) { + return; + } + + normalizedInput = normalizeObjectUnits(config._i); + config._a = [ + normalizedInput.year, + normalizedInput.month, + normalizedInput.day, + normalizedInput.hour, + normalizedInput.minute, + normalizedInput.second, + normalizedInput.millisecond + ]; + + dateFromConfig(config); + } + + function currentDateArray(config) { + var now = new Date(); + if (config._useUTC) { + return [ + now.getUTCFullYear(), + now.getUTCMonth(), + now.getUTCDate() + ]; + } else { + return [now.getFullYear(), now.getMonth(), now.getDate()]; + } + } + + // date from string and format string + function makeDateFromStringAndFormat(config) { + + config._a = []; + config._pf.empty = true; + + // This array is used to make a Date, either with `new Date` or `Date.UTC` + var lang = getLangDefinition(config._l), + string = '' + config._i, + i, parsedInput, tokens, token, skipped, + stringLength = string.length, + totalParsedInputLength = 0; + + tokens = expandFormat(config._f, lang).match(formattingTokens) || []; + + for (i = 0; i < tokens.length; i++) { + token = tokens[i]; + parsedInput = (string.match(getParseRegexForToken(token, config)) || [])[0]; + if (parsedInput) { + skipped = string.substr(0, string.indexOf(parsedInput)); + if (skipped.length > 0) { + config._pf.unusedInput.push(skipped); + } + string = string.slice(string.indexOf(parsedInput) + parsedInput.length); + totalParsedInputLength += parsedInput.length; + } + // don't parse if it's not a known token + if (formatTokenFunctions[token]) { + if (parsedInput) { + config._pf.empty = false; + } + else { + config._pf.unusedTokens.push(token); + } + addTimeToArrayFromToken(token, parsedInput, config); + } + else if (config._strict && !parsedInput) { + config._pf.unusedTokens.push(token); + } + } + + // add remaining unparsed input length to the string + config._pf.charsLeftOver = stringLength - totalParsedInputLength; + if (string.length > 0) { + config._pf.unusedInput.push(string); + } + + // handle am pm + if (config._isPm && config._a[HOUR] < 12) { + config._a[HOUR] += 12; + } + // if is 12 am, change hours to 0 + if (config._isPm === false && config._a[HOUR] === 12) { + config._a[HOUR] = 0; + } + + dateFromConfig(config); + checkOverflow(config); + } + + function unescapeFormat(s) { + return s.replace(/\\(\[)|\\(\])|\[([^\]\[]*)\]|\\(.)/g, function (matched, p1, p2, p3, p4) { + return p1 || p2 || p3 || p4; + }); + } + + // Code from http://stackoverflow.com/questions/3561493/is-there-a-regexp-escape-function-in-javascript + function regexpEscape(s) { + return s.replace(/[-\/\\^$*+?.()|[\]{}]/g, '\\$&'); + } + + // date from string and array of format strings + function makeDateFromStringAndArray(config) { + var tempConfig, + bestMoment, + + scoreToBeat, + i, + currentScore; + + if (config._f.length === 0) { + config._pf.invalidFormat = true; + config._d = new Date(NaN); + return; + } + + for (i = 0; i < config._f.length; i++) { + currentScore = 0; + tempConfig = extend({}, config); + tempConfig._pf = defaultParsingFlags(); + tempConfig._f = config._f[i]; + makeDateFromStringAndFormat(tempConfig); + + if (!isValid(tempConfig)) { + continue; + } + + // if there is any input that was not parsed add a penalty for that format + currentScore += tempConfig._pf.charsLeftOver; + + //or tokens + currentScore += tempConfig._pf.unusedTokens.length * 10; + + tempConfig._pf.score = currentScore; + + if (scoreToBeat == null || currentScore < scoreToBeat) { + scoreToBeat = currentScore; + bestMoment = tempConfig; + } + } + + extend(config, bestMoment || tempConfig); + } + + // date from iso format + function makeDateFromString(config) { + var i, l, + string = config._i, + match = isoRegex.exec(string); + + if (match) { + config._pf.iso = true; + for (i = 0, l = isoDates.length; i < l; i++) { + if (isoDates[i][1].exec(string)) { + // match[5] should be "T" or undefined + config._f = isoDates[i][0] + (match[6] || " "); + break; + } + } + for (i = 0, l = isoTimes.length; i < l; i++) { + if (isoTimes[i][1].exec(string)) { + config._f += isoTimes[i][0]; + break; + } + } + if (string.match(parseTokenTimezone)) { + config._f += "Z"; + } + makeDateFromStringAndFormat(config); + } + else { + config._d = new Date(string); + } + } + + function makeDateFromInput(config) { + var input = config._i, + matched = aspNetJsonRegex.exec(input); + + if (input === undefined) { + config._d = new Date(); + } else if (matched) { + config._d = new Date(+matched[1]); + } else if (typeof input === 'string') { + makeDateFromString(config); + } else if (isArray(input)) { + config._a = input.slice(0); + dateFromConfig(config); + } else if (isDate(input)) { + config._d = new Date(+input); + } else if (typeof(input) === 'object') { + dateFromObject(config); + } else { + config._d = new Date(input); + } + } + + function makeDate(y, m, d, h, M, s, ms) { + //can't just apply() to create a date: + //http://stackoverflow.com/questions/181348/instantiating-a-javascript-object-by-calling-prototype-constructor-apply + var date = new Date(y, m, d, h, M, s, ms); + + //the date constructor doesn't accept years < 1970 + if (y < 1970) { + date.setFullYear(y); + } + return date; + } + + function makeUTCDate(y) { + var date = new Date(Date.UTC.apply(null, arguments)); + if (y < 1970) { + date.setUTCFullYear(y); + } + return date; + } + + function parseWeekday(input, language) { + if (typeof input === 'string') { + if (!isNaN(input)) { + input = parseInt(input, 10); + } + else { + input = language.weekdaysParse(input); + if (typeof input !== 'number') { + return null; + } + } + } + return input; + } + + /************************************ + Relative Time + ************************************/ + + + // helper function for moment.fn.from, moment.fn.fromNow, and moment.duration.fn.humanize + function substituteTimeAgo(string, number, withoutSuffix, isFuture, lang) { + return lang.relativeTime(number || 1, !!withoutSuffix, string, isFuture); + } + + function relativeTime(milliseconds, withoutSuffix, lang) { + var seconds = round(Math.abs(milliseconds) / 1000), + minutes = round(seconds / 60), + hours = round(minutes / 60), + days = round(hours / 24), + years = round(days / 365), + args = seconds < 45 && ['s', seconds] || + minutes === 1 && ['m'] || + minutes < 45 && ['mm', minutes] || + hours === 1 && ['h'] || + hours < 22 && ['hh', hours] || + days === 1 && ['d'] || + days <= 25 && ['dd', days] || + days <= 45 && ['M'] || + days < 345 && ['MM', round(days / 30)] || + years === 1 && ['y'] || ['yy', years]; + args[2] = withoutSuffix; + args[3] = milliseconds > 0; + args[4] = lang; + return substituteTimeAgo.apply({}, args); + } + + + /************************************ + Week of Year + ************************************/ + + + // firstDayOfWeek 0 = sun, 6 = sat + // the day of the week that starts the week + // (usually sunday or monday) + // firstDayOfWeekOfYear 0 = sun, 6 = sat + // the first week is the week that contains the first + // of this day of the week + // (eg. ISO weeks use thursday (4)) + function weekOfYear(mom, firstDayOfWeek, firstDayOfWeekOfYear) { + var end = firstDayOfWeekOfYear - firstDayOfWeek, + daysToDayOfWeek = firstDayOfWeekOfYear - mom.day(), + adjustedMoment; + + + if (daysToDayOfWeek > end) { + daysToDayOfWeek -= 7; + } + + if (daysToDayOfWeek < end - 7) { + daysToDayOfWeek += 7; + } + + adjustedMoment = moment(mom).add('d', daysToDayOfWeek); + return { + week: Math.ceil(adjustedMoment.dayOfYear() / 7), + year: adjustedMoment.year() + }; + } + + //http://en.wikipedia.org/wiki/ISO_week_date#Calculating_a_date_given_the_year.2C_week_number_and_weekday + function dayOfYearFromWeeks(year, week, weekday, firstDayOfWeekOfYear, firstDayOfWeek) { + var d = makeUTCDate(year, 0, 1).getUTCDay(), daysToAdd, dayOfYear; + + weekday = weekday != null ? weekday : firstDayOfWeek; + daysToAdd = firstDayOfWeek - d + (d > firstDayOfWeekOfYear ? 7 : 0) - (d < firstDayOfWeek ? 7 : 0); + dayOfYear = 7 * (week - 1) + (weekday - firstDayOfWeek) + daysToAdd + 1; + + return { + year: dayOfYear > 0 ? year : year - 1, + dayOfYear: dayOfYear > 0 ? dayOfYear : daysInYear(year - 1) + dayOfYear + }; + } + + /************************************ + Top Level Functions + ************************************/ + + function makeMoment(config) { + var input = config._i, + format = config._f; + + if (input === null) { + return moment.invalid({nullInput: true}); + } + + if (typeof input === 'string') { + config._i = input = getLangDefinition().preparse(input); + } + + if (moment.isMoment(input)) { + config = cloneMoment(input); + + config._d = new Date(+input._d); + } else if (format) { + if (isArray(format)) { + makeDateFromStringAndArray(config); + } else { + makeDateFromStringAndFormat(config); + } + } else { + makeDateFromInput(config); + } + + return new Moment(config); + } + + moment = function (input, format, lang, strict) { + var c; + + if (typeof(lang) === "boolean") { + strict = lang; + lang = undefined; + } + // object construction must be done this way. + // https://github.com/moment/moment/issues/1423 + c = {}; + c._isAMomentObject = true; + c._i = input; + c._f = format; + c._l = lang; + c._strict = strict; + c._isUTC = false; + c._pf = defaultParsingFlags(); + + return makeMoment(c); + }; + + // creating with utc + moment.utc = function (input, format, lang, strict) { + var c; + + if (typeof(lang) === "boolean") { + strict = lang; + lang = undefined; + } + // object construction must be done this way. + // https://github.com/moment/moment/issues/1423 + c = {}; + c._isAMomentObject = true; + c._useUTC = true; + c._isUTC = true; + c._l = lang; + c._i = input; + c._f = format; + c._strict = strict; + c._pf = defaultParsingFlags(); + + return makeMoment(c).utc(); + }; + + // creating with unix timestamp (in seconds) + moment.unix = function (input) { + return moment(input * 1000); + }; + + // duration + moment.duration = function (input, key) { + var duration = input, + // matching against regexp is expensive, do it on demand + match = null, + sign, + ret, + parseIso; + + if (moment.isDuration(input)) { + duration = { + ms: input._milliseconds, + d: input._days, + M: input._months + }; + } else if (typeof input === 'number') { + duration = {}; + if (key) { + duration[key] = input; + } else { + duration.milliseconds = input; + } + } else if (!!(match = aspNetTimeSpanJsonRegex.exec(input))) { + sign = (match[1] === "-") ? -1 : 1; + duration = { + y: 0, + d: toInt(match[DATE]) * sign, + h: toInt(match[HOUR]) * sign, + m: toInt(match[MINUTE]) * sign, + s: toInt(match[SECOND]) * sign, + ms: toInt(match[MILLISECOND]) * sign + }; + } else if (!!(match = isoDurationRegex.exec(input))) { + sign = (match[1] === "-") ? -1 : 1; + parseIso = function (inp) { + // We'd normally use ~~inp for this, but unfortunately it also + // converts floats to ints. + // inp may be undefined, so careful calling replace on it. + var res = inp && parseFloat(inp.replace(',', '.')); + // apply sign while we're at it + return (isNaN(res) ? 0 : res) * sign; + }; + duration = { + y: parseIso(match[2]), + M: parseIso(match[3]), + d: parseIso(match[4]), + h: parseIso(match[5]), + m: parseIso(match[6]), + s: parseIso(match[7]), + w: parseIso(match[8]) + }; + } + + ret = new Duration(duration); + + if (moment.isDuration(input) && input.hasOwnProperty('_lang')) { + ret._lang = input._lang; + } + + return ret; + }; + + // version number + moment.version = VERSION; + + // default format + moment.defaultFormat = isoFormat; + + // This function will be called whenever a moment is mutated. + // It is intended to keep the offset in sync with the timezone. + moment.updateOffset = function () {}; + + // This function will load languages and then set the global language. If + // no arguments are passed in, it will simply return the current global + // language key. + moment.lang = function (key, values) { + var r; + if (!key) { + return moment.fn._lang._abbr; + } + if (values) { + loadLang(normalizeLanguage(key), values); + } else if (values === null) { + unloadLang(key); + key = 'en'; + } else if (!languages[key]) { + getLangDefinition(key); + } + r = moment.duration.fn._lang = moment.fn._lang = getLangDefinition(key); + return r._abbr; + }; + + // returns language data + moment.langData = function (key) { + if (key && key._lang && key._lang._abbr) { + key = key._lang._abbr; + } + return getLangDefinition(key); + }; + + // compare moment object + moment.isMoment = function (obj) { + return obj instanceof Moment || + (obj != null && obj.hasOwnProperty('_isAMomentObject')); + }; + + // for typechecking Duration objects + moment.isDuration = function (obj) { + return obj instanceof Duration; + }; + + for (i = lists.length - 1; i >= 0; --i) { + makeList(lists[i]); + } + + moment.normalizeUnits = function (units) { + return normalizeUnits(units); + }; + + moment.invalid = function (flags) { + var m = moment.utc(NaN); + if (flags != null) { + extend(m._pf, flags); + } + else { + m._pf.userInvalidated = true; + } + + return m; + }; + + moment.parseZone = function (input) { + return moment(input).parseZone(); + }; + + /************************************ + Moment Prototype + ************************************/ + + + extend(moment.fn = Moment.prototype, { + + clone : function () { + return moment(this); + }, + + valueOf : function () { + return +this._d + ((this._offset || 0) * 60000); + }, + + unix : function () { + return Math.floor(+this / 1000); + }, + + toString : function () { + return this.clone().lang('en').format("ddd MMM DD YYYY HH:mm:ss [GMT]ZZ"); + }, + + toDate : function () { + return this._offset ? new Date(+this) : this._d; + }, + + toISOString : function () { + var m = moment(this).utc(); + if (0 < m.year() && m.year() <= 9999) { + return formatMoment(m, 'YYYY-MM-DD[T]HH:mm:ss.SSS[Z]'); + } else { + return formatMoment(m, 'YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]'); + } + }, + + toArray : function () { + var m = this; + return [ + m.year(), + m.month(), + m.date(), + m.hours(), + m.minutes(), + m.seconds(), + m.milliseconds() + ]; + }, + + isValid : function () { + return isValid(this); + }, + + isDSTShifted : function () { + + if (this._a) { + return this.isValid() && compareArrays(this._a, (this._isUTC ? moment.utc(this._a) : moment(this._a)).toArray()) > 0; + } + + return false; + }, + + parsingFlags : function () { + return extend({}, this._pf); + }, + + invalidAt: function () { + return this._pf.overflow; + }, + + utc : function () { + return this.zone(0); + }, + + local : function () { + this.zone(0); + this._isUTC = false; + return this; + }, + + format : function (inputString) { + var output = formatMoment(this, inputString || moment.defaultFormat); + return this.lang().postformat(output); + }, + + add : function (input, val) { + var dur; + // switch args to support add('s', 1) and add(1, 's') + if (typeof input === 'string') { + dur = moment.duration(+val, input); + } else { + dur = moment.duration(input, val); + } + addOrSubtractDurationFromMoment(this, dur, 1); + return this; + }, + + subtract : function (input, val) { + var dur; + // switch args to support subtract('s', 1) and subtract(1, 's') + if (typeof input === 'string') { + dur = moment.duration(+val, input); + } else { + dur = moment.duration(input, val); + } + addOrSubtractDurationFromMoment(this, dur, -1); + return this; + }, + + diff : function (input, units, asFloat) { + var that = makeAs(input, this), + zoneDiff = (this.zone() - that.zone()) * 6e4, + diff, output; + + units = normalizeUnits(units); + + if (units === 'year' || units === 'month') { + // average number of days in the months in the given dates + diff = (this.daysInMonth() + that.daysInMonth()) * 432e5; // 24 * 60 * 60 * 1000 / 2 + // difference in months + output = ((this.year() - that.year()) * 12) + (this.month() - that.month()); + // adjust by taking difference in days, average number of days + // and dst in the given months. + output += ((this - moment(this).startOf('month')) - + (that - moment(that).startOf('month'))) / diff; + // same as above but with zones, to negate all dst + output -= ((this.zone() - moment(this).startOf('month').zone()) - + (that.zone() - moment(that).startOf('month').zone())) * 6e4 / diff; + if (units === 'year') { + output = output / 12; + } + } else { + diff = (this - that); + output = units === 'second' ? diff / 1e3 : // 1000 + units === 'minute' ? diff / 6e4 : // 1000 * 60 + units === 'hour' ? diff / 36e5 : // 1000 * 60 * 60 + units === 'day' ? (diff - zoneDiff) / 864e5 : // 1000 * 60 * 60 * 24, negate dst + units === 'week' ? (diff - zoneDiff) / 6048e5 : // 1000 * 60 * 60 * 24 * 7, negate dst + diff; + } + return asFloat ? output : absRound(output); + }, + + from : function (time, withoutSuffix) { + return moment.duration(this.diff(time)).lang(this.lang()._abbr).humanize(!withoutSuffix); + }, + + fromNow : function (withoutSuffix) { + return this.from(moment(), withoutSuffix); + }, + + calendar : function () { + // We want to compare the start of today, vs this. + // Getting start-of-today depends on whether we're zone'd or not. + var sod = makeAs(moment(), this).startOf('day'), + diff = this.diff(sod, 'days', true), + format = diff < -6 ? 'sameElse' : + diff < -1 ? 'lastWeek' : + diff < 0 ? 'lastDay' : + diff < 1 ? 'sameDay' : + diff < 2 ? 'nextDay' : + diff < 7 ? 'nextWeek' : 'sameElse'; + return this.format(this.lang().calendar(format, this)); + }, + + isLeapYear : function () { + return isLeapYear(this.year()); + }, + + isDST : function () { + return (this.zone() < this.clone().month(0).zone() || + this.zone() < this.clone().month(5).zone()); + }, + + day : function (input) { + var day = this._isUTC ? this._d.getUTCDay() : this._d.getDay(); + if (input != null) { + input = parseWeekday(input, this.lang()); + return this.add({ d : input - day }); + } else { + return day; + } + }, + + month : function (input) { + var utc = this._isUTC ? 'UTC' : '', + dayOfMonth; + + if (input != null) { + if (typeof input === 'string') { + input = this.lang().monthsParse(input); + if (typeof input !== 'number') { + return this; + } + } + + dayOfMonth = this.date(); + this.date(1); + this._d['set' + utc + 'Month'](input); + this.date(Math.min(dayOfMonth, this.daysInMonth())); + + moment.updateOffset(this); + return this; + } else { + return this._d['get' + utc + 'Month'](); + } + }, + + startOf: function (units) { + units = normalizeUnits(units); + // the following switch intentionally omits break keywords + // to utilize falling through the cases. + switch (units) { + case 'year': + this.month(0); + /* falls through */ + case 'month': + this.date(1); + /* falls through */ + case 'week': + case 'isoWeek': + case 'day': + this.hours(0); + /* falls through */ + case 'hour': + this.minutes(0); + /* falls through */ + case 'minute': + this.seconds(0); + /* falls through */ + case 'second': + this.milliseconds(0); + /* falls through */ + } + + // weeks are a special case + if (units === 'week') { + this.weekday(0); + } else if (units === 'isoWeek') { + this.isoWeekday(1); + } + + return this; + }, + + endOf: function (units) { + units = normalizeUnits(units); + return this.startOf(units).add((units === 'isoWeek' ? 'week' : units), 1).subtract('ms', 1); + }, + + isAfter: function (input, units) { + units = typeof units !== 'undefined' ? units : 'millisecond'; + return +this.clone().startOf(units) > +moment(input).startOf(units); + }, + + isBefore: function (input, units) { + units = typeof units !== 'undefined' ? units : 'millisecond'; + return +this.clone().startOf(units) < +moment(input).startOf(units); + }, + + isSame: function (input, units) { + units = units || 'ms'; + return +this.clone().startOf(units) === +makeAs(input, this).startOf(units); + }, + + min: function (other) { + other = moment.apply(null, arguments); + return other < this ? this : other; + }, + + max: function (other) { + other = moment.apply(null, arguments); + return other > this ? this : other; + }, + + zone : function (input) { + var offset = this._offset || 0; + if (input != null) { + if (typeof input === "string") { + input = timezoneMinutesFromString(input); + } + if (Math.abs(input) < 16) { + input = input * 60; + } + this._offset = input; + this._isUTC = true; + if (offset !== input) { + addOrSubtractDurationFromMoment(this, moment.duration(offset - input, 'm'), 1, true); + } + } else { + return this._isUTC ? offset : this._d.getTimezoneOffset(); + } + return this; + }, + + zoneAbbr : function () { + return this._isUTC ? "UTC" : ""; + }, + + zoneName : function () { + return this._isUTC ? "Coordinated Universal Time" : ""; + }, + + parseZone : function () { + if (this._tzm) { + this.zone(this._tzm); + } else if (typeof this._i === 'string') { + this.zone(this._i); + } + return this; + }, + + hasAlignedHourOffset : function (input) { + if (!input) { + input = 0; + } + else { + input = moment(input).zone(); + } + + return (this.zone() - input) % 60 === 0; + }, + + daysInMonth : function () { + return daysInMonth(this.year(), this.month()); + }, + + dayOfYear : function (input) { + var dayOfYear = round((moment(this).startOf('day') - moment(this).startOf('year')) / 864e5) + 1; + return input == null ? dayOfYear : this.add("d", (input - dayOfYear)); + }, + + quarter : function () { + return Math.ceil((this.month() + 1.0) / 3.0); + }, + + weekYear : function (input) { + var year = weekOfYear(this, this.lang()._week.dow, this.lang()._week.doy).year; + return input == null ? year : this.add("y", (input - year)); + }, + + isoWeekYear : function (input) { + var year = weekOfYear(this, 1, 4).year; + return input == null ? year : this.add("y", (input - year)); + }, + + week : function (input) { + var week = this.lang().week(this); + return input == null ? week : this.add("d", (input - week) * 7); + }, + + isoWeek : function (input) { + var week = weekOfYear(this, 1, 4).week; + return input == null ? week : this.add("d", (input - week) * 7); + }, + + weekday : function (input) { + var weekday = (this.day() + 7 - this.lang()._week.dow) % 7; + return input == null ? weekday : this.add("d", input - weekday); + }, + + isoWeekday : function (input) { + // behaves the same as moment#day except + // as a getter, returns 7 instead of 0 (1-7 range instead of 0-6) + // as a setter, sunday should belong to the previous week. + return input == null ? this.day() || 7 : this.day(this.day() % 7 ? input : input - 7); + }, + + get : function (units) { + units = normalizeUnits(units); + return this[units](); + }, + + set : function (units, value) { + units = normalizeUnits(units); + if (typeof this[units] === 'function') { + this[units](value); + } + return this; + }, + + // If passed a language key, it will set the language for this + // instance. Otherwise, it will return the language configuration + // variables for this instance. + lang : function (key) { + if (key === undefined) { + return this._lang; + } else { + this._lang = getLangDefinition(key); + return this; + } + } + }); + + // helper for adding shortcuts + function makeGetterAndSetter(name, key) { + moment.fn[name] = moment.fn[name + 's'] = function (input) { + var utc = this._isUTC ? 'UTC' : ''; + if (input != null) { + this._d['set' + utc + key](input); + moment.updateOffset(this); + return this; + } else { + return this._d['get' + utc + key](); + } + }; + } + + // loop through and add shortcuts (Month, Date, Hours, Minutes, Seconds, Milliseconds) + for (i = 0; i < proxyGettersAndSetters.length; i ++) { + makeGetterAndSetter(proxyGettersAndSetters[i].toLowerCase().replace(/s$/, ''), proxyGettersAndSetters[i]); + } + + // add shortcut for year (uses different syntax than the getter/setter 'year' == 'FullYear') + makeGetterAndSetter('year', 'FullYear'); + + // add plural methods + moment.fn.days = moment.fn.day; + moment.fn.months = moment.fn.month; + moment.fn.weeks = moment.fn.week; + moment.fn.isoWeeks = moment.fn.isoWeek; + + // add aliased format methods + moment.fn.toJSON = moment.fn.toISOString; + + /************************************ + Duration Prototype + ************************************/ + + + extend(moment.duration.fn = Duration.prototype, { + + _bubble : function () { + var milliseconds = this._milliseconds, + days = this._days, + months = this._months, + data = this._data, + seconds, minutes, hours, years; + + // The following code bubbles up values, see the tests for + // examples of what that means. + data.milliseconds = milliseconds % 1000; + + seconds = absRound(milliseconds / 1000); + data.seconds = seconds % 60; + + minutes = absRound(seconds / 60); + data.minutes = minutes % 60; + + hours = absRound(minutes / 60); + data.hours = hours % 24; + + days += absRound(hours / 24); + data.days = days % 30; + + months += absRound(days / 30); + data.months = months % 12; + + years = absRound(months / 12); + data.years = years; + }, + + weeks : function () { + return absRound(this.days() / 7); + }, + + valueOf : function () { + return this._milliseconds + + this._days * 864e5 + + (this._months % 12) * 2592e6 + + toInt(this._months / 12) * 31536e6; + }, + + humanize : function (withSuffix) { + var difference = +this, + output = relativeTime(difference, !withSuffix, this.lang()); + + if (withSuffix) { + output = this.lang().pastFuture(difference, output); + } + + return this.lang().postformat(output); + }, + + add : function (input, val) { + // supports only 2.0-style add(1, 's') or add(moment) + var dur = moment.duration(input, val); + + this._milliseconds += dur._milliseconds; + this._days += dur._days; + this._months += dur._months; + + this._bubble(); + + return this; + }, + + subtract : function (input, val) { + var dur = moment.duration(input, val); + + this._milliseconds -= dur._milliseconds; + this._days -= dur._days; + this._months -= dur._months; + + this._bubble(); + + return this; + }, + + get : function (units) { + units = normalizeUnits(units); + return this[units.toLowerCase() + 's'](); + }, + + as : function (units) { + units = normalizeUnits(units); + return this['as' + units.charAt(0).toUpperCase() + units.slice(1) + 's'](); + }, + + lang : moment.fn.lang, + + toIsoString : function () { + // inspired by https://github.com/dordille/moment-isoduration/blob/master/moment.isoduration.js + var years = Math.abs(this.years()), + months = Math.abs(this.months()), + days = Math.abs(this.days()), + hours = Math.abs(this.hours()), + minutes = Math.abs(this.minutes()), + seconds = Math.abs(this.seconds() + this.milliseconds() / 1000); + + if (!this.asSeconds()) { + // this is the same as C#'s (Noda) and python (isodate)... + // but not other JS (goog.date) + return 'P0D'; + } + + return (this.asSeconds() < 0 ? '-' : '') + + 'P' + + (years ? years + 'Y' : '') + + (months ? months + 'M' : '') + + (days ? days + 'D' : '') + + ((hours || minutes || seconds) ? 'T' : '') + + (hours ? hours + 'H' : '') + + (minutes ? minutes + 'M' : '') + + (seconds ? seconds + 'S' : ''); + } + }); + + function makeDurationGetter(name) { + moment.duration.fn[name] = function () { + return this._data[name]; + }; + } + + function makeDurationAsGetter(name, factor) { + moment.duration.fn['as' + name] = function () { + return +this / factor; + }; + } + + for (i in unitMillisecondFactors) { + if (unitMillisecondFactors.hasOwnProperty(i)) { + makeDurationAsGetter(i, unitMillisecondFactors[i]); + makeDurationGetter(i.toLowerCase()); + } + } + + makeDurationAsGetter('Weeks', 6048e5); + moment.duration.fn.asMonths = function () { + return (+this - this.years() * 31536e6) / 2592e6 + this.years() * 12; + }; + + + /************************************ + Default Lang + ************************************/ + + + // Set default language, other languages will inherit from English. + moment.lang('en', { + ordinal : function (number) { + var b = number % 10, + output = (toInt(number % 100 / 10) === 1) ? 'th' : + (b === 1) ? 'st' : + (b === 2) ? 'nd' : + (b === 3) ? 'rd' : 'th'; + return number + output; + } + }); + + /* EMBED_LANGUAGES */ + + /************************************ + Exposing Moment + ************************************/ + + function makeGlobal(deprecate) { + var warned = false, local_moment = moment; + /*global ender:false */ + if (typeof ender !== 'undefined') { + return; + } + // here, `this` means `window` in the browser, or `global` on the server + // add `moment` as a global object via a string identifier, + // for Closure Compiler "advanced" mode + if (deprecate) { + global.moment = function () { + if (!warned && console && console.warn) { + warned = true; + console.warn( + "Accessing Moment through the global scope is " + + "deprecated, and will be removed in an upcoming " + + "release."); + } + return local_moment.apply(null, arguments); + }; + extend(global.moment, local_moment); + } else { + global['moment'] = moment; + } + } + + // CommonJS module is defined + if (hasModule) { + module.exports = moment; + makeGlobal(true); + } else if (typeof define === "function" && define.amd) { + define("moment", function (require, exports, module) { + if (module.config && module.config() && module.config().noGlobal !== true) { + // If user provided noGlobal, he is aware of global + makeGlobal(module.config().noGlobal === undefined); + } + + return moment; + }); + } else { + makeGlobal(); + } +}).call(this); diff --git a/resources/lib/oojs-ui/i18n/ace.json b/resources/lib/oojs-ui/i18n/ace.json new file mode 100644 index 000000000000..554ae57fbd9e --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ace.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Si Gam Acèh" + ] + }, + "ooui-dialog-action-close": "Tôp", + "ooui-outline-control-move-down": "Pinah item u yup", + "ooui-outline-control-move-up": "Pinah item u ateuëh", + "ooui-toolbar-more": "Lom" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/af.json b/resources/lib/oojs-ui/i18n/af.json new file mode 100644 index 000000000000..a622f8931e19 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/af.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "Naudefj" + ] + }, + "ooui-dialog-action-close": "Sluit", + "ooui-outline-control-move-down": "Skuif item af", + "ooui-outline-control-move-up": "Skuif item op" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/am.json b/resources/lib/oojs-ui/i18n/am.json new file mode 100644 index 000000000000..61e4ff66c03a --- /dev/null +++ b/resources/lib/oojs-ui/i18n/am.json @@ -0,0 +1,8 @@ +{ + "@metadata": { + "authors": [ + "Elfalem" + ] + }, + "ooui-dialog-action-close": "ለመዝጋት" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ar.json b/resources/lib/oojs-ui/i18n/ar.json new file mode 100644 index 000000000000..65e1364308a8 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ar.json @@ -0,0 +1,18 @@ +{ + "@metadata": { + "authors": [ + "Ciphers", + "Claw eg", + "Elfalem", + "Jdforrester", + "Mido", + "OsamaK", + "زكريا", + "مشعل الحربي" + ] + }, + "ooui-dialog-action-close": "أغلق", + "ooui-outline-control-move-down": "انقل العنصر للأسفل", + "ooui-outline-control-move-up": "انقل العنصر للأعلى", + "ooui-toolbar-more": "مزيد" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/arc.json b/resources/lib/oojs-ui/i18n/arc.json new file mode 100644 index 000000000000..0f9e75d7d051 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/arc.json @@ -0,0 +1,8 @@ +{ + "@metadata": { + "authors": [ + "Basharh" + ] + }, + "ooui-dialog-action-close": "ܣܟܘܪ" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ast.json b/resources/lib/oojs-ui/i18n/ast.json new file mode 100644 index 000000000000..fe6ea0a2010c --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ast.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Basharh", + "Bishnu Saikia", + "Xuacu" + ] + }, + "ooui-dialog-action-close": "Zarrar", + "ooui-outline-control-move-down": "Mover abaxo l'elementu", + "ooui-outline-control-move-up": "Mover arriba l'elementu", + "ooui-outline-control-remove": "Desaniciar elementu", + "ooui-toolbar-more": "Más" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/az.json b/resources/lib/oojs-ui/i18n/az.json new file mode 100644 index 000000000000..257680bcc542 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/az.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Cekli829", + "Interfase", + "Jduranboger" + ] + }, + "ooui-dialog-action-close": "Bağla", + "ooui-outline-control-move-down": "Bəndi aşağı apar", + "ooui-outline-control-move-up": "Bəndi yuxarı apar", + "ooui-outline-control-remove": "Bəndi sil", + "ooui-toolbar-more": "Daha artıq" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ba.json b/resources/lib/oojs-ui/i18n/ba.json new file mode 100644 index 000000000000..4af01149e3e0 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ba.json @@ -0,0 +1,15 @@ +{ + "@metadata": { + "authors": [ + "AiseluRB", + "Amire80", + "Assele", + "Haqmar", + "Sagan", + "Рустам Нурыев" + ] + }, + "ooui-dialog-action-close": "Ябырға", + "ooui-outline-control-move-down": "Аҫҡа күсерергә", + "ooui-outline-control-move-up": "Өҫкә күсерергә" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/bcl.json b/resources/lib/oojs-ui/i18n/bcl.json new file mode 100644 index 000000000000..aff451ea82ac --- /dev/null +++ b/resources/lib/oojs-ui/i18n/bcl.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Geopoet", + "Sky Harbor" + ] + }, + "ooui-dialog-action-close": "Seraduhon", + "ooui-outline-control-move-down": "Balyuhon an aytem paibaba", + "ooui-outline-control-move-up": "Balyuhon an aytem paitaas", + "ooui-toolbar-more": "Kadugangan" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/be-tarask.json b/resources/lib/oojs-ui/i18n/be-tarask.json new file mode 100644 index 000000000000..5922f61c4f0a --- /dev/null +++ b/resources/lib/oojs-ui/i18n/be-tarask.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "EugeneZelenko", + "Wizardist", + "Чаховіч Уладзіслаў", + "Zedlik" + ] + }, + "ooui-dialog-action-close": "Закрыць", + "ooui-outline-control-move-down": "Перасунуць ніжэй", + "ooui-outline-control-move-up": "Перасунуць вышэй", + "ooui-toolbar-more": "Болей" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/be.json b/resources/lib/oojs-ui/i18n/be.json new file mode 100644 index 000000000000..3058ab820998 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/be.json @@ -0,0 +1,8 @@ +{ + "@metadata": { + "authors": [ + "Чаховіч Уладзіслаў" + ] + }, + "ooui-dialog-action-close": "Закрыць" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/bg.json b/resources/lib/oojs-ui/i18n/bg.json new file mode 100644 index 000000000000..600624427447 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/bg.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "DCLXVI", + "Hristofor.mirchev", + "පසිඳු කාවින්ද", + "Mitzev" + ] + }, + "ooui-dialog-action-close": "Затваряне", + "ooui-outline-control-remove": "Премахване на обекта", + "ooui-toolbar-more": "Още" +} diff --git a/resources/lib/oojs-ui/i18n/bn.json b/resources/lib/oojs-ui/i18n/bn.json new file mode 100644 index 000000000000..c321ab1155ca --- /dev/null +++ b/resources/lib/oojs-ui/i18n/bn.json @@ -0,0 +1,16 @@ +{ + "@metadata": { + "authors": [ + "Aftab1995", + "Bellayet", + "Jayantanth", + "Nasir8891", + "Runab", + "Sayak Sarkar" + ] + }, + "ooui-dialog-action-close": "বন্ধ", + "ooui-outline-control-move-down": "আইটেম নিচে স্থানান্তর", + "ooui-outline-control-move-up": "আইটেম উপরে স্থানান্তর", + "ooui-toolbar-more": "আরও" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/br.json b/resources/lib/oojs-ui/i18n/br.json new file mode 100644 index 000000000000..38eb9e8f39e9 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/br.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Fohanno", + "Fulup", + "Y-M D" + ] + }, + "ooui-dialog-action-close": "Serriñ", + "ooui-outline-control-move-down": "Lakaat an elfenn da ziskenn", + "ooui-outline-control-move-up": "Lakaat an elfenn da bignat" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/bs.json b/resources/lib/oojs-ui/i18n/bs.json new file mode 100644 index 000000000000..95ba48dc342d --- /dev/null +++ b/resources/lib/oojs-ui/i18n/bs.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "DzWiki" + ] + }, + "ooui-dialog-action-close": "Zatvori", + "ooui-outline-control-move-down": "Premjesti stavku dole", + "ooui-outline-control-move-up": "Premjesti stavku gore", + "ooui-outline-control-remove": "Ukloni stavku", + "ooui-toolbar-more": "Više" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ca.json b/resources/lib/oojs-ui/i18n/ca.json new file mode 100644 index 000000000000..61bb1f68c05b --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ca.json @@ -0,0 +1,17 @@ +{ + "@metadata": { + "authors": [ + "Alvaro Vidal-Abarca", + "Amire80", + "Arnaugir", + "Pginer", + "QuimGil", + "SMP", + "Vriullop" + ] + }, + "ooui-dialog-action-close": "Tanca", + "ooui-outline-control-move-down": "Baixa element", + "ooui-outline-control-move-up": "Puja element", + "ooui-toolbar-more": "Més" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ce.json b/resources/lib/oojs-ui/i18n/ce.json new file mode 100644 index 000000000000..ff14ff3ebc45 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ce.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Amire80", + "Умар" + ] + }, + "ooui-dialog-action-close": "ДӀачӀагӀа", + "ooui-outline-control-move-down": "Лаха яккха элемент", + "ooui-outline-control-move-up": "Лаккха яккха элемент", + "ooui-outline-control-remove": "ДӀадаха меттиг", + "ooui-toolbar-more": "Кхин тӀе" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ckb.json b/resources/lib/oojs-ui/i18n/ckb.json new file mode 100644 index 000000000000..839f4a8e7cf6 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ckb.json @@ -0,0 +1,9 @@ +{ + "@metadata": { + "authors": [ + "Calak", + "Muhammed taha" + ] + }, + "ooui-dialog-action-close": "دایخە" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/co.json b/resources/lib/oojs-ui/i18n/co.json new file mode 100644 index 000000000000..e5edb211ec8d --- /dev/null +++ b/resources/lib/oojs-ui/i18n/co.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "Paulu" + ] + }, + "ooui-dialog-action-close": "Chjude", + "ooui-outline-control-move-down": "Fà falà l'ogettu", + "ooui-outline-control-move-up": "Fà cullà l'ogettu" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/cs.json b/resources/lib/oojs-ui/i18n/cs.json new file mode 100644 index 000000000000..670073f9c6a6 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/cs.json @@ -0,0 +1,21 @@ +{ + "@metadata": { + "authors": [ + "Chmee2", + "Jkjk", + "Juandev", + "Koo6", + "Littledogboy", + "Michaelbrabec", + "Mormegil", + "Polda18", + "Tchoř", + "ශ්වෙත" + ] + }, + "ooui-dialog-action-close": "Zavřít", + "ooui-outline-control-move-down": "Přesunout položku dolů", + "ooui-outline-control-move-up": "Přesunout položku nahoru", + "ooui-outline-control-remove": "Odstranit položku", + "ooui-toolbar-more": "Další" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/cu.json b/resources/lib/oojs-ui/i18n/cu.json new file mode 100644 index 000000000000..55594c1ab6cc --- /dev/null +++ b/resources/lib/oojs-ui/i18n/cu.json @@ -0,0 +1,9 @@ +{ + "@metadata": { + "authors": [ + "ОйЛ" + ] + }, + "ooui-dialog-action-close": "ꙁакрꙑи", + "ooui-toolbar-more": "вѧщє" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/cy.json b/resources/lib/oojs-ui/i18n/cy.json new file mode 100644 index 000000000000..d37912d2889d --- /dev/null +++ b/resources/lib/oojs-ui/i18n/cy.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Lloffiwr", + "Robin Owain", + "ОйЛ" + ] + }, + "ooui-dialog-action-close": "Caeer", + "ooui-outline-control-move-down": "Symud yr eitem lawr", + "ooui-outline-control-move-up": "Symud yr eitem lan", + "ooui-toolbar-more": "Rhagor" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/da.json b/resources/lib/oojs-ui/i18n/da.json new file mode 100644 index 000000000000..bf47bcbe7868 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/da.json @@ -0,0 +1,17 @@ +{ + "@metadata": { + "authors": [ + "Cgtdk", + "Christian List", + "EileenSanda", + "Laketown", + "Palnatoke", + "Simeondahl", + "Tehnix" + ] + }, + "ooui-dialog-action-close": "Luk", + "ooui-outline-control-move-down": "Flyt ned", + "ooui-outline-control-move-up": "Flyt op", + "ooui-toolbar-more": "Mere" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/de.json b/resources/lib/oojs-ui/i18n/de.json new file mode 100644 index 000000000000..bed2b2c68200 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/de.json @@ -0,0 +1,21 @@ +{ + "@metadata": { + "authors": [ + "APPER", + "G.Hagedorn", + "Inkowik", + "Jcornelius", + "Jdforrester", + "Kghbln", + "Metalhead64", + "Murma174", + "Se4598", + "Tomabrafix" + ] + }, + "ooui-dialog-action-close": "Schließen", + "ooui-outline-control-move-down": "Element nach unten verschieben", + "ooui-outline-control-move-up": "Element nach oben verschieben", + "ooui-outline-control-remove": "Element entfernen", + "ooui-toolbar-more": "Mehr" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/diq.json b/resources/lib/oojs-ui/i18n/diq.json new file mode 100644 index 000000000000..bb0ac352da56 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/diq.json @@ -0,0 +1,16 @@ +{ + "@metadata": { + "authors": [ + "Erdemaslancan", + "Gorizon", + "Kghbln", + "Marmase", + "Mirzali", + "Se4598" + ] + }, + "ooui-dialog-action-close": "Racnê", + "ooui-outline-control-move-down": "Bendi bere cêr", + "ooui-outline-control-move-up": "Bendi bere cor", + "ooui-toolbar-more": "Zewbi" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/dsb.json b/resources/lib/oojs-ui/i18n/dsb.json new file mode 100644 index 000000000000..ef600933525a --- /dev/null +++ b/resources/lib/oojs-ui/i18n/dsb.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Michawiki" + ] + }, + "ooui-dialog-action-close": "Zacyniś", + "ooui-outline-control-move-down": "Element dołoj pśesunuś", + "ooui-outline-control-move-up": "Element górjej pśesunuś", + "ooui-outline-control-remove": "Zapisk wótpóraś", + "ooui-toolbar-more": "Wěcej" +} diff --git a/resources/lib/oojs-ui/i18n/el.json b/resources/lib/oojs-ui/i18n/el.json new file mode 100644 index 000000000000..d1ef8b237ed8 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/el.json @@ -0,0 +1,19 @@ +{ + "@metadata": { + "authors": [ + "Astralnet", + "Dipa1965", + "Evropi", + "FocalPoint", + "Geraki", + "Glavkos", + "Nikosguard", + "Tifa93" + ] + }, + "ooui-dialog-action-close": "Κλείσιμο", + "ooui-outline-control-move-down": "Μετακίνηση στοιχείου προς τα κάτω", + "ooui-outline-control-move-up": "Μετακίνηση στοιχείου προς τα επάνω", + "ooui-outline-control-remove": "Αφαίρεση στοιχείου", + "ooui-toolbar-more": "Περισσότερα" +} diff --git a/resources/lib/oojs-ui/i18n/eml.json b/resources/lib/oojs-ui/i18n/eml.json new file mode 100644 index 000000000000..5dd09f57b3c5 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/eml.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Gloria sah", + "Lévi" + ] + }, + "ooui-dialog-action-close": "Sèra", + "ooui-outline-control-move-down": "Spôsta in bâs", + "ooui-outline-control-move-up": "Spôsta in êlt", + "ooui-toolbar-more": "Êter" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/en.json b/resources/lib/oojs-ui/i18n/en.json new file mode 100644 index 000000000000..5ff991546d4f --- /dev/null +++ b/resources/lib/oojs-ui/i18n/en.json @@ -0,0 +1,24 @@ +{ + "@metadata": { + "authors": [ + "Trevor Parscal", + "Ed Sanders", + "James D. Forrester", + "Raimond Spekking", + "Erik Moeller", + "Moriel Schottlender", + "Yuki Shira", + "Siebrand Mazeland", + "Rob Moen", + "Timo Tijhof", + "Roan Kattouw", + "Christian Williams", + "Amir E. Aharoni" + ] + }, + "ooui-dialog-action-close": "Close", + "ooui-outline-control-move-down": "Move item down", + "ooui-outline-control-move-up": "Move item up", + "ooui-outline-control-remove": "Remove item", + "ooui-toolbar-more": "More" +} diff --git a/resources/lib/oojs-ui/i18n/eo.json b/resources/lib/oojs-ui/i18n/eo.json new file mode 100644 index 000000000000..51f3261ae89c --- /dev/null +++ b/resources/lib/oojs-ui/i18n/eo.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Happy5214", + "KuboF", + "Shirayuki", + "Yekrats" + ] + }, + "ooui-dialog-action-close": "Fermi", + "ooui-outline-control-move-down": "Movi eron suben", + "ooui-outline-control-move-up": "Movi eron supren", + "ooui-toolbar-more": "Pli" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/es.json b/resources/lib/oojs-ui/i18n/es.json new file mode 100644 index 000000000000..a3be7490d400 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/es.json @@ -0,0 +1,24 @@ +{ + "@metadata": { + "authors": [ + "Armando-Martin", + "Aruizdr", + "Benfutbol10", + "DJ Nietzsche", + "Erdemaslancan", + "Fitoschido", + "Imre", + "Invadinado", + "Jdforrester", + "Jduranboger", + "PoLuX124", + "Ralgis", + "Thehelpfulone" + ] + }, + "ooui-dialog-action-close": "Cerrar", + "ooui-outline-control-move-down": "Mover abajo", + "ooui-outline-control-move-up": "Mover arriba", + "ooui-outline-control-remove": "Eliminar elemento", + "ooui-toolbar-more": "Más" +} diff --git a/resources/lib/oojs-ui/i18n/et.json b/resources/lib/oojs-ui/i18n/et.json new file mode 100644 index 000000000000..f0ddc3914587 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/et.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Avjoska", + "Pikne" + ] + }, + "ooui-dialog-action-close": "Sule", + "ooui-outline-control-move-down": "Liiguta üksust allapoole", + "ooui-outline-control-move-up": "Liiguta üksust ülespoole", + "ooui-outline-control-remove": "Eemalda üksus", + "ooui-toolbar-more": "Veel" +} diff --git a/resources/lib/oojs-ui/i18n/eu.json b/resources/lib/oojs-ui/i18n/eu.json new file mode 100644 index 000000000000..5d3f08b0d84b --- /dev/null +++ b/resources/lib/oojs-ui/i18n/eu.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "An13sa", + "Unai Fdz. de Betoño", + "Xabier Armendaritz" + ] + }, + "ooui-dialog-action-close": "Itxi", + "ooui-outline-control-move-down": "Mugitu itema beherantz", + "ooui-outline-control-move-up": "Mugitu itema gorantz", + "ooui-toolbar-more": "Gehiago" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/fa.json b/resources/lib/oojs-ui/i18n/fa.json new file mode 100644 index 000000000000..3f1ad0ce8435 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/fa.json @@ -0,0 +1,21 @@ +{ + "@metadata": { + "authors": [ + "Dalba", + "Ebraminio", + "Jdforrester", + "Ladsgroup", + "Mjbmr", + "Nojan Madinehi", + "Reza1615", + "Taha", + "درفش کاویانی", + "Armin1392" + ] + }, + "ooui-dialog-action-close": "بستن", + "ooui-outline-control-move-down": "انتقال مورد به پایین", + "ooui-outline-control-move-up": "انتقال مورد به بالا", + "ooui-outline-control-remove": "حذف مورد", + "ooui-toolbar-more": "بیشتر" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/fi.json b/resources/lib/oojs-ui/i18n/fi.json new file mode 100644 index 000000000000..ce2f6d0d9535 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/fi.json @@ -0,0 +1,24 @@ +{ + "@metadata": { + "authors": [ + "Beluga", + "Crt", + "Harriv", + "Linnea", + "Nedergard", + "Nike", + "Olli", + "Pxos", + "Samoasambia", + "Silvonen", + "Skalman", + "Stryn", + "VezonThunder" + ] + }, + "ooui-dialog-action-close": "Sulje", + "ooui-outline-control-move-down": "Siirrä kohdetta alaspäin", + "ooui-outline-control-move-up": "Siirrä kohdetta ylöspäin", + "ooui-outline-control-remove": "Poista kohde", + "ooui-toolbar-more": "Lisää" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/fo.json b/resources/lib/oojs-ui/i18n/fo.json new file mode 100644 index 000000000000..00a48ff820df --- /dev/null +++ b/resources/lib/oojs-ui/i18n/fo.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "EileenSanda" + ] + }, + "ooui-dialog-action-close": "Lat aftur", + "ooui-outline-control-move-down": "Flyt lutin niður", + "ooui-outline-control-move-up": "Flyt lutin upp", + "ooui-toolbar-more": "Meira" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/fr.json b/resources/lib/oojs-ui/i18n/fr.json new file mode 100644 index 000000000000..7674d2f4046b --- /dev/null +++ b/resources/lib/oojs-ui/i18n/fr.json @@ -0,0 +1,36 @@ +{ + "@metadata": { + "authors": [ + "Automatik", + "Benoit Rochon", + "Boniface", + "Brunoperel", + "Crochet.david", + "DavidL", + "Dereckson", + "Gomoko", + "Guillom", + "Hello71", + "Jean-Frédéric", + "Linedwell", + "Ltrlg", + "Metroitendo", + "NemesisIII", + "Nicolas NALLET", + "Npettiaux", + "Rastus Vernon", + "Seb35", + "Sherbrooke", + "Tpt", + "Trizek", + "Urhixidur", + "Verdy p", + "Wyz" + ] + }, + "ooui-dialog-action-close": "Fermer", + "ooui-outline-control-move-down": "Faire descendre l’élément", + "ooui-outline-control-move-up": "Faire monter l’élément", + "ooui-outline-control-remove": "Supprimer l’élément", + "ooui-toolbar-more": "Plus" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/frr.json b/resources/lib/oojs-ui/i18n/frr.json new file mode 100644 index 000000000000..adf8ce813a20 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/frr.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "ChrisPtDe", + "Murma174" + ] + }, + "ooui-dialog-action-close": "Slütj", + "ooui-outline-control-move-down": "Element efter onern sküüw", + "ooui-outline-control-move-up": "Element efter boowen sküüw", + "ooui-outline-control-remove": "Element wechnem", + "ooui-toolbar-more": "Muar" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/fur.json b/resources/lib/oojs-ui/i18n/fur.json new file mode 100644 index 000000000000..18ea3835609a --- /dev/null +++ b/resources/lib/oojs-ui/i18n/fur.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Klenje", + "Tocaibon" + ] + }, + "ooui-dialog-action-close": "Siere", + "ooui-outline-control-move-down": "sposte sot", + "ooui-outline-control-move-up": "sposte in su", + "ooui-toolbar-more": "Altri" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/gl.json b/resources/lib/oojs-ui/i18n/gl.json new file mode 100644 index 000000000000..a029456914a7 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/gl.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Alison", + "Kscanne", + "Toliño" + ] + }, + "ooui-dialog-action-close": "Pechar", + "ooui-outline-control-move-down": "Mover o elemento abaixo", + "ooui-outline-control-move-up": "Mover o elemento arriba", + "ooui-outline-control-remove": "Eliminar o elemento", + "ooui-toolbar-more": "Máis" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/gu.json b/resources/lib/oojs-ui/i18n/gu.json new file mode 100644 index 000000000000..ccabf8d4435f --- /dev/null +++ b/resources/lib/oojs-ui/i18n/gu.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Ashok modhvadia", + "KartikMistry", + "The Discoverer" + ] + }, + "ooui-dialog-action-close": "બંધ કરો", + "ooui-outline-control-move-down": "વસ્તુ નીચે ખસેડો", + "ooui-outline-control-move-up": "વસ્તુ ઉપર ખસેડો", + "ooui-outline-control-remove": "વસ્તુ હટાવો", + "ooui-toolbar-more": "વધુ" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/he.json b/resources/lib/oojs-ui/i18n/he.json new file mode 100644 index 000000000000..404dc82e8d63 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/he.json @@ -0,0 +1,23 @@ +{ + "@metadata": { + "authors": [ + "Amire80", + "ExampleTomer", + "Guycn2", + "Matanya", + "Mooeypoo", + "Orsa", + "Shimmin Beg", + "אור שפירא", + "חיים", + "ערן", + "פוילישער", + "קיפודנחש" + ] + }, + "ooui-dialog-action-close": "סגירה", + "ooui-outline-control-move-down": "להזיז את הפריט מטה", + "ooui-outline-control-move-up": "להזיז את הפריט מעלה", + "ooui-outline-control-remove": "הסרת פריט", + "ooui-toolbar-more": "עוד" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/hi.json b/resources/lib/oojs-ui/i18n/hi.json new file mode 100644 index 000000000000..ae895d128c59 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/hi.json @@ -0,0 +1,16 @@ +{ + "@metadata": { + "authors": [ + "Ansumang", + "Devayon", + "Rajesh", + "Siddhartha Ghai", + "Goelujjwal" + ] + }, + "ooui-dialog-action-close": "बंद करें", + "ooui-outline-control-move-down": "प्रविष्टि नीचे ले जाएँ", + "ooui-outline-control-move-up": "प्रविष्टि ऊपर ले जाएँ", + "ooui-outline-control-remove": "आइटम हटाएँ", + "ooui-toolbar-more": "अधिक" +} diff --git a/resources/lib/oojs-ui/i18n/hr.json b/resources/lib/oojs-ui/i18n/hr.json new file mode 100644 index 000000000000..1c3f92549c84 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/hr.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "MaGa", + "Roberta F.", + "SpeedyGonsales" + ] + }, + "ooui-dialog-action-close": "zatvori", + "ooui-outline-control-move-down": "Premjesti stavku dolje", + "ooui-outline-control-move-up": "Premjesti stavku gore", + "ooui-toolbar-more": "Više mogućnosti" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/hsb.json b/resources/lib/oojs-ui/i18n/hsb.json new file mode 100644 index 000000000000..f674cd2e1f97 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/hsb.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "J budissin", + "Michawiki" + ] + }, + "ooui-dialog-action-close": "Začinić", + "ooui-outline-control-move-down": "Zapisk dele přesunyć", + "ooui-outline-control-move-up": "Zapisk horje přesunyć", + "ooui-outline-control-remove": "Zapisk wotstronić", + "ooui-toolbar-more": "Wjace" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/hu.json b/resources/lib/oojs-ui/i18n/hu.json new file mode 100644 index 000000000000..b2cf2c0e8a9c --- /dev/null +++ b/resources/lib/oojs-ui/i18n/hu.json @@ -0,0 +1,16 @@ +{ + "@metadata": { + "authors": [ + "Dj", + "Einstein2", + "Misibacsi", + "ViDam", + "Tacsipacsi" + ] + }, + "ooui-dialog-action-close": "Bezár", + "ooui-outline-control-move-down": "Elem mozgatása lefelé", + "ooui-outline-control-move-up": "Elem mozgatása felfelé", + "ooui-outline-control-remove": "Elem eltávolítása", + "ooui-toolbar-more": "Tovább..." +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/hy.json b/resources/lib/oojs-ui/i18n/hy.json new file mode 100644 index 000000000000..4cb88214ac73 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/hy.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Vacio", + "Xelgen" + ] + }, + "ooui-dialog-action-close": "Փակել", + "ooui-outline-control-move-down": "Իջեցնել կետը", + "ooui-outline-control-move-up": "Բարձրացնել կետը", + "ooui-outline-control-remove": "Հեռացնել տարրը", + "ooui-toolbar-more": "Ավելին" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ia.json b/resources/lib/oojs-ui/i18n/ia.json new file mode 100644 index 000000000000..e335553affb2 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ia.json @@ -0,0 +1,8 @@ +{ + "@metadata": { + "authors": [ + "McDutchie" + ] + }, + "ooui-dialog-action-close": "Clauder" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/id.json b/resources/lib/oojs-ui/i18n/id.json new file mode 100644 index 000000000000..6d3ba4d1ee63 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/id.json @@ -0,0 +1,18 @@ +{ + "@metadata": { + "authors": [ + "Farras", + "Ilham151096", + "Iwan Novirion", + "Iyan", + "Kenrick95", + "McDutchie", + "Rv77ax", + "William Surya Permana" + ] + }, + "ooui-dialog-action-close": "Tutup", + "ooui-outline-control-move-down": "Pindahkan butir ke bawah", + "ooui-outline-control-move-up": "Pindahkan butir ke atas", + "ooui-toolbar-more": "Lainnya" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ie.json b/resources/lib/oojs-ui/i18n/ie.json new file mode 100644 index 000000000000..84d002d15cd2 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ie.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Makuba" + ] + }, + "ooui-dialog-action-close": "Terminar", + "ooui-outline-control-move-down": "Mover element a infra", + "ooui-outline-control-move-up": "Mover element a supra", + "ooui-toolbar-more": "Plu" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ilo.json b/resources/lib/oojs-ui/i18n/ilo.json new file mode 100644 index 000000000000..838facec2922 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ilo.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Lam-ang" + ] + }, + "ooui-dialog-action-close": "Irekep", + "ooui-outline-control-move-down": "Ipababa ti banag", + "ooui-outline-control-move-up": "Ipangato ti banag", + "ooui-outline-control-remove": "Ikkaten ti banag", + "ooui-toolbar-more": "Adu pay" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/is.json b/resources/lib/oojs-ui/i18n/is.json new file mode 100644 index 000000000000..fbdb5d1e52a3 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/is.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Maxí", + "Snævar" + ] + }, + "ooui-dialog-action-close": "Loka", + "ooui-outline-control-move-down": "Færa atriði niður", + "ooui-outline-control-move-up": "Færa atriði upp", + "ooui-toolbar-more": "Fleira" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/it.json b/resources/lib/oojs-ui/i18n/it.json new file mode 100644 index 000000000000..747ec79181e7 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/it.json @@ -0,0 +1,22 @@ +{ + "@metadata": { + "authors": [ + "Beta16", + "Darth Kule", + "Doc.mari", + "Eleonora negri", + "Elitre", + "F. Cosoleto", + "FRacco", + "Gianfranco", + "Minerva Titani", + "Raoli", + "Una giornata uggiosa '94" + ] + }, + "ooui-dialog-action-close": "Chiudi", + "ooui-outline-control-move-down": "Sposta in basso", + "ooui-outline-control-move-up": "Sposta in alto", + "ooui-outline-control-remove": "Rimuovi elemento", + "ooui-toolbar-more": "Altro" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ja.json b/resources/lib/oojs-ui/i18n/ja.json new file mode 100644 index 000000000000..c7c085123bf2 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ja.json @@ -0,0 +1,15 @@ +{ + "@metadata": { + "authors": [ + "Fryed-peach", + "Miya", + "Penn Station", + "Shirayuki" + ] + }, + "ooui-dialog-action-close": "閉じる", + "ooui-outline-control-move-down": "項目を下に移動させる", + "ooui-outline-control-move-up": "項目を上に移動させる", + "ooui-outline-control-remove": "項目を除去", + "ooui-toolbar-more": "その他" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/jv.json b/resources/lib/oojs-ui/i18n/jv.json new file mode 100644 index 000000000000..a362079703af --- /dev/null +++ b/resources/lib/oojs-ui/i18n/jv.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Gleki", + "NoiX180", + "Pras" + ] + }, + "ooui-dialog-action-close": "Tutup", + "ooui-outline-control-move-down": "Pindhahaken butir mangandhap" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ka.json b/resources/lib/oojs-ui/i18n/ka.json new file mode 100644 index 000000000000..c9d2774362c9 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ka.json @@ -0,0 +1,18 @@ +{ + "@metadata": { + "authors": [ + "BRUTE", + "David1010", + "Gleki", + "ITshnik", + "MIKHEIL", + "NoiX180", + "Pras", + "Tokoko" + ] + }, + "ooui-dialog-action-close": "დახურვა", + "ooui-outline-control-move-down": "ელემენტის ქვემოთ გადატანა", + "ooui-outline-control-move-up": "ელემენტის ზემოთ გადატანა", + "ooui-toolbar-more": "მეტი" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/kk-cyrl.json b/resources/lib/oojs-ui/i18n/kk-cyrl.json new file mode 100644 index 000000000000..7213dad73ab7 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/kk-cyrl.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Arystanbek" + ] + }, + "ooui-dialog-action-close": "Жабу", + "ooui-outline-control-move-down": "Элементті төмен жылжыту", + "ooui-outline-control-move-up": "Элементті жоғары жылжыту", + "ooui-outline-control-remove": "Элементті алып тастау", + "ooui-toolbar-more": "толығырақ" +} diff --git a/resources/lib/oojs-ui/i18n/km.json b/resources/lib/oojs-ui/i18n/km.json new file mode 100644 index 000000000000..2013ee3de485 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/km.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Sovichet" + ] + }, + "ooui-dialog-action-close": "បិទ", + "ooui-outline-control-move-down": "រុញទៅក្រោម", + "ooui-outline-control-move-up": "រុញទៅលើ", + "ooui-toolbar-more": "បន្ថែម" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/kn.json b/resources/lib/oojs-ui/i18n/kn.json new file mode 100644 index 000000000000..4932f6d831fa --- /dev/null +++ b/resources/lib/oojs-ui/i18n/kn.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "Vikassy" + ] + }, + "ooui-dialog-action-close": "ಮುಚ್ಚಿ", + "ooui-outline-control-remove": "ವಸ್ತು ತೆಗೆ", + "ooui-toolbar-more": "ಹೆಚ್ಚು" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ko.json b/resources/lib/oojs-ui/i18n/ko.json new file mode 100644 index 000000000000..25749ce18101 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ko.json @@ -0,0 +1,16 @@ +{ + "@metadata": { + "authors": [ + "Freebiekr", + "Hym411", + "Kwj2772", + "LFM", + "아라" + ] + }, + "ooui-dialog-action-close": "닫기", + "ooui-outline-control-move-down": "항목을 아래로 옮기기", + "ooui-outline-control-move-up": "항목을 위로 옮기기", + "ooui-outline-control-remove": "항목 지우기", + "ooui-toolbar-more": "더 보기" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/krc.json b/resources/lib/oojs-ui/i18n/krc.json new file mode 100644 index 000000000000..f62913996574 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/krc.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "Iltever" + ] + }, + "ooui-dialog-action-close": "Джаб", + "ooui-outline-control-move-down": "Элементни тюбюне кёчюр", + "ooui-outline-control-move-up": "Элементни башына кёчюр" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/kw.json b/resources/lib/oojs-ui/i18n/kw.json new file mode 100644 index 000000000000..95a9b91217e1 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/kw.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "George Animal", + "Nrowe", + "Purodha" + ] + }, + "ooui-dialog-action-close": "Degea" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ky.json b/resources/lib/oojs-ui/i18n/ky.json new file mode 100644 index 000000000000..2d62bda30bb8 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ky.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Chorobek", + "George Animal", + "Nrowe", + "Tynchtyk Chorotegin", + "Викиней" + ] + }, + "ooui-dialog-action-close": "Жабуу" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/lb.json b/resources/lib/oojs-ui/i18n/lb.json new file mode 100644 index 000000000000..6359026c4320 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/lb.json @@ -0,0 +1,18 @@ +{ + "@metadata": { + "authors": [ + "Autokrator", + "Chorobek", + "Robby", + "Soued031", + "Tynchtyk Chorotegin", + "UV", + "Викиней" + ] + }, + "ooui-dialog-action-close": "Zoumaachen", + "ooui-outline-control-move-down": "Element erof réckelen", + "ooui-outline-control-move-up": "Element erop réckelen", + "ooui-outline-control-remove": "Element ewechhuelen", + "ooui-toolbar-more": "Méi" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/lmo.json b/resources/lib/oojs-ui/i18n/lmo.json new file mode 100644 index 000000000000..e506b7a1103b --- /dev/null +++ b/resources/lib/oojs-ui/i18n/lmo.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Ninonino" + ] + }, + "ooui-dialog-action-close": "Sèra", + "ooui-outline-control-move-down": "Spòsta 'n zó", + "ooui-outline-control-move-up": "Spòsta 'n sö", + "ooui-toolbar-more": "Amò" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/lt.json b/resources/lib/oojs-ui/i18n/lt.json new file mode 100644 index 000000000000..db679bca92ec --- /dev/null +++ b/resources/lib/oojs-ui/i18n/lt.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Audriusa", + "Eitvys200", + "Mantak111" + ] + }, + "ooui-dialog-action-close": "Uždaryti", + "ooui-outline-control-remove": "Šalinti elementus" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/lv.json b/resources/lib/oojs-ui/i18n/lv.json new file mode 100644 index 000000000000..c633339c9d87 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/lv.json @@ -0,0 +1,15 @@ +{ + "@metadata": { + "authors": [ + "Admresdeserv.", + "Audriusa", + "Eitvys200", + "Papuass", + "PeterisP" + ] + }, + "ooui-dialog-action-close": "Aizvērt", + "ooui-outline-control-move-down": "Pārvietot vienumu uz leju", + "ooui-outline-control-move-up": "Pārvietot vienumu uz augšu", + "ooui-toolbar-more": "Vairāk" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/mg.json b/resources/lib/oojs-ui/i18n/mg.json new file mode 100644 index 000000000000..dcb5fd55af3f --- /dev/null +++ b/resources/lib/oojs-ui/i18n/mg.json @@ -0,0 +1,8 @@ +{ + "@metadata": { + "authors": [ + "Jagwar" + ] + }, + "ooui-dialog-action-close": "Hidiana" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/min.json b/resources/lib/oojs-ui/i18n/min.json new file mode 100644 index 000000000000..55174c09e0a1 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/min.json @@ -0,0 +1,9 @@ +{ + "@metadata": { + "authors": [ + "Iwan Novirion", + "Jagwar" + ] + }, + "ooui-dialog-action-close": "Tutuik" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/mk.json b/resources/lib/oojs-ui/i18n/mk.json new file mode 100644 index 000000000000..22fd037f7d6f --- /dev/null +++ b/resources/lib/oojs-ui/i18n/mk.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Bjankuloski06", + "Brest", + "Iwan Novirion" + ] + }, + "ooui-dialog-action-close": "Затвори", + "ooui-outline-control-move-down": "Помести надолу", + "ooui-outline-control-move-up": "Помести нагоре", + "ooui-outline-control-remove": "Отстрани ставка", + "ooui-toolbar-more": "Повеќе" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ml.json b/resources/lib/oojs-ui/i18n/ml.json new file mode 100644 index 000000000000..355e33737fc5 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ml.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Kavya Manohar", + "Praveenp", + "Santhosh.thottingal", + "Vssun" + ] + }, + "ooui-dialog-action-close": "അടയ്ക്കുക", + "ooui-outline-control-move-down": "ഇനം താഴേയ്ക്ക് മാറ്റുക", + "ooui-outline-control-move-up": "ഇനം മുകളിലേയ്ക്ക് മാറ്റുക", + "ooui-toolbar-more": "കൂടുതൽ" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/mr.json b/resources/lib/oojs-ui/i18n/mr.json new file mode 100644 index 000000000000..d4db84f61858 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/mr.json @@ -0,0 +1,16 @@ +{ + "@metadata": { + "authors": [ + "Kaajawa", + "Mahitgar", + "Praju23", + "V.narsikar", + "Ydyashad", + "संतोष दहिवळ" + ] + }, + "ooui-dialog-action-close": "बंद करा", + "ooui-outline-control-move-down": "घटक (आयटम) खाली सरकवा", + "ooui-outline-control-move-up": "घटक (आयटम) वर सरकवा", + "ooui-toolbar-more": "अधिक" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ms.json b/resources/lib/oojs-ui/i18n/ms.json new file mode 100644 index 000000000000..4f78aaa6dd69 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ms.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Anakmalaysia", + "Aurora" + ] + }, + "ooui-dialog-action-close": "Tutup", + "ooui-outline-control-move-down": "Alihkan perkara ke bawah", + "ooui-outline-control-move-up": "Alihkan perkara ke atas", + "ooui-outline-control-remove": "Buang perkara", + "ooui-toolbar-more": "Selebihnya" +} diff --git a/resources/lib/oojs-ui/i18n/nap.json b/resources/lib/oojs-ui/i18n/nap.json new file mode 100644 index 000000000000..6b0b3ecaa5ad --- /dev/null +++ b/resources/lib/oojs-ui/i18n/nap.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Chelin", + "Chrisportelli", + "PiRSquared17" + ] + }, + "ooui-dialog-action-close": "Chiure", + "ooui-toolbar-more": "Atro" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/nb.json b/resources/lib/oojs-ui/i18n/nb.json new file mode 100644 index 000000000000..7cdecaaae170 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/nb.json @@ -0,0 +1,15 @@ +{ + "@metadata": { + "authors": [ + "Danmichaelo", + "Event", + "Jeblad", + "Laaknor", + "Njardarlogar" + ] + }, + "ooui-dialog-action-close": "Lukk", + "ooui-outline-control-move-down": "Flytt ned", + "ooui-outline-control-move-up": "Flytt opp", + "ooui-toolbar-more": "Mer" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/nds-nl.json b/resources/lib/oojs-ui/i18n/nds-nl.json new file mode 100644 index 000000000000..81f8a43ec21c --- /dev/null +++ b/resources/lib/oojs-ui/i18n/nds-nl.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "Servien" + ] + }, + "ooui-dialog-action-close": "Sluten", + "ooui-outline-control-move-down": "Onderwarp ummeneer zetten", + "ooui-outline-control-move-up": "Onderwarp umhoge zetten" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/nds.json b/resources/lib/oojs-ui/i18n/nds.json new file mode 100644 index 000000000000..d0806d0ff50d --- /dev/null +++ b/resources/lib/oojs-ui/i18n/nds.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Zylbath" + ] + }, + "ooui-dialog-action-close": "Dichtmaken", + "ooui-outline-control-move-down": "Element na ünnen schuven", + "ooui-outline-control-move-up": "Element na baven schuven", + "ooui-toolbar-more": "Mehr" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ne.json b/resources/lib/oojs-ui/i18n/ne.json new file mode 100644 index 000000000000..ae948c60de1b --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ne.json @@ -0,0 +1,8 @@ +{ + "@metadata": { + "authors": [ + "RajeshPandey", + "सरोज कुमार ढकाल" + ] + } +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/nl.json b/resources/lib/oojs-ui/i18n/nl.json new file mode 100644 index 000000000000..549fad2046a3 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/nl.json @@ -0,0 +1,27 @@ +{ + "@metadata": { + "authors": [ + "Bluyten", + "Breghtje", + "Catrope", + "Flightmare", + "Hansmuller", + "Jdforrester", + "Keegan", + "Konovalov", + "RajeshPandey", + "Romaine", + "SPQRobin", + "Saruman", + "Siebrand", + "Southparkfan", + "सरोज कुमार ढकाल", + "Sjoerddebruin" + ] + }, + "ooui-dialog-action-close": "Sluiten", + "ooui-outline-control-move-down": "Item omlaag verplaatsen", + "ooui-outline-control-move-up": "Item omhoog verplaatsen", + "ooui-outline-control-remove": "Item verwijderen", + "ooui-toolbar-more": "Meer" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/nn.json b/resources/lib/oojs-ui/i18n/nn.json new file mode 100644 index 000000000000..dd86f5e7b3b4 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/nn.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Jeblad", + "Njardarlogar" + ] + }, + "ooui-dialog-action-close": "Lat att", + "ooui-outline-control-move-down": "Flytt element ned", + "ooui-outline-control-move-up": "Flytt element opp", + "ooui-toolbar-more": "Fleire" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/om.json b/resources/lib/oojs-ui/i18n/om.json new file mode 100644 index 000000000000..cd22c402aec7 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/om.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Cedric31", + "Tumsaa" + ] + }, + "ooui-dialog-action-close": "Cufi", + "ooui-outline-control-move-down": "Gad buusi", + "ooui-outline-control-move-up": "Ol baasi", + "ooui-outline-control-remove": "Balleessi", + "ooui-toolbar-more": "Dabalata" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/or.json b/resources/lib/oojs-ui/i18n/or.json new file mode 100644 index 000000000000..35721a1fb454 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/or.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "Odisha1", + "Psubhashish", + "ଶିତିକଣ୍ଠ ଦାଶ" + ] + }, + "ooui-dialog-action-close": "ବନ୍ଦ କରିବେ" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/pa.json b/resources/lib/oojs-ui/i18n/pa.json new file mode 100644 index 000000000000..6c76d7fd772f --- /dev/null +++ b/resources/lib/oojs-ui/i18n/pa.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Amikeco", + "Babanwalia", + "Bouron", + "Nasir8891" + ] + }, + "ooui-dialog-action-close": "বন্ধ" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/pfl.json b/resources/lib/oojs-ui/i18n/pfl.json new file mode 100644 index 000000000000..40cc15d285d0 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/pfl.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Manuae" + ] + }, + "ooui-dialog-action-close": "Schließe", + "ooui-outline-control-move-down": "Bweeschs nunna", + "ooui-outline-control-move-up": "Bweeschs nuff", + "ooui-outline-control-remove": "Leschs", + "ooui-toolbar-more": "Mea" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/pl.json b/resources/lib/oojs-ui/i18n/pl.json new file mode 100644 index 000000000000..2cb733079528 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/pl.json @@ -0,0 +1,24 @@ +{ + "@metadata": { + "authors": [ + "Babanwalia", + "Chrumps", + "Matma Rex", + "Mikołka", + "Nasir8891", + "Odie2", + "Rzuwig", + "Tar Lócesilion", + "Ty221", + "WTM", + "Woytecr", + "Wpedzich", + "Jacenty359" + ] + }, + "ooui-dialog-action-close": "Zamknij", + "ooui-outline-control-move-down": "Przenieś niżej", + "ooui-outline-control-move-up": "Przenieś wyżej", + "ooui-outline-control-remove": "Usuń element", + "ooui-toolbar-more": "Więcej" +} diff --git a/resources/lib/oojs-ui/i18n/pms.json b/resources/lib/oojs-ui/i18n/pms.json new file mode 100644 index 000000000000..bb8f113dc6d5 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/pms.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Borichèt", + "Dragonòt", + "පසිඳු කාවින්ද" + ] + }, + "ooui-dialog-action-close": "Saré", + "ooui-outline-control-move-down": "Fé calé giù l'element", + "ooui-outline-control-move-up": "Fé monté l'element", + "ooui-toolbar-more": "Ëd pi" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ps.json b/resources/lib/oojs-ui/i18n/ps.json new file mode 100644 index 000000000000..4f2170751529 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ps.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Ahmed-Najib-Biabani-Ibrahimkhel" + ] + }, + "ooui-dialog-action-close": "تړل", + "ooui-outline-control-move-down": "توکی ښکته راوړل", + "ooui-outline-control-move-up": "توکی پورته راوړل", + "ooui-toolbar-more": "نور" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/pt-br.json b/resources/lib/oojs-ui/i18n/pt-br.json new file mode 100644 index 000000000000..f7586609a0ba --- /dev/null +++ b/resources/lib/oojs-ui/i18n/pt-br.json @@ -0,0 +1,19 @@ +{ + "@metadata": { + "authors": [ + "Cainamarques", + "Dianakc", + "Fúlvio", + "Helder.wiki", + "HenriqueCrang", + "Jaideraf", + "Luckas", + "OTAVIO1981", + 555 + ] + }, + "ooui-dialog-action-close": "Fechar", + "ooui-outline-control-move-down": "Mover item para baixo", + "ooui-outline-control-move-up": "Mover item para cima", + "ooui-toolbar-more": "Mais" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/pt.json b/resources/lib/oojs-ui/i18n/pt.json new file mode 100644 index 000000000000..53b5280bd900 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/pt.json @@ -0,0 +1,21 @@ +{ + "@metadata": { + "authors": [ + "Cainamarques", + "Fúlvio", + "GoEThe", + "Hamilton Abreu", + "Helder.wiki", + "Jaideraf", + "Jdforrester", + "Luckas", + "Vitorvicentevalente", + "SandroHc" + ] + }, + "ooui-dialog-action-close": "Fechar", + "ooui-outline-control-move-down": "Mover item para baixo", + "ooui-outline-control-move-up": "Mover item para cima", + "ooui-outline-control-remove": "Remover elemento", + "ooui-toolbar-more": "Mais" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/qqq.json b/resources/lib/oojs-ui/i18n/qqq.json new file mode 100644 index 000000000000..75bbec41cac1 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/qqq.json @@ -0,0 +1,27 @@ +{ + "@metadata": { + "authors": [ + "Amire80", + "Beta16", + "Erik Moeller", + "Jdforrester", + "Lloffiwr", + "Mooeypoo", + "Mormegil", + "Nike", + "PoLuX124", + "Purodha", + "Raymond", + "Sagan", + "Sayak Sarkar", + "Shirayuki", + "Siebrand", + "Trevor Parscal" + ] + }, + "ooui-dialog-action-close": "Label text for button to exit from dialog.\n\n{{Identical|Close}}", + "ooui-outline-control-move-down": "Tool tip for a button that moves items in a list down one place", + "ooui-outline-control-move-up": "Tool tip for a button that moves items in a list up one place", + "ooui-outline-control-remove": "Tool tip for a button that removes items from a list.\n{{Identical|Remove item}}", + "ooui-toolbar-more": "Label for the toolbar group that contains a list of all other available tools.\n{{Identical|More}}" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/qu.json b/resources/lib/oojs-ui/i18n/qu.json new file mode 100644 index 000000000000..4442528fc72a --- /dev/null +++ b/resources/lib/oojs-ui/i18n/qu.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "AlimanRuna", + "Jduranboger" + ] + }, + "ooui-dialog-action-close": "Wichq'ay", + "ooui-outline-control-move-down": "Qallawata uraykuchiy", + "ooui-outline-control-move-up": "Qallawata huqariy", + "ooui-outline-control-remove": "P'anqa sutikunata qichuy", + "ooui-toolbar-more": "Aswan" +} diff --git a/resources/lib/oojs-ui/i18n/ro.json b/resources/lib/oojs-ui/i18n/ro.json new file mode 100644 index 000000000000..48929756b92e --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ro.json @@ -0,0 +1,15 @@ +{ + "@metadata": { + "authors": [ + "AlimanRuna", + "Firilacroco", + "Minisarm", + "Stelistcristi" + ] + }, + "ooui-dialog-action-close": "Închide", + "ooui-outline-control-move-down": "Mută elementul mai jos", + "ooui-outline-control-move-up": "Mută elementul mai sus", + "ooui-outline-control-remove": "Elimină elementul", + "ooui-toolbar-more": "Mai mult" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/roa-tara.json b/resources/lib/oojs-ui/i18n/roa-tara.json new file mode 100644 index 000000000000..c7699d6df665 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/roa-tara.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Joetaras" + ] + }, + "ooui-dialog-action-close": "Achiude", + "ooui-outline-control-move-down": "Spuèste 'a vôsce sotte", + "ooui-outline-control-move-up": "Spuèste 'a vôsce sus", + "ooui-toolbar-more": "De cchiù" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ru.json b/resources/lib/oojs-ui/i18n/ru.json new file mode 100644 index 000000000000..f6e76a6ca14d --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ru.json @@ -0,0 +1,26 @@ +{ + "@metadata": { + "authors": [ + "Amire80", + "DR", + "Eugrus", + "Iluvatar", + "KPu3uC B Poccuu", + "Kalan", + "MaxBioHazard", + "NBS", + "Niklem", + "Okras", + "Ole Yves", + "Putnik", + "Sunpriat", + "Yury Katkov", + "Умар" + ] + }, + "ooui-dialog-action-close": "Закрыть", + "ooui-outline-control-move-down": "Переместить элемент вниз", + "ooui-outline-control-move-up": "Переместить элемент вверх", + "ooui-outline-control-remove": "Удалить пункт", + "ooui-toolbar-more": "Ещё" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sah.json b/resources/lib/oojs-ui/i18n/sah.json new file mode 100644 index 000000000000..9b3fcc8615c2 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sah.json @@ -0,0 +1,9 @@ +{ + "@metadata": { + "authors": [ + "Gazeb", + "HalanTul" + ] + }, + "ooui-dialog-action-close": "Сап" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/scn.json b/resources/lib/oojs-ui/i18n/scn.json new file mode 100644 index 000000000000..a699911229ab --- /dev/null +++ b/resources/lib/oojs-ui/i18n/scn.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Gazeb", + "Gmelfi", + "HalanTul" + ] + }, + "ooui-dialog-action-close": "Chiùi", + "ooui-outline-control-move-down": "Sposta di sutta", + "ooui-outline-control-move-up": "Sposta di supra", + "ooui-toolbar-more": "Àutri cosi" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sco.json b/resources/lib/oojs-ui/i18n/sco.json new file mode 100644 index 000000000000..f8dc77c72a39 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sco.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "John Reid" + ] + }, + "ooui-dialog-action-close": "Claise", + "ooui-outline-control-move-down": "Muiv eetem doon", + "ooui-outline-control-move-up": "Muiv eetem up", + "ooui-outline-control-remove": "Remuiv eitem", + "ooui-toolbar-more": "Mair" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sh.json b/resources/lib/oojs-ui/i18n/sh.json new file mode 100644 index 000000000000..5e299808c609 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sh.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "OC Ripper" + ] + }, + "ooui-dialog-action-close": "Zatvori", + "ooui-outline-control-move-down": "Pomakni stavku dolje", + "ooui-outline-control-move-up": "Pomakni stavku gore" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/si.json b/resources/lib/oojs-ui/i18n/si.json new file mode 100644 index 000000000000..cf7a9fddb0ca --- /dev/null +++ b/resources/lib/oojs-ui/i18n/si.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Singhalawap", + "පසිඳු කාවින්ද", + "ශ්වෙත" + ] + }, + "ooui-dialog-action-close": "නිමවන්න", + "ooui-outline-control-move-down": "අයිතමය පහලටදමන්න", + "ooui-outline-control-move-up": "අයිතමය ඉහලටදමන්න" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sk.json b/resources/lib/oojs-ui/i18n/sk.json new file mode 100644 index 000000000000..60b6f431455c --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sk.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Mimarik", + "Teslaton" + ] + }, + "ooui-dialog-action-close": "Zatvoriť", + "ooui-outline-control-move-down": "Posunúť položku nadol", + "ooui-outline-control-move-up": "Posunúť položku nahor", + "ooui-toolbar-more": "Viac" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sl.json b/resources/lib/oojs-ui/i18n/sl.json new file mode 100644 index 000000000000..b14d47b0d6e4 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sl.json @@ -0,0 +1,15 @@ +{ + "@metadata": { + "authors": [ + "Dbc334", + "Eleassar", + "Pinky sl", + "Yerpo" + ] + }, + "ooui-dialog-action-close": "Zapri", + "ooui-outline-control-move-down": "Prestavi predmet nižje", + "ooui-outline-control-move-up": "Prestavi predmet višje", + "ooui-outline-control-remove": "Odstrani vnos", + "ooui-toolbar-more": "Več" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sq.json b/resources/lib/oojs-ui/i18n/sq.json new file mode 100644 index 000000000000..24a5af26f850 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sq.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Euriditi", + "Kushtrim", + "Elioqoshi" + ] + }, + "ooui-dialog-action-close": "Mbylle", + "ooui-outline-control-move-down": "Zhvendose artikullin më poshtë", + "ooui-outline-control-move-up": "Zhvendose artikullin më lart", + "ooui-outline-control-remove": "Hiq artikullin", + "ooui-toolbar-more": "Më tepër..." +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sr-ec.json b/resources/lib/oojs-ui/i18n/sr-ec.json new file mode 100644 index 000000000000..7eaaacd1ab52 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sr-ec.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Milicevic01", + "Nikola Smolenski", + "Милан Јелисавчић" + ] + }, + "ooui-dialog-action-close": "Затвори", + "ooui-outline-control-move-down": "Премести ставку на доле", + "ooui-outline-control-move-up": "Премести ставку на горе", + "ooui-outline-control-remove": "Уклони ставку", + "ooui-toolbar-more": "Више" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sv.json b/resources/lib/oojs-ui/i18n/sv.json new file mode 100644 index 000000000000..f7d6f04892ad --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sv.json @@ -0,0 +1,22 @@ +{ + "@metadata": { + "authors": [ + "Ainali", + "Haxpett", + "Jopparn", + "Knuckles", + "Magol", + "Milicevic01", + "Per", + "Sendelbach", + "Skalman", + "WikiPhoenix", + "Lokal Profil" + ] + }, + "ooui-dialog-action-close": "Stäng", + "ooui-outline-control-move-down": "Flytta ned objekt", + "ooui-outline-control-move-up": "Flytta upp objekt", + "ooui-outline-control-remove": "Ta bort objekt", + "ooui-toolbar-more": "Mer" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/sw.json b/resources/lib/oojs-ui/i18n/sw.json new file mode 100644 index 000000000000..1c61b06a287d --- /dev/null +++ b/resources/lib/oojs-ui/i18n/sw.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Lloffiwr", + "Muddyb Blast Producer" + ] + }, + "ooui-dialog-action-close": "Funga", + "ooui-outline-control-move-down": "Sogeza kipengee chini", + "ooui-outline-control-move-up": "Sogeza kipengee juu", + "ooui-toolbar-more": "Zaidi" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ta.json b/resources/lib/oojs-ui/i18n/ta.json new file mode 100644 index 000000000000..a9795fde9fa0 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ta.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Jayarathina", + "Sank", + "Shanmugamp7", + "மதனாஹரன்" + ] + }, + "ooui-dialog-action-close": "மூடுக" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/te.json b/resources/lib/oojs-ui/i18n/te.json new file mode 100644 index 000000000000..a1f12857bb1b --- /dev/null +++ b/resources/lib/oojs-ui/i18n/te.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Arjunaraoc", + "Jayarathina", + "Sank", + "Shanmugamp7", + "Veeven", + "Visdaviva", + "மதனாஹரன்" + ] + }, + "ooui-dialog-action-close": "మూయి" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/th.json b/resources/lib/oojs-ui/i18n/th.json new file mode 100644 index 000000000000..b7ee05ae2aba --- /dev/null +++ b/resources/lib/oojs-ui/i18n/th.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Supasate", + "Taweetham" + ] + }, + "ooui-dialog-action-close": "ปิด", + "ooui-outline-control-move-down": "เลื่อนรายการลง", + "ooui-outline-control-move-up": "ย้ายรายการขึ้น" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/tl.json b/resources/lib/oojs-ui/i18n/tl.json new file mode 100644 index 000000000000..a0738824511e --- /dev/null +++ b/resources/lib/oojs-ui/i18n/tl.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "AnakngAraw", + "Sky Harbor" + ] + }, + "ooui-dialog-action-close": "Isara", + "ooui-outline-control-move-down": "Ilipat ang aytem pababa", + "ooui-outline-control-move-up": "Ilipat ang aytem pataas", + "ooui-toolbar-more": "Marami pa" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/tr.json b/resources/lib/oojs-ui/i18n/tr.json new file mode 100644 index 000000000000..94d34a2d03fa --- /dev/null +++ b/resources/lib/oojs-ui/i18n/tr.json @@ -0,0 +1,17 @@ +{ + "@metadata": { + "authors": [ + "Emperyan", + "Incelemeelemani", + "LuCKY", + "Maidis", + "Rapsar", + "Talha Samil Cakir", + "TurkishStyles" + ] + }, + "ooui-dialog-action-close": "Kapat", + "ooui-outline-control-move-down": "Ögeyi aşağı taşı", + "ooui-outline-control-move-up": "Ögeyi yukarı taşı", + "ooui-toolbar-more": "Daha fazla" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/tt-cyrl.json b/resources/lib/oojs-ui/i18n/tt-cyrl.json new file mode 100644 index 000000000000..1c0bd90cccfe --- /dev/null +++ b/resources/lib/oojs-ui/i18n/tt-cyrl.json @@ -0,0 +1,10 @@ +{ + "@metadata": { + "authors": [ + "Ajdar" + ] + }, + "ooui-dialog-action-close": "Ябу", + "ooui-outline-control-move-down": "Элементны аска күчерү", + "ooui-outline-control-move-up": "Элементны өскә күчерү" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/ug-arab.json b/resources/lib/oojs-ui/i18n/ug-arab.json new file mode 100644 index 000000000000..efba086e7166 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/ug-arab.json @@ -0,0 +1,9 @@ +{ + "@metadata": { + "authors": [ + "Sahran", + "Tel'et", + "Tifinaghes" + ] + } +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/uk.json b/resources/lib/oojs-ui/i18n/uk.json new file mode 100644 index 000000000000..42487c94efcd --- /dev/null +++ b/resources/lib/oojs-ui/i18n/uk.json @@ -0,0 +1,25 @@ +{ + "@metadata": { + "authors": [ + "AS", + "Aced", + "Ahonc", + "Andriykopanytsia", + "Base", + "Perohanych", + "RLuts", + "Sahran", + "Sergento", + "Steve.rusyn", + "SteveR", + "Tel'et", + "Tifinaghes", + "Ата" + ] + }, + "ooui-dialog-action-close": "Закрити", + "ooui-outline-control-move-down": "Перемістити елемент униз", + "ooui-outline-control-move-up": "Перемістити елемент вгору", + "ooui-outline-control-remove": "Видалити елемент", + "ooui-toolbar-more": "Більше" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/uz.json b/resources/lib/oojs-ui/i18n/uz.json new file mode 100644 index 000000000000..473fc75b5225 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/uz.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "CoderSI", + "Noor2020", + "Sociologist", + "පසිඳු කාවින්ද" + ] + }, + "ooui-dialog-action-close": "Yopish", + "ooui-outline-control-move-down": "Elementni pastga koʻchirish", + "ooui-outline-control-move-up": "Elementni yuqoriga koʻchirish", + "ooui-toolbar-more": "Yana" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/vec.json b/resources/lib/oojs-ui/i18n/vec.json new file mode 100644 index 000000000000..01833f7a961c --- /dev/null +++ b/resources/lib/oojs-ui/i18n/vec.json @@ -0,0 +1,12 @@ +{ + "@metadata": { + "authors": [ + "Candalua", + "GatoSelvadego" + ] + }, + "ooui-dialog-action-close": "Sara", + "ooui-outline-control-move-down": "Sposta in baso", + "ooui-outline-control-move-up": "Sposta in sima", + "ooui-toolbar-more": "Altro" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/vi.json b/resources/lib/oojs-ui/i18n/vi.json new file mode 100644 index 000000000000..342ad6f89edd --- /dev/null +++ b/resources/lib/oojs-ui/i18n/vi.json @@ -0,0 +1,14 @@ +{ + "@metadata": { + "authors": [ + "Cheers!", + "Jdforrester", + "Minh Nguyen" + ] + }, + "ooui-dialog-action-close": "Đóng", + "ooui-outline-control-move-down": "Chuyển mục xuống", + "ooui-outline-control-move-up": "Chuyển mục lên", + "ooui-outline-control-remove": "Xóa khoản", + "ooui-toolbar-more": "Thêm" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/vo.json b/resources/lib/oojs-ui/i18n/vo.json new file mode 100644 index 000000000000..2ed7e2f3d5bd --- /dev/null +++ b/resources/lib/oojs-ui/i18n/vo.json @@ -0,0 +1,9 @@ +{ + "@metadata": { + "authors": [ + "Malafaya" + ] + }, + "ooui-dialog-action-close": "Färmükön", + "ooui-toolbar-more": "Pluikos" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/wuu.json b/resources/lib/oojs-ui/i18n/wuu.json new file mode 100644 index 000000000000..72aa48be226b --- /dev/null +++ b/resources/lib/oojs-ui/i18n/wuu.json @@ -0,0 +1,9 @@ +{ + "@metadata": { + "authors": [ + "Malafaya", + "十弌" + ] + }, + "ooui-toolbar-more": "還多" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/yi.json b/resources/lib/oojs-ui/i18n/yi.json new file mode 100644 index 000000000000..ab5c5102f870 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/yi.json @@ -0,0 +1,13 @@ +{ + "@metadata": { + "authors": [ + "Malafaya", + "פוילישער", + "十弌" + ] + }, + "ooui-dialog-action-close": "שליסן", + "ooui-outline-control-move-down": "רוקן עלעמענט אראפ", + "ooui-outline-control-move-up": "רוקן עלעמענט ארויף", + "ooui-toolbar-more": "נאך" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/yo.json b/resources/lib/oojs-ui/i18n/yo.json new file mode 100644 index 000000000000..f71d3ddbab40 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/yo.json @@ -0,0 +1,11 @@ +{ + "@metadata": { + "authors": [ + "Demmy" + ] + }, + "ooui-dialog-action-close": "Ìpadé", + "ooui-outline-control-move-down": "Sún onítòún sí sàlẹ̀", + "ooui-outline-control-move-up": "Sún onítòún s'ókè", + "ooui-toolbar-more": "Míràn" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/zh-hans.json b/resources/lib/oojs-ui/i18n/zh-hans.json new file mode 100644 index 000000000000..19d9c7e9b513 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/zh-hans.json @@ -0,0 +1,26 @@ +{ + "@metadata": { + "authors": [ + "Anakmalaysia", + "Bencmq", + "Demmy", + "Hydra", + "Hzy980512", + "Liangent", + "Liuxinyu970226", + "Qiyue2001", + "Shirayuki", + "Shizhao", + "TianyinLee", + "Xiaomingyan", + "Yfdyh000", + "Zhangjintao", + "乌拉跨氪" + ] + }, + "ooui-dialog-action-close": "关闭", + "ooui-outline-control-move-down": "下移项", + "ooui-outline-control-move-up": "上移项", + "ooui-outline-control-remove": "删除项", + "ooui-toolbar-more": "更多" +} diff --git a/resources/lib/oojs-ui/i18n/zh-hant.json b/resources/lib/oojs-ui/i18n/zh-hant.json new file mode 100644 index 000000000000..6e7b12e77ffa --- /dev/null +++ b/resources/lib/oojs-ui/i18n/zh-hant.json @@ -0,0 +1,23 @@ +{ + "@metadata": { + "authors": [ + "Anakmalaysia", + "Ch.Andrew", + "Hydra", + "Justincheng12345", + "Liflon", + "Liuxinyu970226", + "Qiyue2001", + "Radish10cm", + "Shirayuki", + "Simon Shek", + "Spring Roll Conan", + "Waihorace" + ] + }, + "ooui-dialog-action-close": "關閉", + "ooui-outline-control-move-down": "向下移項", + "ooui-outline-control-move-up": "向上移項", + "ooui-outline-control-remove": "移除項", + "ooui-toolbar-more": "更多" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/zh-hk.json b/resources/lib/oojs-ui/i18n/zh-hk.json new file mode 100644 index 000000000000..60e8fbdde51c --- /dev/null +++ b/resources/lib/oojs-ui/i18n/zh-hk.json @@ -0,0 +1,4 @@ +{ + "@metadata": [], + "ooui-dialog-action-close": "關閉" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/i18n/zh-tw.json b/resources/lib/oojs-ui/i18n/zh-tw.json new file mode 100644 index 000000000000..f7987e514993 --- /dev/null +++ b/resources/lib/oojs-ui/i18n/zh-tw.json @@ -0,0 +1,7 @@ +{ + "@metadata": [], + "ooui-dialog-action-close": "關閉", + "ooui-outline-control-move-down": "向下移", + "ooui-outline-control-move-up": "向上移", + "ooui-toolbar-more": "更多" +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/images/fade-down.png b/resources/lib/oojs-ui/images/fade-down.png Binary files differnew file mode 100644 index 000000000000..50c7931ed735 --- /dev/null +++ b/resources/lib/oojs-ui/images/fade-down.png diff --git a/resources/lib/oojs-ui/images/fade-up.png b/resources/lib/oojs-ui/images/fade-up.png Binary files differnew file mode 100644 index 000000000000..7a0cb87c3b88 --- /dev/null +++ b/resources/lib/oojs-ui/images/fade-up.png diff --git a/resources/lib/oojs-ui/images/icons/accept.png b/resources/lib/oojs-ui/images/icons/accept.png Binary files differnew file mode 100644 index 000000000000..1075110f5109 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/accept.png diff --git a/resources/lib/oojs-ui/images/icons/accept.svg b/resources/lib/oojs-ui/images/icons/accept.svg new file mode 100644 index 000000000000..df78186b67ae --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/accept.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="apply" style="opacity:0.75;"> + <polygon id="check" style="fill-rule:evenodd;clip-rule:evenodd;" points="19.062,5.139 17.418,4 8.867,16.357 5.413,12.903 4,14.316 9.021,19.338"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/add-item.png b/resources/lib/oojs-ui/images/icons/add-item.png Binary files differnew file mode 100644 index 000000000000..5cf353f06d80 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/add-item.png diff --git a/resources/lib/oojs-ui/images/icons/add-item.svg b/resources/lib/oojs-ui/images/icons/add-item.svg new file mode 100644 index 000000000000..2620e76cde07 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/add-item.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="apply" style="opacity:0.75;"> + <path d="M13,8 L11,8 L11,11 L8,11 L8,13 L11,13 L11,16 L13,16 L13,13 L16,13 L16,11 L13,11 z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/advanced.png b/resources/lib/oojs-ui/images/icons/advanced.png Binary files differnew file mode 100644 index 000000000000..7f5ada53d9a7 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/advanced.png diff --git a/resources/lib/oojs-ui/images/icons/advanced.svg b/resources/lib/oojs-ui/images/icons/advanced.svg new file mode 100644 index 000000000000..3e87cabad22b --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/advanced.svg @@ -0,0 +1,17 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="settings" style="opacity:0.75;"> + <path id="gear" style="fill-rule:evenodd;clip-rule:evenodd;" d="M20.869,13.476C20.948,12.994,21,12.504,21,12 + s-0.052-0.994-0.131-1.476l-2.463-0.259c-0.149-0.556-0.367-1.082-0.648-1.57l1.558-1.924c-0.576-0.806-1.281-1.511-2.087-2.087 + l-1.924,1.558c-0.488-0.281-1.015-0.499-1.57-0.648l-0.259-2.463C12.994,3.052,12.504,3,12,3s-0.994,0.052-1.476,0.131 + l-0.259,2.463C9.71,5.743,9.184,5.961,8.695,6.242L6.771,4.685C5.966,5.261,5.261,5.966,4.685,6.771l1.558,1.924 + c-0.281,0.488-0.499,1.015-0.648,1.57l-2.463,0.259C3.052,11.006,3,11.496,3,12s0.052,0.994,0.131,1.476l2.463,0.259 + c0.149,0.556,0.367,1.082,0.648,1.57l-1.558,1.924c0.576,0.806,1.281,1.511,2.087,2.087l1.924-1.558 + c0.488,0.281,1.015,0.499,1.57,0.648l0.259,2.463C11.006,20.948,11.496,21,12,21s0.994-0.052,1.476-0.131l0.259-2.463 + c0.556-0.149,1.082-0.367,1.57-0.648l1.924,1.558c0.806-0.576,1.511-1.281,2.087-2.087l-1.558-1.924 + c0.281-0.488,0.499-1.015,0.648-1.57L20.869,13.476z M12,15.998c-2.209,0-3.998-1.789-3.998-3.998S9.791,8.002,12,8.002 + S15.998,9.791,15.998,12S14.209,15.998,12,15.998z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/alert.png b/resources/lib/oojs-ui/images/icons/alert.png Binary files differnew file mode 100644 index 000000000000..992ea2ab38dd --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/alert.png diff --git a/resources/lib/oojs-ui/images/icons/alert.svg b/resources/lib/oojs-ui/images/icons/alert.svg new file mode 100644 index 000000000000..886a7c03b808 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/alert.svg @@ -0,0 +1,10 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="alert" style="opacity:0.75;"> + <rect id="point" x="11" y="16" style="fill-rule:evenodd;clip-rule:evenodd;" width="2" height="2"/> + <polygon id="stroke" style="fill-rule:evenodd;clip-rule:evenodd;" points="13.516,10 10.516,10 11,15 13,15"/> + <path id="triangle" d="M12.017,5.974L19.536,19H4.496L12.017,5.974 M12.017,3.5c-0.544,0-1.088,0.357-1.5,1.071L2.532,18.402 C1.707,19.831,2.382,21,4.032,21H20c1.65,0,2.325-1.169,1.5-2.599L13.517,4.572C13.104,3.857,12.561,3.5,12.017,3.5L12.017,3.5z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/arched-arrow-ltr.png b/resources/lib/oojs-ui/images/icons/arched-arrow-ltr.png Binary files differnew file mode 100644 index 000000000000..5db1c4da63b0 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/arched-arrow-ltr.png diff --git a/resources/lib/oojs-ui/images/icons/arched-arrow-ltr.svg b/resources/lib/oojs-ui/images/icons/arched-arrow-ltr.svg new file mode 100644 index 000000000000..5b343a5323f1 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/arched-arrow-ltr.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="arched-arrow-ltr" style="opacity:0.75;"> + <path id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" d="M19.925,14.937l-2.391-6.901l-1.48,2.329 c-0.964-0.845-2.699-1.85-5.513-1.823c-4.887,0.046-6.524,4.244-6.524,4.244s2.753-2.639,6.925-1.949 c1.729,0.286,3.007,1.206,3.675,1.791l-1.474,2.319L19.925,14.937z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/arched-arrow-rtl.png b/resources/lib/oojs-ui/images/icons/arched-arrow-rtl.png Binary files differnew file mode 100644 index 000000000000..7931971b2626 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/arched-arrow-rtl.png diff --git a/resources/lib/oojs-ui/images/icons/arched-arrow-rtl.svg b/resources/lib/oojs-ui/images/icons/arched-arrow-rtl.svg new file mode 100644 index 000000000000..bb5f10ecc8cf --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/arched-arrow-rtl.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="arched-arrow-rtl" style="opacity:0.75;"> + <path id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" d="M13.401,8.542c-2.814-0.027-4.549,0.978-5.513,1.823 l-1.48-2.329l-2.391,6.901l6.782,0.009l-1.474-2.319c0.668-0.584,1.945-1.504,3.675-1.791c4.172-0.69,6.925,1.949,6.925,1.949 S18.288,8.588,13.401,8.542z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/check.png b/resources/lib/oojs-ui/images/icons/check.png Binary files differnew file mode 100644 index 000000000000..82c3cb4b6704 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/check.png diff --git a/resources/lib/oojs-ui/images/icons/check.svg b/resources/lib/oojs-ui/images/icons/check.svg new file mode 100644 index 000000000000..e67cd6cfc097 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/check.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="UTF-8"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24" height="24" viewBox="0, 0, 24, 24"> + <g id="check"> + <path d="M7.105,13.473 L8.527,12.05 L10.428,13.952 L15.238,7 L16.895,8.148 L10.635,17 z" fill="#000000"/> + </g> + <defs/> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/clear.png b/resources/lib/oojs-ui/images/icons/clear.png Binary files differnew file mode 100644 index 000000000000..697dd62bcbfd --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/clear.png diff --git a/resources/lib/oojs-ui/images/icons/clear.svg b/resources/lib/oojs-ui/images/icons/clear.svg new file mode 100644 index 000000000000..d83eb02b0d49 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/clear.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="clear" style="opacity:0.75;"> + <path id="circle_with_strike" style="fill-rule:evenodd;clip-rule:evenodd;" d="M11.999,5.022c-3.853,0-6.977,3.124-6.977,6.978 c0,3.853,3.124,6.978,6.977,6.978c3.854,0,6.979-3.125,6.979-6.978C18.978,8.146,15.853,5.022,11.999,5.022z M6.886,12 c0-1.092,0.572-3.25,0.93-2.929l7.113,7.113c0.488,0.525-1.837,0.931-2.93,0.931C9.174,17.114,6.886,14.824,6.886,12z M16.184,14.929L9.07,7.816c-0.445-0.483,1.837-0.931,2.929-0.931c2.827,0,5.115,2.289,5.115,5.114 C17.114,13.092,16.75,15.542,16.184,14.929z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/close.png b/resources/lib/oojs-ui/images/icons/close.png Binary files differnew file mode 100644 index 000000000000..f7eed9fe5018 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/close.png diff --git a/resources/lib/oojs-ui/images/icons/close.svg b/resources/lib/oojs-ui/images/icons/close.svg new file mode 100644 index 000000000000..a0118c2ffe0b --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/close.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="close" style="opacity:0.75;"> + <polygon id="x" style="fill-rule:evenodd;clip-rule:evenodd;" points="18.717,6.697 17.303,5.283 12,10.586 6.697,5.283 5.283,6.697 10.586,12 5.283,17.303 6.697,18.717 12,13.414 17.303,18.717 18.717,17.303 13.414,12 "/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/code.png b/resources/lib/oojs-ui/images/icons/code.png Binary files differnew file mode 100644 index 000000000000..a5ebdbf782a3 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/code.png diff --git a/resources/lib/oojs-ui/images/icons/code.svg b/resources/lib/oojs-ui/images/icons/code.svg new file mode 100644 index 000000000000..6f1ed53a97cb --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/code.svg @@ -0,0 +1,14 @@ +<?xml version="1.0" encoding="utf-8"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" id="Layer_1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" + width="24px" height="24px" viewBox="0 0 24 24" enable-background="new 0 0 24 24" xml:space="preserve"> +<g id="code" opacity="0.75"> + <path id="left-bracket" d="M4,12v-1h1c1,0,1,0,1-1V7.614C6,7.1,6.024,6.718,6.073,6.472C6.127,6.22,6.212,6.009,6.33,5.839 + C6.534,5.56,6.803,5.364,7.138,5.255C7.473,5.14,8.01,5,8.973,5H10v1H9.248c-0.457,0-0.77,0.191-0.936,0.408 + C8.145,6.623,8,6.853,8,7.476v1.857c0,0.729-0.041,1.18-0.244,1.493c-0.2,0.307-0.562,0.529-1.09,0.667 + c0.535,0.155,0.9,0.385,1.096,0.688C7.961,12.484,8,12.938,8,13.665v1.862c0,0.619,0.145,0.848,0.312,1.062 + c0.166,0.22,0.479,0.407,0.936,0.407L10,17l0,0v1H8.973c-0.963,0-1.5-0.133-1.835-0.248c-0.335-0.109-0.604-0.307-0.808-0.591 + c-0.118-0.165-0.203-0.374-0.257-0.625C6.024,16.283,6,15.9,6,15.387V13c0-1,0-1-1-1H4z"/> + <use transform="matrix(-1,0,0,1,24,0)" id="right-bracket" x="0" y="0" width="24" height="24" xlink:href="#left-bracket" /> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/collapse.png b/resources/lib/oojs-ui/images/icons/collapse.png Binary files differnew file mode 100644 index 000000000000..38b796fae9a3 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/collapse.png diff --git a/resources/lib/oojs-ui/images/icons/collapse.svg b/resources/lib/oojs-ui/images/icons/collapse.svg new file mode 100644 index 000000000000..a89cebf9fac8 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/collapse.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="collapse" style="opacity:0.75;"> + <polygon id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" points="6.697,15.714 12,10.412 17.303,15.714 18.717,14.3 12,7.583 5.283,14.3"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/comment.png b/resources/lib/oojs-ui/images/icons/comment.png Binary files differnew file mode 100644 index 000000000000..95464559001d --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/comment.png diff --git a/resources/lib/oojs-ui/images/icons/comment.svg b/resources/lib/oojs-ui/images/icons/comment.svg new file mode 100644 index 000000000000..e052935bffb1 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/comment.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="comment" style="opacity:0.75;"> + <path id="speech_bubble" style="fill-rule:evenodd;clip-rule:evenodd;" d="M15,6H9C7.343,6,6,7.344,6,9v4c0,1.656,1.343,3,3,3v3 l3-3h3c1.657,0,3-1.344,3-3V9C18,7.344,16.657,6,15,6z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/expand.png b/resources/lib/oojs-ui/images/icons/expand.png Binary files differnew file mode 100644 index 000000000000..e90aca1c24ab --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/expand.png diff --git a/resources/lib/oojs-ui/images/icons/expand.svg b/resources/lib/oojs-ui/images/icons/expand.svg new file mode 100644 index 000000000000..b542f5f41973 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/expand.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="expand" style="opacity:0.75;"> + <polygon id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" points="17.303,8.283 12,13.586 6.697,8.283 5.283,9.697 12,16.414 18.717,9.697"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/help.png b/resources/lib/oojs-ui/images/icons/help.png Binary files differnew file mode 100644 index 000000000000..dca745bc4b6c --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/help.png diff --git a/resources/lib/oojs-ui/images/icons/help.svg b/resources/lib/oojs-ui/images/icons/help.svg new file mode 100644 index 000000000000..c68bdda84263 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/help.svg @@ -0,0 +1,12 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="help" style="opacity:0.75;"> + <path id="circle" style="fill-rule:evenodd;clip-rule:evenodd;" d="M12.001,2.085c-5.478,0-9.916,4.438-9.916,9.916 c0,5.476,4.438,9.914,9.916,9.914c5.476,0,9.914-4.438,9.914-9.914C21.915,6.523,17.477,2.085,12.001,2.085z M12.002,20.085 c-4.465,0-8.084-3.619-8.084-8.083c0-4.465,3.619-8.084,8.084-8.084c4.464,0,8.083,3.619,8.083,8.084 C20.085,16.466,16.466,20.085,12.002,20.085z"/> + <g id="question_mark"> + <path id="top" style="fill-rule:evenodd;clip-rule:evenodd;" d="M11.766,6.688c-2.5,0-3.219,2.188-3.219,2.188l1.411,0.854 c0,0,0.298-0.791,0.901-1.229c0.516-0.375,1.625-0.625,2.219,0.125c0.701,0.885-0.17,1.587-1.078,2.719 C11.047,12.531,11,15,11,15h1.969c0,0,0.135-2.318,1.041-3.381c0.603-0.707,1.443-1.338,1.443-2.494S14.266,6.688,11.766,6.688z"/> + <rect id="bottom" x="11" y="16" style="fill-rule:evenodd;clip-rule:evenodd;" width="2" height="2"/> + </g> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/history.png b/resources/lib/oojs-ui/images/icons/history.png Binary files differnew file mode 100644 index 000000000000..c0499313275d --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/history.png diff --git a/resources/lib/oojs-ui/images/icons/history.svg b/resources/lib/oojs-ui/images/icons/history.svg new file mode 100644 index 000000000000..40c0ae30dc55 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/history.svg @@ -0,0 +1,9 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="history" style="opacity:0.75;"> + <path id="clock_hands" style="fill-rule:evenodd;clip-rule:evenodd;" d="M17.26,15.076c0,0-2.385-1.935-4.005-3.062 c0.72-2.397,1.702-6.559,1.702-6.559s-4.35,5.363-4.877,6.699c-0.463,1.168,1.459,2.209,2.346,1.678 C14.326,14.383,17.26,15.076,17.26,15.076z"/> + <path id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" d="M12.086,2.085c-5.478,0-9.916,4.438-9.916,9.916 c0,1.783,0.476,3.454,1.301,4.898l-2.223,2.04h5.688v-5.219l-2.066,1.896c-0.55-1.088-0.866-2.312-0.866-3.615 c0-4.465,3.619-8.084,8.084-8.084c4.464,0,8.083,3.619,8.083,8.084c0,4.464-3.619,8.083-8.083,8.083 c-1.145,0-2.228-0.247-3.213-0.678l-0.833,1.634c1.235,0.557,2.602,0.874,4.045,0.874c5.476,0,9.914-4.438,9.914-9.914 C22,6.523,17.562,2.085,12.086,2.085z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/link.png b/resources/lib/oojs-ui/images/icons/link.png Binary files differnew file mode 100644 index 000000000000..7dfa26806926 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/link.png diff --git a/resources/lib/oojs-ui/images/icons/link.svg b/resources/lib/oojs-ui/images/icons/link.svg new file mode 100644 index 000000000000..dadf69ca70d3 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/link.svg @@ -0,0 +1,15 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="link" style="opacity:0.75;"> + <path id="right" d="M19.188,12.001c0,1.1-0.891,2.015-1.988,2.015l-4.195-0.015C13.543,15.089,13.968,16,15.002,16h3 + C19.658,16,21,13.657,21,12s-1.342-4-2.998-4h-3c-1.034,0-1.459,0.911-1.998,1.999l4.195-0.015 + C18.297,9.984,19.188,10.901,19.188,12.001z"/> + <path id="center" d="M8,12c0,0.535,0.42,1,0.938,1h6.109c0.518,0,0.938-0.465,0.938-1c0-0.534-0.42-1-0.938-1H8.938 + C8.42,11,8,11.466,8,12z"/> + <path id="left" d="M4.816,11.999c0-1.1,0.891-2.015,1.988-2.015L11,9.999C10.461,8.911,10.036,8,9.002,8h-3 + c-1.656,0-2.998,2.343-2.998,4s1.342,4,2.998,4h3c1.034,0,1.459-0.911,1.998-1.999l-4.195,0.015 + C5.707,14.016,4.816,13.099,4.816,11.999z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/menu.png b/resources/lib/oojs-ui/images/icons/menu.png Binary files differnew file mode 100644 index 000000000000..b5ac60f13a2e --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/menu.png diff --git a/resources/lib/oojs-ui/images/icons/menu.svg b/resources/lib/oojs-ui/images/icons/menu.svg new file mode 100644 index 000000000000..657fab217952 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/menu.svg @@ -0,0 +1,10 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="menu" style="opacity:0.75;"> + <path id="lines" d="M6,15h12c0.553,0,1,0.447,1,1v1c0,0.553-0.447,1-1,1H6c-0.553,0-1-0.447-1-1v-1C5,15.447,5.447,15,6,15z M5,11v1 + c0,0.553,0.447,1,1,1h12c0.553,0,1-0.447,1-1v-1c0-0.553-0.447-1-1-1H6C5.447,10,5,10.447,5,11z M5,6v1c0,0.553,0.447,1,1,1h12 + c0.553,0,1-0.447,1-1V6c0-0.553-0.447-1-1-1H6C5.447,5,5,5.447,5,6z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/move-ltr.png b/resources/lib/oojs-ui/images/icons/move-ltr.png Binary files differnew file mode 100644 index 000000000000..ded5f05a2851 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/move-ltr.png diff --git a/resources/lib/oojs-ui/images/icons/move-ltr.svg b/resources/lib/oojs-ui/images/icons/move-ltr.svg new file mode 100644 index 000000000000..a378a5d8aeca --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/move-ltr.svg @@ -0,0 +1,9 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="move-ltr" style="opacity:0.75;"> + <polygon id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" points="8.935,7.181 14.237,12.483 8.935,17.786 + 10.349,19.2 17.065,12.483 10.349,5.767"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/move-rtl.png b/resources/lib/oojs-ui/images/icons/move-rtl.png Binary files differnew file mode 100644 index 000000000000..fc6e62d585b1 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/move-rtl.png diff --git a/resources/lib/oojs-ui/images/icons/move-rtl.svg b/resources/lib/oojs-ui/images/icons/move-rtl.svg new file mode 100644 index 000000000000..c0b334b60b90 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/move-rtl.svg @@ -0,0 +1,9 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="move-rtl" style="opacity:0.75;"> + <polygon id="arrow_9_" style="fill-rule:evenodd;clip-rule:evenodd;" points="15.065,17.786 9.763,12.483 15.065,7.181 + 13.651,5.767 6.935,12.483 13.651,19.2"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/picture.png b/resources/lib/oojs-ui/images/icons/picture.png Binary files differnew file mode 100644 index 000000000000..faf8af9493d7 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/picture.png diff --git a/resources/lib/oojs-ui/images/icons/picture.svg b/resources/lib/oojs-ui/images/icons/picture.svg new file mode 100644 index 000000000000..078ce102309c --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/picture.svg @@ -0,0 +1,12 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="picture" style="opacity:0.75;"> + <path id="frame" style="fill-rule:evenodd;clip-rule:evenodd;" d="M18,4H6C4,3.993,3,4.993,3,6.993L3.014,16C3,18,4,18.988,6,19h12 + c2-0.012,2.994-1,3-3.006V6.993C20.994,4.993,20,3.993,18,4z M19,17H5V6h14V17z"/> + <polygon id="mountains" style="fill-rule:evenodd;clip-rule:evenodd;" points="6,13.5 9.5,10 11.828,12.312 10.516,13.406 + 11.391,14.438 15.5,11 18,13 18,16 6,16"/> + <polygon id="sky" style="fill-rule:evenodd;clip-rule:evenodd;" points="6,12 9.516,7.844 12.562,11.016 15.5,9 18,11 18,7 6,7"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/remove-item.png b/resources/lib/oojs-ui/images/icons/remove-item.png Binary files differnew file mode 100644 index 000000000000..2f11db3ad35b --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/remove-item.png diff --git a/resources/lib/oojs-ui/images/icons/remove-item.svg b/resources/lib/oojs-ui/images/icons/remove-item.svg new file mode 100644 index 000000000000..b95e7d3ad314 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/remove-item.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="UTF-8"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24" height="24" viewBox="0, 0, 24, 24"> + <g id="remove-item"> + <path d="M8,11 L16,11 L16,13 L8,13 z" fill="#000000"/> + </g> + <defs/> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/remove.png b/resources/lib/oojs-ui/images/icons/remove.png Binary files differnew file mode 100644 index 000000000000..d7e116cf5a40 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/remove.png diff --git a/resources/lib/oojs-ui/images/icons/remove.svg b/resources/lib/oojs-ui/images/icons/remove.svg new file mode 100644 index 000000000000..17c8d39a090f --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/remove.svg @@ -0,0 +1,9 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="remove" style="opacity:0.75;"> + <path id="trash_can" style="fill-rule:evenodd;clip-rule:evenodd;" d="M12,10h-1v6h1V10z M10,10H9v6h1V10z M14,10h-1v6h1V10z + M14,6V5H9v1H6v3h1v7.966l1,1.031v-0.074V18h6.984L15,17.982v0.015l1-1.031V9h1V6H14z M15,17H8V9h7V17z M16,8H7V7h9V8z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/search.png b/resources/lib/oojs-ui/images/icons/search.png Binary files differnew file mode 100644 index 000000000000..df29792c696d --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/search.png diff --git a/resources/lib/oojs-ui/images/icons/search.svg b/resources/lib/oojs-ui/images/icons/search.svg new file mode 100644 index 000000000000..37feda424616 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/search.svg @@ -0,0 +1,13 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!-- Generator: Adobe Illustrator 16.0.0, SVG Export Plug-In . SVG Version: 6.00 Build 0) --> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="search" style="opacity:0.75;"> + <path id="magnifying_glass" d="M16.021,15.96l-2.374-2.375c-0.048-0.047-0.105-0.079-0.169-0.099c0.403-0.566,0.643-1.26,0.643-2.009 + C14.12,9.557,12.563,8,10.644,8c-1.921,0-3.478,1.557-3.478,3.478c0,1.92,1.557,3.477,3.478,3.477c0.749,0,1.442-0.239,2.01-0.643 + c0.019,0.063,0.051,0.121,0.098,0.169l2.375,2.374c0.19,0.189,0.543,0.143,0.79-0.104S16.21,16.15,16.021,15.96z M10.644,13.69 + c-1.221,0-2.213-0.991-2.213-2.213c0-1.221,0.992-2.213,2.213-2.213c1.222,0,2.213,0.992,2.213,2.213 + C12.856,12.699,11.865,13.69,10.644,13.69z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/settings.png b/resources/lib/oojs-ui/images/icons/settings.png Binary files differnew file mode 100644 index 000000000000..b1b35e9e7826 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/settings.png diff --git a/resources/lib/oojs-ui/images/icons/settings.svg b/resources/lib/oojs-ui/images/icons/settings.svg new file mode 100644 index 000000000000..1464a793ea72 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/settings.svg @@ -0,0 +1,16 @@ +<?xml version="1.0" encoding="UTF-8"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24" height="24" viewBox="0, 0, 24, 24"> + <g id="settings" opacity="0.75"> + <path d="M3,4 L6,4 L6,6 L3,6 z" fill="#000000"/> + <path d="M12,4 L21,4 L21,6 L12,6 z" fill="#000000"/> + <path d="M8,3 L10,3 C10.552,3 11,3.448 11,4 L11,6 C11,6.552 10.552,7 10,7 L8,7 C7.448,7 7,6.552 7,6 L7,4 C7,3.448 7.448,3 8,3 z" fill="#000000"/> + <path d="M3,11 L12,11 L12,13 L3,13 z" fill="#000000"/> + <path d="M18,11 L21,11 L21,13 L18,13 z" fill="#000000"/> + <path d="M14,10 L16,10 C16.552,10 17,10.448 17,11 L17,13 C17,13.552 16.552,14 16,14 L14,14 C13.448,14 13,13.552 13,13 L13,11 C13,10.448 13.448,10 14,10 z" fill="#000000"/> + <path d="M3,18 L9,18 L9,20 L3,20 z" fill="#000000"/> + <path d="M15,18 L21,18 L21,20 L15,20 z" fill="#000000"/> + <path d="M11,17 L13,17 C13.552,17 14,17.448 14,18 L14,20 C14,20.552 13.552,21 13,21 L11,21 C10.448,21 10,20.552 10,20 L10,18 C10,17.448 10.448,17 11,17 z" fill="#000000"/> + </g> + <defs/> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/tag.png b/resources/lib/oojs-ui/images/icons/tag.png Binary files differnew file mode 100644 index 000000000000..722f4d7ab085 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/tag.png diff --git a/resources/lib/oojs-ui/images/icons/tag.svg b/resources/lib/oojs-ui/images/icons/tag.svg new file mode 100644 index 000000000000..d21e5e3cf9a0 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/tag.svg @@ -0,0 +1,11 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="tag" style="opacity:0.75;"> + <path d="M18.748,11.717c0.389,0.389,0.389,1.025,0,1.414l-4.949,4.95c-0.389,0.389-1.025,0.389-1.414,0l-6.01-6.01 + c-0.389-0.389-0.707-1.157-0.707-1.707L5.667,6c0-0.55,0.45-1,1-1h4.364c0.55,0,1.318,0.318,1.707,0.707L18.748,11.717z + M8.104,7.456C7.525,8.032,7.526,8.97,8.103,9.549c0.578,0.577,1.516,0.577,2.095,0.001c0.576-0.578,0.576-1.517,0-2.095 + C9.617,6.879,8.68,6.878,8.104,7.456z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/icons/window.png b/resources/lib/oojs-ui/images/icons/window.png Binary files differnew file mode 100644 index 000000000000..3d48a3cf3f33 --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/window.png diff --git a/resources/lib/oojs-ui/images/icons/window.svg b/resources/lib/oojs-ui/images/icons/window.svg new file mode 100644 index 000000000000..621cf2c8c62c --- /dev/null +++ b/resources/lib/oojs-ui/images/icons/window.svg @@ -0,0 +1,10 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="24px" + height="24px" viewBox="0 0 24 24" style="enable-background:new 0 0 24 24;" xml:space="preserve"> +<g id="window" style="opacity:0.75;"> + <rect id="title" x="7" y="10" width="10" height="1"/> + <path id="window" d="M16,19H8c-2.206,0-4-1.794-4-4V9c0-2.206,1.794-4,4-4h8c2.206,0,4,1.794,4,4v6C20,17.206,18.206,19,16,19z + M8,7C6.897,7,6,7.897,6,9v6c0,1.103,0.897,2,2,2h8c1.103,0,2-0.897,2-2V9c0-1.103-0.897-2-2-2H8z"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/indicators/down.png b/resources/lib/oojs-ui/images/indicators/down.png Binary files differnew file mode 100644 index 000000000000..47ff54cbed58 --- /dev/null +++ b/resources/lib/oojs-ui/images/indicators/down.png diff --git a/resources/lib/oojs-ui/images/indicators/down.svg b/resources/lib/oojs-ui/images/indicators/down.svg new file mode 100644 index 000000000000..c871f603d77f --- /dev/null +++ b/resources/lib/oojs-ui/images/indicators/down.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="12px" + height="12px" viewBox="0 0 12 12" style="enable-background:new 0 0 12 12;" xml:space="preserve"> +<g id="down" style="opacity:0.75;"> + <polygon id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" points="2.023,3 5.512,8.953 9,3"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/indicators/required.png b/resources/lib/oojs-ui/images/indicators/required.png Binary files differnew file mode 100644 index 000000000000..aeb35a3c0e72 --- /dev/null +++ b/resources/lib/oojs-ui/images/indicators/required.png diff --git a/resources/lib/oojs-ui/images/indicators/required.svg b/resources/lib/oojs-ui/images/indicators/required.svg new file mode 100644 index 000000000000..7c60ec0b0d6f --- /dev/null +++ b/resources/lib/oojs-ui/images/indicators/required.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="UTF-8"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="12" height="12" viewBox="0, 0, 12, 12"> + <g id="required" opacity="0.75"> + <path d="M7,0 L7,4.268 L10.696,2.134 L11.696,3.866 L8,6 L11.696,8.134 L10.696,9.866 L7,7.732 L7,12 L5,12 L5,7.732 L1.304,9.866 L0.304,8.134 L4,6 L0.304,3.866 L1.304,2.134 L5,4.268 L5,0 z" fill="#000000"/> + </g> + <defs/> +</svg> diff --git a/resources/lib/oojs-ui/images/indicators/up.png b/resources/lib/oojs-ui/images/indicators/up.png Binary files differnew file mode 100644 index 000000000000..b827f6d54e76 --- /dev/null +++ b/resources/lib/oojs-ui/images/indicators/up.png diff --git a/resources/lib/oojs-ui/images/indicators/up.svg b/resources/lib/oojs-ui/images/indicators/up.svg new file mode 100644 index 000000000000..a5d7f38293ae --- /dev/null +++ b/resources/lib/oojs-ui/images/indicators/up.svg @@ -0,0 +1,8 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" width="12px" + height="12px" viewBox="0 0 12 12" style="enable-background:new 0 0 12 12;" xml:space="preserve"> +<g id="up" style="opacity:0.75;"> + <polygon id="arrow" style="fill-rule:evenodd;clip-rule:evenodd;" points="5.512,2.006 2,8 9.024,8 "/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/tail.svg b/resources/lib/oojs-ui/images/tail.svg new file mode 100644 index 000000000000..4df8bb2be62a --- /dev/null +++ b/resources/lib/oojs-ui/images/tail.svg @@ -0,0 +1,9 @@ +<?xml version="1.0" encoding="iso-8859-1"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"> +<svg version="1.1" id="Layer_1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" + width="15px" height="8px" viewBox="0 0 15 8" style="enable-background:new 0 0 15 8;" xml:space="preserve"> +<g id="tail"> + <polygon id="outline" style="fill-rule:evenodd;clip-rule:evenodd;fill:#808080;" points="7.609,2.499 2.096,8 13.125,8"/> + <polygon id="fill" style="fill-rule:evenodd;clip-rule:evenodd;fill:#FFFFFF;" points="7.609,3 2.598,8 12.622,8"/> +</g> +</svg> diff --git a/resources/lib/oojs-ui/images/textures/pending.gif b/resources/lib/oojs-ui/images/textures/pending.gif Binary files differnew file mode 100644 index 000000000000..1194eed2934d --- /dev/null +++ b/resources/lib/oojs-ui/images/textures/pending.gif diff --git a/resources/lib/oojs-ui/images/textures/transparency.png b/resources/lib/oojs-ui/images/textures/transparency.png Binary files differnew file mode 100644 index 000000000000..b8e36d31d1bf --- /dev/null +++ b/resources/lib/oojs-ui/images/textures/transparency.png diff --git a/resources/lib/oojs-ui/images/toolbar-shadow.png b/resources/lib/oojs-ui/images/toolbar-shadow.png Binary files differnew file mode 100644 index 000000000000..97e8d13dcd61 --- /dev/null +++ b/resources/lib/oojs-ui/images/toolbar-shadow.png diff --git a/resources/lib/oojs-ui/oojs-ui-agora.css b/resources/lib/oojs-ui/oojs-ui-agora.css new file mode 100644 index 000000000000..8aedde533fae --- /dev/null +++ b/resources/lib/oojs-ui/oojs-ui-agora.css @@ -0,0 +1,80 @@ +.oo-ui-window-head { + height: 3.35em; + border-bottom: 1px solid #dddddd; +} + +.oo-ui-window-body { + padding: 2em 3.35em; +} + +.oo-ui-window-icon { + width: 3.35em; + height: 3.35em; + background-size: 2em auto; + border-left: 1px solid #dddddd; +} + +.oo-ui-window-title { + line-height: 3.35em; +} + +.oo-ui-buttonedElement.oo-ui-indicatedElement .oo-ui-buttonedElement-button > .oo-ui-indicatedElement-indicator, +.oo-ui-buttonedElement.oo-ui-iconedElement .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + width: 3.35em; + height: 3.35em; + background-size: 2em auto; +} + +.oo-ui-optionWidget { + padding: 0.8em 1em 0.8em 3.35em; + font-weight: bold; + border-bottom: 1px solid #dddddd; +} + +.oo-ui-optionWidget.oo-ui-indicatedElement .oo-ui-labeledElement-label { + padding-right: 1.5em; +} + +.oo-ui-optionWidget-level-0 { + padding-left: 3.5em; +} + +.oo-ui-optionWidget-level-0 .oo-ui-iconedElement-icon { + left: 1em; +} + +.oo-ui-optionWidget-level-1 { + padding-left: 5em; +} + +.oo-ui-optionWidget-level-1 .oo-ui-iconedElement-icon { + left: 2.5em; +} + +.oo-ui-optionWidget-level-2 { + padding-left: 6.5em; +} + +.oo-ui-optionWidget-level-2 .oo-ui-iconedElement-icon { + left: 4em; +} + +.oo-ui-buttonOptionWidget { + padding: 0; +} + +.oo-ui-menuItemWidget.oo-ui-optionWidget-selected { + color: #ffffff; + background: #347bff; +} + +.oo-ui-menuSectionItemWidget { + font-weight: normal; + color: #777777; + border: none; +} + +.oo-ui-textInputWidget input, +.oo-ui-textInputWidget textarea { + padding: .8em 1em; +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/oojs-ui-apex.css b/resources/lib/oojs-ui/oojs-ui-apex.css new file mode 100644 index 000000000000..00cd4337313a --- /dev/null +++ b/resources/lib/oojs-ui/oojs-ui-apex.css @@ -0,0 +1,782 @@ +.oo-ui-dialog { + background-color: #fff; + background-color: rgba(255, 255, 255, 0.5); + opacity: 0; + -webkit-transition: all 250ms ease-in-out; + -moz-transition: all 250ms ease-in-out; + -ms-transition: all 250ms ease-in-out; + -o-transition: all 250ms ease-in-out; + transition: all 250ms ease-in-out; +} + +.oo-ui-dialog .oo-ui-window-frame { + background-color: #fff; + border: solid 1px #ccc; + border-radius: 0.5em; + -webkit-transform: scale(0.5); + -moz-transform: scale(0.5); + -ms-transform: scale(0.5); + -o-transform: scale(0.5); + transform: scale(0.5); + box-shadow: 0 0.2em 1em rgba(0, 0, 0, 0.3); + -webkit-transition: all 250ms ease-in-out; + -moz-transition: all 250ms ease-in-out; + -ms-transition: all 250ms ease-in-out; + -o-transition: all 250ms ease-in-out; + transition: all 250ms ease-in-out; +} + +.oo-ui-dialog-open { + opacity: 1; +} + +.oo-ui-dialog-open .oo-ui-window-frame { + -webkit-transform: scale(1); + -moz-transform: scale(1); + -ms-transform: scale(1); + -o-transform: scale(1); + transform: scale(1); +} + +.oo-ui-dialog-content .oo-ui-window-body { + box-shadow: 0 0 0.66em rgba(0, 0, 0, 0.25); +} + +.oo-ui-frame-content { + font-family: sans-serif; + font-size: 0.8em; +} + +.oo-ui-toolbar-bar { + background: #f8fbfd; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #ffffff), color-stop(100%, #f1f7fb)); + background-image: -webkit-linear-gradient(top, #ffffff 0%, #f1f7fb 100%); + background-image: -moz-linear-gradient(top, #ffffff 0%, #f1f7fb 100%); + background-image: -ms-linear-gradient(top, #ffffff 0%, #f1f7fb 100%); + background-image: -o-linear-gradient(top, #ffffff 0%, #f1f7fb 100%); + background-image: linear-gradient(top, #ffffff 0%, #f1f7fb 100%); + border-bottom: solid 1px #ccc; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#ffffff', endColorstr='#f1f7fb'); +} + +.oo-ui-toolbar-bar .oo-ui-toolbar-bar { + background: none; + border: none; +} + +.oo-ui-toolbar-shadow { + bottom: -9px; + height: 9px; + background-image: /* @embed */ url(images/toolbar-shadow.png); + opacity: 0.125; + -webkit-transition: opacity 500ms ease-in-out; + -moz-transition: opacity 500ms ease-in-out; + -ms-transition: opacity 500ms ease-in-out; + -o-transition: opacity 500ms ease-in-out; + transition: opacity 500ms ease-in-out; +} + +.oo-ui-toolGroup { + border: solid 1px transparent; + border-radius: 0.25em; + -webkit-transition: border-color 300ms ease-in-out; + -moz-transition: border-color 300ms ease-in-out; + -ms-transition: border-color 300ms ease-in-out; + -o-transition: border-color 300ms ease-in-out; + transition: border-color 300ms ease-in-out; +} + +.oo-ui-toolGroup.oo-ui-widget-enabled:hover { + border-color: rgba(0, 0, 0, 0.1); +} + +.oo-ui-toolGroup.oo-ui-widget-enabled .oo-ui-tool-link .oo-ui-tool-title { + color: #000; +} + +.oo-ui-window-body { + padding: 0 0.75em; +} + +.oo-ui-window-icon { + width: 2em; + height: 2em; + margin-right: 0.5em; + line-height: 2em; +} + +.oo-ui-window-title { + line-height: 2em; + color: #333; +} + +.oo-ui-window-overlay { + font-family: sans-serif; + font-size: 1em; + line-height: 1.5em; +} + +.oo-ui-buttonedElement .oo-ui-buttonedElement-button { + color: #333; +} + +.oo-ui-buttonedElement.oo-ui-indicatedElement .oo-ui-buttonedElement-button > .oo-ui-indicatedElement-indicator, +.oo-ui-buttonedElement.oo-ui-iconedElement .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + width: 1.9em; + height: 1.9em; + opacity: 0.8; +} + +.oo-ui-buttonedElement-frameless .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + /* Don't animate opacities for now, causes wiggling in Chrome (bug 63020) */ + + /*.oo-ui-transition(opacity 200ms);*/ + +} + +.oo-ui-buttonedElement-frameless .oo-ui-buttonedElement-button:hover > .oo-ui-iconedElement-icon, +.oo-ui-buttonedElement-frameless .oo-ui-buttonedElement-button:focus > .oo-ui-iconedElement-icon { + opacity: 1; +} + +.oo-ui-buttonedElement-frameless .oo-ui-buttonedElement-button:hover > .oo-ui-labeledElement-label, +.oo-ui-buttonedElement-frameless .oo-ui-buttonedElement-button:focus > .oo-ui-labeledElement-label { + color: #000; +} + +.oo-ui-buttonedElement-frameless .oo-ui-buttonedElement-button > .oo-ui-labeledElement-label { + color: #333; +} + +.oo-ui-buttonedElement-frameless.oo-ui-widget-disabled .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-buttonedElement-frameless.oo-ui-widget-disabled .oo-ui-buttonedElement-button > .oo-ui-labeledElement-label { + color: #ccc; +} + +.oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button { + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.5); + background: #eeeeee; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #ffffff), color-stop(100%, #dddddd)); + background-image: -webkit-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: -moz-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: -ms-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: -o-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: linear-gradient(top, #ffffff 0%, #dddddd 100%); + border: 1px #c9c9c9 solid; + border-radius: 0.3em; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#ffffff', endColorstr='#dddddd'); + -webkit-transition: border-color 100ms ease-in-out; + -moz-transition: border-color 100ms ease-in-out; + -ms-transition: border-color 100ms ease-in-out; + -o-transition: border-color 100ms ease-in-out; + transition: border-color 100ms ease-in-out; +} + +.oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button:hover, +.oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button:focus { + border-color: #aaa; +} + +.oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button.oo-ui-buttonedElement-active, +.oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button.oo-ui-buttonedElement-pressed { + color: black; + background: #eeeeee; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #dddddd), color-stop(100%, #ffffff)); + background-image: -webkit-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: -moz-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: -ms-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: -o-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: linear-gradient(top, #dddddd 0%, #ffffff 100%); + border-color: #c9c9c9; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#dddddd', endColorstr='#ffffff'); + box-shadow: inset 0 1px 4px 0 rgba(0, 0, 0, 0.07); +} + +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-primary .oo-ui-buttonedElement-button { + background: #cde7f4; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #eaf4fa), color-stop(100%, #b0d9ee)); + background-image: -webkit-linear-gradient(top, #eaf4fa 0%, #b0d9ee 100%); + background-image: -moz-linear-gradient(top, #eaf4fa 0%, #b0d9ee 100%); + background-image: -ms-linear-gradient(top, #eaf4fa 0%, #b0d9ee 100%); + background-image: -o-linear-gradient(top, #eaf4fa 0%, #b0d9ee 100%); + background-image: linear-gradient(top, #eaf4fa 0%, #b0d9ee 100%); + border: solid 1px #a6cee1; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#eaf4fa', endColorstr='#b0d9ee'); +} + +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-primary .oo-ui-buttonedElement-button:hover, +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-primary .oo-ui-buttonedElement-button:focus { + border-color: #9dc2d4; +} + +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-primary .oo-ui-buttonedElement-button.oo-ui-buttonedElement-active, +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-primary .oo-ui-buttonedElement-button.oo-ui-buttonedElement-pressed { + background: #cde7f4; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #b0d9ee), color-stop(100%, #eaf4fa)); + background-image: -webkit-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: -moz-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: -ms-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: -o-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + border: solid 1px #a6cee1; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#b0d9ee', endColorstr='#eaf4fa'); +} + +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-constructive .oo-ui-buttonedElement-button { + background: #daf0be; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #f0fbe1), color-stop(100%, #c3e59a)); + background-image: -webkit-linear-gradient(top, #f0fbe1 0%, #c3e59a 100%); + background-image: -moz-linear-gradient(top, #f0fbe1 0%, #c3e59a 100%); + background-image: -ms-linear-gradient(top, #f0fbe1 0%, #c3e59a 100%); + background-image: -o-linear-gradient(top, #f0fbe1 0%, #c3e59a 100%); + background-image: linear-gradient(top, #f0fbe1 0%, #c3e59a 100%); + border: solid 1px #b8d892; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#f0fbe1', endColorstr='#c3e59a'); +} + +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-constructive .oo-ui-buttonedElement-button:hover, +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-constructive .oo-ui-buttonedElement-button:focus { + border-color: #adcb89; +} + +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-constructive .oo-ui-buttonedElement-button.oo-ui-buttonedElement-active, +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-constructive .oo-ui-buttonedElement-button.oo-ui-buttonedElement-pressed { + background: #daf0be; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #c3e59a), color-stop(100%, #f0fbe1)); + background-image: -webkit-linear-gradient(top, #c3e59a 0%, #f0fbe1 100%); + background-image: -moz-linear-gradient(top, #c3e59a 0%, #f0fbe1 100%); + background-image: -ms-linear-gradient(top, #c3e59a 0%, #f0fbe1 100%); + background-image: -o-linear-gradient(top, #c3e59a 0%, #f0fbe1 100%); + background-image: linear-gradient(top, #c3e59a 0%, #f0fbe1 100%); + border: solid 1px #b8d892; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#c3e59a', endColorstr='#f0fbe1'); +} + +.oo-ui-buttonedElement-framed.oo-ui-flaggableElement-destructive .oo-ui-buttonedElement-button { + color: #d45353; +} + +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-active, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-pressed { + color: #333; + background: #eee; + border-color: #ccc; + opacity: 0.5; + box-shadow: none; +} + +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button:hover, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-active:hover, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-pressed:hover, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button:focus, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-active:focus, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-pressed:focus { + border-color: #ccc; + box-shadow: none; +} + +.oo-ui-bookletLayout > .oo-ui-gridLayout > .oo-ui-panelLayout { + -webkit-transition: width 250ms ease-in-out, height 250ms ease-in-out, top 250ms ease-in-out, left 250ms ease-in-out; + -moz-transition: width 250ms ease-in-out, height 250ms ease-in-out, top 250ms ease-in-out, left 250ms ease-in-out; + -ms-transition: width 250ms ease-in-out, height 250ms ease-in-out, top 250ms ease-in-out, left 250ms ease-in-out; + -o-transition: width 250ms ease-in-out, height 250ms ease-in-out, top 250ms ease-in-out, left 250ms ease-in-out; + transition: width 250ms ease-in-out, height 250ms ease-in-out, top 250ms ease-in-out, left 250ms ease-in-out; +} + +.oo-ui-bookletLayout-outlinePanel { + border-right: solid 1px #ddd; +} + +.oo-ui-bookletLayout-outlinePanel .oo-ui-outlineControlsWidget { + box-shadow: 0 0 0.25em rgba(0, 0, 0, 0.25); +} + +.oo-ui-fieldsetLayout { + border: none; +} + +.oo-ui-fieldsetLayout > legend.oo-ui-labeledElement-label { + font-size: 1.5em; +} + +.oo-ui-barToolGroup .oo-ui-tool { + margin: -1px 0 -1px -1px; + border: solid 1px transparent; +} + +.oo-ui-barToolGroup .oo-ui-tool:first-child { + border-bottom-left-radius: 0.25em; + border-top-left-radius: 0.25em; +} + +.oo-ui-barToolGroup .oo-ui-tool:last-child { + margin-right: -1px; + border-top-right-radius: 0.25em; + border-bottom-right-radius: 0.25em; +} + +.oo-ui-barToolGroup .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 0.8; +} + +.oo-ui-barToolGroup.oo-ui-widget-enabled .oo-ui-tool.oo-ui-widget-enabled:hover { + border-color: rgba(0, 0, 0, 0.2); +} + +.oo-ui-barToolGroup.oo-ui-widget-enabled .oo-ui-tool-active.oo-ui-widget-enabled { + background: #f8fbfd; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #f1f7fb), color-stop(100%, #ffffff)); + background-image: -webkit-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -moz-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -ms-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -o-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + border-color: rgba(0, 0, 0, 0.2); + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#f1f7fb', endColorstr='#ffffff'); + box-shadow: inset 0 0.07em 0.07em 0 rgba(0, 0, 0, 0.07); +} + +.oo-ui-barToolGroup.oo-ui-widget-enabled .oo-ui-tool-active.oo-ui-widget-enabled + .oo-ui-tool-active.oo-ui-widget-enabled { + border-left-color: rgba(0, 0, 0, 0.1); +} + +.oo-ui-barToolGroup.oo-ui-widget-enabled .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-barToolGroup.oo-ui-widget-enabled .oo-ui-tool.oo-ui-widget-enabled .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 0.8; +} + +.oo-ui-barToolGroup.oo-ui-widget-enabled .oo-ui-tool.oo-ui-widget-enabled:hover .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 1; +} + +.oo-ui-barToolGroup.oo-ui-widget-disabled .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-listToolGroup.oo-ui-popupToolGroup-active { + border-color: rgba(0, 0, 0, 0.2); +} + +.oo-ui-listToolGroup .oo-ui-tool { + margin: -1px 0; + border: solid 1px transparent; +} + +.oo-ui-listToolGroup .oo-ui-tool-active.oo-ui-widget-enabled { + background: #f8fbfd; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #f1f7fb), color-stop(100%, #ffffff)); + background-image: -webkit-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -moz-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -ms-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -o-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + border-color: rgba(0, 0, 0, 0.1); + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#f1f7fb', endColorstr='#ffffff'); + box-shadow: inset 0 0.07em 0.07em 0 rgba(0, 0, 0, 0.07); +} + +.oo-ui-listToolGroup .oo-ui-tool-active.oo-ui-widget-enabled + .oo-ui-tool-active.oo-ui-widget-enabled { + border-top-color: rgba(0, 0, 0, 0.1); +} + +.oo-ui-listToolGroup .oo-ui-tool-active.oo-ui-widget-enabled:hover { + border-color: rgba(0, 0, 0, 0.2); +} + +.oo-ui-listToolGroup .oo-ui-tool.oo-ui-widget-enabled:hover { + border-color: rgba(0, 0, 0, 0.2); +} + +.oo-ui-listToolGroup .oo-ui-tool.oo-ui-widget-enabled .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 0.8; +} + +.oo-ui-listToolGroup .oo-ui-tool.oo-ui-widget-enabled:hover .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 1; +} + +.oo-ui-listToolGroup .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link .oo-ui-tool-title { + color: #ccc; +} + +.oo-ui-listToolGroup .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-listToolGroup.oo-ui-widget-disabled .oo-ui-indicatedElement-indicator, +.oo-ui-listToolGroup.oo-ui-widget-disabled .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-menuToolGroup { + border-color: rgba(0, 0, 0, 0.1); +} + +.oo-ui-menuToolGroup.oo-ui-widget-enabled:hover { + border-color: rgba(0, 0, 0, 0.2); +} + +.oo-ui-menuToolGroup.oo-ui-popupToolGroup-active { + border-color: rgba(0, 0, 0, 0.25); +} + +.oo-ui-menuToolGroup .oo-ui-tool.oo-ui-widget-enabled:hover { + background-color: #e1f3ff; +} + +.oo-ui-menuToolGroup .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link .oo-ui-tool-title { + color: #ccc; +} + +.oo-ui-menuToolGroup .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-menuToolGroup.oo-ui-widget-disabled { + color: #ccc; + text-shadow: 0 1px 1px #fff; + background-color: #f3f3f3; + border-color: #ddd; +} + +.oo-ui-menuToolGroup.oo-ui-widget-disabled .oo-ui-indicatedElement-indicator, +.oo-ui-menuToolGroup.oo-ui-widget-disabled .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-popupToolGroup-handle .oo-ui-indicatedElement-indicator, +.oo-ui-popupToolGroup-handle .oo-ui-iconedElement-icon { + opacity: 0.8; +} + +.oo-ui-popupToolGroup .oo-ui-toolGroup-tools { + background-color: white; + border: solid 1px #ccc; + box-shadow: 0 0.25em 1em rgba(0, 0, 0, 0.25); +} + +.oo-ui-popupToolGroup-active.oo-ui-widget-enabled { + background: #f8fbfd; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #f1f7fb), color-stop(100%, #ffffff)); + background-image: -webkit-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -moz-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -ms-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: -o-linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + background-image: linear-gradient(top, #f1f7fb 0%, #ffffff 100%); + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#f1f7fb', endColorstr='#ffffff'); + box-shadow: inset 0 0.07em 0.07em 0 rgba(0, 0, 0, 0.07); +} + +.oo-ui-optionWidget { + padding: 0.5em 2em 0.5em 3em; +} + +.oo-ui-optionWidget-highlighted { + background-color: #e1f3ff; +} + +.oo-ui-selectWidget-depressed .oo-ui-optionWidget-selected { + background-color: #a7dcff; +} + +.oo-ui-selectWidget-pressed .oo-ui-optionWidget-pressed { + background-color: #a7dcff; +} + +.oo-ui-optionWidget.oo-ui-widget-disabled { + color: #ccc; +} + +.oo-ui-menuWidget { + margin-top: -1px; + background: #fff; + border: solid 1px #ccc; + border-radius: 0 0 0.25em 0.25em; + box-shadow: 0 0.15em 1em 0 rgba(0, 0, 0, 0.2); +} + +.oo-ui-popupWidget-popup { + background-color: #fff; + border: solid 1px #ccc; + border-radius: 0.25em; + box-shadow: 0 0.15em 0.5em 0 rgba(0, 0, 0, 0.2); +} + +.oo-ui-popupWidget-tailed .oo-ui-popupWidget-tail { + width: 15px; + height: 8px; + margin-left: -7px; + background-image: /* @embed */ url(images/tail.svg); +} + +.oo-ui-popupWidget-transitioning .oo-ui-popupWidget-popup { + -webkit-transition: width 100ms ease-in-out, height 100ms ease-in-out, left 100ms ease-in-out; + -moz-transition: width 100ms ease-in-out, height 100ms ease-in-out, left 100ms ease-in-out; + -ms-transition: width 100ms ease-in-out, height 100ms ease-in-out, left 100ms ease-in-out; + -o-transition: width 100ms ease-in-out, height 100ms ease-in-out, left 100ms ease-in-out; + transition: width 100ms ease-in-out, height 100ms ease-in-out, left 100ms ease-in-out; +} + +.oo-ui-popupWidget-body { + box-shadow: 0 0 0.66em rgba(0, 0, 0, 0.25); +} + +.oo-ui-buttonGroupWidget { + display: inline-block; + white-space: nowrap; +} + +.oo-ui-buttonOptionWidget { + padding: 0; +} + +.oo-ui-buttonOptionWidget.oo-ui-optionWidget-selected, +.oo-ui-buttonOptionWidget.oo-ui-optionWidget-pressed, +.oo-ui-buttonOptionWidget.oo-ui-optionWidget-highlighted { + background-color: transparent; +} + +.oo-ui-buttonSelectWidget { + border-radius: 0.3em; +} + +.oo-ui-buttonSelectWidget .oo-ui-buttonOptionWidget .oo-ui-buttonedElement-button { + margin-left: -1px; + border-radius: 0; +} + +.oo-ui-buttonSelectWidget .oo-ui-buttonOptionWidget:first-child .oo-ui-buttonedElement-button { + margin-left: 0; + border-bottom-left-radius: 0.3em; + border-top-left-radius: 0.3em; +} + +.oo-ui-buttonSelectWidget .oo-ui-buttonOptionWidget:last-child .oo-ui-buttonedElement-button { + border-top-right-radius: 0.3em; + border-bottom-right-radius: 0.3em; +} + +.oo-ui-inlineMenuWidget-handle { + border: solid 1px rgba(0, 0, 0, 0.1); + border-radius: 0.25em; +} + +.oo-ui-inlineMenuWidget-handle:hover { + border-color: rgba(0, 0, 0, 0.2); +} + +.oo-ui-inlineMenuWidget-handle .oo-ui-indicatedElement-indicator, +.oo-ui-inlineMenuWidget-handle .oo-ui-iconedElement-icon { + opacity: 0.8; +} + +.oo-ui-inlineMenuWidget.oo-ui-widget-disabled .oo-ui-inlineMenuWidget-handle { + color: #ccc; + text-shadow: 0 1px 1px #fff; + background-color: #f3f3f3; + border-color: #ddd; +} + +.oo-ui-inlineMenuWidget.oo-ui-widget-disabled .oo-ui-indicatedElement-indicator { + opacity: 0.2; +} + +.oo-ui-menuItemWidget.oo-ui-optionWidget-highlighted { + background-color: #e1f3ff; +} + +.oo-ui-menuSectionItemWidget { + padding: 0.33em 0.75em; + color: #888; +} + +.oo-ui-outlineControlsWidget { + background-color: #fff; +} + +.oo-ui-outlineControlsWidget > .oo-ui-iconedElement-icon { + opacity: 0.2; +} + +.oo-ui-outlineItemWidget { + font-size: 1.1em; +} + +.oo-ui-outlineItemWidget.oo-ui-indicatedElement .oo-ui-labeledElement-label { + padding-right: 1.5em; +} + +.oo-ui-outlineItemWidget-level-0 { + padding-left: 3.5em; +} + +.oo-ui-outlineItemWidget-level-0 .oo-ui-iconedElement-icon { + left: 1em; +} + +.oo-ui-outlineItemWidget-level-1 { + padding-left: 5em; +} + +.oo-ui-outlineItemWidget-level-1 .oo-ui-iconedElement-icon { + left: 2.5em; +} + +.oo-ui-outlineItemWidget-level-2 { + padding-left: 6.5em; +} + +.oo-ui-outlineItemWidget-level-2 .oo-ui-iconedElement-icon { + left: 4em; +} + +.oo-ui-selectWidget-depressed .oo-ui-outlineItemWidget.oo-ui-optionWidget-selected { + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.5); + background-color: #a7dcff; +} + +.oo-ui-outlineItemWidget.oo-ui-flaggableElement-important { + font-weight: bold; +} + +.oo-ui-outlineItemWidget.oo-ui-flaggableElement-placeholder { + font-style: italic; +} + +.oo-ui-outlineItemWidget.oo-ui-flaggableElement-empty .oo-ui-iconedElement-icon, +.oo-ui-outlineItemWidget.oo-ui-flaggableElement-empty .oo-ui-indicatedElement-indicator { + opacity: 0.5; +} + +.oo-ui-outlineItemWidget.oo-ui-flaggableElement-empty .oo-ui-labeledElement-label { + color: #777; +} + +.oo-ui-searchWidget-query { + box-shadow: 0 0 0.5em rgba(0, 0, 0, 0.2); +} + +.oo-ui-textInputWidget { + width: 20em; +} + +.oo-ui-textInputWidget input, +.oo-ui-textInputWidget textarea { + padding: 0.5em; + font-family: sans-serif; + font-size: 1em; + background-color: #fff; + border: solid 1px #ccc; + border-radius: 0.25em; + box-shadow: 0 0 0 white, inset 0 0.1em 0.2em #ddd; + -webkit-transition: border-color 200ms, box-shadow 200ms; + -moz-transition: border-color 200ms, box-shadow 200ms; + -ms-transition: border-color 200ms, box-shadow 200ms; + -o-transition: border-color 200ms, box-shadow 200ms; + transition: border-color 200ms, box-shadow 200ms; +} + +.oo-ui-textInputWidget-decorated input, +.oo-ui-textInputWidget-decorated textarea { + padding-left: 2em; +} + +.oo-ui-textInputWidget-icon { + width: 2em; +} + +.oo-ui-textInputWidget.oo-ui-widget-enabled input:focus, +.oo-ui-textInputWidget.oo-ui-widget-enabled textarea:focus { + border-color: #a7dcff; + outline: none; + box-shadow: 0 0 0.3em #a7dcff, 0 0 0 white; +} + +.oo-ui-textInputWidget input[readonly], +.oo-ui-textInputWidget textarea[readonly] { + color: #777; + text-shadow: 0 1px 1px #fff; +} + +.oo-ui-textInputWidget-pending input, +.oo-ui-textInputWidget-pending textarea { + background-color: transparent; +} + +.oo-ui-textInputWidget.oo-ui-widget-disabled input, +.oo-ui-textInputWidget.oo-ui-widget-disabled input:focus, +.oo-ui-textInputWidget.oo-ui-widget-disabled textarea, +.oo-ui-textInputWidget.oo-ui-widget-disabled textarea:focus { + color: #ccc; + text-shadow: 0 1px 1px #fff; + background-color: #f3f3f3; + border-color: #ddd; +} + +.oo-ui-toggleSwitchWidget { + background: #eeeeee; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #dddddd), color-stop(100%, #ffffff)); + background-image: -webkit-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: -moz-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: -ms-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: -o-linear-gradient(top, #dddddd 0%, #ffffff 100%); + background-image: linear-gradient(top, #dddddd 0%, #ffffff 100%); + border: solid 1px #ccc; + border-radius: 1em; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#dddddd', endColorstr='#ffffff'); + box-shadow: 0 0 0 white, inset 0 0.1em 0.2em #ddd; +} + +.oo-ui-toggleSwitchWidget.oo-ui-widget-disabled { + opacity: 0.5; +} + +.oo-ui-toggleSwitchWidget-grip { + background: #eeeeee; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #ffffff), color-stop(100%, #dddddd)); + background-image: -webkit-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: -moz-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: -ms-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: -o-linear-gradient(top, #ffffff 0%, #dddddd 100%); + background-image: linear-gradient(top, #ffffff 0%, #dddddd 100%); + border: 1px #c9c9c9 solid; + border-radius: 1em; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#ffffff', endColorstr='#dddddd'); + box-shadow: 0 0.1em 0.25em rgba(0, 0, 0, 0.1); +} + +.oo-ui-toggleSwitchWidget.oo-ui-widget-enabled:hover, +.oo-ui-toggleSwitchWidget.oo-ui-widget-enabled:hover .oo-ui-toggleSwitchWidget-grip { + border-color: #aaa; +} + +.oo-ui-toggleSwitchWidget .oo-ui-toggleSwitchWidget-glow { + background: #cde7f4; + background-image: -webkit-gradient(linear, right top, right bottom, color-stop(0%, #b0d9ee), color-stop(100%, #eaf4fa)); + background-image: -webkit-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: -moz-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: -ms-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: -o-linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + background-image: linear-gradient(top, #b0d9ee 0%, #eaf4fa 100%); + border-radius: 1em; + filter: progid:DXImageTransform.Microsoft.gradient(GradientType=0, startColorstr='#b0d9ee', endColorstr='#eaf4fa'); + box-shadow: inset 0 1px 4px 0 rgba(0, 0, 0, 0.07); +} + +.oo-ui-toggleWidget-on .oo-ui-toggleSwitchWidget-glow { + opacity: 1; +} + +.oo-ui-toggleWidget-off .oo-ui-toggleSwitchWidget-glow { + display: block; + opacity: 0; +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/oojs-ui.js b/resources/lib/oojs-ui/oojs-ui.js new file mode 100644 index 000000000000..1565cbbc9982 --- /dev/null +++ b/resources/lib/oojs-ui/oojs-ui.js @@ -0,0 +1,8203 @@ +/*! + * OOjs UI v0.1.0-pre (eaa1b7f06d) + * https://www.mediawiki.org/wiki/OOjs_UI + * + * Copyright 2011–2014 OOjs Team and other contributors. + * Released under the MIT license + * http://oojs.mit-license.org + * + * Date: Thu Apr 03 2014 16:56:21 GMT-0700 (PDT) + */ +( function ( OO ) { + +'use strict'; +/** + * Namespace for all classes, static methods and static properties. + * + * @class + * @singleton + */ +OO.ui = {}; + +OO.ui.bind = $.proxy; + +/** + * @property {Object} + */ +OO.ui.Keys = { + 'UNDEFINED': 0, + 'BACKSPACE': 8, + 'DELETE': 46, + 'LEFT': 37, + 'RIGHT': 39, + 'UP': 38, + 'DOWN': 40, + 'ENTER': 13, + 'END': 35, + 'HOME': 36, + 'TAB': 9, + 'PAGEUP': 33, + 'PAGEDOWN': 34, + 'ESCAPE': 27, + 'SHIFT': 16, + 'SPACE': 32 +}; + +/** + * Get the user's language and any fallback languages. + * + * These language codes are used to localize user interface elements in the user's language. + * + * In environments that provide a localization system, this function should be overridden to + * return the user's language(s). The default implementation returns English (en) only. + * + * @return {string[]} Language codes, in descending order of priority + */ +OO.ui.getUserLanguages = function () { + return [ 'en' ]; +}; + +/** + * Get a value in an object keyed by language code. + * + * @param {Object.<string,Mixed>} obj Object keyed by language code + * @param {string|null} [lang] Language code, if omitted or null defaults to any user language + * @param {string} [fallback] Fallback code, used if no matching language can be found + * @return {Mixed} Local value + */ +OO.ui.getLocalValue = function ( obj, lang, fallback ) { + var i, len, langs; + + // Requested language + if ( obj[lang] ) { + return obj[lang]; + } + // Known user language + langs = OO.ui.getUserLanguages(); + for ( i = 0, len = langs.length; i < len; i++ ) { + lang = langs[i]; + if ( obj[lang] ) { + return obj[lang]; + } + } + // Fallback language + if ( obj[fallback] ) { + return obj[fallback]; + } + // First existing language + for ( lang in obj ) { + return obj[lang]; + } + + return undefined; +}; + +( function () { + +/** + * Message store for the default implementation of OO.ui.msg + * + * Environments that provide a localization system should not use this, but should override + * OO.ui.msg altogether. + * + * @private + */ +var messages = { + // Label text for button to exit from dialog + 'ooui-dialog-action-close': 'Close', + // Tool tip for a button that moves items in a list down one place + 'ooui-outline-control-move-down': 'Move item down', + // Tool tip for a button that moves items in a list up one place + 'ooui-outline-control-move-up': 'Move item up', + // Tool tip for a button that removes items from a list + 'ooui-outline-control-remove': 'Remove item', + // Label for the toolbar group that contains a list of all other available tools + 'ooui-toolbar-more': 'More' +}; + +/** + * Get a localized message. + * + * In environments that provide a localization system, this function should be overridden to + * return the message translated in the user's language. The default implementation always returns + * English messages. + * + * After the message key, message parameters may optionally be passed. In the default implementation, + * any occurrences of $1 are replaced with the first parameter, $2 with the second parameter, etc. + * Alternative implementations of OO.ui.msg may use any substitution system they like, as long as + * they support unnamed, ordered message parameters. + * + * @abstract + * @param {string} key Message key + * @param {Mixed...} [params] Message parameters + * @return {string} Translated message with parameters substituted + */ +OO.ui.msg = function ( key ) { + var message = messages[key], params = Array.prototype.slice.call( arguments, 1 ); + if ( typeof message === 'string' ) { + // Perform $1 substitution + message = message.replace( /\$(\d+)/g, function ( unused, n ) { + var i = parseInt( n, 10 ); + return params[i - 1] !== undefined ? params[i - 1] : '$' + n; + } ); + } else { + // Return placeholder if message not found + message = '[' + key + ']'; + } + return message; +}; + +/** */ +OO.ui.deferMsg = function ( key ) { + return function () { + return OO.ui.msg( key ); + }; +}; + +/** */ +OO.ui.resolveMsg = function ( msg ) { + if ( $.isFunction( msg ) ) { + return msg(); + } + return msg; +}; + +} )(); +/** + * DOM element abstraction. + * + * @abstract + * @class + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {Function} [$] jQuery for the frame the widget is in + * @cfg {string[]} [classes] CSS class names + * @cfg {jQuery} [$content] Content elements to append + */ +OO.ui.Element = function OoUiElement( config ) { + // Configuration initialization + config = config || {}; + + // Properties + this.$ = config.$ || OO.ui.Element.getJQuery( document ); + this.$element = this.$( this.$.context.createElement( this.getTagName() ) ); + this.elementGroup = null; + + // Initialization + if ( $.isArray( config.classes ) ) { + this.$element.addClass( config.classes.join( ' ' ) ); + } + if ( config.$content ) { + this.$element.append( config.$content ); + } +}; + +/* Static Properties */ + +OO.ui.Element.static = {}; + +/** + * HTML tag name. + * + * This may be ignored if getTagName is overridden. + * + * @static + * @property {string} + * @inheritable + */ +OO.ui.Element.static.tagName = 'div'; + +/* Static Methods */ + +/** + * Get a jQuery function within a specific document. + * + * @static + * @param {jQuery|HTMLElement|HTMLDocument|Window} context Context to bind the function to + * @param {OO.ui.Frame} [frame] Frame of the document context + * @return {Function} Bound jQuery function + */ +OO.ui.Element.getJQuery = function ( context, frame ) { + function wrapper( selector ) { + return $( selector, wrapper.context ); + } + + wrapper.context = this.getDocument( context ); + + if ( frame ) { + wrapper.frame = frame; + } + + return wrapper; +}; + +/** + * Get the document of an element. + * + * @static + * @param {jQuery|HTMLElement|HTMLDocument|Window} obj Object to get the document for + * @return {HTMLDocument|null} Document object + */ +OO.ui.Element.getDocument = function ( obj ) { + // jQuery - selections created "offscreen" won't have a context, so .context isn't reliable + return ( obj[0] && obj[0].ownerDocument ) || + // Empty jQuery selections might have a context + obj.context || + // HTMLElement + obj.ownerDocument || + // Window + obj.document || + // HTMLDocument + ( obj.nodeType === 9 && obj ) || + null; +}; + +/** + * Get the window of an element or document. + * + * @static + * @param {jQuery|HTMLElement|HTMLDocument|Window} obj Context to get the window for + * @return {Window} Window object + */ +OO.ui.Element.getWindow = function ( obj ) { + var doc = this.getDocument( obj ); + return doc.parentWindow || doc.defaultView; +}; + +/** + * Get the direction of an element or document. + * + * @static + * @param {jQuery|HTMLElement|HTMLDocument|Window} obj Context to get the direction for + * @return {string} Text direction, either `ltr` or `rtl` + */ +OO.ui.Element.getDir = function ( obj ) { + var isDoc, isWin; + + if ( obj instanceof jQuery ) { + obj = obj[0]; + } + isDoc = obj.nodeType === 9; + isWin = obj.document !== undefined; + if ( isDoc || isWin ) { + if ( isWin ) { + obj = obj.document; + } + obj = obj.body; + } + return $( obj ).css( 'direction' ); +}; + +/** + * Get the offset between two frames. + * + * TODO: Make this function not use recursion. + * + * @static + * @param {Window} from Window of the child frame + * @param {Window} [to=window] Window of the parent frame + * @param {Object} [offset] Offset to start with, used internally + * @return {Object} Offset object, containing left and top properties + */ +OO.ui.Element.getFrameOffset = function ( from, to, offset ) { + var i, len, frames, frame, rect; + + if ( !to ) { + to = window; + } + if ( !offset ) { + offset = { 'top': 0, 'left': 0 }; + } + if ( from.parent === from ) { + return offset; + } + + // Get iframe element + frames = from.parent.document.getElementsByTagName( 'iframe' ); + for ( i = 0, len = frames.length; i < len; i++ ) { + if ( frames[i].contentWindow === from ) { + frame = frames[i]; + break; + } + } + + // Recursively accumulate offset values + if ( frame ) { + rect = frame.getBoundingClientRect(); + offset.left += rect.left; + offset.top += rect.top; + if ( from !== to ) { + this.getFrameOffset( from.parent, offset ); + } + } + return offset; +}; + +/** + * Get the offset between two elements. + * + * @static + * @param {jQuery} $from + * @param {jQuery} $to + * @return {Object} Translated position coordinates, containing top and left properties + */ +OO.ui.Element.getRelativePosition = function ( $from, $to ) { + var from = $from.offset(), + to = $to.offset(); + return { 'top': Math.round( from.top - to.top ), 'left': Math.round( from.left - to.left ) }; +}; + +/** + * Get element border sizes. + * + * @static + * @param {HTMLElement} el Element to measure + * @return {Object} Dimensions object with `top`, `left`, `bottom` and `right` properties + */ +OO.ui.Element.getBorders = function ( el ) { + var doc = el.ownerDocument, + win = doc.parentWindow || doc.defaultView, + style = win && win.getComputedStyle ? + win.getComputedStyle( el, null ) : + el.currentStyle, + $el = $( el ), + top = parseFloat( style ? style.borderTopWidth : $el.css( 'borderTopWidth' ) ) || 0, + left = parseFloat( style ? style.borderLeftWidth : $el.css( 'borderLeftWidth' ) ) || 0, + bottom = parseFloat( style ? style.borderBottomWidth : $el.css( 'borderBottomWidth' ) ) || 0, + right = parseFloat( style ? style.borderRightWidth : $el.css( 'borderRightWidth' ) ) || 0; + + return { + 'top': Math.round( top ), + 'left': Math.round( left ), + 'bottom': Math.round( bottom ), + 'right': Math.round( right ) + }; +}; + +/** + * Get dimensions of an element or window. + * + * @static + * @param {HTMLElement|Window} el Element to measure + * @return {Object} Dimensions object with `borders`, `scroll`, `scrollbar` and `rect` properties + */ +OO.ui.Element.getDimensions = function ( el ) { + var $el, $win, + doc = el.ownerDocument || el.document, + win = doc.parentWindow || doc.defaultView; + + if ( win === el || el === doc.documentElement ) { + $win = $( win ); + return { + 'borders': { 'top': 0, 'left': 0, 'bottom': 0, 'right': 0 }, + 'scroll': { + 'top': $win.scrollTop(), + 'left': $win.scrollLeft() + }, + 'scrollbar': { 'right': 0, 'bottom': 0 }, + 'rect': { + 'top': 0, + 'left': 0, + 'bottom': $win.innerHeight(), + 'right': $win.innerWidth() + } + }; + } else { + $el = $( el ); + return { + 'borders': this.getBorders( el ), + 'scroll': { + 'top': $el.scrollTop(), + 'left': $el.scrollLeft() + }, + 'scrollbar': { + 'right': $el.innerWidth() - el.clientWidth, + 'bottom': $el.innerHeight() - el.clientHeight + }, + 'rect': el.getBoundingClientRect() + }; + } +}; + +/** + * Get closest scrollable container. + * + * Traverses up until either a scrollable element or the root is reached, in which case the window + * will be returned. + * + * @static + * @param {HTMLElement} el Element to find scrollable container for + * @param {string} [dimension] Dimension of scrolling to look for; `x`, `y` or omit for either + * @return {HTMLElement|Window} Closest scrollable container + */ +OO.ui.Element.getClosestScrollableContainer = function ( el, dimension ) { + var i, val, + props = [ 'overflow' ], + $parent = $( el ).parent(); + + if ( dimension === 'x' || dimension === 'y' ) { + props.push( 'overflow-' + dimension ); + } + + while ( $parent.length ) { + if ( $parent[0] === el.ownerDocument.body ) { + return $parent[0]; + } + i = props.length; + while ( i-- ) { + val = $parent.css( props[i] ); + if ( val === 'auto' || val === 'scroll' ) { + return $parent[0]; + } + } + $parent = $parent.parent(); + } + return this.getDocument( el ).body; +}; + +/** + * Scroll element into view. + * + * @static + * @param {HTMLElement} el Element to scroll into view + * @param {Object} [config={}] Configuration config + * @param {string} [config.duration] jQuery animation duration value + * @param {string} [config.direction] Scroll in only one direction, e.g. 'x' or 'y', omit + * to scroll in both directions + * @param {Function} [config.complete] Function to call when scrolling completes + */ +OO.ui.Element.scrollIntoView = function ( el, config ) { + // Configuration initialization + config = config || {}; + + var anim = {}, + callback = typeof config.complete === 'function' && config.complete, + sc = this.getClosestScrollableContainer( el, config.direction ), + $sc = $( sc ), + eld = this.getDimensions( el ), + scd = this.getDimensions( sc ), + rel = { + 'top': eld.rect.top - ( scd.rect.top + scd.borders.top ), + 'bottom': scd.rect.bottom - scd.borders.bottom - scd.scrollbar.bottom - eld.rect.bottom, + 'left': eld.rect.left - ( scd.rect.left + scd.borders.left ), + 'right': scd.rect.right - scd.borders.right - scd.scrollbar.right - eld.rect.right + }; + + if ( !config.direction || config.direction === 'y' ) { + if ( rel.top < 0 ) { + anim.scrollTop = scd.scroll.top + rel.top; + } else if ( rel.top > 0 && rel.bottom < 0 ) { + anim.scrollTop = scd.scroll.top + Math.min( rel.top, -rel.bottom ); + } + } + if ( !config.direction || config.direction === 'x' ) { + if ( rel.left < 0 ) { + anim.scrollLeft = scd.scroll.left + rel.left; + } else if ( rel.left > 0 && rel.right < 0 ) { + anim.scrollLeft = scd.scroll.left + Math.min( rel.left, -rel.right ); + } + } + if ( !$.isEmptyObject( anim ) ) { + $sc.stop( true ).animate( anim, config.duration || 'fast' ); + if ( callback ) { + $sc.queue( function ( next ) { + callback(); + next(); + } ); + } + } else { + if ( callback ) { + callback(); + } + } +}; + +/* Methods */ + +/** + * Get the HTML tag name. + * + * Override this method to base the result on instance information. + * + * @return {string} HTML tag name + */ +OO.ui.Element.prototype.getTagName = function () { + return this.constructor.static.tagName; +}; + +/** + * Check if the element is attached to the DOM + * @return {boolean} The element is attached to the DOM + */ +OO.ui.Element.prototype.isElementAttached = function () { + return $.contains( this.getElementDocument(), this.$element[0] ); +}; + +/** + * Get the DOM document. + * + * @return {HTMLDocument} Document object + */ +OO.ui.Element.prototype.getElementDocument = function () { + return OO.ui.Element.getDocument( this.$element ); +}; + +/** + * Get the DOM window. + * + * @return {Window} Window object + */ +OO.ui.Element.prototype.getElementWindow = function () { + return OO.ui.Element.getWindow( this.$element ); +}; + +/** + * Get closest scrollable container. + * + * @see #static-method-getClosestScrollableContainer + */ +OO.ui.Element.prototype.getClosestScrollableElementContainer = function () { + return OO.ui.Element.getClosestScrollableContainer( this.$element[0] ); +}; + +/** + * Get group element is in. + * + * @return {OO.ui.GroupElement|null} Group element, null if none + */ +OO.ui.Element.prototype.getElementGroup = function () { + return this.elementGroup; +}; + +/** + * Set group element is in. + * + * @param {OO.ui.GroupElement|null} group Group element, null if none + * @chainable + */ +OO.ui.Element.prototype.setElementGroup = function ( group ) { + this.elementGroup = group; + return this; +}; + +/** + * Scroll element into view. + * + * @see #static-method-scrollIntoView + * @param {Object} [config={}] + */ +OO.ui.Element.prototype.scrollElementIntoView = function ( config ) { + return OO.ui.Element.scrollIntoView( this.$element[0], config ); +}; + +( function () { + // Static + var specialFocusin; + + function handler( e ) { + jQuery.event.simulate( 'focusin', e.target, jQuery.event.fix( e ), /* bubble = */ true ); + } + + specialFocusin = { + setup: function () { + var doc = this.ownerDocument || this, + attaches = $.data( doc, 'ooui-focusin-attaches' ); + if ( !attaches ) { + doc.addEventListener( 'focus', handler, true ); + } + $.data( doc, 'ooui-focusin-attaches', ( attaches || 0 ) + 1 ); + }, + teardown: function () { + var doc = this.ownerDocument || this, + attaches = $.data( doc, 'ooui-focusin-attaches' ) - 1; + if ( !attaches ) { + doc.removeEventListener( 'focus', handler, true ); + $.removeData( doc, 'ooui-focusin-attaches' ); + } else { + $.data( doc, 'ooui-focusin-attaches', attaches ); + } + } + }; + + /** + * Bind a handler for an event on the DOM element. + * + * Uses jQuery internally for everything except for events which are + * known to have issues in the browser or in jQuery. This method + * should become obsolete eventually. + * + * @param {string} event + * @param {Function} callback + */ + OO.ui.Element.prototype.onDOMEvent = function ( event, callback ) { + var orig; + + if ( event === 'focusin' ) { + // jQuery 1.8.3 has a bug with handling focusin events inside iframes. + // Firefox doesn't support focusin at all, so we listen for 'focus' on the + // document, and simulate a 'focusin' event on the target element and make + // it bubble from there. + // + // - http://jsfiddle.net/sw3hr/ + // - http://bugs.jquery.com/ticket/14180 + // - https://github.com/jquery/jquery/commit/1cecf64e5aa4153 + + // Replace jQuery's override with our own + orig = $.event.special.focusin; + $.event.special.focusin = specialFocusin; + + this.$element.on( event, callback ); + + // Restore + $.event.special.focusin = orig; + + } else { + this.$element.on( event, callback ); + } + }; + + /** + * @param {string} event + * @param {Function} callback + */ + OO.ui.Element.prototype.offDOMEvent = function ( event, callback ) { + var orig; + if ( event === 'focusin' ) { + orig = $.event.special.focusin; + $.event.special.focusin = specialFocusin; + this.$element.off( event, callback ); + $.event.special.focusin = orig; + } else { + this.$element.off( event, callback ); + } + }; +}() ); +/** + * Embedded iframe with the same styles as its parent. + * + * @class + * @extends OO.ui.Element + * @mixins OO.EventEmitter + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.Frame = function OoUiFrame( config ) { + // Parent constructor + OO.ui.Frame.super.call( this, config ); + + // Mixin constructors + OO.EventEmitter.call( this ); + + // Properties + this.loading = false; + this.loaded = false; + this.config = config; + + // Initialize + this.$element + .addClass( 'oo-ui-frame' ) + .attr( { 'frameborder': 0, 'scrolling': 'no' } ); + +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.Frame, OO.ui.Element ); + +OO.mixinClass( OO.ui.Frame, OO.EventEmitter ); + +/* Static Properties */ + +/** + * @static + * @inheritdoc + */ +OO.ui.Frame.static.tagName = 'iframe'; + +/* Events */ + +/** + * @event load + */ + +/* Static Methods */ + +/** + * Transplant the CSS styles from as parent document to a frame's document. + * + * This loops over the style sheets in the parent document, and copies their nodes to the + * frame's document. It then polls the document to see when all styles have loaded, and once they + * have, invokes the callback. + * + * If the styles still haven't loaded after a long time (5 seconds by default), we give up waiting + * and invoke the callback anyway. This protects against cases like a display: none; iframe in + * Firefox, where the styles won't load until the iframe becomes visible. + * + * For details of how we arrived at the strategy used in this function, see #load. + * + * @static + * @inheritable + * @param {HTMLDocument} parentDoc Document to transplant styles from + * @param {HTMLDocument} frameDoc Document to transplant styles to + * @param {Function} [callback] Callback to execute once styles have loaded + * @param {number} [timeout=5000] How long to wait before giving up (in ms). If 0, never give up. + */ +OO.ui.Frame.static.transplantStyles = function ( parentDoc, frameDoc, callback, timeout ) { + var i, numSheets, styleNode, newNode, timeoutID, pollNodeId, $pendingPollNodes, + $pollNodes = $( [] ), + // Fake font-family value + fontFamily = 'oo-ui-frame-transplantStyles-loaded'; + + for ( i = 0, numSheets = parentDoc.styleSheets.length; i < numSheets; i++ ) { + styleNode = parentDoc.styleSheets[i].ownerNode; + if ( callback && styleNode.nodeName.toLowerCase() === 'link' ) { + // External stylesheet + // Create a node with a unique ID that we're going to monitor to see when the CSS + // has loaded + pollNodeId = 'oo-ui-frame-transplantStyles-loaded-' + i; + $pollNodes = $pollNodes.add( $( '<div>', frameDoc ) + .attr( 'id', pollNodeId ) + .appendTo( frameDoc.body ) + ); + + // Add <style>@import url(...); #pollNodeId { font-family: ... }</style> + // The font-family rule will only take effect once the @import finishes + newNode = frameDoc.createElement( 'style' ); + newNode.textContent = '@import url(' + styleNode.href + ');\n' + + '#' + pollNodeId + ' { font-family: ' + fontFamily + '; }'; + } else { + // Not an external stylesheet, or no polling required; just copy the node over + newNode = frameDoc.importNode( styleNode, true ); + } + frameDoc.head.appendChild( newNode ); + } + + if ( callback ) { + // Poll every 100ms until all external stylesheets have loaded + $pendingPollNodes = $pollNodes; + timeoutID = setTimeout( function pollExternalStylesheets() { + while ( + $pendingPollNodes.length > 0 && + $pendingPollNodes.eq( 0 ).css( 'font-family' ) === fontFamily + ) { + $pendingPollNodes = $pendingPollNodes.slice( 1 ); + } + + if ( $pendingPollNodes.length === 0 ) { + // We're done! + if ( timeoutID !== null ) { + timeoutID = null; + $pollNodes.remove(); + callback(); + } + } else { + timeoutID = setTimeout( pollExternalStylesheets, 100 ); + } + }, 100 ); + // ...but give up after a while + if ( timeout !== 0 ) { + setTimeout( function () { + if ( timeoutID ) { + clearTimeout( timeoutID ); + timeoutID = null; + $pollNodes.remove(); + callback(); + } + }, timeout || 5000 ); + } + } +}; + +/* Methods */ + +/** + * Load the frame contents. + * + * Once the iframe's stylesheets are loaded, the `initialize` event will be emitted. + * + * Sounds simple right? Read on... + * + * When you create a dynamic iframe using open/write/close, the window.load event for the + * iframe is triggered when you call close, and there's no further load event to indicate that + * everything is actually loaded. + * + * In Chrome, stylesheets don't show up in document.styleSheets until they have loaded, so we could + * just poll that array and wait for it to have the right length. However, in Firefox, stylesheets + * are added to document.styleSheets immediately, and the only way you can determine whether they've + * loaded is to attempt to access .cssRules and wait for that to stop throwing an exception. But + * cross-domain stylesheets never allow .cssRules to be accessed even after they have loaded. + * + * The workaround is to change all `<link href="...">` tags to `<style>@import url(...)</style>` tags. + * Because `@import` is blocking, Chrome won't add the stylesheet to document.styleSheets until + * the `@import` has finished, and Firefox won't allow .cssRules to be accessed until the `@import` + * has finished. And because the contents of the `<style>` tag are from the same origin, accessing + * .cssRules is allowed. + * + * However, now that we control the styles we're injecting, we might as well do away with + * browser-specific polling hacks like document.styleSheets and .cssRules, and instead inject + * `<style>@import url(...); #foo { font-family: someValue; }</style>`, then create `<div id="foo">` + * and wait for its font-family to change to someValue. Because `@import` is blocking, the font-family + * rule is not applied until after the `@import` finishes. + * + * All this stylesheet injection and polling magic is in #transplantStyles. + * + * @private + * @fires load + */ +OO.ui.Frame.prototype.load = function () { + var win = this.$element.prop( 'contentWindow' ), + doc = win.document, + frame = this; + + this.loading = true; + + // Figure out directionality: + this.dir = this.$element.closest( '[dir]' ).prop( 'dir' ) || 'ltr'; + + // Initialize contents + doc.open(); + doc.write( + '<!doctype html>' + + '<html>' + + '<body class="oo-ui-frame-body oo-ui-' + this.dir + '" style="direction:' + this.dir + ';" dir="' + this.dir + '">' + + '<div class="oo-ui-frame-content"></div>' + + '</body>' + + '</html>' + ); + doc.close(); + + // Properties + this.$ = OO.ui.Element.getJQuery( doc, this ); + this.$content = this.$( '.oo-ui-frame-content' ); + this.$document = this.$( doc ); + + this.constructor.static.transplantStyles( + this.getElementDocument(), + this.$document[0], + function () { + frame.loading = false; + frame.loaded = true; + frame.emit( 'load' ); + } + ); +}; + +/** + * Run a callback as soon as the frame has been loaded. + * + * + * This will start loading if it hasn't already, and runs + * immediately if the frame is already loaded. + * + * Don't call this until the element is attached. + * + * @param {Function} callback + */ +OO.ui.Frame.prototype.run = function ( callback ) { + if ( this.loaded ) { + callback(); + } else { + if ( !this.loading ) { + this.load(); + } + this.once( 'load', callback ); + } +}; + +/** + * Sets the size of the frame. + * + * @param {number} width Frame width in pixels + * @param {number} height Frame height in pixels + * @chainable + */ +OO.ui.Frame.prototype.setSize = function ( width, height ) { + this.$element.css( { 'width': width, 'height': height } ); + return this; +}; +/** + * Container for elements in a child frame. + * + * There are two ways to specify a title: set the static `title` property or provide a `title` + * property in the configuration options. The latter will override the former. + * + * @abstract + * @class + * @extends OO.ui.Element + * @mixins OO.EventEmitter + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {string|Function} [title] Title string or function that returns a string + * @cfg {string} [icon] Symbolic name of icon + * @fires initialize + */ +OO.ui.Window = function OoUiWindow( config ) { + // Parent constructor + OO.ui.Window.super.call( this, config ); + + // Mixin constructors + OO.EventEmitter.call( this ); + + // Properties + this.visible = false; + this.opening = false; + this.closing = false; + this.title = OO.ui.resolveMsg( config.title || this.constructor.static.title ); + this.icon = config.icon || this.constructor.static.icon; + this.frame = new OO.ui.Frame( { '$': this.$ } ); + this.$frame = this.$( '<div>' ); + this.$ = function () { + throw new Error( 'this.$() cannot be used until the frame has been initialized.' ); + }; + + // Initialization + this.$element + .addClass( 'oo-ui-window' ) + // Hide the window using visibility: hidden; while the iframe is still loading + // Can't use display: none; because that prevents the iframe from loading in Firefox + .css( 'visibility', 'hidden' ) + .append( this.$frame ); + this.$frame + .addClass( 'oo-ui-window-frame' ) + .append( this.frame.$element ); + + // Events + this.frame.connect( this, { 'load': 'initialize' } ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.Window, OO.ui.Element ); + +OO.mixinClass( OO.ui.Window, OO.EventEmitter ); + +/* Events */ + +/** + * Initialize contents. + * + * Fired asynchronously after construction when iframe is ready. + * + * @event initialize + */ + +/** + * Open window. + * + * Fired after window has been opened. + * + * @event open + * @param {Object} data Window opening data + */ + +/** + * Close window. + * + * Fired after window has been closed. + * + * @event close + * @param {Object} data Window closing data + */ + +/* Static Properties */ + +/** + * Symbolic name of icon. + * + * @static + * @inheritable + * @property {string} + */ +OO.ui.Window.static.icon = 'window'; + +/** + * Window title. + * + * Subclasses must implement this property before instantiating the window. + * Alternatively, override #getTitle with an alternative implementation. + * + * @static + * @abstract + * @inheritable + * @property {string|Function} Title string or function that returns a string + */ +OO.ui.Window.static.title = null; + +/* Methods */ + +/** + * Check if window is visible. + * + * @return {boolean} Window is visible + */ +OO.ui.Window.prototype.isVisible = function () { + return this.visible; +}; + +/** + * Check if window is opening. + * + * @return {boolean} Window is opening + */ +OO.ui.Window.prototype.isOpening = function () { + return this.opening; +}; + +/** + * Check if window is closing. + * + * @return {boolean} Window is closing + */ +OO.ui.Window.prototype.isClosing = function () { + return this.closing; +}; + +/** + * Get the window frame. + * + * @return {OO.ui.Frame} Frame of window + */ +OO.ui.Window.prototype.getFrame = function () { + return this.frame; +}; + +/** + * Get the title of the window. + * + * @return {string} Title text + */ +OO.ui.Window.prototype.getTitle = function () { + return this.title; +}; + +/** + * Get the window icon. + * + * @return {string} Symbolic name of icon + */ +OO.ui.Window.prototype.getIcon = function () { + return this.icon; +}; + +/** + * Set the size of window frame. + * + * @param {number} [width=auto] Custom width + * @param {number} [height=auto] Custom height + * @chainable + */ +OO.ui.Window.prototype.setSize = function ( width, height ) { + if ( !this.frame.$content ) { + return; + } + + this.frame.$element.css( { + 'width': width === undefined ? 'auto' : width, + 'height': height === undefined ? 'auto' : height + } ); + + return this; +}; + +/** + * Set the title of the window. + * + * @param {string|Function} title Title text or a function that returns text + * @chainable + */ +OO.ui.Window.prototype.setTitle = function ( title ) { + this.title = OO.ui.resolveMsg( title ); + if ( this.$title ) { + this.$title.text( title ); + } + return this; +}; + +/** + * Set the icon of the window. + * + * @param {string} icon Symbolic name of icon + * @chainable + */ +OO.ui.Window.prototype.setIcon = function ( icon ) { + if ( this.$icon ) { + this.$icon.removeClass( 'oo-ui-icon-' + this.icon ); + } + this.icon = icon; + if ( this.$icon ) { + this.$icon.addClass( 'oo-ui-icon-' + this.icon ); + } + + return this; +}; + +/** + * Set the position of window to fit with contents. + * + * @param {string} left Left offset + * @param {string} top Top offset + * @chainable + */ +OO.ui.Window.prototype.setPosition = function ( left, top ) { + this.$element.css( { 'left': left, 'top': top } ); + return this; +}; + +/** + * Set the height of window to fit with contents. + * + * @param {number} [min=0] Min height + * @param {number} [max] Max height (defaults to content's outer height) + * @chainable + */ +OO.ui.Window.prototype.fitHeightToContents = function ( min, max ) { + var height = this.frame.$content.outerHeight(); + + this.frame.$element.css( + 'height', Math.max( min || 0, max === undefined ? height : Math.min( max, height ) ) + ); + + return this; +}; + +/** + * Set the width of window to fit with contents. + * + * @param {number} [min=0] Min height + * @param {number} [max] Max height (defaults to content's outer width) + * @chainable + */ +OO.ui.Window.prototype.fitWidthToContents = function ( min, max ) { + var width = this.frame.$content.outerWidth(); + + this.frame.$element.css( + 'width', Math.max( min || 0, max === undefined ? width : Math.min( max, width ) ) + ); + + return this; +}; + +/** + * Initialize window contents. + * + * The first time the window is opened, #initialize is called when it's safe to begin populating + * its contents. See #setup for a way to make changes each time the window opens. + * + * Once this method is called, this.$$ can be used to create elements within the frame. + * + * @fires initialize + * @chainable + */ +OO.ui.Window.prototype.initialize = function () { + // Properties + this.$ = this.frame.$; + this.$title = this.$( '<div class="oo-ui-window-title"></div>' ) + .text( this.title ); + this.$icon = this.$( '<div class="oo-ui-window-icon"></div>' ) + .addClass( 'oo-ui-icon-' + this.icon ); + this.$head = this.$( '<div class="oo-ui-window-head"></div>' ); + this.$body = this.$( '<div class="oo-ui-window-body"></div>' ); + this.$foot = this.$( '<div class="oo-ui-window-foot"></div>' ); + this.$overlay = this.$( '<div class="oo-ui-window-overlay"></div>' ); + + // Initialization + this.frame.$content.append( + this.$head.append( this.$icon, this.$title ), + this.$body, + this.$foot, + this.$overlay + ); + + // Undo the visibility: hidden; hack from the constructor and apply display: none; + // We can do this safely now that the iframe has initialized + this.$element.hide().css( 'visibility', '' ); + + this.emit( 'initialize' ); + + return this; +}; + +/** + * Setup window for use. + * + * Each time the window is opened, once it's ready to be interacted with, this will set it up for + * use in a particular context, based on the `data` argument. + * + * When you override this method, you must call the parent method at the very beginning. + * + * @abstract + * @param {Object} [data] Window opening data + */ +OO.ui.Window.prototype.setup = function () { + // Override to do something +}; + +/** + * Tear down window after use. + * + * Each time the window is closed, and it's done being interacted with, this will tear it down and + * do something with the user's interactions within the window, based on the `data` argument. + * + * When you override this method, you must call the parent method at the very end. + * + * @abstract + * @param {Object} [data] Window closing data + */ +OO.ui.Window.prototype.teardown = function () { + // Override to do something +}; + +/** + * Open window. + * + * Do not override this method. See #setup for a way to make changes each time the window opens. + * + * @param {Object} [data] Window opening data + * @fires open + * @chainable + */ +OO.ui.Window.prototype.open = function ( data ) { + if ( !this.opening && !this.closing && !this.visible ) { + this.opening = true; + this.frame.run( OO.ui.bind( function () { + this.$element.show(); + this.visible = true; + this.frame.$element.focus(); + this.emit( 'opening', data ); + this.setup( data ); + this.emit( 'open', data ); + this.opening = false; + }, this ) ); + } + + return this; +}; + +/** + * Close window. + * + * See #teardown for a way to do something each time the window closes. + * + * @param {Object} [data] Window closing data + * @fires close + * @chainable + */ +OO.ui.Window.prototype.close = function ( data ) { + if ( !this.opening && !this.closing && this.visible ) { + this.frame.$content.find( ':focus' ).blur(); + this.closing = true; + this.$element.hide(); + this.visible = false; + this.emit( 'closing', data ); + this.teardown( data ); + this.emit( 'close', data ); + this.closing = false; + } + + return this; +}; +/** + * Set of mutually exclusive windows. + * + * @class + * @extends OO.ui.Element + * @mixins OO.EventEmitter + * + * @constructor + * @param {OO.Factory} factory Window factory + * @param {Object} [config] Configuration options + */ +OO.ui.WindowSet = function OoUiWindowSet( factory, config ) { + // Parent constructor + OO.ui.WindowSet.super.call( this, config ); + + // Mixin constructors + OO.EventEmitter.call( this ); + + // Properties + this.factory = factory; + + /** + * List of all windows associated with this window set. + * + * @property {OO.ui.Window[]} + */ + this.windowList = []; + + /** + * Mapping of OO.ui.Window objects created by name from the #factory. + * + * @property {Object} + */ + this.windows = {}; + this.currentWindow = null; + + // Initialization + this.$element.addClass( 'oo-ui-windowSet' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.WindowSet, OO.ui.Element ); + +OO.mixinClass( OO.ui.WindowSet, OO.EventEmitter ); + +/* Events */ + +/** + * @event opening + * @param {OO.ui.Window} win Window that's being opened + * @param {Object} config Window opening information + */ + +/** + * @event open + * @param {OO.ui.Window} win Window that's been opened + * @param {Object} config Window opening information + */ + +/** + * @event closing + * @param {OO.ui.Window} win Window that's being closed + * @param {Object} config Window closing information + */ + +/** + * @event close + * @param {OO.ui.Window} win Window that's been closed + * @param {Object} config Window closing information + */ + +/* Methods */ + +/** + * Handle a window that's being opened. + * + * @param {OO.ui.Window} win Window that's being opened + * @param {Object} [config] Window opening information + * @fires opening + */ +OO.ui.WindowSet.prototype.onWindowOpening = function ( win, config ) { + if ( this.currentWindow && this.currentWindow !== win ) { + this.currentWindow.close(); + } + this.currentWindow = win; + this.emit( 'opening', win, config ); +}; + +/** + * Handle a window that's been opened. + * + * @param {OO.ui.Window} win Window that's been opened + * @param {Object} [config] Window opening information + * @fires open + */ +OO.ui.WindowSet.prototype.onWindowOpen = function ( win, config ) { + this.emit( 'open', win, config ); +}; + +/** + * Handle a window that's being closed. + * + * @param {OO.ui.Window} win Window that's being closed + * @param {Object} [config] Window closing information + * @fires closing + */ +OO.ui.WindowSet.prototype.onWindowClosing = function ( win, config ) { + this.currentWindow = null; + this.emit( 'closing', win, config ); +}; + +/** + * Handle a window that's been closed. + * + * @param {OO.ui.Window} win Window that's been closed + * @param {Object} [config] Window closing information + * @fires close + */ +OO.ui.WindowSet.prototype.onWindowClose = function ( win, config ) { + this.emit( 'close', win, config ); +}; + +/** + * Get the current window. + * + * @return {OO.ui.Window} Current window + */ +OO.ui.WindowSet.prototype.getCurrentWindow = function () { + return this.currentWindow; +}; + +/** + * Return a given window. + * + * @param {string} name Symbolic name of window + * @return {OO.ui.Window} Window with specified name + */ +OO.ui.WindowSet.prototype.getWindow = function ( name ) { + var win; + + if ( !this.factory.lookup( name ) ) { + throw new Error( 'Unknown window: ' + name ); + } + if ( !( name in this.windows ) ) { + win = this.windows[name] = this.createWindow( name ); + this.addWindow( win ); + } + return this.windows[name]; +}; + +/** + * Create a window for use in this window set. + * + * @param {string} name Symbolic name of window + * @return {OO.ui.Window} Window with specified name + */ +OO.ui.WindowSet.prototype.createWindow = function ( name ) { + return this.factory.create( name, { '$': this.$ } ); +}; + +/** + * Add a given window to this window set. + * + * Connects event handlers and attaches it to the DOM. Calling + * OO.ui.Window#open will not work until the window is added to the set. + * + * @param {OO.ui.Window} win + */ +OO.ui.WindowSet.prototype.addWindow = function ( win ) { + if ( this.windowList.indexOf( win ) !== -1 ) { + // Already set up + return; + } + this.windowList.push( win ); + + win.connect( this, { + 'opening': [ 'onWindowOpening', win ], + 'open': [ 'onWindowOpen', win ], + 'closing': [ 'onWindowClosing', win ], + 'close': [ 'onWindowClose', win ] + } ); + this.$element.append( win.$element ); +}; +/** + * @abstract + * @class + * @extends OO.ui.Window + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [footless] Hide foot + * @cfg {string} [size='large'] Symbolic name of dialog size, `small`, `medium` or `large` + */ +OO.ui.Dialog = function OoUiDialog( config ) { + // Configuration initialization + config = $.extend( { 'size': 'large' }, config ); + + // Parent constructor + OO.ui.Dialog.super.call( this, config ); + + // Properties + this.visible = false; + this.footless = !!config.footless; + this.size = null; + this.onWindowMouseWheelHandler = OO.ui.bind( this.onWindowMouseWheel, this ); + this.onDocumentKeyDownHandler = OO.ui.bind( this.onDocumentKeyDown, this ); + + // Events + this.$element.on( 'mousedown', false ); + this.connect( this, { 'opening': 'onOpening' } ); + + // Initialization + this.$element.addClass( 'oo-ui-dialog' ); + this.setSize( config.size ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.Dialog, OO.ui.Window ); + +/* Static Properties */ + +/** + * Symbolic name of dialog. + * + * @abstract + * @static + * @property {string} + * @inheritable + */ +OO.ui.Dialog.static.name = ''; + +/** + * Map of symbolic size names and CSS classes. + * + * @static + * @property {Object} + * @inheritable + */ +OO.ui.Dialog.static.sizeCssClasses = { + 'small': 'oo-ui-dialog-small', + 'medium': 'oo-ui-dialog-medium', + 'large': 'oo-ui-dialog-large' +}; + +/* Methods */ + +/** + * Handle close button click events. + */ +OO.ui.Dialog.prototype.onCloseButtonClick = function () { + this.close( { 'action': 'cancel' } ); +}; + +/** + * Handle window mouse wheel events. + * + * @param {jQuery.Event} e Mouse wheel event + */ +OO.ui.Dialog.prototype.onWindowMouseWheel = function () { + return false; +}; + +/** + * Handle document key down events. + * + * @param {jQuery.Event} e Key down event + */ +OO.ui.Dialog.prototype.onDocumentKeyDown = function ( e ) { + switch ( e.which ) { + case OO.ui.Keys.PAGEUP: + case OO.ui.Keys.PAGEDOWN: + case OO.ui.Keys.END: + case OO.ui.Keys.HOME: + case OO.ui.Keys.LEFT: + case OO.ui.Keys.UP: + case OO.ui.Keys.RIGHT: + case OO.ui.Keys.DOWN: + // Prevent any key events that might cause scrolling + return false; + } +}; + +/** + * Handle frame document key down events. + * + * @param {jQuery.Event} e Key down event + */ +OO.ui.Dialog.prototype.onFrameDocumentKeyDown = function ( e ) { + if ( e.which === OO.ui.Keys.ESCAPE ) { + this.close( { 'action': 'cancel' } ); + return false; + } +}; + +/** */ +OO.ui.Dialog.prototype.onOpening = function () { + this.$element.addClass( 'oo-ui-dialog-open' ); +}; + +/** + * Set dialog size. + * + * @param {string} [size='large'] Symbolic name of dialog size, `small`, `medium` or `large` + */ +OO.ui.Dialog.prototype.setSize = function ( size ) { + var name, state, cssClass, + sizeCssClasses = OO.ui.Dialog.static.sizeCssClasses; + + if ( !sizeCssClasses[size] ) { + size = 'large'; + } + this.size = size; + for ( name in sizeCssClasses ) { + state = name === size; + cssClass = sizeCssClasses[name]; + this.$element.toggleClass( cssClass, state ); + if ( this.frame.$content ) { + this.frame.$content.toggleClass( cssClass, state ); + } + } +}; + +/** + * @inheritdoc + */ +OO.ui.Dialog.prototype.initialize = function () { + // Parent method + OO.ui.Window.prototype.initialize.call( this ); + + // Properties + this.closeButton = new OO.ui.ButtonWidget( { + '$': this.$, + 'frameless': true, + 'icon': 'close', + 'title': OO.ui.msg( 'ooui-dialog-action-close' ) + } ); + + // Events + this.closeButton.connect( this, { 'click': 'onCloseButtonClick' } ); + this.frame.$document.on( 'keydown', OO.ui.bind( this.onFrameDocumentKeyDown, this ) ); + + // Initialization + this.frame.$content.addClass( 'oo-ui-dialog-content' ); + if ( this.footless ) { + this.frame.$content.addClass( 'oo-ui-dialog-content-footless' ); + } + this.closeButton.$element.addClass( 'oo-ui-window-closeButton' ); + this.$head.append( this.closeButton.$element ); +}; + +/** + * @inheritdoc + */ +OO.ui.Dialog.prototype.setup = function ( data ) { + // Parent method + OO.ui.Window.prototype.setup.call( this, data ); + + // Prevent scrolling in top-level window + this.$( window ).on( 'mousewheel', this.onWindowMouseWheelHandler ); + this.$( document ).on( 'keydown', this.onDocumentKeyDownHandler ); +}; + +/** + * @inheritdoc + */ +OO.ui.Dialog.prototype.teardown = function ( data ) { + // Parent method + OO.ui.Window.prototype.teardown.call( this, data ); + + // Allow scrolling in top-level window + this.$( window ).off( 'mousewheel', this.onWindowMouseWheelHandler ); + this.$( document ).off( 'keydown', this.onDocumentKeyDownHandler ); +}; + +/** + * @inheritdoc + */ +OO.ui.Dialog.prototype.close = function ( data ) { + var dialog = this; + if ( !dialog.opening && !dialog.closing && dialog.visible ) { + // Trigger transition + dialog.$element.removeClass( 'oo-ui-dialog-open' ); + // Allow transition to complete before actually closing + setTimeout( function () { + // Parent method + OO.ui.Window.prototype.close.call( dialog, data ); + }, 250 ); + } +}; +/** + * Container for elements. + * + * @abstract + * @class + * @extends OO.ui.Element + * @mixins OO.EventEmitter + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.Layout = function OoUiLayout( config ) { + // Initialize config + config = config || {}; + + // Parent constructor + OO.ui.Layout.super.call( this, config ); + + // Mixin constructors + OO.EventEmitter.call( this ); + + // Initialization + this.$element.addClass( 'oo-ui-layout' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.Layout, OO.ui.Element ); + +OO.mixinClass( OO.ui.Layout, OO.EventEmitter ); +/** + * User interface control. + * + * @abstract + * @class + * @extends OO.ui.Element + * @mixins OO.EventEmitter + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [disabled=false] Disable + */ +OO.ui.Widget = function OoUiWidget( config ) { + // Initialize config + config = $.extend( { 'disabled': false }, config ); + + // Parent constructor + OO.ui.Widget.super.call( this, config ); + + // Mixin constructors + OO.EventEmitter.call( this ); + + // Properties + this.disabled = null; + this.wasDisabled = null; + + // Initialization + this.$element.addClass( 'oo-ui-widget' ); + this.setDisabled( !!config.disabled ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.Widget, OO.ui.Element ); + +OO.mixinClass( OO.ui.Widget, OO.EventEmitter ); + +/* Events */ + +/** + * @event disable + * @param {boolean} disabled Widget is disabled + */ + +/* Methods */ + +/** + * Check if the widget is disabled. + * + * @param {boolean} Button is disabled + */ +OO.ui.Widget.prototype.isDisabled = function () { + return this.disabled; +}; + +/** + * Update the disabled state, in case of changes in parent widget. + * + * @chainable + */ +OO.ui.Widget.prototype.updateDisabled = function () { + this.setDisabled( this.disabled ); + return this; +}; + +/** + * Set the disabled state of the widget. + * + * This should probably change the widgets' appearance and prevent it from being used. + * + * @param {boolean} disabled Disable widget + * @chainable + */ +OO.ui.Widget.prototype.setDisabled = function ( disabled ) { + var isDisabled; + + this.disabled = !!disabled; + isDisabled = this.isDisabled(); + if ( isDisabled !== this.wasDisabled ) { + this.$element.toggleClass( 'oo-ui-widget-disabled', isDisabled ); + this.$element.toggleClass( 'oo-ui-widget-enabled', !isDisabled ); + this.emit( 'disable', isDisabled ); + } + this.wasDisabled = isDisabled; + return this; +}; +/** + * Element with a button. + * + * @class + * @abstract + * + * @constructor + * @param {jQuery} $button Button node, assigned to #$button + * @param {Object} [config] Configuration options + * @cfg {boolean} [frameless] Render button without a frame + * @cfg {number} [tabIndex=0] Button's tab index, use -1 to prevent tab focusing + */ +OO.ui.ButtonedElement = function OoUiButtonedElement( $button, config ) { + // Configuration initialization + config = config || {}; + + // Properties + this.$button = $button; + this.tabIndex = null; + this.active = false; + this.onMouseUpHandler = OO.ui.bind( this.onMouseUp, this ); + + // Events + this.$button.on( 'mousedown', OO.ui.bind( this.onMouseDown, this ) ); + + // Initialization + this.$element.addClass( 'oo-ui-buttonedElement' ); + this.$button + .addClass( 'oo-ui-buttonedElement-button' ) + .attr( 'role', 'button' ) + .prop( 'tabIndex', config.tabIndex || 0 ); + if ( config.frameless ) { + this.$element.addClass( 'oo-ui-buttonedElement-frameless' ); + } else { + this.$element.addClass( 'oo-ui-buttonedElement-framed' ); + } +}; + +/* Methods */ + +/** + * Handles mouse down events. + * + * @method + * @param {jQuery.Event} e Mouse down event + */ +OO.ui.ButtonedElement.prototype.onMouseDown = function () { + this.tabIndex = this.$button.attr( 'tabIndex' ); + // Remove the tab-index while the button is down to prevent the button from stealing focus + this.$button + .removeAttr( 'tabIndex' ) + .addClass( 'oo-ui-buttonedElement-pressed' ); + this.getElementDocument().addEventListener( 'mouseup', this.onMouseUpHandler, true ); +}; + +/** + * Handles mouse up events. + * + * @method + * @param {jQuery.Event} e Mouse up event + */ +OO.ui.ButtonedElement.prototype.onMouseUp = function () { + // Restore the tab-index after the button is up to restore the button's accesssibility + this.$button + .attr( 'tabIndex', this.tabIndex ) + .removeClass( 'oo-ui-buttonedElement-pressed' ); + this.getElementDocument().removeEventListener( 'mouseup', this.onMouseUpHandler, true ); +}; + +/** + * Set active state. + * + * @method + * @param {boolean} [value] Make button active + * @chainable + */ +OO.ui.ButtonedElement.prototype.setActive = function ( value ) { + this.$button.toggleClass( 'oo-ui-buttonedElement-active', !!value ); + return this; +}; +/** + * Element that can be automatically clipped to visible boundaies. + * + * @class + * @abstract + * + * @constructor + * @param {jQuery} $clippable Nodes to clip, assigned to #$clippable + * @param {Object} [config] Configuration options + */ +OO.ui.ClippableElement = function OoUiClippableElement( $clippable, config ) { + // Configuration initialization + config = config || {}; + + // Properties + this.$clippable = $clippable; + this.clipping = false; + this.clipped = false; + this.$clippableContainer = null; + this.$clippableScroller = null; + this.$clippableWindow = null; + this.idealWidth = null; + this.idealHeight = null; + this.onClippableContainerScrollHandler = OO.ui.bind( this.clip, this ); + this.onClippableWindowResizeHandler = OO.ui.bind( this.clip, this ); + + // Initialization + this.$clippable.addClass( 'oo-ui-clippableElement-clippable' ); +}; + +/* Methods */ + +/** + * Set clipping. + * + * @method + * @param {boolean} value Enable clipping + * @chainable + */ +OO.ui.ClippableElement.prototype.setClipping = function ( value ) { + value = !!value; + + if ( this.clipping !== value ) { + this.clipping = value; + if ( this.clipping ) { + this.$clippableContainer = this.$( this.getClosestScrollableElementContainer() ); + // If the clippable container is the body, we have to listen to scroll events and check + // jQuery.scrollTop on the window because of browser inconsistencies + this.$clippableScroller = this.$clippableContainer.is( 'body' ) ? + this.$( OO.ui.Element.getWindow( this.$clippableContainer ) ) : + this.$clippableContainer; + this.$clippableScroller.on( 'scroll', this.onClippableContainerScrollHandler ); + this.$clippableWindow = this.$( this.getElementWindow() ) + .on( 'resize', this.onClippableWindowResizeHandler ); + // Initial clip after visible + setTimeout( OO.ui.bind( this.clip, this ) ); + } else { + this.$clippableContainer = null; + this.$clippableScroller.off( 'scroll', this.onClippableContainerScrollHandler ); + this.$clippableScroller = null; + this.$clippableWindow.off( 'resize', this.onClippableWindowResizeHandler ); + this.$clippableWindow = null; + } + } + + return this; +}; + +/** + * Check if the element will be clipped to fit the visible area of the nearest scrollable container. + * + * @method + * @return {boolean} Element will be clipped to the visible area + */ +OO.ui.ClippableElement.prototype.isClipping = function () { + return this.clipping; +}; + +/** + * Check if the bottom or right of the element is being clipped by the nearest scrollable container. + * + * @method + * @return {boolean} Part of the element is being clipped + */ +OO.ui.ClippableElement.prototype.isClipped = function () { + return this.clipped; +}; + +/** + * Set the ideal size. + * + * @method + * @param {number|string} [width] Width as a number of pixels or CSS string with unit suffix + * @param {number|string} [height] Height as a number of pixels or CSS string with unit suffix + */ +OO.ui.ClippableElement.prototype.setIdealSize = function ( width, height ) { + this.idealWidth = width; + this.idealHeight = height; +}; + +/** + * Clip element to visible boundaries and allow scrolling when needed. + * + * Element will be clipped the bottom or right of the element is within 10px of the edge of, or + * overlapped by, the visible area of the nearest scrollable container. + * + * @method + * @chainable + */ +OO.ui.ClippableElement.prototype.clip = function () { + if ( !this.clipping ) { + // this.$clippableContainer and this.$clippableWindow are null, so the below will fail + return this; + } + + var buffer = 10, + cOffset = this.$clippable.offset(), + ccOffset = this.$clippableContainer.offset() || { 'top': 0, 'left': 0 }, + ccHeight = this.$clippableContainer.innerHeight() - buffer, + ccWidth = this.$clippableContainer.innerWidth() - buffer, + scrollTop = this.$clippableScroller.scrollTop(), + scrollLeft = this.$clippableScroller.scrollLeft(), + desiredWidth = ( ccOffset.left + scrollLeft + ccWidth ) - cOffset.left, + desiredHeight = ( ccOffset.top + scrollTop + ccHeight ) - cOffset.top, + naturalWidth = this.$clippable.prop( 'scrollWidth' ), + naturalHeight = this.$clippable.prop( 'scrollHeight' ), + clipWidth = desiredWidth < naturalWidth, + clipHeight = desiredHeight < naturalHeight; + + if ( clipWidth ) { + this.$clippable.css( { 'overflow-x': 'auto', 'width': desiredWidth } ); + } else { + this.$clippable.css( { 'overflow-x': '', 'width': this.idealWidth || '' } ); + } + if ( clipHeight ) { + this.$clippable.css( { 'overflow-y': 'auto', 'height': desiredHeight } ); + } else { + this.$clippable.css( { 'overflow-y': '', 'height': this.idealHeight || '' } ); + } + + this.clipped = clipWidth || clipHeight; + + return this; +}; +/** + * Element with named flags, used for styling, that can be added, removed and listed and checked. + * + * @class + * @abstract + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {string[]} [flags=[]] Styling flags, e.g. 'primary', 'destructive' or 'constructive' + */ +OO.ui.FlaggableElement = function OoUiFlaggableElement( config ) { + // Config initialization + config = config || {}; + + // Properties + this.flags = {}; + + // Initialization + this.setFlags( config.flags ); +}; + +/* Methods */ + +/** + * Check if a flag is set. + * + * @method + * @param {string} flag Flag name to check + * @returns {boolean} Has flag + */ +OO.ui.FlaggableElement.prototype.hasFlag = function ( flag ) { + return flag in this.flags; +}; + +/** + * Get the names of all flags. + * + * @method + * @returns {string[]} flags Flag names + */ +OO.ui.FlaggableElement.prototype.getFlags = function () { + return Object.keys( this.flags ); +}; + +/** + * Add one or more flags. + * + * @method + * @param {string[]|Object.<string, boolean>} flags List of flags to add, or list of set/remove + * values, keyed by flag name + * @chainable + */ +OO.ui.FlaggableElement.prototype.setFlags = function ( flags ) { + var i, len, flag, + classPrefix = 'oo-ui-flaggableElement-'; + + if ( $.isArray( flags ) ) { + for ( i = 0, len = flags.length; i < len; i++ ) { + flag = flags[i]; + // Set + this.flags[flag] = true; + this.$element.addClass( classPrefix + flag ); + } + } else if ( OO.isPlainObject( flags ) ) { + for ( flag in flags ) { + if ( flags[flag] ) { + // Set + this.flags[flag] = true; + this.$element.addClass( classPrefix + flag ); + } else { + // Remove + delete this.flags[flag]; + this.$element.removeClass( classPrefix + flag ); + } + } + } + return this; +}; +/** + * Element containing a sequence of child elements. + * + * @class + * @abstract + * + * @constructor + * @param {jQuery} $group Container node, assigned to #$group + * @param {Object} [config] Configuration options + * @cfg {Object.<string,string>} [aggregations] Events to aggregate, keyed by item event name + */ +OO.ui.GroupElement = function OoUiGroupElement( $group, config ) { + // Configuration + config = config || {}; + + // Properties + this.$group = $group; + this.items = []; + this.$items = this.$( [] ); + this.aggregate = !$.isEmptyObject( config.aggregations ); + this.aggregations = config.aggregations || {}; +}; + +/* Methods */ + +/** + * Get items. + * + * @method + * @returns {OO.ui.Element[]} Items + */ +OO.ui.GroupElement.prototype.getItems = function () { + return this.items.slice( 0 ); +}; + +/** + * Add items. + * + * @method + * @param {OO.ui.Element[]} items Item + * @param {number} [index] Index to insert items at + * @chainable + */ +OO.ui.GroupElement.prototype.addItems = function ( items, index ) { + var i, len, item, event, events, currentIndex, + $items = this.$( [] ); + + for ( i = 0, len = items.length; i < len; i++ ) { + item = items[i]; + + // Check if item exists then remove it first, effectively "moving" it + currentIndex = $.inArray( item, this.items ); + if ( currentIndex >= 0 ) { + this.removeItems( [ item ] ); + // Adjust index to compensate for removal + if ( currentIndex < index ) { + index--; + } + } + // Add the item + if ( this.aggregate ) { + events = {}; + for ( event in this.aggregations ) { + events[event] = [ 'emit', this.aggregations[event], item ]; + } + item.connect( this, events ); + } + item.setElementGroup( this ); + $items = $items.add( item.$element ); + } + + if ( index === undefined || index < 0 || index >= this.items.length ) { + this.$group.append( $items ); + this.items.push.apply( this.items, items ); + } else if ( index === 0 ) { + this.$group.prepend( $items ); + this.items.unshift.apply( this.items, items ); + } else { + this.$items.eq( index ).before( $items ); + this.items.splice.apply( this.items, [ index, 0 ].concat( items ) ); + } + + this.$items = this.$items.add( $items ); + + return this; +}; + +/** + * Remove items. + * + * Items will be detached, not removed, so they can be used later. + * + * @method + * @param {OO.ui.Element[]} items Items to remove + * @chainable + */ +OO.ui.GroupElement.prototype.removeItems = function ( items ) { + var i, len, item, index; + + // Remove specific items + for ( i = 0, len = items.length; i < len; i++ ) { + item = items[i]; + index = $.inArray( item, this.items ); + if ( index !== -1 ) { + if ( this.aggregate ) { + item.disconnect( this ); + } + item.setElementGroup( null ); + this.items.splice( index, 1 ); + item.$element.detach(); + this.$items = this.$items.not( item.$element ); + } + } + + return this; +}; + +/** + * Clear all items. + * + * Items will be detached, not removed, so they can be used later. + * + * @method + * @chainable + */ +OO.ui.GroupElement.prototype.clearItems = function () { + var i, len, item; + + // Remove all items + for ( i = 0, len = this.items.length; i < len; i++ ) { + item = this.items[i]; + if ( this.aggregate ) { + item.disconnect( this ); + } + item.setElementGroup( null ); + } + this.items = []; + this.$items.detach(); + this.$items = this.$( [] ); +}; +/** + * Element containing an icon. + * + * @class + * @abstract + * + * @constructor + * @param {jQuery} $icon Icon node, assigned to #$icon + * @param {Object} [config] Configuration options + * @cfg {Object|string} [icon=''] Symbolic icon name, or map of icon names keyed by language ID; + * use the 'default' key to specify the icon to be used when there is no icon in the user's + * language + */ +OO.ui.IconedElement = function OoUiIconedElement( $icon, config ) { + // Config intialization + config = config || {}; + + // Properties + this.$icon = $icon; + this.icon = null; + + // Initialization + this.$icon.addClass( 'oo-ui-iconedElement-icon' ); + this.setIcon( config.icon || this.constructor.static.icon ); +}; + +/* Static Properties */ + +OO.ui.IconedElement.static = {}; + +/** + * Icon. + * + * Value should be the unique portion of an icon CSS class name, such as 'up' for 'oo-ui-icon-up'. + * + * For i18n purposes, this property can be an object containing a `default` icon name property and + * additional icon names keyed by language code. + * + * Example of i18n icon definition: + * { 'default': 'bold-a', 'en': 'bold-b', 'de': 'bold-f' } + * + * @static + * @inheritable + * @property {Object|string} Symbolic icon name, or map of icon names keyed by language ID; + * use the 'default' key to specify the icon to be used when there is no icon in the user's + * language + */ +OO.ui.IconedElement.static.icon = null; + +/* Methods */ + +/** + * Set icon. + * + * @method + * @param {Object|string} icon Symbolic icon name, or map of icon names keyed by language ID; + * use the 'default' key to specify the icon to be used when there is no icon in the user's + * language + * @chainable + */ +OO.ui.IconedElement.prototype.setIcon = function ( icon ) { + icon = OO.isPlainObject( icon ) ? OO.ui.getLocalValue( icon, null, 'default' ) : icon; + + if ( this.icon ) { + this.$icon.removeClass( 'oo-ui-icon-' + this.icon ); + } + if ( typeof icon === 'string' ) { + icon = icon.trim(); + if ( icon.length ) { + this.$icon.addClass( 'oo-ui-icon-' + icon ); + this.icon = icon; + } + } + this.$element.toggleClass( 'oo-ui-iconedElement', !!this.icon ); + + return this; +}; + +/** + * Get icon. + * + * @method + * @returns {string} Icon + */ +OO.ui.IconedElement.prototype.getIcon = function () { + return this.icon; +}; +/** + * Element containing an indicator. + * + * @class + * @abstract + * + * @constructor + * @param {jQuery} $indicator Indicator node, assigned to #$indicator + * @param {Object} [config] Configuration options + * @cfg {string} [indicator] Symbolic indicator name + * @cfg {string} [indicatorTitle] Indicator title text or a function that return text + */ +OO.ui.IndicatedElement = function OoUiIndicatedElement( $indicator, config ) { + // Config intialization + config = config || {}; + + // Properties + this.$indicator = $indicator; + this.indicator = null; + this.indicatorLabel = null; + + // Initialization + this.$indicator.addClass( 'oo-ui-indicatedElement-indicator' ); + this.setIndicator( config.indicator || this.constructor.static.indicator ); + this.setIndicatorTitle( config.indicatorTitle || this.constructor.static.indicatorTitle ); +}; + +/* Static Properties */ + +OO.ui.IndicatedElement.static = {}; + +/** + * indicator. + * + * @static + * @inheritable + * @property {string|null} Symbolic indicator name or null for no indicator + */ +OO.ui.IndicatedElement.static.indicator = null; + +/** + * Indicator title. + * + * @static + * @inheritable + * @property {string|Function|null} Indicator title text, a function that return text or null for no + * indicator title + */ +OO.ui.IndicatedElement.static.indicatorTitle = null; + +/* Methods */ + +/** + * Set indicator. + * + * @method + * @param {string|null} indicator Symbolic name of indicator to use or null for no indicator + * @chainable + */ +OO.ui.IndicatedElement.prototype.setIndicator = function ( indicator ) { + if ( this.indicator ) { + this.$indicator.removeClass( 'oo-ui-indicator-' + this.indicator ); + this.indicator = null; + } + if ( typeof indicator === 'string' ) { + indicator = indicator.trim(); + if ( indicator.length ) { + this.$indicator.addClass( 'oo-ui-indicator-' + indicator ); + this.indicator = indicator; + } + } + this.$element.toggleClass( 'oo-ui-indicatedElement', !!this.indicator ); + + return this; +}; + +/** + * Set indicator label. + * + * @method + * @param {string|Function|null} indicator Indicator title text, a function that return text or null + * for no indicator title + * @chainable + */ +OO.ui.IndicatedElement.prototype.setIndicatorTitle = function ( indicatorTitle ) { + this.indicatorTitle = indicatorTitle = OO.ui.resolveMsg( indicatorTitle ); + + if ( typeof indicatorTitle === 'string' && indicatorTitle.length ) { + this.$indicator.attr( 'title', indicatorTitle ); + } else { + this.$indicator.removeAttr( 'title' ); + } + + return this; +}; + +/** + * Get indicator. + * + * @method + * @returns {string} title Symbolic name of indicator + */ +OO.ui.IndicatedElement.prototype.getIndicator = function () { + return this.indicator; +}; + +/** + * Get indicator title. + * + * @method + * @returns {string} Indicator title text + */ +OO.ui.IndicatedElement.prototype.getIndicatorTitle = function () { + return this.indicatorTitle; +}; +/** + * Element containing a label. + * + * @class + * @abstract + * + * @constructor + * @param {jQuery} $label Label node, assigned to #$label + * @param {Object} [config] Configuration options + * @cfg {jQuery|string|Function} [label] Label nodes, text or a function that returns nodes or text + * @cfg {boolean} [autoFitLabel=true] Whether to fit the label or not. + */ +OO.ui.LabeledElement = function OoUiLabeledElement( $label, config ) { + // Config intialization + config = config || {}; + + // Properties + this.$label = $label; + this.label = null; + + // Initialization + this.$label.addClass( 'oo-ui-labeledElement-label' ); + this.setLabel( config.label || this.constructor.static.label ); + this.autoFitLabel = config.autoFitLabel === undefined || !!config.autoFitLabel; +}; + +/* Static Properties */ + +OO.ui.LabeledElement.static = {}; + +/** + * Label. + * + * @static + * @inheritable + * @property {string|Function|null} Label text; a function that returns a nodes or text; or null for + * no label + */ +OO.ui.LabeledElement.static.label = null; + +/* Methods */ + +/** + * Set the label. + * + * An empty string will result in the label being hidden. A string containing only whitespace will + * be converted to a single + * + * @method + * @param {jQuery|string|Function|null} label Label nodes; text; a function that retuns nodes or + * text; or null for no label + * @chainable + */ +OO.ui.LabeledElement.prototype.setLabel = function ( label ) { + var empty = false; + + this.label = label = OO.ui.resolveMsg( label ) || null; + if ( typeof label === 'string' && label.length ) { + if ( label.match( /^\s*$/ ) ) { + // Convert whitespace only string to a single non-breaking space + this.$label.html( ' ' ); + } else { + this.$label.text( label ); + } + } else if ( label instanceof jQuery ) { + this.$label.empty().append( label ); + } else { + this.$label.empty(); + empty = true; + } + this.$element.toggleClass( 'oo-ui-labeledElement', !empty ); + this.$label.css( 'display', empty ? 'none' : '' ); + + return this; +}; + +/** + * Get the label. + * + * @method + * @returns {jQuery|string|Function|null} label Label nodes; text; a function that returns nodes or + * text; or null for no label + */ +OO.ui.LabeledElement.prototype.getLabel = function () { + return this.label; +}; + +/** + * Fit the label. + * + * @method + * @chainable + */ +OO.ui.LabeledElement.prototype.fitLabel = function () { + if ( this.$label.autoEllipsis && this.autoFitLabel ) { + this.$label.autoEllipsis( { 'hasSpan': false, 'tooltip': true } ); + } + return this; +}; +/** + * Popuppable element. + * + * @class + * @abstract + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {number} [popupWidth=320] Width of popup + * @cfg {number} [popupHeight] Height of popup + * @cfg {Object} [popup] Configuration to pass to popup + */ +OO.ui.PopuppableElement = function OoUiPopuppableElement( config ) { + // Configuration initialization + config = $.extend( { 'popupWidth': 320 }, config ); + + // Properties + this.popup = new OO.ui.PopupWidget( $.extend( + { 'align': 'center', 'autoClose': true }, + config.popup, + { '$': this.$, '$autoCloseIgnore': this.$element } + ) ); + this.popupWidth = config.popupWidth; + this.popupHeight = config.popupHeight; +}; + +/* Methods */ + +/** + * Get popup. + * + * @method + * @returns {OO.ui.PopupWidget} Popup widget + */ +OO.ui.PopuppableElement.prototype.getPopup = function () { + return this.popup; +}; + +/** + * Show popup. + * + * @method + */ +OO.ui.PopuppableElement.prototype.showPopup = function () { + this.popup.show().display( this.popupWidth, this.popupHeight ); +}; + +/** + * Hide popup. + * + * @method + */ +OO.ui.PopuppableElement.prototype.hidePopup = function () { + this.popup.hide(); +}; +/** + * Element with a title. + * + * @class + * @abstract + * + * @constructor + * @param {jQuery} $label Titled node, assigned to #$titled + * @param {Object} [config] Configuration options + * @cfg {string|Function} [title] Title text or a function that returns text + */ +OO.ui.TitledElement = function OoUiTitledElement( $titled, config ) { + // Config intialization + config = config || {}; + + // Properties + this.$titled = $titled; + this.title = null; + + // Initialization + this.setTitle( config.title || this.constructor.static.title ); +}; + +/* Static Properties */ + +OO.ui.TitledElement.static = {}; + +/** + * Title. + * + * @static + * @inheritable + * @property {string|Function} Title text or a function that returns text + */ +OO.ui.TitledElement.static.title = null; + +/* Methods */ + +/** + * Set title. + * + * @method + * @param {string|Function|null} title Title text, a function that returns text or null for no title + * @chainable + */ +OO.ui.TitledElement.prototype.setTitle = function ( title ) { + this.title = title = OO.ui.resolveMsg( title ) || null; + + if ( typeof title === 'string' && title.length ) { + this.$titled.attr( 'title', title ); + } else { + this.$titled.removeAttr( 'title' ); + } + + return this; +}; + +/** + * Get title. + * + * @method + * @returns {string} Title string + */ +OO.ui.TitledElement.prototype.getTitle = function () { + return this.title; +}; +/** + * Generic toolbar tool. + * + * @abstract + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.IconedElement + * + * @constructor + * @param {OO.ui.ToolGroup} toolGroup + * @param {Object} [config] Configuration options + * @cfg {string|Function} [title] Title text or a function that returns text + */ +OO.ui.Tool = function OoUiTool( toolGroup, config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.Tool.super.call( this, config ); + + // Mixin constructors + OO.ui.IconedElement.call( this, this.$( '<span>' ), config ); + + // Properties + this.toolGroup = toolGroup; + this.toolbar = this.toolGroup.getToolbar(); + this.active = false; + this.$title = this.$( '<span>' ); + this.$link = this.$( '<a>' ); + this.title = null; + + // Events + this.toolbar.connect( this, { 'updateState': 'onUpdateState' } ); + + // Initialization + this.$title.addClass( 'oo-ui-tool-title' ); + this.$link + .addClass( 'oo-ui-tool-link' ) + .append( this.$icon, this.$title ); + this.$element + .data( 'oo-ui-tool', this ) + .addClass( + 'oo-ui-tool ' + 'oo-ui-tool-name-' + + this.constructor.static.name.replace( /^([^\/]+)\/([^\/]+).*$/, '$1-$2' ) + ) + .append( this.$link ); + this.setTitle( config.title || this.constructor.static.title ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.Tool, OO.ui.Widget ); + +OO.mixinClass( OO.ui.Tool, OO.ui.IconedElement ); + +/* Events */ + +/** + * @event select + */ + +/* Static Properties */ + +/** + * @static + * @inheritdoc + */ +OO.ui.Tool.static.tagName = 'span'; + +/** + * Symbolic name of tool. + * + * @abstract + * @static + * @property {string} + * @inheritable + */ +OO.ui.Tool.static.name = ''; + +/** + * Tool group. + * + * @abstract + * @static + * @property {string} + * @inheritable + */ +OO.ui.Tool.static.group = ''; + +/** + * Tool title. + * + * Title is used as a tooltip when the tool is part of a bar tool group, or a label when the tool + * is part of a list or menu tool group. If a trigger is associated with an action by the same name + * as the tool, a description of its keyboard shortcut for the appropriate platform will be + * appended to the title if the tool is part of a bar tool group. + * + * @abstract + * @static + * @property {string|Function} Title text or a function that returns text + * @inheritable + */ +OO.ui.Tool.static.title = ''; + +/** + * Tool can be automatically added to catch-all groups. + * + * @static + * @property {boolean} + * @inheritable + */ +OO.ui.Tool.static.autoAddToCatchall = true; + +/** + * Tool can be automatically added to named groups. + * + * @static + * @property {boolean} + * @inheritable + */ +OO.ui.Tool.static.autoAddToGroup = true; + +/** + * Check if this tool is compatible with given data. + * + * @static + * @method + * @inheritable + * @param {Mixed} data Data to check + * @return {boolean} Tool can be used with data + */ +OO.ui.Tool.static.isCompatibleWith = function () { + return false; +}; + +/* Methods */ + +/** + * Handle the toolbar state being updated. + * + * This is an abstract method that must be overridden in a concrete subclass. + * + * @abstract + */ +OO.ui.Tool.prototype.onUpdateState = function () { + throw new Error( + 'OO.ui.Tool.onUpdateState not implemented in this subclass:' + this.constructor + ); +}; + +/** + * Handle the tool being selected. + * + * This is an abstract method that must be overridden in a concrete subclass. + * + * @abstract + */ +OO.ui.Tool.prototype.onSelect = function () { + throw new Error( + 'OO.ui.Tool.onSelect not implemented in this subclass:' + this.constructor + ); +}; + +/** + * Check if the button is active. + * + * @param {boolean} Button is active + */ +OO.ui.Tool.prototype.isActive = function () { + return this.active; +}; + +/** + * Make the button appear active or inactive. + * + * @param {boolean} state Make button appear active + */ +OO.ui.Tool.prototype.setActive = function ( state ) { + this.active = !!state; + if ( this.active ) { + this.$element.addClass( 'oo-ui-tool-active' ); + } else { + this.$element.removeClass( 'oo-ui-tool-active' ); + } +}; + +/** + * Get the tool title. + * + * @param {string|Function} title Title text or a function that returns text + * @chainable + */ +OO.ui.Tool.prototype.setTitle = function ( title ) { + this.title = OO.ui.resolveMsg( title ); + this.updateTitle(); + return this; +}; + +/** + * Get the tool title. + * + * @return {string} Title text + */ +OO.ui.Tool.prototype.getTitle = function () { + return this.title; +}; + +/** + * Get the tool's symbolic name. + * + * @return {string} Symbolic name of tool + */ +OO.ui.Tool.prototype.getName = function () { + return this.constructor.static.name; +}; + +/** + * Update the title. + */ +OO.ui.Tool.prototype.updateTitle = function () { + var titleTooltips = this.toolGroup.constructor.static.titleTooltips, + accelTooltips = this.toolGroup.constructor.static.accelTooltips, + accel = this.toolbar.getToolAccelerator( this.constructor.static.name ), + tooltipParts = []; + + this.$title.empty() + .text( this.title ) + .append( + this.$( '<span>' ) + .addClass( 'oo-ui-tool-accel' ) + .text( accel ) + ); + + if ( titleTooltips && typeof this.title === 'string' && this.title.length ) { + tooltipParts.push( this.title ); + } + if ( accelTooltips && typeof accel === 'string' && accel.length ) { + tooltipParts.push( accel ); + } + if ( tooltipParts.length ) { + this.$link.attr( 'title', tooltipParts.join( ' ' ) ); + } else { + this.$link.removeAttr( 'title' ); + } +}; + +/** + * Destroy tool. + */ +OO.ui.Tool.prototype.destroy = function () { + this.toolbar.disconnect( this ); + this.$element.remove(); +}; +/** + * Collection of tool groups. + * + * @class + * @extends OO.ui.Element + * @mixins OO.EventEmitter + * @mixins OO.ui.GroupElement + * + * @constructor + * @param {OO.ui.ToolFactory} toolFactory Factory for creating tools + * @param {OO.ui.ToolGroupFactory} toolGroupFactory Factory for creating tool groups + * @param {Object} [config] Configuration options + * @cfg {boolean} [actions] Add an actions section opposite to the tools + * @cfg {boolean} [shadow] Add a shadow below the toolbar + */ +OO.ui.Toolbar = function OoUiToolbar( toolFactory, toolGroupFactory, config ) { + // Configuration initialization + config = config || {}; + + // Parent constructor + OO.ui.Toolbar.super.call( this, config ); + + // Mixin constructors + OO.EventEmitter.call( this ); + OO.ui.GroupElement.call( this, this.$( '<div>' ), config ); + + // Properties + this.toolFactory = toolFactory; + this.toolGroupFactory = toolGroupFactory; + this.groups = []; + this.tools = {}; + this.$bar = this.$( '<div>' ); + this.$actions = this.$( '<div>' ); + this.initialized = false; + + // Events + this.$element + .add( this.$bar ).add( this.$group ).add( this.$actions ) + .on( 'mousedown', OO.ui.bind( this.onMouseDown, this ) ); + + // Initialization + this.$group.addClass( 'oo-ui-toolbar-tools' ); + this.$bar.addClass( 'oo-ui-toolbar-bar' ).append( this.$group ); + if ( config.actions ) { + this.$actions.addClass( 'oo-ui-toolbar-actions' ); + this.$bar.append( this.$actions ); + } + this.$bar.append( '<div style="clear:both"></div>' ); + if ( config.shadow ) { + this.$bar.append( '<div class="oo-ui-toolbar-shadow"></div>' ); + } + this.$element.addClass( 'oo-ui-toolbar' ).append( this.$bar ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.Toolbar, OO.ui.Element ); + +OO.mixinClass( OO.ui.Toolbar, OO.EventEmitter ); +OO.mixinClass( OO.ui.Toolbar, OO.ui.GroupElement ); + +/* Methods */ + +/** + * Get the tool factory. + * + * @return {OO.ui.ToolFactory} Tool factory + */ +OO.ui.Toolbar.prototype.getToolFactory = function () { + return this.toolFactory; +}; + +/** + * Get the tool group factory. + * + * @return {OO.Factory} Tool group factory + */ +OO.ui.Toolbar.prototype.getToolGroupFactory = function () { + return this.toolGroupFactory; +}; + +/** + * Handles mouse down events. + * + * @param {jQuery.Event} e Mouse down event + */ +OO.ui.Toolbar.prototype.onMouseDown = function ( e ) { + var $closestWidgetToEvent = this.$( e.target ).closest( '.oo-ui-widget' ), + $closestWidgetToToolbar = this.$element.closest( '.oo-ui-widget' ); + if ( !$closestWidgetToEvent.length || $closestWidgetToEvent[0] === $closestWidgetToToolbar[0] ) { + return false; + } +}; + +/** + * Sets up handles and preloads required information for the toolbar to work. + * This must be called immediately after it is attached to a visible document. + */ +OO.ui.Toolbar.prototype.initialize = function () { + this.initialized = true; +}; + +/** + * Setup toolbar. + * + * Tools can be specified in the following ways: + * + * - A specific tool: `{ 'name': 'tool-name' }` or `'tool-name'` + * - All tools in a group: `{ 'group': 'group-name' }` + * - All tools: `'*'` - Using this will make the group a list with a "More" label by default + * + * @param {Object.<string,Array>} groups List of tool group configurations + * @param {Array|string} [groups.include] Tools to include + * @param {Array|string} [groups.exclude] Tools to exclude + * @param {Array|string} [groups.promote] Tools to promote to the beginning + * @param {Array|string} [groups.demote] Tools to demote to the end + */ +OO.ui.Toolbar.prototype.setup = function ( groups ) { + var i, len, type, group, + items = [], + defaultType = 'bar'; + + // Cleanup previous groups + this.reset(); + + // Build out new groups + for ( i = 0, len = groups.length; i < len; i++ ) { + group = groups[i]; + if ( group.include === '*' ) { + // Apply defaults to catch-all groups + if ( group.type === undefined ) { + group.type = 'list'; + } + if ( group.label === undefined ) { + group.label = 'ooui-toolbar-more'; + } + } + // Check type has been registered + type = this.getToolGroupFactory().lookup( group.type ) ? group.type : defaultType; + items.push( + this.getToolGroupFactory().create( type, this, $.extend( { '$': this.$ }, group ) ) + ); + } + this.addItems( items ); +}; + +/** + * Remove all tools and groups from the toolbar. + */ +OO.ui.Toolbar.prototype.reset = function () { + var i, len; + + this.groups = []; + this.tools = {}; + for ( i = 0, len = this.items.length; i < len; i++ ) { + this.items[i].destroy(); + } + this.clearItems(); +}; + +/** + * Destroys toolbar, removing event handlers and DOM elements. + * + * Call this whenever you are done using a toolbar. + */ +OO.ui.Toolbar.prototype.destroy = function () { + this.reset(); + this.$element.remove(); +}; + +/** + * Check if tool has not been used yet. + * + * @param {string} name Symbolic name of tool + * @return {boolean} Tool is available + */ +OO.ui.Toolbar.prototype.isToolAvailable = function ( name ) { + return !this.tools[name]; +}; + +/** + * Prevent tool from being used again. + * + * @param {OO.ui.Tool} tool Tool to reserve + */ +OO.ui.Toolbar.prototype.reserveTool = function ( tool ) { + this.tools[tool.getName()] = tool; +}; + +/** + * Allow tool to be used again. + * + * @param {OO.ui.Tool} tool Tool to release + */ +OO.ui.Toolbar.prototype.releaseTool = function ( tool ) { + delete this.tools[tool.getName()]; +}; + +/** + * Get accelerator label for tool. + * + * This is a stub that should be overridden to provide access to accelerator information. + * + * @param {string} name Symbolic name of tool + * @return {string|undefined} Tool accelerator label if available + */ +OO.ui.Toolbar.prototype.getToolAccelerator = function () { + return undefined; +}; +/** + * Factory for tools. + * + * @class + * @extends OO.Factory + * @constructor + */ +OO.ui.ToolFactory = function OoUiToolFactory() { + // Parent constructor + OO.ui.ToolFactory.super.call( this ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ToolFactory, OO.Factory ); + +/* Methods */ + +/** */ +OO.ui.ToolFactory.prototype.getTools = function ( include, exclude, promote, demote ) { + var i, len, included, promoted, demoted, + auto = [], + used = {}; + + // Collect included and not excluded tools + included = OO.simpleArrayDifference( this.extract( include ), this.extract( exclude ) ); + + // Promotion + promoted = this.extract( promote, used ); + demoted = this.extract( demote, used ); + + // Auto + for ( i = 0, len = included.length; i < len; i++ ) { + if ( !used[included[i]] ) { + auto.push( included[i] ); + } + } + + return promoted.concat( auto ).concat( demoted ); +}; + +/** + * Get a flat list of names from a list of names or groups. + * + * Tools can be specified in the following ways: + * + * - A specific tool: `{ 'name': 'tool-name' }` or `'tool-name'` + * - All tools in a group: `{ 'group': 'group-name' }` + * - All tools: `'*'` + * + * @private + * @param {Array|string} collection List of tools + * @param {Object} [used] Object with names that should be skipped as properties; extracted + * names will be added as properties + * @return {string[]} List of extracted names + */ +OO.ui.ToolFactory.prototype.extract = function ( collection, used ) { + var i, len, item, name, tool, + names = []; + + if ( collection === '*' ) { + for ( name in this.registry ) { + tool = this.registry[name]; + if ( + // Only add tools by group name when auto-add is enabled + tool.static.autoAddToCatchall && + // Exclude already used tools + ( !used || !used[name] ) + ) { + names.push( name ); + if ( used ) { + used[name] = true; + } + } + } + } else if ( $.isArray( collection ) ) { + for ( i = 0, len = collection.length; i < len; i++ ) { + item = collection[i]; + // Allow plain strings as shorthand for named tools + if ( typeof item === 'string' ) { + item = { 'name': item }; + } + if ( OO.isPlainObject( item ) ) { + if ( item.group ) { + for ( name in this.registry ) { + tool = this.registry[name]; + if ( + // Include tools with matching group + tool.static.group === item.group && + // Only add tools by group name when auto-add is enabled + tool.static.autoAddToGroup && + // Exclude already used tools + ( !used || !used[name] ) + ) { + names.push( name ); + if ( used ) { + used[name] = true; + } + } + } + // Include tools with matching name and exclude already used tools + } else if ( item.name && ( !used || !used[item.name] ) ) { + names.push( item.name ); + if ( used ) { + used[item.name] = true; + } + } + } + } + } + return names; +}; +/** + * Collection of tools. + * + * Tools can be specified in the following ways: + * + * - A specific tool: `{ 'name': 'tool-name' }` or `'tool-name'` + * - All tools in a group: `{ 'group': 'group-name' }` + * - All tools: `'*'` + * + * @abstract + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.GroupElement + * + * @constructor + * @param {OO.ui.Toolbar} toolbar + * @param {Object} [config] Configuration options + * @cfg {Array|string} [include=[]] List of tools to include + * @cfg {Array|string} [exclude=[]] List of tools to exclude + * @cfg {Array|string} [promote=[]] List of tools to promote to the beginning + * @cfg {Array|string} [demote=[]] List of tools to demote to the end + */ +OO.ui.ToolGroup = function OoUiToolGroup( toolbar, config ) { + // Configuration initialization + config = $.extend( true, { + 'aggregations': { 'disable': 'itemDisable' } + }, config ); + + // Parent constructor + OO.ui.ToolGroup.super.call( this, config ); + + // Mixin constructors + OO.ui.GroupElement.call( this, this.$( '<div>' ), config ); + + // Properties + this.toolbar = toolbar; + this.tools = {}; + this.pressed = null; + this.autoDisabled = false; + this.include = config.include || []; + this.exclude = config.exclude || []; + this.promote = config.promote || []; + this.demote = config.demote || []; + this.onCapturedMouseUpHandler = OO.ui.bind( this.onCapturedMouseUp, this ); + + // Events + this.$element.on( { + 'mousedown': OO.ui.bind( this.onMouseDown, this ), + 'mouseup': OO.ui.bind( this.onMouseUp, this ), + 'mouseover': OO.ui.bind( this.onMouseOver, this ), + 'mouseout': OO.ui.bind( this.onMouseOut, this ) + } ); + this.toolbar.getToolFactory().connect( this, { 'register': 'onToolFactoryRegister' } ); + this.connect( this, { 'itemDisable': 'updateDisabled' } ); + + // Initialization + this.$group.addClass( 'oo-ui-toolGroup-tools' ); + this.$element + .addClass( 'oo-ui-toolGroup' ) + .append( this.$group ); + this.populate(); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ToolGroup, OO.ui.Widget ); + +OO.mixinClass( OO.ui.ToolGroup, OO.ui.GroupElement ); + +/* Events */ + +/** + * @event update + */ + +/* Static Properties */ + +/** + * Show labels in tooltips. + * + * @static + * @property {boolean} + * @inheritable + */ +OO.ui.ToolGroup.static.titleTooltips = false; + +/** + * Show acceleration labels in tooltips. + * + * @static + * @property {boolean} + * @inheritable + */ +OO.ui.ToolGroup.static.accelTooltips = false; + +/** + * Automatically disable the toolgroup when all tools are disabled + * + * @static + * @property {boolean} + * @inheritable + */ +OO.ui.ToolGroup.static.autoDisable = true; + +/* Methods */ + +/** + * @inheritdoc + */ +OO.ui.ToolGroup.prototype.isDisabled = function () { + return this.autoDisabled || OO.ui.ToolGroup.super.prototype.isDisabled.apply( this, arguments ); +}; + +/** + * @inheritdoc + */ +OO.ui.ToolGroup.prototype.updateDisabled = function () { + var i, item, allDisabled = true; + + if ( this.constructor.static.autoDisable ) { + for ( i = this.items.length - 1; i >= 0; i-- ) { + item = this.items[i]; + if ( !item.isDisabled() ) { + allDisabled = false; + break; + } + } + this.autoDisabled = allDisabled; + } + OO.ui.ToolGroup.super.prototype.updateDisabled.apply( this, arguments ); +}; + +/** + * Handle mouse down events. + * + * @param {jQuery.Event} e Mouse down event + */ +OO.ui.ToolGroup.prototype.onMouseDown = function ( e ) { + if ( !this.disabled && e.which === 1 ) { + this.pressed = this.getTargetTool( e ); + if ( this.pressed ) { + this.pressed.setActive( true ); + this.getElementDocument().addEventListener( + 'mouseup', this.onCapturedMouseUpHandler, true + ); + return false; + } + } +}; + +/** + * Handle captured mouse up events. + * + * @param {Event} e Mouse up event + */ +OO.ui.ToolGroup.prototype.onCapturedMouseUp = function ( e ) { + this.getElementDocument().removeEventListener( 'mouseup', this.onCapturedMouseUpHandler, true ); + // onMouseUp may be called a second time, depending on where the mouse is when the button is + // released, but since `this.pressed` will no longer be true, the second call will be ignored. + this.onMouseUp( e ); +}; + +/** + * Handle mouse up events. + * + * @param {jQuery.Event} e Mouse up event + */ +OO.ui.ToolGroup.prototype.onMouseUp = function ( e ) { + var tool = this.getTargetTool( e ); + + if ( !this.disabled && e.which === 1 && this.pressed && this.pressed === tool ) { + this.pressed.onSelect(); + } + + this.pressed = null; + return false; +}; + +/** + * Handle mouse over events. + * + * @param {jQuery.Event} e Mouse over event + */ +OO.ui.ToolGroup.prototype.onMouseOver = function ( e ) { + var tool = this.getTargetTool( e ); + + if ( this.pressed && this.pressed === tool ) { + this.pressed.setActive( true ); + } +}; + +/** + * Handle mouse out events. + * + * @param {jQuery.Event} e Mouse out event + */ +OO.ui.ToolGroup.prototype.onMouseOut = function ( e ) { + var tool = this.getTargetTool( e ); + + if ( this.pressed && this.pressed === tool ) { + this.pressed.setActive( false ); + } +}; + +/** + * Get the closest tool to a jQuery.Event. + * + * Only tool links are considered, which prevents other elements in the tool such as popups from + * triggering tool group interactions. + * + * @private + * @param {jQuery.Event} e + * @return {OO.ui.Tool|null} Tool, `null` if none was found + */ +OO.ui.ToolGroup.prototype.getTargetTool = function ( e ) { + var tool, + $item = this.$( e.target ).closest( '.oo-ui-tool-link' ); + + if ( $item.length ) { + tool = $item.parent().data( 'oo-ui-tool' ); + } + + return tool && !tool.isDisabled() ? tool : null; +}; + +/** + * Handle tool registry register events. + * + * If a tool is registered after the group is created, we must repopulate the list to account for: + * + * - a tool being added that may be included + * - a tool already included being overridden + * + * @param {string} name Symbolic name of tool + */ +OO.ui.ToolGroup.prototype.onToolFactoryRegister = function () { + this.populate(); +}; + +/** + * Get the toolbar this group is in. + * + * @return {OO.ui.Toolbar} Toolbar of group + */ +OO.ui.ToolGroup.prototype.getToolbar = function () { + return this.toolbar; +}; + +/** + * Add and remove tools based on configuration. + */ +OO.ui.ToolGroup.prototype.populate = function () { + var i, len, name, tool, + toolFactory = this.toolbar.getToolFactory(), + names = {}, + add = [], + remove = [], + list = this.toolbar.getToolFactory().getTools( + this.include, this.exclude, this.promote, this.demote + ); + + // Build a list of needed tools + for ( i = 0, len = list.length; i < len; i++ ) { + name = list[i]; + if ( + // Tool exists + toolFactory.lookup( name ) && + // Tool is available or is already in this group + ( this.toolbar.isToolAvailable( name ) || this.tools[name] ) + ) { + tool = this.tools[name]; + if ( !tool ) { + // Auto-initialize tools on first use + this.tools[name] = tool = toolFactory.create( name, this ); + tool.updateTitle(); + } + this.toolbar.reserveTool( tool ); + add.push( tool ); + names[name] = true; + } + } + // Remove tools that are no longer needed + for ( name in this.tools ) { + if ( !names[name] ) { + this.tools[name].destroy(); + this.toolbar.releaseTool( this.tools[name] ); + remove.push( this.tools[name] ); + delete this.tools[name]; + } + } + if ( remove.length ) { + this.removeItems( remove ); + } + // Update emptiness state + if ( add.length ) { + this.$element.removeClass( 'oo-ui-toolGroup-empty' ); + } else { + this.$element.addClass( 'oo-ui-toolGroup-empty' ); + } + // Re-add tools (moving existing ones to new locations) + this.addItems( add ); + // Disabled state may depend on items + this.updateDisabled(); +}; + +/** + * Destroy tool group. + */ +OO.ui.ToolGroup.prototype.destroy = function () { + var name; + + this.clearItems(); + this.toolbar.getToolFactory().disconnect( this ); + for ( name in this.tools ) { + this.toolbar.releaseTool( this.tools[name] ); + this.tools[name].disconnect( this ).destroy(); + delete this.tools[name]; + } + this.$element.remove(); +}; +/** + * Factory for tools. + * + * @class + * @extends OO.Factory + * @constructor + */ +OO.ui.ToolGroupFactory = function OoUiToolGroupFactory() { + // Parent constructor + OO.Factory.call( this ); + + var i, l, + defaultClasses = this.constructor.static.getDefaultClasses(); + + // Register default toolgroups + for ( i = 0, l = defaultClasses.length; i < l; i++ ) { + this.register( defaultClasses[i] ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ToolGroupFactory, OO.Factory ); + +/* Static Methods */ + +/** + * Get a default set of classes to be registered on construction + * @return {Function[]} Default classes + */ +OO.ui.ToolGroupFactory.static.getDefaultClasses = function () { + return [ + OO.ui.BarToolGroup, + OO.ui.ListToolGroup, + OO.ui.MenuToolGroup + ]; +}; +/** + * Layout made of a fieldset and optional legend. + * + * Just add OO.ui.FieldLayout items. + * + * @class + * @extends OO.ui.Layout + * @mixins OO.ui.LabeledElement + * @mixins OO.ui.IconedElement + * @mixins OO.ui.GroupElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {string} [icon] Symbolic icon name + * @cfg {OO.ui.FieldLayout[]} [items] Items to add + */ +OO.ui.FieldsetLayout = function OoUiFieldsetLayout( config ) { + // Config initialization + config = config || {}; + + // Parent constructor + OO.ui.FieldsetLayout.super.call( this, config ); + + // Mixin constructors + OO.ui.IconedElement.call( this, this.$( '<div>' ), config ); + OO.ui.LabeledElement.call( this, this.$( '<legend>' ), config ); + OO.ui.GroupElement.call( this, this.$( '<div>' ), config ); + + // Initialization + this.$element + .addClass( 'oo-ui-fieldsetLayout' ) + .append( this.$icon, this.$label, this.$group ); + if ( $.isArray( config.items ) ) { + this.addItems( config.items ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.FieldsetLayout, OO.ui.Layout ); + +OO.mixinClass( OO.ui.FieldsetLayout, OO.ui.IconedElement ); +OO.mixinClass( OO.ui.FieldsetLayout, OO.ui.LabeledElement ); +OO.mixinClass( OO.ui.FieldsetLayout, OO.ui.GroupElement ); + +/* Static Properties */ + +OO.ui.FieldsetLayout.static.tagName = 'fieldset'; +/** + * Layout made of a field and optional label. + * + * @class + * @extends OO.ui.Layout + * @mixins OO.ui.LabeledElement + * + * Available label alignment modes include: + * - 'left': Label is before the field and aligned away from it, best for when the user will be + * scanning for a specific label in a form with many fields + * - 'right': Label is before the field and aligned toward it, best for forms the user is very + * familiar with and will tab through field checking quickly to verify which field they are in + * - 'top': Label is before the field and above it, best for when the use will need to fill out all + * fields from top to bottom in a form with few fields + * - 'inline': Label is after the field and aligned toward it, best for small boolean fields like + * checkboxes or radio buttons + * + * @constructor + * @param {OO.ui.Widget} field Field widget + * @param {Object} [config] Configuration options + * @cfg {string} [align='left'] Alignment mode, either 'left', 'right', 'top' or 'inline' + */ +OO.ui.FieldLayout = function OoUiFieldLayout( field, config ) { + // Config initialization + config = $.extend( { 'align': 'left' }, config ); + + // Parent constructor + OO.ui.FieldLayout.super.call( this, config ); + + // Mixin constructors + OO.ui.LabeledElement.call( this, this.$( '<label>' ), config ); + + // Properties + this.$field = this.$( '<div>' ); + this.field = field; + this.align = null; + + // Events + if ( this.field instanceof OO.ui.InputWidget ) { + this.$label.on( 'click', OO.ui.bind( this.onLabelClick, this ) ); + } + + // Initialization + this.$element.addClass( 'oo-ui-fieldLayout' ); + this.$field + .addClass( 'oo-ui-fieldLayout-field' ) + .append( this.field.$element ); + this.setAlignment( config.align ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.FieldLayout, OO.ui.Layout ); + +OO.mixinClass( OO.ui.FieldLayout, OO.ui.LabeledElement ); + +/* Methods */ + +/** + * Handles label mouse click events. + * + * @method + * @param {jQuery.Event} e Mouse click event + */ +OO.ui.FieldLayout.prototype.onLabelClick = function () { + this.field.simulateLabelClick(); + return false; +}; + +/** + * Get the field. + * + * @returns {OO.ui.Widget} Field widget + */ +OO.ui.FieldLayout.prototype.getField = function () { + return this.field; +}; + +/** + * Set the field alignment mode. + * + * @param {string} value Alignment mode, either 'left', 'right', 'top' or 'inline' + * @chainable + */ +OO.ui.FieldLayout.prototype.setAlignment = function ( value ) { + if ( value !== this.align ) { + // Default to 'left' + if ( [ 'left', 'right', 'top', 'inline' ].indexOf( value ) === -1 ) { + value = 'left'; + } + // Reorder elements + if ( value === 'inline' ) { + this.$element.append( this.$field, this.$label ); + } else { + this.$element.append( this.$label, this.$field ); + } + // Set classes + if ( this.align ) { + this.$element.removeClass( 'oo-ui-fieldLayout-align-' + this.align ); + } + this.align = value; + this.$element.addClass( 'oo-ui-fieldLayout-align-' + this.align ); + } + + return this; +}; +/** + * Layout made of proportionally sized columns and rows. + * + * @class + * @extends OO.ui.Layout + * + * @constructor + * @param {OO.ui.PanelLayout[]} panels Panels in the grid + * @param {Object} [config] Configuration options + * @cfg {number[]} [widths] Widths of columns as ratios + * @cfg {number[]} [heights] Heights of columns as ratios + */ +OO.ui.GridLayout = function OoUiGridLayout( panels, config ) { + var i, len, widths; + + // Config initialization + config = config || {}; + + // Parent constructor + OO.ui.GridLayout.super.call( this, config ); + + // Properties + this.panels = []; + this.widths = []; + this.heights = []; + + // Initialization + this.$element.addClass( 'oo-ui-gridLayout' ); + for ( i = 0, len = panels.length; i < len; i++ ) { + this.panels.push( panels[i] ); + this.$element.append( panels[i].$element ); + } + if ( config.widths || config.heights ) { + this.layout( config.widths || [1], config.heights || [1] ); + } else { + // Arrange in columns by default + widths = []; + for ( i = 0, len = this.panels.length; i < len; i++ ) { + widths[i] = 1; + } + this.layout( widths, [1] ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.GridLayout, OO.ui.Layout ); + +/* Events */ + +/** + * @event layout + */ + +/** + * @event update + */ + +/* Static Properties */ + +OO.ui.GridLayout.static.tagName = 'div'; + +/* Methods */ + +/** + * Set grid dimensions. + * + * @method + * @param {number[]} widths Widths of columns as ratios + * @param {number[]} heights Heights of rows as ratios + * @fires layout + * @throws {Error} If grid is not large enough to fit all panels + */ +OO.ui.GridLayout.prototype.layout = function ( widths, heights ) { + var x, y, + xd = 0, + yd = 0, + cols = widths.length, + rows = heights.length; + + // Verify grid is big enough to fit panels + if ( cols * rows < this.panels.length ) { + throw new Error( 'Grid is not large enough to fit ' + this.panels.length + 'panels' ); + } + + // Sum up denominators + for ( x = 0; x < cols; x++ ) { + xd += widths[x]; + } + for ( y = 0; y < rows; y++ ) { + yd += heights[y]; + } + // Store factors + this.widths = []; + this.heights = []; + for ( x = 0; x < cols; x++ ) { + this.widths[x] = widths[x] / xd; + } + for ( y = 0; y < rows; y++ ) { + this.heights[y] = heights[y] / yd; + } + // Synchronize view + this.update(); + this.emit( 'layout' ); +}; + +/** + * Update panel positions and sizes. + * + * @method + * @fires update + */ +OO.ui.GridLayout.prototype.update = function () { + var x, y, panel, + i = 0, + left = 0, + top = 0, + dimensions, + width = 0, + height = 0, + cols = this.widths.length, + rows = this.heights.length; + + for ( y = 0; y < rows; y++ ) { + for ( x = 0; x < cols; x++ ) { + panel = this.panels[i]; + width = this.widths[x]; + height = this.heights[y]; + dimensions = { + 'width': Math.round( width * 100 ) + '%', + 'height': Math.round( height * 100 ) + '%', + 'top': Math.round( top * 100 ) + '%' + }; + // If RTL, reverse: + if ( OO.ui.Element.getDir( this.$.context ) === 'rtl' ) { + dimensions.right = Math.round( left * 100 ) + '%'; + } else { + dimensions.left = Math.round( left * 100 ) + '%'; + } + panel.$element.css( dimensions ); + i++; + left += width; + } + top += height; + left = 0; + } + + this.emit( 'update' ); +}; + +/** + * Get a panel at a given position. + * + * The x and y position is affected by the current grid layout. + * + * @method + * @param {number} x Horizontal position + * @param {number} y Vertical position + * @returns {OO.ui.PanelLayout} The panel at the given postion + */ +OO.ui.GridLayout.prototype.getPanel = function ( x, y ) { + return this.panels[( x * this.widths.length ) + y]; +}; +/** + * Layout containing a series of pages. + * + * @class + * @extends OO.ui.Layout + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [continuous=false] Show all pages, one after another + * @cfg {boolean} [autoFocus=false] Focus on the first focusable element when changing to a page + * @cfg {boolean} [outlined=false] Show an outline + * @cfg {boolean} [editable=false] Show controls for adding, removing and reordering pages + * @cfg {Object[]} [adders] List of adders for controls, each with name, icon and title properties + */ +OO.ui.BookletLayout = function OoUiBookletLayout( config ) { + // Initialize configuration + config = config || {}; + + // Parent constructor + OO.ui.BookletLayout.super.call( this, config ); + + // Properties + this.currentPageName = null; + this.pages = {}; + this.ignoreFocus = false; + this.stackLayout = new OO.ui.StackLayout( { '$': this.$, 'continuous': !!config.continuous } ); + this.autoFocus = !!config.autoFocus; + this.outlineVisible = false; + this.outlined = !!config.outlined; + if ( this.outlined ) { + this.editable = !!config.editable; + this.adders = config.adders || null; + this.outlineControlsWidget = null; + this.outlineWidget = new OO.ui.OutlineWidget( { '$': this.$ } ); + this.outlinePanel = new OO.ui.PanelLayout( { '$': this.$, 'scrollable': true } ); + this.gridLayout = new OO.ui.GridLayout( + [this.outlinePanel, this.stackLayout], { '$': this.$, 'widths': [1, 2] } + ); + this.outlineVisible = true; + if ( this.editable ) { + this.outlineControlsWidget = new OO.ui.OutlineControlsWidget( + this.outlineWidget, + { '$': this.$, 'adders': this.adders } + ); + } + } + + // Events + this.stackLayout.connect( this, { 'set': 'onStackLayoutSet' } ); + if ( this.outlined ) { + this.outlineWidget.connect( this, { 'select': 'onOutlineWidgetSelect' } ); + } + if ( this.autoFocus ) { + // Event 'focus' does not bubble, but 'focusin' does + this.stackLayout.onDOMEvent( 'focusin', OO.ui.bind( this.onStackLayoutFocus, this ) ); + } + + // Initialization + this.$element.addClass( 'oo-ui-bookletLayout' ); + this.stackLayout.$element.addClass( 'oo-ui-bookletLayout-stackLayout' ); + if ( this.outlined ) { + this.outlinePanel.$element + .addClass( 'oo-ui-bookletLayout-outlinePanel' ) + .append( this.outlineWidget.$element ); + if ( this.editable ) { + this.outlinePanel.$element + .addClass( 'oo-ui-bookletLayout-outlinePanel-editable' ) + .append( this.outlineControlsWidget.$element ); + } + this.$element.append( this.gridLayout.$element ); + } else { + this.$element.append( this.stackLayout.$element ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.BookletLayout, OO.ui.Layout ); + +/* Events */ + +/** + * @event set + * @param {OO.ui.PageLayout} page Current page + */ + +/** + * @event add + * @param {OO.ui.PageLayout[]} page Added pages + * @param {number} index Index pages were added at + */ + +/** + * @event remove + * @param {OO.ui.PageLayout[]} pages Removed pages + */ + +/* Methods */ + +/** + * Handle stack layout focus. + * + * @method + * @param {jQuery.Event} e Focusin event + */ +OO.ui.BookletLayout.prototype.onStackLayoutFocus = function ( e ) { + var name, $target; + + if ( this.ignoreFocus ) { + // Avoid recursion from programmatic focus trigger in #onStackLayoutSet + return; + } + + $target = $( e.target ).closest( '.oo-ui-pageLayout' ); + for ( name in this.pages ) { + if ( this.pages[ name ].$element[0] === $target[0] ) { + this.setPage( name ); + break; + } + } +}; + +/** + * Handle stack layout set events. + * + * @method + * @param {OO.ui.PanelLayout|null} page The page panel that is now the current panel + */ +OO.ui.BookletLayout.prototype.onStackLayoutSet = function ( page ) { + if ( page ) { + this.stackLayout.$element.find( ':focus' ).blur(); + page.scrollElementIntoView( { 'complete': OO.ui.bind( function () { + this.ignoreFocus = true; + if ( this.autoFocus ) { + page.$element.find( ':input:first' ).focus(); + } + this.ignoreFocus = false; + }, this ) } ); + } +}; + +/** + * Handle outline widget select events. + * + * @method + * @param {OO.ui.OptionWidget|null} item Selected item + */ +OO.ui.BookletLayout.prototype.onOutlineWidgetSelect = function ( item ) { + if ( item ) { + this.setPage( item.getData() ); + } +}; + +/** + * Check if booklet has an outline. + * + * @method + * @returns {boolean} Booklet is outlined + */ +OO.ui.BookletLayout.prototype.isOutlined = function () { + return this.outlined; +}; + +/** + * Check if booklet has editing controls. + * + * @method + * @returns {boolean} Booklet is outlined + */ +OO.ui.BookletLayout.prototype.isEditable = function () { + return this.editable; +}; + +/** + * Check if booklet has editing controls. + * + * @method + * @returns {boolean} Booklet is outlined + */ +OO.ui.BookletLayout.prototype.isOutlineVisible = function () { + return this.outlined && this.outlineVisible; +}; + +/** + * Hide or show the outline. + * + * @param {boolean} [show] Show outline, omit to invert current state + * @chainable + */ +OO.ui.BookletLayout.prototype.toggleOutline = function ( show ) { + if ( this.outlined ) { + show = show === undefined ? !this.outlineVisible : !!show; + this.outlineVisible = show; + this.gridLayout.layout( show ? [ 1, 2 ] : [ 0, 1 ], [ 1 ] ); + } + + return this; +}; + +/** + * Get the outline widget. + * + * @method + * @param {OO.ui.PageLayout} page Page to be selected + * @returns {OO.ui.PageLayout|null} Closest page to another + */ +OO.ui.BookletLayout.prototype.getClosestPage = function ( page ) { + var next, prev, level, + pages = this.stackLayout.getItems(), + index = $.inArray( page, pages ); + + if ( index !== -1 ) { + next = pages[index + 1]; + prev = pages[index - 1]; + // Prefer adjacent pages at the same level + if ( this.outlined ) { + level = this.outlineWidget.getItemFromData( page.getName() ).getLevel(); + if ( + prev && + level === this.outlineWidget.getItemFromData( prev.getName() ).getLevel() + ) { + return prev; + } + if ( + next && + level === this.outlineWidget.getItemFromData( next.getName() ).getLevel() + ) { + return next; + } + } + } + return prev || next || null; +}; + +/** + * Get the outline widget. + * + * @method + * @returns {OO.ui.OutlineWidget|null} Outline widget, or null if boolet has no outline + */ +OO.ui.BookletLayout.prototype.getOutline = function () { + return this.outlineWidget; +}; + +/** + * Get the outline controls widget. If the outline is not editable, null is returned. + * + * @method + * @returns {OO.ui.OutlineControlsWidget|null} The outline controls widget. + */ +OO.ui.BookletLayout.prototype.getOutlineControls = function () { + return this.outlineControlsWidget; +}; + +/** + * Get a page by name. + * + * @method + * @param {string} name Symbolic name of page + * @returns {OO.ui.PageLayout|undefined} Page, if found + */ +OO.ui.BookletLayout.prototype.getPage = function ( name ) { + return this.pages[name]; +}; + +/** + * Get the current page name. + * + * @method + * @returns {string|null} Current page name + */ +OO.ui.BookletLayout.prototype.getPageName = function () { + return this.currentPageName; +}; + +/** + * Add a page to the layout. + * + * When pages are added with the same names as existing pages, the existing pages will be + * automatically removed before the new pages are added. + * + * @method + * @param {OO.ui.PageLayout[]} pages Pages to add + * @param {number} index Index to insert pages after + * @fires add + * @chainable + */ +OO.ui.BookletLayout.prototype.addPages = function ( pages, index ) { + var i, len, name, page, item, currentIndex, + stackLayoutPages = this.stackLayout.getItems(), + remove = [], + items = []; + + // Remove pages with same names + for ( i = 0, len = pages.length; i < len; i++ ) { + page = pages[i]; + name = page.getName(); + + if ( Object.prototype.hasOwnProperty.call( this.pages, name ) ) { + // Correct the insertion index + currentIndex = $.inArray( this.pages[name], stackLayoutPages ); + if ( currentIndex !== -1 && currentIndex + 1 < index ) { + index--; + } + remove.push( this.pages[name] ); + } + } + if ( remove.length ) { + this.removePages( remove ); + } + + // Add new pages + for ( i = 0, len = pages.length; i < len; i++ ) { + page = pages[i]; + name = page.getName(); + this.pages[page.getName()] = page; + if ( this.outlined ) { + item = new OO.ui.OutlineItemWidget( name, page, { '$': this.$ } ); + page.setOutlineItem( item ); + items.push( item ); + } + } + + if ( this.outlined && items.length ) { + this.outlineWidget.addItems( items, index ); + this.updateOutlineWidget(); + } + this.stackLayout.addItems( pages, index ); + this.emit( 'add', pages, index ); + + return this; +}; + +/** + * Remove a page from the layout. + * + * @method + * @fires remove + * @chainable + */ +OO.ui.BookletLayout.prototype.removePages = function ( pages ) { + var i, len, name, page, + items = []; + + for ( i = 0, len = pages.length; i < len; i++ ) { + page = pages[i]; + name = page.getName(); + delete this.pages[name]; + if ( this.outlined ) { + items.push( this.outlineWidget.getItemFromData( name ) ); + page.setOutlineItem( null ); + } + } + if ( this.outlined && items.length ) { + this.outlineWidget.removeItems( items ); + this.updateOutlineWidget(); + } + this.stackLayout.removeItems( pages ); + this.emit( 'remove', pages ); + + return this; +}; + +/** + * Clear all pages from the layout. + * + * @method + * @fires remove + * @chainable + */ +OO.ui.BookletLayout.prototype.clearPages = function () { + var i, len, + pages = this.stackLayout.getItems(); + + this.pages = {}; + this.currentPageName = null; + if ( this.outlined ) { + this.outlineWidget.clearItems(); + for ( i = 0, len = pages.length; i < len; i++ ) { + pages[i].setOutlineItem( null ); + } + } + this.stackLayout.clearItems(); + + this.emit( 'remove', pages ); + + return this; +}; + +/** + * Set the current page by name. + * + * @method + * @fires set + * @param {string} name Symbolic name of page + */ +OO.ui.BookletLayout.prototype.setPage = function ( name ) { + var selectedItem, + page = this.pages[name]; + + if ( name !== this.currentPageName ) { + if ( this.outlined ) { + selectedItem = this.outlineWidget.getSelectedItem(); + if ( selectedItem && selectedItem.getData() !== name ) { + this.outlineWidget.selectItem( this.outlineWidget.getItemFromData( name ) ); + } + } + if ( page ) { + if ( this.currentPageName && this.pages[this.currentPageName] ) { + this.pages[this.currentPageName].setActive( false ); + } + this.currentPageName = name; + this.stackLayout.setItem( page ); + page.setActive( true ); + this.emit( 'set', page ); + } + } +}; + +/** + * Call this after adding or removing items from the OutlineWidget. + * + * @method + * @chainable + */ +OO.ui.BookletLayout.prototype.updateOutlineWidget = function () { + // Auto-select first item when nothing is selected anymore + if ( !this.outlineWidget.getSelectedItem() ) { + this.outlineWidget.selectItem( this.outlineWidget.getFirstSelectableItem() ); + } + + return this; +}; +/** + * Layout that expands to cover the entire area of its parent, with optional scrolling and padding. + * + * @class + * @extends OO.ui.Layout + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [scrollable] Allow vertical scrolling + * @cfg {boolean} [padded] Pad the content from the edges + */ +OO.ui.PanelLayout = function OoUiPanelLayout( config ) { + // Config initialization + config = config || {}; + + // Parent constructor + OO.ui.PanelLayout.super.call( this, config ); + + // Initialization + this.$element.addClass( 'oo-ui-panelLayout' ); + if ( config.scrollable ) { + this.$element.addClass( 'oo-ui-panelLayout-scrollable' ); + } + + if ( config.padded ) { + this.$element.addClass( 'oo-ui-panelLayout-padded' ); + } + + // Add directionality class: + this.$element.addClass( 'oo-ui-' + OO.ui.Element.getDir( this.$.context ) ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.PanelLayout, OO.ui.Layout ); +/** + * Page within an OO.ui.BookletLayout. + * + * @class + * @extends OO.ui.PanelLayout + * + * @constructor + * @param {string} name Unique symbolic name of page + * @param {Object} [config] Configuration options + * @param {string} [outlineItem] Outline item widget + */ +OO.ui.PageLayout = function OoUiPageLayout( name, config ) { + // Configuration initialization + config = $.extend( { 'scrollable': true }, config ); + + // Parent constructor + OO.ui.PageLayout.super.call( this, config ); + + // Properties + this.name = name; + this.outlineItem = config.outlineItem || null; + this.active = false; + + // Initialization + this.$element.addClass( 'oo-ui-pageLayout' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.PageLayout, OO.ui.PanelLayout ); + +/* Events */ + +/** + * @event active + * @param {boolean} active Page is active + */ + +/* Methods */ + +/** + * Get page name. + * + * @returns {string} Symbolic name of page + */ +OO.ui.PageLayout.prototype.getName = function () { + return this.name; +}; + +/** + * Check if page is active. + * + * @returns {boolean} Page is active + */ +OO.ui.PageLayout.prototype.isActive = function () { + return this.active; +}; + +/** + * Get outline item. + * + * @returns {OO.ui.OutlineItemWidget|null} Outline item widget + */ +OO.ui.PageLayout.prototype.getOutlineItem = function () { + return this.outlineItem; +}; + +/** + * Get outline item. + * + * @param {OO.ui.OutlineItemWidget|null} outlineItem Outline item widget, null to clear + * @chainable + */ +OO.ui.PageLayout.prototype.setOutlineItem = function ( outlineItem ) { + this.outlineItem = outlineItem; + return this; +}; + +/** + * Set page active state. + * + * @param {boolean} Page is active + * @fires active + */ +OO.ui.PageLayout.prototype.setActive = function ( active ) { + active = !!active; + + if ( active !== this.active ) { + this.active = active; + this.$element.toggleClass( 'oo-ui-pageLayout-active', active ); + this.emit( 'active', this.active ); + } +}; +/** + * Layout containing a series of mutually exclusive pages. + * + * @class + * @extends OO.ui.PanelLayout + * @mixins OO.ui.GroupElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [continuous=false] Show all pages, one after another + * @cfg {string} [icon=''] Symbolic icon name + * @cfg {OO.ui.Layout[]} [items] Layouts to add + */ +OO.ui.StackLayout = function OoUiStackLayout( config ) { + // Config initialization + config = $.extend( { 'scrollable': true }, config ); + + // Parent constructor + OO.ui.StackLayout.super.call( this, config ); + + // Mixin constructors + OO.ui.GroupElement.call( this, this.$element, config ); + + // Properties + this.currentItem = null; + this.continuous = !!config.continuous; + + // Initialization + this.$element.addClass( 'oo-ui-stackLayout' ); + if ( this.continuous ) { + this.$element.addClass( 'oo-ui-stackLayout-continuous' ); + } + if ( $.isArray( config.items ) ) { + this.addItems( config.items ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.StackLayout, OO.ui.PanelLayout ); + +OO.mixinClass( OO.ui.StackLayout, OO.ui.GroupElement ); + +/* Events */ + +/** + * @event set + * @param {OO.ui.PanelLayout|null} [item] Current item + */ + +/* Methods */ + +/** + * Add items. + * + * Adding an existing item (by value) will move it. + * + * @method + * @param {OO.ui.PanelLayout[]} items Items to add + * @param {number} [index] Index to insert items after + * @chainable + */ +OO.ui.StackLayout.prototype.addItems = function ( items, index ) { + OO.ui.GroupElement.prototype.addItems.call( this, items, index ); + + if ( !this.currentItem && items.length ) { + this.setItem( items[0] ); + } + + return this; +}; + +/** + * Remove items. + * + * Items will be detached, not removed, so they can be used later. + * + * @method + * @param {OO.ui.PanelLayout[]} items Items to remove + * @chainable + */ +OO.ui.StackLayout.prototype.removeItems = function ( items ) { + OO.ui.GroupElement.prototype.removeItems.call( this, items ); + if ( $.inArray( this.currentItem, items ) !== -1 ) { + this.currentItem = null; + if ( !this.currentItem && this.items.length ) { + this.setItem( this.items[0] ); + } + } + + return this; +}; + +/** + * Clear all items. + * + * Items will be detached, not removed, so they can be used later. + * + * @method + * @chainable + */ +OO.ui.StackLayout.prototype.clearItems = function () { + this.currentItem = null; + OO.ui.GroupElement.prototype.clearItems.call( this ); + + return this; +}; + +/** + * Show item. + * + * Any currently shown item will be hidden. + * + * @method + * @param {OO.ui.PanelLayout} item Item to show + * @chainable + */ +OO.ui.StackLayout.prototype.setItem = function ( item ) { + if ( item !== this.currentItem ) { + if ( !this.continuous ) { + this.$items.css( 'display', '' ); + } + if ( $.inArray( item, this.items ) !== -1 ) { + if ( !this.continuous ) { + item.$element.css( 'display', 'block' ); + } + } else { + item = null; + } + this.currentItem = item; + this.emit( 'set', item ); + } + + return this; +}; +/** + * Horizontal bar layout of tools as icon buttons. + * + * @class + * @abstract + * @extends OO.ui.ToolGroup + * + * @constructor + * @param {OO.ui.Toolbar} toolbar + * @param {Object} [config] Configuration options + */ +OO.ui.BarToolGroup = function OoUiBarToolGroup( toolbar, config ) { + // Parent constructor + OO.ui.BarToolGroup.super.call( this, toolbar, config ); + + // Initialization + this.$element.addClass( 'oo-ui-barToolGroup' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.BarToolGroup, OO.ui.ToolGroup ); + +/* Static Properties */ + +OO.ui.BarToolGroup.static.titleTooltips = true; + +OO.ui.BarToolGroup.static.accelTooltips = true; + +OO.ui.BarToolGroup.static.name = 'bar'; +/** + * Popup list of tools with an icon and optional label. + * + * @class + * @abstract + * @extends OO.ui.ToolGroup + * @mixins OO.ui.IconedElement + * @mixins OO.ui.IndicatedElement + * @mixins OO.ui.LabeledElement + * @mixins OO.ui.TitledElement + * @mixins OO.ui.ClippableElement + * + * @constructor + * @param {OO.ui.Toolbar} toolbar + * @param {Object} [config] Configuration options + */ +OO.ui.PopupToolGroup = function OoUiPopupToolGroup( toolbar, config ) { + // Configuration initialization + config = config || {}; + + // Parent constructor + OO.ui.PopupToolGroup.super.call( this, toolbar, config ); + + // Mixin constructors + OO.ui.IconedElement.call( this, this.$( '<span>' ), config ); + OO.ui.IndicatedElement.call( this, this.$( '<span>' ), config ); + OO.ui.LabeledElement.call( this, this.$( '<span>' ), config ); + OO.ui.TitledElement.call( this, this.$element, config ); + OO.ui.ClippableElement.call( this, this.$group, config ); + + // Properties + this.active = false; + this.dragging = false; + this.onBlurHandler = OO.ui.bind( this.onBlur, this ); + this.$handle = this.$( '<span>' ); + + // Events + this.$handle.on( { + 'mousedown': OO.ui.bind( this.onHandleMouseDown, this ), + 'mouseup': OO.ui.bind( this.onHandleMouseUp, this ) + } ); + + // Initialization + this.$handle + .addClass( 'oo-ui-popupToolGroup-handle' ) + .append( this.$icon, this.$label, this.$indicator ); + this.$element + .addClass( 'oo-ui-popupToolGroup' ) + .prepend( this.$handle ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.PopupToolGroup, OO.ui.ToolGroup ); + +OO.mixinClass( OO.ui.PopupToolGroup, OO.ui.IconedElement ); +OO.mixinClass( OO.ui.PopupToolGroup, OO.ui.IndicatedElement ); +OO.mixinClass( OO.ui.PopupToolGroup, OO.ui.LabeledElement ); +OO.mixinClass( OO.ui.PopupToolGroup, OO.ui.TitledElement ); +OO.mixinClass( OO.ui.PopupToolGroup, OO.ui.ClippableElement ); + +/* Static Properties */ + +/* Methods */ + +/** + * @inheritdoc + */ +OO.ui.PopupToolGroup.prototype.setDisabled = function () { + // Parent method + OO.ui.PopupToolGroup.super.prototype.setDisabled.apply( this, arguments ); + + if ( this.isDisabled() && this.isElementAttached() ) { + this.setActive( false ); + } +}; + +/** + * Handle focus being lost. + * + * The event is actually generated from a mouseup, so it is not a normal blur event object. + * + * @method + * @param {jQuery.Event} e Mouse up event + */ +OO.ui.PopupToolGroup.prototype.onBlur = function ( e ) { + // Only deactivate when clicking outside the dropdown element + if ( this.$( e.target ).closest( '.oo-ui-popupToolGroup' )[0] !== this.$element[0] ) { + this.setActive( false ); + } +}; + +/** + * @inheritdoc + */ +OO.ui.PopupToolGroup.prototype.onMouseUp = function ( e ) { + if ( !this.disabled && e.which === 1 ) { + this.setActive( false ); + } + return OO.ui.ToolGroup.prototype.onMouseUp.call( this, e ); +}; + +/** + * Handle mouse up events. + * + * @method + * @param {jQuery.Event} e Mouse up event + */ +OO.ui.PopupToolGroup.prototype.onHandleMouseUp = function () { + return false; +}; + +/** + * Handle mouse down events. + * + * @method + * @param {jQuery.Event} e Mouse down event + */ +OO.ui.PopupToolGroup.prototype.onHandleMouseDown = function ( e ) { + if ( !this.disabled && e.which === 1 ) { + this.setActive( !this.active ); + } + return false; +}; + +/** + * Switch into active mode. + * + * When active, mouseup events anywhere in the document will trigger deactivation. + * + * @method + */ +OO.ui.PopupToolGroup.prototype.setActive = function ( value ) { + value = !!value; + if ( this.active !== value ) { + this.active = value; + if ( value ) { + this.setClipping( true ); + this.$element.addClass( 'oo-ui-popupToolGroup-active' ); + this.getElementDocument().addEventListener( 'mouseup', this.onBlurHandler, true ); + } else { + this.setClipping( false ); + this.$element.removeClass( 'oo-ui-popupToolGroup-active' ); + this.getElementDocument().removeEventListener( 'mouseup', this.onBlurHandler, true ); + } + } +}; +/** + * Drop down list layout of tools as labeled icon buttons. + * + * @class + * @abstract + * @extends OO.ui.PopupToolGroup + * + * @constructor + * @param {OO.ui.Toolbar} toolbar + * @param {Object} [config] Configuration options + */ +OO.ui.ListToolGroup = function OoUiListToolGroup( toolbar, config ) { + // Parent constructor + OO.ui.ListToolGroup.super.call( this, toolbar, config ); + + // Initialization + this.$element.addClass( 'oo-ui-listToolGroup' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ListToolGroup, OO.ui.PopupToolGroup ); + +/* Static Properties */ + +OO.ui.ListToolGroup.static.accelTooltips = true; + +OO.ui.ListToolGroup.static.name = 'list'; +/** + * Drop down menu layout of tools as selectable menu items. + * + * @class + * @abstract + * @extends OO.ui.PopupToolGroup + * + * @constructor + * @param {OO.ui.Toolbar} toolbar + * @param {Object} [config] Configuration options + */ +OO.ui.MenuToolGroup = function OoUiMenuToolGroup( toolbar, config ) { + // Configuration initialization + config = config || {}; + + // Parent constructor + OO.ui.MenuToolGroup.super.call( this, toolbar, config ); + + // Events + this.toolbar.connect( this, { 'updateState': 'onUpdateState' } ); + + // Initialization + this.$element.addClass( 'oo-ui-menuToolGroup' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.MenuToolGroup, OO.ui.PopupToolGroup ); + +/* Static Properties */ + +OO.ui.MenuToolGroup.static.accelTooltips = true; + +OO.ui.MenuToolGroup.static.name = 'menu'; + +/* Methods */ + +/** + * Handle the toolbar state being updated. + * + * When the state changes, the title of each active item in the menu will be joined together and + * used as a label for the group. The label will be empty if none of the items are active. + * + * @method + */ +OO.ui.MenuToolGroup.prototype.onUpdateState = function () { + var name, + labelTexts = []; + + for ( name in this.tools ) { + if ( this.tools[name].isActive() ) { + labelTexts.push( this.tools[name].getTitle() ); + } + } + + this.setLabel( labelTexts.join( ', ' ) || ' ' ); +}; +/** + * UserInterface popup tool. + * + * @abstract + * @class + * @extends OO.ui.Tool + * @mixins OO.ui.PopuppableElement + * + * @constructor + * @param {OO.ui.Toolbar} toolbar + * @param {Object} [config] Configuration options + */ +OO.ui.PopupTool = function OoUiPopupTool( toolbar, config ) { + // Parent constructor + OO.ui.PopupTool.super.call( this, toolbar, config ); + + // Mixin constructors + OO.ui.PopuppableElement.call( this, config ); + + // Initialization + this.$element + .addClass( 'oo-ui-popupTool' ) + .append( this.popup.$element ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.PopupTool, OO.ui.Tool ); + +OO.mixinClass( OO.ui.PopupTool, OO.ui.PopuppableElement ); + +/* Methods */ + +/** + * Handle the tool being selected. + * + * @inheritdoc + */ +OO.ui.PopupTool.prototype.onSelect = function () { + if ( !this.disabled ) { + if ( this.popup.isVisible() ) { + this.hidePopup(); + } else { + this.showPopup(); + } + } + this.setActive( false ); + return false; +}; + +/** + * Handle the toolbar state being updated. + * + * @inheritdoc + */ +OO.ui.PopupTool.prototype.onUpdateState = function () { + this.setActive( false ); +}; +/** + * Group widget. + * + * Mixin for OO.ui.Widget subclasses. + * + * Use together with OO.ui.ItemWidget to make disabled state inheritable. + * + * @class + * @abstract + * @extends OO.ui.GroupElement + * + * @constructor + * @param {jQuery} $group Container node, assigned to #$group + * @param {Object} [config] Configuration options + */ +OO.ui.GroupWidget = function OoUiGroupWidget( $element, config ) { + // Parent constructor + OO.ui.GroupWidget.super.call( this, $element, config ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.GroupWidget, OO.ui.GroupElement ); + +/* Methods */ + +/** + * Set the disabled state of the widget. + * + * This will also update the disabled state of child widgets. + * + * @method + * @param {boolean} disabled Disable widget + * @chainable + */ +OO.ui.GroupWidget.prototype.setDisabled = function ( disabled ) { + var i, len; + + // Parent method + // Note this is calling OO.ui.Widget; we're assuming the class this is mixed into + // is a subclass of OO.ui.Widget. + OO.ui.Widget.prototype.setDisabled.call( this, disabled ); + + // During construction, #setDisabled is called before the OO.ui.GroupElement constructor + if ( this.items ) { + for ( i = 0, len = this.items.length; i < len; i++ ) { + this.items[i].updateDisabled(); + } + } + + return this; +}; +/** + * Item widget. + * + * Use together with OO.ui.GroupWidget to make disabled state inheritable. + * + * @class + * @abstract + * + * @constructor + */ +OO.ui.ItemWidget = function OoUiItemWidget() { + // +}; + +/* Methods */ + +/** + * Check if widget is disabled. + * + * Checks parent if present, making disabled state inheritable. + * + * @returns {boolean} Widget is disabled + */ +OO.ui.ItemWidget.prototype.isDisabled = function () { + return this.disabled || + ( this.elementGroup instanceof OO.ui.Widget && this.elementGroup.isDisabled() ); +}; + +/** + * Set group element is in. + * + * @param {OO.ui.GroupElement|null} group Group element, null if none + * @chainable + */ +OO.ui.ItemWidget.prototype.setElementGroup = function ( group ) { + // Parent method + OO.ui.Element.prototype.setElementGroup.call( this, group ); + + // Initialize item disabled states + this.updateDisabled(); + + return this; +}; +/** + * Creates an OO.ui.IconWidget object. + * + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.IconedElement + * @mixins OO.ui.TitledElement + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.IconWidget = function OoUiIconWidget( config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.IconWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.IconedElement.call( this, this.$element, config ); + OO.ui.TitledElement.call( this, this.$element, config ); + + // Initialization + this.$element.addClass( 'oo-ui-iconWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.IconWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.IconWidget, OO.ui.IconedElement ); +OO.mixinClass( OO.ui.IconWidget, OO.ui.TitledElement ); + +/* Static Properties */ + +OO.ui.IconWidget.static.tagName = 'span'; +/** + * Creates an OO.ui.IndicatorWidget object. + * + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.IndicatedElement + * @mixins OO.ui.TitledElement + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.IndicatorWidget = function OoUiIndicatorWidget( config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.IndicatorWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.IndicatedElement.call( this, this.$element, config ); + OO.ui.TitledElement.call( this, this.$element, config ); + + // Initialization + this.$element.addClass( 'oo-ui-indicatorWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.IndicatorWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.IndicatorWidget, OO.ui.IndicatedElement ); +OO.mixinClass( OO.ui.IndicatorWidget, OO.ui.TitledElement ); + +/* Static Properties */ + +OO.ui.IndicatorWidget.static.tagName = 'span'; +/** + * Container for multiple related buttons. + * + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.GroupElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {OO.ui.ButtonWidget} [items] Buttons to add + */ +OO.ui.ButtonGroupWidget = function OoUiButtonGroupWidget( config ) { + // Parent constructor + OO.ui.ButtonGroupWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.GroupElement.call( this, this.$element, config ); + + // Initialization + this.$element.addClass( 'oo-ui-buttonGroupWidget' ); + if ( $.isArray( config.items ) ) { + this.addItems( config.items ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ButtonGroupWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.ButtonGroupWidget, OO.ui.GroupElement ); +/** + * Creates an OO.ui.ButtonWidget object. + * + * @class + * @abstract + * @extends OO.ui.Widget + * @mixins OO.ui.ButtonedElement + * @mixins OO.ui.IconedElement + * @mixins OO.ui.IndicatedElement + * @mixins OO.ui.LabeledElement + * @mixins OO.ui.TitledElement + * @mixins OO.ui.FlaggableElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {string} [title=''] Title text + * @cfg {string} [href] Hyperlink to visit when clicked + * @cfg {string} [target] Target to open hyperlink in + */ +OO.ui.ButtonWidget = function OoUiButtonWidget( config ) { + // Configuration initialization + config = $.extend( { 'target': '_blank' }, config ); + + // Parent constructor + OO.ui.ButtonWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.ButtonedElement.call( this, this.$( '<a>' ), config ); + OO.ui.IconedElement.call( this, this.$( '<span>' ), config ); + OO.ui.IndicatedElement.call( this, this.$( '<span>' ), config ); + OO.ui.LabeledElement.call( this, this.$( '<span>' ), config ); + OO.ui.TitledElement.call( this, this.$button, config ); + OO.ui.FlaggableElement.call( this, config ); + + // Properties + this.isHyperlink = typeof config.href === 'string'; + + // Events + this.$button.on( { + 'click': OO.ui.bind( this.onClick, this ), + 'keypress': OO.ui.bind( this.onKeyPress, this ) + } ); + + // Initialization + this.$button + .append( this.$icon, this.$label, this.$indicator ) + .attr( { 'href': config.href, 'target': config.target } ); + this.$element + .addClass( 'oo-ui-buttonWidget' ) + .append( this.$button ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ButtonWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.ButtonWidget, OO.ui.ButtonedElement ); +OO.mixinClass( OO.ui.ButtonWidget, OO.ui.IconedElement ); +OO.mixinClass( OO.ui.ButtonWidget, OO.ui.IndicatedElement ); +OO.mixinClass( OO.ui.ButtonWidget, OO.ui.LabeledElement ); +OO.mixinClass( OO.ui.ButtonWidget, OO.ui.TitledElement ); +OO.mixinClass( OO.ui.ButtonWidget, OO.ui.FlaggableElement ); + +/* Events */ + +/** + * @event click + */ + +/* Methods */ + +/** + * Handles mouse click events. + * + * @method + * @param {jQuery.Event} e Mouse click event + * @fires click + */ +OO.ui.ButtonWidget.prototype.onClick = function () { + if ( !this.disabled ) { + this.emit( 'click' ); + if ( this.isHyperlink ) { + return true; + } + } + return false; +}; + +/** + * Handles keypress events. + * + * @method + * @param {jQuery.Event} e Keypress event + * @fires click + */ +OO.ui.ButtonWidget.prototype.onKeyPress = function ( e ) { + if ( !this.disabled && e.which === OO.ui.Keys.SPACE ) { + if ( this.isHyperlink ) { + this.onClick(); + return true; + } + } + return false; +}; +/** + * Creates an OO.ui.InputWidget object. + * + * @class + * @abstract + * @extends OO.ui.Widget + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {string} [name=''] HTML input name + * @cfg {string} [value=''] Input value + * @cfg {boolean} [readOnly=false] Prevent changes + * @cfg {Function} [inputFilter] Filter function to apply to the input. Takes a string argument and returns a string. + */ +OO.ui.InputWidget = function OoUiInputWidget( config ) { + // Config intialization + config = $.extend( { 'readOnly': false }, config ); + + // Parent constructor + OO.ui.InputWidget.super.call( this, config ); + + // Properties + this.$input = this.getInputElement( config ); + this.value = ''; + this.readOnly = false; + this.inputFilter = config.inputFilter; + + // Events + this.$input.on( 'keydown mouseup cut paste change input select', OO.ui.bind( this.onEdit, this ) ); + + // Initialization + this.$input + .attr( 'name', config.name ) + .prop( 'disabled', this.disabled ); + this.setReadOnly( config.readOnly ); + this.$element.addClass( 'oo-ui-inputWidget' ).append( this.$input ); + this.setValue( config.value ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.InputWidget, OO.ui.Widget ); + +/* Events */ + +/** + * @event change + * @param value + */ + +/* Methods */ + +/** + * Get input element. + * + * @method + * @param {Object} [config] Configuration options + * @returns {jQuery} Input element + */ +OO.ui.InputWidget.prototype.getInputElement = function () { + return this.$( '<input>' ); +}; + +/** + * Handle potentially value-changing events. + * + * @method + * @param {jQuery.Event} e Key down, mouse up, cut, paste, change, input, or select event + */ +OO.ui.InputWidget.prototype.onEdit = function () { + if ( !this.disabled ) { + // Allow the stack to clear so the value will be updated + setTimeout( OO.ui.bind( function () { + this.setValue( this.$input.val() ); + }, this ) ); + } +}; + +/** + * Get the value of the input. + * + * @method + * @returns {string} Input value + */ +OO.ui.InputWidget.prototype.getValue = function () { + return this.value; +}; + +/** + * Sets the direction of the current input, either RTL or LTR + * + * @method + * @param {boolean} isRTL + */ +OO.ui.InputWidget.prototype.setRTL = function ( isRTL ) { + if ( isRTL ) { + this.$input.removeClass( 'oo-ui-ltr' ); + this.$input.addClass( 'oo-ui-rtl' ); + } else { + this.$input.removeClass( 'oo-ui-rtl' ); + this.$input.addClass( 'oo-ui-ltr' ); + } +}; + +/** + * Set the value of the input. + * + * @method + * @param {string} value New value + * @fires change + * @chainable + */ +OO.ui.InputWidget.prototype.setValue = function ( value ) { + value = this.sanitizeValue( value ); + if ( this.value !== value ) { + this.value = value; + this.emit( 'change', this.value ); + } + // Update the DOM if it has changed. Note that with sanitizeValue, it + // is possible for the DOM value to change without this.value changing. + if ( this.$input.val() !== this.value ) { + this.$input.val( this.value ); + } + return this; +}; + +/** + * Sanitize incoming value. + * + * Ensures value is a string, and converts undefined and null to empty strings. + * + * @method + * @param {string} value Original value + * @returns {string} Sanitized value + */ +OO.ui.InputWidget.prototype.sanitizeValue = function ( value ) { + if ( value === undefined || value === null ) { + return ''; + } else if ( this.inputFilter ) { + return this.inputFilter( String( value ) ); + } else { + return String( value ); + } +}; + +/** + * Simulate the behavior of clicking on a label bound to this input. + * + * @method + */ +OO.ui.InputWidget.prototype.simulateLabelClick = function () { + if ( !this.isDisabled() ) { + if ( this.$input.is( ':checkbox,:radio' ) ) { + this.$input.click(); + } else if ( this.$input.is( ':input' ) ) { + this.$input.focus(); + } + } +}; + +/** + * Check if the widget is read-only. + * + * @method + * @param {boolean} Input is read-only + */ +OO.ui.InputWidget.prototype.isReadOnly = function () { + return this.readOnly; +}; + +/** + * Set the read-only state of the widget. + * + * This should probably change the widgets's appearance and prevent it from being used. + * + * @method + * @param {boolean} state Make input read-only + * @chainable + */ +OO.ui.InputWidget.prototype.setReadOnly = function ( state ) { + this.readOnly = !!state; + this.$input.prop( 'readonly', this.readOnly ); + return this; +}; + +/** + * @inheritdoc + */ +OO.ui.InputWidget.prototype.setDisabled = function ( state ) { + OO.ui.Widget.prototype.setDisabled.call( this, state ); + if ( this.$input ) { + this.$input.prop( 'disabled', this.disabled ); + } + return this; +}; +/** + * Creates an OO.ui.CheckboxInputWidget object. + * + * @class + * @extends OO.ui.InputWidget + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.CheckboxInputWidget = function OoUiCheckboxInputWidget( config ) { + // Parent constructor + OO.ui.CheckboxInputWidget.super.call( this, config ); + + // Initialization + this.$element.addClass( 'oo-ui-checkboxInputWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.CheckboxInputWidget, OO.ui.InputWidget ); + +/* Events */ + +/* Methods */ + +/** + * Get input element. + * + * @returns {jQuery} Input element + */ +OO.ui.CheckboxInputWidget.prototype.getInputElement = function () { + return this.$( '<input type="checkbox" />' ); +}; + +/** + * Get checked state of the checkbox + * + * @returns {boolean} If the checkbox is checked + */ +OO.ui.CheckboxInputWidget.prototype.getValue = function () { + return this.value; +}; + +/** + * Set value + */ +OO.ui.CheckboxInputWidget.prototype.setValue = function ( value ) { + value = !!value; + if ( this.value !== value ) { + this.value = value; + this.$input.prop( 'checked', this.value ); + this.emit( 'change', this.value ); + } +}; + +/** + * @inheritdoc + */ +OO.ui.CheckboxInputWidget.prototype.onEdit = function () { + if ( !this.disabled ) { + // Allow the stack to clear so the value will be updated + setTimeout( OO.ui.bind( function () { + this.setValue( this.$input.prop( 'checked' ) ); + }, this ) ); + } +}; +/** + * Creates an OO.ui.LabelWidget object. + * + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.LabeledElement + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.LabelWidget = function OoUiLabelWidget( config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.LabelWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.LabeledElement.call( this, this.$element, config ); + + // Properties + this.input = config.input; + + // Events + if ( this.input instanceof OO.ui.InputWidget ) { + this.$element.on( 'click', OO.ui.bind( this.onClick, this ) ); + } + + // Initialization + this.$element.addClass( 'oo-ui-labelWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.LabelWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.LabelWidget, OO.ui.LabeledElement ); + +/* Static Properties */ + +OO.ui.LabelWidget.static.tagName = 'label'; + +/* Methods */ + +/** + * Handles label mouse click events. + * + * @method + * @param {jQuery.Event} e Mouse click event + */ +OO.ui.LabelWidget.prototype.onClick = function () { + this.input.simulateLabelClick(); + return false; +}; +/** + * Lookup input widget. + * + * Mixin that adds a menu showing suggested values to a text input. Subclasses must handle `select` + * events on #lookupMenu to make use of selections. + * + * @class + * @abstract + * + * @constructor + * @param {OO.ui.TextInputWidget} input Input widget + * @param {Object} [config] Configuration options + * @cfg {jQuery} [$overlay=this.$( 'body' )] Overlay layer + */ +OO.ui.LookupInputWidget = function OoUiLookupInputWidget( input, config ) { + // Config intialization + config = config || {}; + + // Properties + this.lookupInput = input; + this.$overlay = config.$overlay || this.$( 'body,.oo-ui-window-overlay' ).last(); + this.lookupMenu = new OO.ui.TextInputMenuWidget( this, { + '$': OO.ui.Element.getJQuery( this.$overlay ), + 'input': this.lookupInput, + '$container': config.$container + } ); + this.lookupCache = {}; + this.lookupQuery = null; + this.lookupRequest = null; + this.populating = false; + + // Events + this.$overlay.append( this.lookupMenu.$element ); + + this.lookupInput.$input.on( { + 'focus': OO.ui.bind( this.onLookupInputFocus, this ), + 'blur': OO.ui.bind( this.onLookupInputBlur, this ), + 'mousedown': OO.ui.bind( this.onLookupInputMouseDown, this ) + } ); + this.lookupInput.connect( this, { 'change': 'onLookupInputChange' } ); + + // Initialization + this.$element.addClass( 'oo-ui-lookupWidget' ); + this.lookupMenu.$element.addClass( 'oo-ui-lookupWidget-menu' ); +}; + +/* Methods */ + +/** + * Handle input focus event. + * + * @method + * @param {jQuery.Event} e Input focus event + */ +OO.ui.LookupInputWidget.prototype.onLookupInputFocus = function () { + this.openLookupMenu(); +}; + +/** + * Handle input blur event. + * + * @method + * @param {jQuery.Event} e Input blur event + */ +OO.ui.LookupInputWidget.prototype.onLookupInputBlur = function () { + this.lookupMenu.hide(); +}; + +/** + * Handle input mouse down event. + * + * @method + * @param {jQuery.Event} e Input mouse down event + */ +OO.ui.LookupInputWidget.prototype.onLookupInputMouseDown = function () { + this.openLookupMenu(); +}; + +/** + * Handle input change event. + * + * @method + * @param {string} value New input value + */ +OO.ui.LookupInputWidget.prototype.onLookupInputChange = function () { + this.openLookupMenu(); +}; + +/** + * Open the menu. + * + * @method + * @chainable + */ +OO.ui.LookupInputWidget.prototype.openLookupMenu = function () { + var value = this.lookupInput.getValue(); + + if ( this.lookupMenu.$input.is( ':focus' ) && $.trim( value ) !== '' ) { + this.populateLookupMenu(); + if ( !this.lookupMenu.isVisible() ) { + this.lookupMenu.show(); + } + } else { + this.lookupMenu.clearItems(); + this.lookupMenu.hide(); + } + + return this; +}; + +/** + * Populate lookup menu with current information. + * + * @method + * @chainable + */ +OO.ui.LookupInputWidget.prototype.populateLookupMenu = function () { + if ( !this.populating ) { + this.populating = true; + this.getLookupMenuItems() + .done( OO.ui.bind( function ( items ) { + this.lookupMenu.clearItems(); + if ( items.length ) { + this.lookupMenu.show(); + this.lookupMenu.addItems( items ); + this.initializeLookupMenuSelection(); + this.openLookupMenu(); + } else { + this.lookupMenu.hide(); + } + this.populating = false; + }, this ) ) + .fail( OO.ui.bind( function () { + this.lookupMenu.clearItems(); + this.populating = false; + }, this ) ); + } + + return this; +}; + +/** + * Set selection in the lookup menu with current information. + * + * @method + * @chainable + */ +OO.ui.LookupInputWidget.prototype.initializeLookupMenuSelection = function () { + if ( !this.lookupMenu.getSelectedItem() ) { + this.lookupMenu.intializeSelection( this.lookupMenu.getFirstSelectableItem() ); + } + this.lookupMenu.highlightItem( this.lookupMenu.getSelectedItem() ); +}; + +/** + * Get lookup menu items for the current query. + * + * @method + * @returns {jQuery.Promise} Promise object which will be passed menu items as the first argument + * of the done event + */ +OO.ui.LookupInputWidget.prototype.getLookupMenuItems = function () { + var value = this.lookupInput.getValue(), + deferred = $.Deferred(); + + if ( value && value !== this.lookupQuery ) { + // Abort current request if query has changed + if ( this.lookupRequest ) { + this.lookupRequest.abort(); + this.lookupQuery = null; + this.lookupRequest = null; + } + if ( value in this.lookupCache ) { + deferred.resolve( this.getLookupMenuItemsFromData( this.lookupCache[value] ) ); + } else { + this.lookupQuery = value; + this.lookupRequest = this.getLookupRequest() + .always( OO.ui.bind( function () { + this.lookupQuery = null; + this.lookupRequest = null; + }, this ) ) + .done( OO.ui.bind( function ( data ) { + this.lookupCache[value] = this.getLookupCacheItemFromData( data ); + deferred.resolve( this.getLookupMenuItemsFromData( this.lookupCache[value] ) ); + }, this ) ) + .fail( function () { + deferred.reject(); + } ); + this.pushPending(); + this.lookupRequest.always( OO.ui.bind( function () { + this.popPending(); + }, this ) ); + } + } + return deferred.promise(); +}; + +/** + * Get a new request object of the current lookup query value. + * + * @method + * @abstract + * @returns {jqXHR} jQuery AJAX object, or promise object with an .abort() method + */ +OO.ui.LookupInputWidget.prototype.getLookupRequest = function () { + // Stub, implemented in subclass + return null; +}; + +/** + * Handle successful lookup request. + * + * Overriding methods should call #populateLookupMenu when results are available and cache results + * for future lookups in #lookupCache as an array of #OO.ui.MenuItemWidget objects. + * + * @method + * @abstract + * @param {Mixed} data Response from server + */ +OO.ui.LookupInputWidget.prototype.onLookupRequestDone = function () { + // Stub, implemented in subclass +}; + +/** + * Get a list of menu item widgets from the data stored by the lookup request's done handler. + * + * @method + * @abstract + * @param {Mixed} data Cached result data, usually an array + * @returns {OO.ui.MenuItemWidget[]} Menu items + */ +OO.ui.LookupInputWidget.prototype.getLookupMenuItemsFromData = function () { + // Stub, implemented in subclass + return []; +}; +/** + * Creates an OO.ui.OptionWidget object. + * + * @class + * @abstract + * @extends OO.ui.Widget + * @mixins OO.ui.IconedElement + * @mixins OO.ui.LabeledElement + * @mixins OO.ui.IndicatedElement + * @mixins OO.ui.FlaggableElement + * + * @constructor + * @param {Mixed} data Option data + * @param {Object} [config] Configuration options + * @cfg {string} [rel] Value for `rel` attribute in DOM, allowing per-option styling + */ +OO.ui.OptionWidget = function OoUiOptionWidget( data, config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.OptionWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.ItemWidget.call( this ); + OO.ui.IconedElement.call( this, this.$( '<span>' ), config ); + OO.ui.LabeledElement.call( this, this.$( '<span>' ), config ); + OO.ui.IndicatedElement.call( this, this.$( '<span>' ), config ); + OO.ui.FlaggableElement.call( this, config ); + + // Properties + this.data = data; + this.selected = false; + this.highlighted = false; + this.pressed = false; + + // Initialization + this.$element + .data( 'oo-ui-optionWidget', this ) + .attr( 'rel', config.rel ) + .addClass( 'oo-ui-optionWidget' ) + .append( this.$label ); + this.$element + .prepend( this.$icon ) + .append( this.$indicator ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.OptionWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.OptionWidget, OO.ui.ItemWidget ); +OO.mixinClass( OO.ui.OptionWidget, OO.ui.IconedElement ); +OO.mixinClass( OO.ui.OptionWidget, OO.ui.LabeledElement ); +OO.mixinClass( OO.ui.OptionWidget, OO.ui.IndicatedElement ); +OO.mixinClass( OO.ui.OptionWidget, OO.ui.FlaggableElement ); + +/* Static Properties */ + +OO.ui.OptionWidget.static.tagName = 'li'; + +OO.ui.OptionWidget.static.selectable = true; + +OO.ui.OptionWidget.static.highlightable = true; + +OO.ui.OptionWidget.static.pressable = true; + +OO.ui.OptionWidget.static.scrollIntoViewOnSelect = false; + +/* Methods */ + +/** + * Check if option can be selected. + * + * @method + * @returns {boolean} Item is selectable + */ +OO.ui.OptionWidget.prototype.isSelectable = function () { + return this.constructor.static.selectable && !this.disabled; +}; + +/** + * Check if option can be highlighted. + * + * @method + * @returns {boolean} Item is highlightable + */ +OO.ui.OptionWidget.prototype.isHighlightable = function () { + return this.constructor.static.highlightable && !this.disabled; +}; + +/** + * Check if option can be pressed. + * + * @method + * @returns {boolean} Item is pressable + */ +OO.ui.OptionWidget.prototype.isPressable = function () { + return this.constructor.static.pressable && !this.disabled; +}; + +/** + * Check if option is selected. + * + * @method + * @returns {boolean} Item is selected + */ +OO.ui.OptionWidget.prototype.isSelected = function () { + return this.selected; +}; + +/** + * Check if option is highlighted. + * + * @method + * @returns {boolean} Item is highlighted + */ +OO.ui.OptionWidget.prototype.isHighlighted = function () { + return this.highlighted; +}; + +/** + * Check if option is pressed. + * + * @method + * @returns {boolean} Item is pressed + */ +OO.ui.OptionWidget.prototype.isPressed = function () { + return this.pressed; +}; + +/** + * Set selected state. + * + * @method + * @param {boolean} [state=false] Select option + * @chainable + */ +OO.ui.OptionWidget.prototype.setSelected = function ( state ) { + if ( !this.disabled && this.constructor.static.selectable ) { + this.selected = !!state; + if ( this.selected ) { + this.$element.addClass( 'oo-ui-optionWidget-selected' ); + if ( this.constructor.static.scrollIntoViewOnSelect ) { + this.scrollElementIntoView(); + } + } else { + this.$element.removeClass( 'oo-ui-optionWidget-selected' ); + } + } + return this; +}; + +/** + * Set highlighted state. + * + * @method + * @param {boolean} [state=false] Highlight option + * @chainable + */ +OO.ui.OptionWidget.prototype.setHighlighted = function ( state ) { + if ( !this.disabled && this.constructor.static.highlightable ) { + this.highlighted = !!state; + if ( this.highlighted ) { + this.$element.addClass( 'oo-ui-optionWidget-highlighted' ); + } else { + this.$element.removeClass( 'oo-ui-optionWidget-highlighted' ); + } + } + return this; +}; + +/** + * Set pressed state. + * + * @method + * @param {boolean} [state=false] Press option + * @chainable + */ +OO.ui.OptionWidget.prototype.setPressed = function ( state ) { + if ( !this.disabled && this.constructor.static.pressable ) { + this.pressed = !!state; + if ( this.pressed ) { + this.$element.addClass( 'oo-ui-optionWidget-pressed' ); + } else { + this.$element.removeClass( 'oo-ui-optionWidget-pressed' ); + } + } + return this; +}; + +/** + * Make the option's highlight flash. + * + * While flashing, the visual style of the pressed state is removed if present. + * + * @method + * @param {Function} [done] Callback to execute when flash effect is complete. + */ +OO.ui.OptionWidget.prototype.flash = function ( done ) { + var $this = this.$element; + + if ( !this.disabled && this.constructor.static.pressable ) { + $this.removeClass( 'oo-ui-optionWidget-highlighted oo-ui-optionWidget-pressed' ); + setTimeout( OO.ui.bind( function () { + $this.addClass( 'oo-ui-optionWidget-highlighted' ); + if ( done ) { + // Restore original classes + $this + .toggleClass( 'oo-ui-optionWidget-highlighted', this.highlighted ) + .toggleClass( 'oo-ui-optionWidget-pressed', this.pressed ); + setTimeout( done, 100 ); + } + }, this ), 100 ); + } +}; + +/** + * Get option data. + * + * @method + * @returns {Mixed} Option data + */ +OO.ui.OptionWidget.prototype.getData = function () { + return this.data; +}; +/** + * Create an OO.ui.SelectWidget object. + * + * @class + * @abstract + * @extends OO.ui.Widget + * @mixins OO.ui.GroupElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {OO.ui.OptionWidget[]} [items] Options to add + */ +OO.ui.SelectWidget = function OoUiSelectWidget( config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.SelectWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.GroupWidget.call( this, this.$element, config ); + + // Properties + this.pressed = false; + this.selecting = null; + this.hashes = {}; + + // Events + this.$element.on( { + 'mousedown': OO.ui.bind( this.onMouseDown, this ), + 'mouseup': OO.ui.bind( this.onMouseUp, this ), + 'mousemove': OO.ui.bind( this.onMouseMove, this ), + 'mouseover': OO.ui.bind( this.onMouseOver, this ), + 'mouseleave': OO.ui.bind( this.onMouseLeave, this ) + } ); + + // Initialization + this.$element.addClass( 'oo-ui-selectWidget oo-ui-selectWidget-depressed' ); + if ( $.isArray( config.items ) ) { + this.addItems( config.items ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.SelectWidget, OO.ui.Widget ); + +// Need to mixin base class as well +OO.mixinClass( OO.ui.SelectWidget, OO.ui.GroupElement ); + +OO.mixinClass( OO.ui.SelectWidget, OO.ui.GroupWidget ); + +/* Events */ + +/** + * @event highlight + * @param {OO.ui.OptionWidget|null} item Highlighted item + */ + +/** + * @event press + * @param {OO.ui.OptionWidget|null} item Pressed item + */ + +/** + * @event select + * @param {OO.ui.OptionWidget|null} item Selected item + */ + +/** + * @event add + * @param {OO.ui.OptionWidget[]} items Added items + * @param {number} index Index items were added at + */ + +/** + * @event remove + * @param {OO.ui.OptionWidget[]} items Removed items + */ + +/* Static Properties */ + +OO.ui.SelectWidget.static.tagName = 'ul'; + +/* Methods */ + +/** + * Handle mouse down events. + * + * @method + * @private + * @param {jQuery.Event} e Mouse down event + */ +OO.ui.SelectWidget.prototype.onMouseDown = function ( e ) { + var item; + + if ( !this.disabled && e.which === 1 ) { + this.togglePressed( true ); + item = this.getTargetItem( e ); + if ( item && item.isSelectable() ) { + this.pressItem( item ); + this.selecting = item; + this.$( this.$.context ).one( 'mouseup', OO.ui.bind( this.onMouseUp, this ) ); + } + } + return false; +}; + +/** + * Handle mouse up events. + * + * @method + * @private + * @param {jQuery.Event} e Mouse up event + */ +OO.ui.SelectWidget.prototype.onMouseUp = function ( e ) { + var item; + + this.togglePressed( false ); + if ( !this.selecting ) { + item = this.getTargetItem( e ); + if ( item && item.isSelectable() ) { + this.selecting = item; + } + } + if ( !this.disabled && e.which === 1 && this.selecting ) { + this.pressItem( null ); + this.selectItem( this.selecting ); + this.selecting = null; + } + + return false; +}; + +/** + * Handle mouse move events. + * + * @method + * @private + * @param {jQuery.Event} e Mouse move event + */ +OO.ui.SelectWidget.prototype.onMouseMove = function ( e ) { + var item; + + if ( !this.disabled && this.pressed ) { + item = this.getTargetItem( e ); + if ( item && item !== this.selecting && item.isSelectable() ) { + this.pressItem( item ); + this.selecting = item; + } + } + return false; +}; + +/** + * Handle mouse over events. + * + * @method + * @private + * @param {jQuery.Event} e Mouse over event + */ +OO.ui.SelectWidget.prototype.onMouseOver = function ( e ) { + var item; + + if ( !this.disabled ) { + item = this.getTargetItem( e ); + if ( item && item.isHighlightable() ) { + this.highlightItem( item ); + } + } + return false; +}; + +/** + * Handle mouse leave events. + * + * @method + * @private + * @param {jQuery.Event} e Mouse over event + */ +OO.ui.SelectWidget.prototype.onMouseLeave = function () { + if ( !this.disabled ) { + this.highlightItem( null ); + } + return false; +}; + +/** + * Get the closest item to a jQuery.Event. + * + * @method + * @private + * @param {jQuery.Event} e + * @returns {OO.ui.OptionWidget|null} Outline item widget, `null` if none was found + */ +OO.ui.SelectWidget.prototype.getTargetItem = function ( e ) { + var $item = this.$( e.target ).closest( '.oo-ui-optionWidget' ); + if ( $item.length ) { + return $item.data( 'oo-ui-optionWidget' ); + } + return null; +}; + +/** + * Get selected item. + * + * @method + * @returns {OO.ui.OptionWidget|null} Selected item, `null` if no item is selected + */ +OO.ui.SelectWidget.prototype.getSelectedItem = function () { + var i, len; + + for ( i = 0, len = this.items.length; i < len; i++ ) { + if ( this.items[i].isSelected() ) { + return this.items[i]; + } + } + return null; +}; + +/** + * Get highlighted item. + * + * @method + * @returns {OO.ui.OptionWidget|null} Highlighted item, `null` if no item is highlighted + */ +OO.ui.SelectWidget.prototype.getHighlightedItem = function () { + var i, len; + + for ( i = 0, len = this.items.length; i < len; i++ ) { + if ( this.items[i].isHighlighted() ) { + return this.items[i]; + } + } + return null; +}; + +/** + * Get an existing item with equivilant data. + * + * @method + * @param {Object} data Item data to search for + * @returns {OO.ui.OptionWidget|null} Item with equivilent value, `null` if none exists + */ +OO.ui.SelectWidget.prototype.getItemFromData = function ( data ) { + var hash = OO.getHash( data ); + + if ( hash in this.hashes ) { + return this.hashes[hash]; + } + + return null; +}; + +/** + * Toggle pressed state. + * + * @param {boolean} pressed An option is being pressed + */ +OO.ui.SelectWidget.prototype.togglePressed = function ( pressed ) { + if ( pressed === undefined ) { + pressed = !this.pressed; + } + if ( pressed !== this.pressed ) { + this.$element.toggleClass( 'oo-ui-selectWidget-pressed', pressed ); + this.$element.toggleClass( 'oo-ui-selectWidget-depressed', !pressed ); + this.pressed = pressed; + } +}; + +/** + * Highlight an item. + * + * Highlighting is mutually exclusive. + * + * @method + * @param {OO.ui.OptionWidget} [item] Item to highlight, omit to deselect all + * @fires highlight + * @chainable + */ +OO.ui.SelectWidget.prototype.highlightItem = function ( item ) { + var i, len, highlighted, + changed = false; + + for ( i = 0, len = this.items.length; i < len; i++ ) { + highlighted = this.items[i] === item; + if ( this.items[i].isHighlighted() !== highlighted ) { + this.items[i].setHighlighted( highlighted ); + changed = true; + } + } + if ( changed ) { + this.emit( 'highlight', item ); + } + + return this; +}; + +/** + * Select an item. + * + * @method + * @param {OO.ui.OptionWidget} [item] Item to select, omit to deselect all + * @fires select + * @chainable + */ +OO.ui.SelectWidget.prototype.selectItem = function ( item ) { + var i, len, selected, + changed = false; + + for ( i = 0, len = this.items.length; i < len; i++ ) { + selected = this.items[i] === item; + if ( this.items[i].isSelected() !== selected ) { + this.items[i].setSelected( selected ); + changed = true; + } + } + if ( changed ) { + this.emit( 'select', item ); + } + + return this; +}; + +/** + * Press an item. + * + * @method + * @param {OO.ui.OptionWidget} [item] Item to press, omit to depress all + * @fires press + * @chainable + */ +OO.ui.SelectWidget.prototype.pressItem = function ( item ) { + var i, len, pressed, + changed = false; + + for ( i = 0, len = this.items.length; i < len; i++ ) { + pressed = this.items[i] === item; + if ( this.items[i].isPressed() !== pressed ) { + this.items[i].setPressed( pressed ); + changed = true; + } + } + if ( changed ) { + this.emit( 'press', item ); + } + + return this; +}; + +/** + * Setup selection and highlighting. + * + * This should be used to synchronize the UI with the model without emitting events that would in + * turn update the model. + * + * @param {OO.ui.OptionWidget} [item] Item to select + * @chainable + */ +OO.ui.SelectWidget.prototype.intializeSelection = function ( item ) { + var i, len, selected; + + for ( i = 0, len = this.items.length; i < len; i++ ) { + selected = this.items[i] === item; + this.items[i].setSelected( selected ); + this.items[i].setHighlighted( selected ); + } + + return this; +}; + +/** + * Get an item relative to another one. + * + * @method + * @param {OO.ui.OptionWidget} item Item to start at + * @param {number} direction Direction to move in + * @returns {OO.ui.OptionWidget|null} Item at position, `null` if there are no items in the menu + */ +OO.ui.SelectWidget.prototype.getRelativeSelectableItem = function ( item, direction ) { + var inc = direction > 0 ? 1 : -1, + len = this.items.length, + index = item instanceof OO.ui.OptionWidget ? + $.inArray( item, this.items ) : ( inc > 0 ? -1 : 0 ), + stopAt = Math.max( Math.min( index, len - 1 ), 0 ), + i = inc > 0 ? + // Default to 0 instead of -1, if nothing is selected let's start at the beginning + Math.max( index, -1 ) : + // Default to n-1 instead of -1, if nothing is selected let's start at the end + Math.min( index, len ); + + while ( true ) { + i = ( i + inc + len ) % len; + item = this.items[i]; + if ( item instanceof OO.ui.OptionWidget && item.isSelectable() ) { + return item; + } + // Stop iterating when we've looped all the way around + if ( i === stopAt ) { + break; + } + } + return null; +}; + +/** + * Get the next selectable item. + * + * @method + * @returns {OO.ui.OptionWidget|null} Item, `null` if ther aren't any selectable items + */ +OO.ui.SelectWidget.prototype.getFirstSelectableItem = function () { + var i, len, item; + + for ( i = 0, len = this.items.length; i < len; i++ ) { + item = this.items[i]; + if ( item instanceof OO.ui.OptionWidget && item.isSelectable() ) { + return item; + } + } + + return null; +}; + +/** + * Add items. + * + * When items are added with the same values as existing items, the existing items will be + * automatically removed before the new items are added. + * + * @method + * @param {OO.ui.OptionWidget[]} items Items to add + * @param {number} [index] Index to insert items after + * @fires add + * @chainable + */ +OO.ui.SelectWidget.prototype.addItems = function ( items, index ) { + var i, len, item, hash, + remove = []; + + for ( i = 0, len = items.length; i < len; i++ ) { + item = items[i]; + hash = OO.getHash( item.getData() ); + if ( hash in this.hashes ) { + // Remove item with same value + remove.push( this.hashes[hash] ); + } + this.hashes[hash] = item; + } + if ( remove.length ) { + this.removeItems( remove ); + } + + OO.ui.GroupElement.prototype.addItems.call( this, items, index ); + + // Always provide an index, even if it was omitted + this.emit( 'add', items, index === undefined ? this.items.length - items.length - 1 : index ); + + return this; +}; + +/** + * Remove items. + * + * Items will be detached, not removed, so they can be used later. + * + * @method + * @param {OO.ui.OptionWidget[]} items Items to remove + * @fires remove + * @chainable + */ +OO.ui.SelectWidget.prototype.removeItems = function ( items ) { + var i, len, item, hash; + + for ( i = 0, len = items.length; i < len; i++ ) { + item = items[i]; + hash = OO.getHash( item.getData() ); + if ( hash in this.hashes ) { + // Remove existing item + delete this.hashes[hash]; + } + if ( item.isSelected() ) { + this.selectItem( null ); + } + } + OO.ui.GroupElement.prototype.removeItems.call( this, items ); + + this.emit( 'remove', items ); + + return this; +}; + +/** + * Clear all items. + * + * Items will be detached, not removed, so they can be used later. + * + * @method + * @fires remove + * @chainable + */ +OO.ui.SelectWidget.prototype.clearItems = function () { + var items = this.items.slice(); + + // Clear all items + this.hashes = {}; + OO.ui.GroupElement.prototype.clearItems.call( this ); + this.selectItem( null ); + + this.emit( 'remove', items ); + + return this; +}; +/** + * Creates an OO.ui.MenuItemWidget object. + * + * @class + * @extends OO.ui.OptionWidget + * + * @constructor + * @param {Mixed} data Item data + * @param {Object} [config] Configuration options + */ +OO.ui.MenuItemWidget = function OoUiMenuItemWidget( data, config ) { + // Configuration initialization + config = $.extend( { 'icon': 'check' }, config ); + + // Parent constructor + OO.ui.MenuItemWidget.super.call( this, data, config ); + + // Initialization + this.$element.addClass( 'oo-ui-menuItemWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.MenuItemWidget, OO.ui.OptionWidget ); +/** + * Create an OO.ui.MenuWidget object. + * + * @class + * @extends OO.ui.SelectWidget + * @mixins OO.ui.ClippableElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {OO.ui.InputWidget} [input] Input to bind keyboard handlers to + */ +OO.ui.MenuWidget = function OoUiMenuWidget( config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.MenuWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.ClippableElement.call( this, this.$group, config ); + + // Properties + this.newItems = null; + this.$input = config.input ? config.input.$input : null; + this.$previousFocus = null; + this.isolated = !config.input; + this.visible = false; + this.onKeyDownHandler = OO.ui.bind( this.onKeyDown, this ); + + // Initialization + this.$element.hide().addClass( 'oo-ui-menuWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.MenuWidget, OO.ui.SelectWidget ); + +OO.mixinClass( OO.ui.MenuWidget, OO.ui.ClippableElement ); + +/* Methods */ + +/** + * Handles key down events. + * + * @method + * @param {jQuery.Event} e Key down event + */ +OO.ui.MenuWidget.prototype.onKeyDown = function ( e ) { + var nextItem, + handled = false, + highlightItem = this.getHighlightedItem(); + + if ( !this.disabled && this.visible ) { + if ( !highlightItem ) { + highlightItem = this.getSelectedItem(); + } + switch ( e.keyCode ) { + case OO.ui.Keys.ENTER: + this.selectItem( highlightItem ); + handled = true; + break; + case OO.ui.Keys.UP: + nextItem = this.getRelativeSelectableItem( highlightItem, -1 ); + handled = true; + break; + case OO.ui.Keys.DOWN: + nextItem = this.getRelativeSelectableItem( highlightItem, 1 ); + handled = true; + break; + case OO.ui.Keys.ESCAPE: + if ( highlightItem ) { + highlightItem.setHighlighted( false ); + } + this.hide(); + handled = true; + break; + } + + if ( nextItem ) { + this.highlightItem( nextItem ); + nextItem.scrollElementIntoView(); + } + + if ( handled ) { + e.preventDefault(); + e.stopPropagation(); + return false; + } + } +}; + +/** + * Check if the menu is visible. + * + * @method + * @returns {boolean} Menu is visible + */ +OO.ui.MenuWidget.prototype.isVisible = function () { + return this.visible; +}; + +/** + * Bind key down listener + * + * @method + */ +OO.ui.MenuWidget.prototype.bindKeyDownListener = function () { + if ( this.$input ) { + this.$input.on( 'keydown', this.onKeyDownHandler ); + } else { + // Capture menu navigation keys + this.getElementWindow().addEventListener( 'keydown', this.onKeyDownHandler, true ); + } +}; + +/** + * Unbind key down listener + * + * @method + */ +OO.ui.MenuWidget.prototype.unbindKeyDownListener = function () { + if ( this.$input ) { + this.$input.off( 'keydown' ); + } else { + this.getElementWindow().removeEventListener( 'keydown', this.onKeyDownHandler, true ); + } +}; + +/** + * Select an item. + * + * The menu will stay open if an item is silently selected. + * + * @method + * @param {OO.ui.OptionWidget} [item] Item to select, omit to deselect all + * @chainable + */ +OO.ui.MenuWidget.prototype.selectItem = function ( item ) { + // Parent method + OO.ui.SelectWidget.prototype.selectItem.call( this, item ); + + if ( !this.disabled ) { + if ( item ) { + this.disabled = true; + item.flash( OO.ui.bind( function () { + this.hide(); + this.disabled = false; + }, this ) ); + } else { + this.hide(); + } + } + + return this; +}; + +/** + * Add items. + * + * Adding an existing item (by value) will move it. + * + * @method + * @param {OO.ui.MenuItemWidget[]} items Items to add + * @param {number} [index] Index to insert items after + * @chainable + */ +OO.ui.MenuWidget.prototype.addItems = function ( items, index ) { + var i, len, item; + + // Parent method + OO.ui.SelectWidget.prototype.addItems.call( this, items, index ); + + // Auto-initialize + if ( !this.newItems ) { + this.newItems = []; + } + + for ( i = 0, len = items.length; i < len; i++ ) { + item = items[i]; + if ( this.visible ) { + // Defer fitting label until + item.fitLabel(); + } else { + this.newItems.push( item ); + } + } + + return this; +}; + +/** + * Show the menu. + * + * @method + * @chainable + */ +OO.ui.MenuWidget.prototype.show = function () { + var i, len; + + if ( this.items.length ) { + this.$element.show(); + this.visible = true; + this.bindKeyDownListener(); + + // Change focus to enable keyboard navigation + if ( this.isolated && this.$input && !this.$input.is( ':focus' ) ) { + this.$previousFocus = this.$( ':focus' ); + this.$input.focus(); + } + if ( this.newItems && this.newItems.length ) { + for ( i = 0, len = this.newItems.length; i < len; i++ ) { + this.newItems[i].fitLabel(); + } + this.newItems = null; + } + + this.setClipping( true ); + } + + return this; +}; + +/** + * Hide the menu. + * + * @method + * @chainable + */ +OO.ui.MenuWidget.prototype.hide = function () { + this.$element.hide(); + this.visible = false; + this.unbindKeyDownListener(); + + if ( this.isolated && this.$previousFocus ) { + this.$previousFocus.focus(); + this.$previousFocus = null; + } + + this.setClipping( false ); + + return this; +}; +/** + * Inline menu of options. + * + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.IconedElement + * @mixins OO.ui.IndicatedElement + * @mixins OO.ui.LabeledElement + * @mixins OO.ui.TitledElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {Object} [menu] Configuration options to pass to menu widget + */ +OO.ui.InlineMenuWidget = function OoUiInlineMenuWidget( config ) { + // Configuration initialization + config = $.extend( { 'indicator': 'down' }, config ); + + // Parent constructor + OO.ui.InlineMenuWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.IconedElement.call( this, this.$( '<span>' ), config ); + OO.ui.IndicatedElement.call( this, this.$( '<span>' ), config ); + OO.ui.LabeledElement.call( this, this.$( '<span>' ), config ); + OO.ui.TitledElement.call( this, this.$label, config ); + + // Properties + this.menu = new OO.ui.MenuWidget( $.extend( { '$': this.$ }, config.menu ) ); + this.$handle = this.$( '<span>' ); + + // Events + this.$element.on( { 'click': OO.ui.bind( this.onClick, this ) } ); + this.menu.connect( this, { 'select': 'onMenuSelect' } ); + + // Initialization + this.$handle + .addClass( 'oo-ui-inlineMenuWidget-handle' ) + .append( this.$icon, this.$label, this.$indicator ); + this.$element + .addClass( 'oo-ui-inlineMenuWidget' ) + .append( this.$handle, this.menu.$element ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.InlineMenuWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.InlineMenuWidget, OO.ui.IconedElement ); +OO.mixinClass( OO.ui.InlineMenuWidget, OO.ui.IndicatedElement ); +OO.mixinClass( OO.ui.InlineMenuWidget, OO.ui.LabeledElement ); +OO.mixinClass( OO.ui.InlineMenuWidget, OO.ui.TitledElement ); + +/* Methods */ + +/** + * Get the menu. + * + * @return {OO.ui.MenuWidget} Menu of widget + */ +OO.ui.InlineMenuWidget.prototype.getMenu = function () { + return this.menu; +}; + +/** + * Handles menu select events. + * + * @method + * @param {OO.ui.MenuItemWidget} item Selected menu item + */ +OO.ui.InlineMenuWidget.prototype.onMenuSelect = function ( item ) { + var selectedLabel = item.getLabel(); + + // If the label is a DOM element, clone it, because setLabel will append() it + if ( selectedLabel instanceof jQuery ) { + selectedLabel = selectedLabel.clone(); + } + + this.setLabel( selectedLabel ); +}; + +/** + * Handles mouse click events. + * + * @method + * @param {jQuery.Event} e Mouse click event + */ +OO.ui.InlineMenuWidget.prototype.onClick = function ( e ) { + // Skip clicks within the menu + if ( $.contains( this.menu.$element[0], e.target ) ) { + return; + } + + if ( !this.disabled ) { + if ( this.menu.isVisible() ) { + this.menu.hide(); + } else { + this.menu.show(); + } + } + return false; +}; +/** + * Creates an OO.ui.MenuSectionItemWidget object. + * + * @class + * @extends OO.ui.OptionWidget + * + * @constructor + * @param {Mixed} data Item data + * @param {Object} [config] Configuration options + */ +OO.ui.MenuSectionItemWidget = function OoUiMenuSectionItemWidget( data, config ) { + // Parent constructor + OO.ui.MenuSectionItemWidget.super.call( this, data, config ); + + // Initialization + this.$element.addClass( 'oo-ui-menuSectionItemWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.MenuSectionItemWidget, OO.ui.OptionWidget ); + +OO.ui.MenuSectionItemWidget.static.selectable = false; + +OO.ui.MenuSectionItemWidget.static.highlightable = false; +/** + * Create an OO.ui.OutlineWidget object. + * + * @class + * @extends OO.ui.SelectWidget + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.OutlineWidget = function OoUiOutlineWidget( config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.OutlineWidget.super.call( this, config ); + + // Initialization + this.$element.addClass( 'oo-ui-outlineWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.OutlineWidget, OO.ui.SelectWidget ); +/** + * Creates an OO.ui.OutlineControlsWidget object. + * + * @class + * + * @constructor + * @param {OO.ui.OutlineWidget} outline Outline to control + * @param {Object} [config] Configuration options + */ +OO.ui.OutlineControlsWidget = function OoUiOutlineControlsWidget( outline, config ) { + // Configuration initialization + config = $.extend( { 'icon': 'add-item' }, config ); + + // Parent constructor + OO.ui.OutlineControlsWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.GroupElement.call( this, this.$( '<div>' ), config ); + OO.ui.IconedElement.call( this, this.$( '<div>' ), config ); + + // Properties + this.outline = outline; + this.$movers = this.$( '<div>' ); + this.upButton = new OO.ui.ButtonWidget( { + '$': this.$, + 'frameless': true, + 'icon': 'collapse', + 'title': OO.ui.msg( 'ooui-outline-control-move-up' ) + } ); + this.downButton = new OO.ui.ButtonWidget( { + '$': this.$, + 'frameless': true, + 'icon': 'expand', + 'title': OO.ui.msg( 'ooui-outline-control-move-down' ) + } ); + this.removeButton = new OO.ui.ButtonWidget( { + '$': this.$, + 'frameless': true, + 'icon': 'remove', + 'title': OO.ui.msg( 'ooui-outline-control-remove' ) + } ); + + // Events + outline.connect( this, { + 'select': 'onOutlineChange', + 'add': 'onOutlineChange', + 'remove': 'onOutlineChange' + } ); + this.upButton.connect( this, { 'click': ['emit', 'move', -1] } ); + this.downButton.connect( this, { 'click': ['emit', 'move', 1] } ); + this.removeButton.connect( this, { 'click': ['emit', 'remove'] } ); + + // Initialization + this.$element.addClass( 'oo-ui-outlineControlsWidget' ); + this.$group.addClass( 'oo-ui-outlineControlsWidget-adders' ); + this.$movers + .addClass( 'oo-ui-outlineControlsWidget-movers' ) + .append( this.removeButton.$element, this.upButton.$element, this.downButton.$element ); + this.$element.append( this.$icon, this.$group, this.$movers ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.OutlineControlsWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.OutlineControlsWidget, OO.ui.GroupElement ); +OO.mixinClass( OO.ui.OutlineControlsWidget, OO.ui.IconedElement ); + +/* Events */ + +/** + * @event move + * @param {number} places Number of places to move + */ + +/** + * @event remove + */ + +/* Methods */ + +/** + * Handle outline change events. + * + * @method + */ +OO.ui.OutlineControlsWidget.prototype.onOutlineChange = function () { + var i, len, firstMovable, lastMovable, + items = this.outline.getItems(), + selectedItem = this.outline.getSelectedItem(), + movable = selectedItem && selectedItem.isMovable(), + removable = selectedItem && selectedItem.isRemovable(); + + if ( movable ) { + i = -1; + len = items.length; + while ( ++i < len ) { + if ( items[i].isMovable() ) { + firstMovable = items[i]; + break; + } + } + i = len; + while ( i-- ) { + if ( items[i].isMovable() ) { + lastMovable = items[i]; + break; + } + } + } + this.upButton.setDisabled( !movable || selectedItem === firstMovable ); + this.downButton.setDisabled( !movable || selectedItem === lastMovable ); + this.removeButton.setDisabled( !removable ); +}; +/** + * Creates an OO.ui.OutlineItemWidget object. + * + * @class + * @extends OO.ui.OptionWidget + * + * @constructor + * @param {Mixed} data Item data + * @param {Object} [config] Configuration options + * @cfg {number} [level] Indentation level + * @cfg {boolean} [movable] Allow modification from outline controls + */ +OO.ui.OutlineItemWidget = function OoUiOutlineItemWidget( data, config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.OutlineItemWidget.super.call( this, data, config ); + + // Properties + this.level = 0; + this.movable = !!config.movable; + this.removable = !!config.removable; + + // Initialization + this.$element.addClass( 'oo-ui-outlineItemWidget' ); + this.setLevel( config.level ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.OutlineItemWidget, OO.ui.OptionWidget ); + +/* Static Properties */ + +OO.ui.OutlineItemWidget.static.highlightable = false; + +OO.ui.OutlineItemWidget.static.scrollIntoViewOnSelect = true; + +OO.ui.OutlineItemWidget.static.levelClass = 'oo-ui-outlineItemWidget-level-'; + +OO.ui.OutlineItemWidget.static.levels = 3; + +/* Methods */ + +/** + * Check if item is movable. + * + * Movablilty is used by outline controls. + * + * @returns {boolean} Item is movable + */ +OO.ui.OutlineItemWidget.prototype.isMovable = function () { + return this.movable; +}; + +/** + * Check if item is removable. + * + * Removablilty is used by outline controls. + * + * @returns {boolean} Item is removable + */ +OO.ui.OutlineItemWidget.prototype.isRemovable = function () { + return this.removable; +}; + +/** + * Get indentation level. + * + * @returns {number} Indentation level + */ +OO.ui.OutlineItemWidget.prototype.getLevel = function () { + return this.level; +}; + +/** + * Set movability. + * + * Movablilty is used by outline controls. + * + * @param {boolean} movable Item is movable + * @chainable + */ +OO.ui.OutlineItemWidget.prototype.setMovable = function ( movable ) { + this.movable = !!movable; + return this; +}; + +/** + * Set removability. + * + * Removablilty is used by outline controls. + * + * @param {boolean} movable Item is removable + * @chainable + */ +OO.ui.OutlineItemWidget.prototype.setRemovable = function ( removable ) { + this.removable = !!removable; + return this; +}; + +/** + * Set indentation level. + * + * @method + * @param {number} [level=0] Indentation level, in the range of [0,#maxLevel] + * @chainable + */ +OO.ui.OutlineItemWidget.prototype.setLevel = function ( level ) { + var levels = this.constructor.static.levels, + levelClass = this.constructor.static.levelClass, + i = levels; + + this.level = level ? Math.max( 0, Math.min( levels - 1, level ) ) : 0; + while ( i-- ) { + if ( this.level === i ) { + this.$element.addClass( levelClass + i ); + } else { + this.$element.removeClass( levelClass + i ); + } + } + + return this; +}; +/** + * Create an OO.ui.ButtonOptionWidget object. + * + * @class + * @extends OO.ui.OptionWidget + * @mixins OO.ui.ButtonedElement + * @mixins OO.ui.FlaggableElement + * + * @constructor + * @param {Mixed} data Option data + * @param {Object} [config] Configuration options + */ +OO.ui.ButtonOptionWidget = function OoUiButtonOptionWidget( data, config ) { + // Parent constructor + OO.ui.ButtonOptionWidget.super.call( this, data, config ); + + // Mixin constructors + OO.ui.ButtonedElement.call( this, this.$( '<a>' ), config ); + OO.ui.FlaggableElement.call( this, config ); + + // Initialization + this.$element.addClass( 'oo-ui-buttonOptionWidget' ); + this.$button.append( this.$element.contents() ); + this.$element.append( this.$button ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ButtonOptionWidget, OO.ui.OptionWidget ); + +OO.mixinClass( OO.ui.ButtonOptionWidget, OO.ui.ButtonedElement ); +OO.mixinClass( OO.ui.ButtonOptionWidget, OO.ui.FlaggableElement ); + +/* Methods */ + +/** + * @inheritdoc + */ +OO.ui.ButtonOptionWidget.prototype.setSelected = function ( state ) { + OO.ui.OptionWidget.prototype.setSelected.call( this, state ); + + this.setActive( state ); + + return this; +}; +/** + * Create an OO.ui.ButtonSelect object. + * + * @class + * @extends OO.ui.SelectWidget + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.ButtonSelectWidget = function OoUiButtonSelectWidget( config ) { + // Parent constructor + OO.ui.ButtonSelectWidget.super.call( this, config ); + + // Initialization + this.$element.addClass( 'oo-ui-buttonSelectWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ButtonSelectWidget, OO.ui.SelectWidget ); +/** + * Creates an OO.ui.PopupWidget object. + * + * @class + * @extends OO.ui.Widget + * @mixins OO.ui.LabeledElement + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [tail=true] Show tail pointing to origin of popup + * @cfg {string} [align='center'] Alignment of popup to origin + * @cfg {jQuery} [$container] Container to prevent popup from rendering outside of + * @cfg {boolean} [autoClose=false] Popup auto-closes when it loses focus + * @cfg {jQuery} [$autoCloseIgnore] Elements to not auto close when clicked + * @cfg {boolean} [head] Show label and close button at the top + */ +OO.ui.PopupWidget = function OoUiPopupWidget( config ) { + // Config intialization + config = config || {}; + + // Parent constructor + OO.ui.PopupWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.LabeledElement.call( this, this.$( '<div>' ), config ); + OO.ui.ClippableElement.call( this, this.$( '<div>' ), config ); + + // Properties + this.visible = false; + this.$popup = this.$( '<div>' ); + this.$head = this.$( '<div>' ); + this.$body = this.$clippable; + this.$tail = this.$( '<div>' ); + this.$container = config.$container || this.$( 'body' ); + this.autoClose = !!config.autoClose; + this.$autoCloseIgnore = config.$autoCloseIgnore; + this.transitionTimeout = null; + this.tail = false; + this.align = config.align || 'center'; + this.closeButton = new OO.ui.ButtonWidget( { '$': this.$, 'frameless': true, 'icon': 'close' } ); + this.onMouseDownHandler = OO.ui.bind( this.onMouseDown, this ); + + // Events + this.closeButton.connect( this, { 'click': 'onCloseButtonClick' } ); + + // Initialization + this.useTail( config.tail !== undefined ? !!config.tail : true ); + this.$body.addClass( 'oo-ui-popupWidget-body' ); + this.$tail.addClass( 'oo-ui-popupWidget-tail' ); + this.$head + .addClass( 'oo-ui-popupWidget-head' ) + .append( this.$label, this.closeButton.$element ); + if ( !config.head ) { + this.$head.hide(); + } + this.$popup + .addClass( 'oo-ui-popupWidget-popup' ) + .append( this.$head, this.$body ); + this.$element.hide() + .addClass( 'oo-ui-popupWidget' ) + .append( this.$popup, this.$tail ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.PopupWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.PopupWidget, OO.ui.LabeledElement ); + +OO.mixinClass( OO.ui.PopupWidget, OO.ui.ClippableElement ); + +/* Events */ + +/** + * @event hide + */ + +/** + * @event show + */ + +/* Methods */ + +/** + * Handles mouse down events. + * + * @method + * @param {jQuery.Event} e Mouse down event + */ +OO.ui.PopupWidget.prototype.onMouseDown = function ( e ) { + if ( + this.visible && + !$.contains( this.$element[0], e.target ) && + ( !this.$autoCloseIgnore || !this.$autoCloseIgnore.has( e.target ).length ) + ) { + this.hide(); + } +}; + +/** + * Bind mouse down listener + * + * @method + */ +OO.ui.PopupWidget.prototype.bindMouseDownListener = function () { + // Capture clicks outside popup + this.getElementWindow().addEventListener( 'mousedown', this.onMouseDownHandler, true ); +}; + +/** + * Handles close button click events. + * + * @method + */ +OO.ui.PopupWidget.prototype.onCloseButtonClick = function () { + if ( this.visible ) { + this.hide(); + } +}; + +/** + * Unbind mouse down listener + * + * @method + */ +OO.ui.PopupWidget.prototype.unbindMouseDownListener = function () { + this.getElementWindow().removeEventListener( 'mousedown', this.onMouseDownHandler, true ); +}; + +/** + * Check if the popup is visible. + * + * @method + * @returns {boolean} Popup is visible + */ +OO.ui.PopupWidget.prototype.isVisible = function () { + return this.visible; +}; + +/** + * Set whether to show a tail. + * + * @method + * @returns {boolean} Make tail visible + */ +OO.ui.PopupWidget.prototype.useTail = function ( value ) { + value = !!value; + if ( this.tail !== value ) { + this.tail = value; + if ( value ) { + this.$element.addClass( 'oo-ui-popupWidget-tailed' ); + } else { + this.$element.removeClass( 'oo-ui-popupWidget-tailed' ); + } + } +}; + +/** + * Check if showing a tail. + * + * @method + * @returns {boolean} tail is visible + */ +OO.ui.PopupWidget.prototype.hasTail = function () { + return this.tail; +}; + +/** + * Show the context. + * + * @method + * @fires show + * @chainable + */ +OO.ui.PopupWidget.prototype.show = function () { + if ( !this.visible ) { + this.setClipping( true ); + this.$element.show(); + this.visible = true; + this.emit( 'show' ); + if ( this.autoClose ) { + this.bindMouseDownListener(); + } + } + return this; +}; + +/** + * Hide the context. + * + * @method + * @fires hide + * @chainable + */ +OO.ui.PopupWidget.prototype.hide = function () { + if ( this.visible ) { + this.setClipping( false ); + this.$element.hide(); + this.visible = false; + this.emit( 'hide' ); + if ( this.autoClose ) { + this.unbindMouseDownListener(); + } + } + return this; +}; + +/** + * Updates the position and size. + * + * @method + * @param {number} width Width + * @param {number} height Height + * @param {boolean} [transition=false] Use a smooth transition + * @chainable + */ +OO.ui.PopupWidget.prototype.display = function ( width, height, transition ) { + var padding = 10, + originOffset = Math.round( this.$element.offset().left ), + containerLeft = Math.round( this.$container.offset().left ), + containerWidth = this.$container.innerWidth(), + containerRight = containerLeft + containerWidth, + popupOffset = width * ( { 'left': 0, 'center': -0.5, 'right': -1 } )[this.align], + popupLeft = popupOffset - padding, + popupRight = popupOffset + padding + width + padding, + overlapLeft = ( originOffset + popupLeft ) - containerLeft, + overlapRight = containerRight - ( originOffset + popupRight ); + + // Prevent transition from being interrupted + clearTimeout( this.transitionTimeout ); + if ( transition ) { + // Enable transition + this.$element.addClass( 'oo-ui-popupWidget-transitioning' ); + } + + if ( overlapRight < 0 ) { + popupOffset += overlapRight; + } else if ( overlapLeft < 0 ) { + popupOffset -= overlapLeft; + } + + // Position body relative to anchor and resize + this.$popup.css( { + 'left': popupOffset, + 'width': width, + 'height': height === undefined ? 'auto' : height + } ); + + if ( transition ) { + // Prevent transitioning after transition is complete + this.transitionTimeout = setTimeout( OO.ui.bind( function () { + this.$element.removeClass( 'oo-ui-popupWidget-transitioning' ); + }, this ), 200 ); + } else { + // Prevent transitioning immediately + this.$element.removeClass( 'oo-ui-popupWidget-transitioning' ); + } + + return this; +}; +/** + * Button that shows and hides a popup. + * + * @class + * @extends OO.ui.ButtonWidget + * @mixins OO.ui.PopuppableElement + * + * @constructor + * @param {Object} [config] Configuration options + */ +OO.ui.PopupButtonWidget = function OoUiPopupButtonWidget( config ) { + // Parent constructor + OO.ui.PopupButtonWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.PopuppableElement.call( this, config ); + + // Initialization + this.$element + .addClass( 'oo-ui-popupButtonWidget' ) + .append( this.popup.$element ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.PopupButtonWidget, OO.ui.ButtonWidget ); + +OO.mixinClass( OO.ui.PopupButtonWidget, OO.ui.PopuppableElement ); + +/* Methods */ + +/** + * Handles mouse click events. + * + * @method + * @param {jQuery.Event} e Mouse click event + */ +OO.ui.PopupButtonWidget.prototype.onClick = function ( e ) { + // Skip clicks within the popup + if ( $.contains( this.popup.$element[0], e.target ) ) { + return; + } + + if ( !this.disabled ) { + if ( this.popup.isVisible() ) { + this.hidePopup(); + } else { + this.showPopup(); + } + OO.ui.ButtonWidget.prototype.onClick.call( this ); + } + return false; +}; +/** + * Creates an OO.ui.SearchWidget object. + * + * @class + * @extends OO.ui.Widget + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {string|jQuery} [placeholder] Placeholder text for query input + * @cfg {string} [value] Initial query value + */ +OO.ui.SearchWidget = function OoUiSearchWidget( config ) { + // Configuration intialization + config = config || {}; + + // Parent constructor + OO.ui.SearchWidget.super.call( this, config ); + + // Properties + this.query = new OO.ui.TextInputWidget( { + '$': this.$, + 'icon': 'search', + 'placeholder': config.placeholder, + 'value': config.value + } ); + this.results = new OO.ui.SelectWidget( { '$': this.$ } ); + this.$query = this.$( '<div>' ); + this.$results = this.$( '<div>' ); + + // Events + this.query.connect( this, { + 'change': 'onQueryChange', + 'enter': 'onQueryEnter' + } ); + this.results.connect( this, { + 'highlight': 'onResultsHighlight', + 'select': 'onResultsSelect' + } ); + this.query.$input.on( 'keydown', OO.ui.bind( this.onQueryKeydown, this ) ); + + // Initialization + this.$query + .addClass( 'oo-ui-searchWidget-query' ) + .append( this.query.$element ); + this.$results + .addClass( 'oo-ui-searchWidget-results' ) + .append( this.results.$element ); + this.$element + .addClass( 'oo-ui-searchWidget' ) + .append( this.$results, this.$query ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.SearchWidget, OO.ui.Widget ); + +/* Events */ + +/** + * @event highlight + * @param {Object|null} item Item data or null if no item is highlighted + */ + +/** + * @event select + * @param {Object|null} item Item data or null if no item is selected + */ + +/* Methods */ + +/** + * Handle query key down events. + * + * @method + * @param {jQuery.Event} e Key down event + */ +OO.ui.SearchWidget.prototype.onQueryKeydown = function ( e ) { + var highlightedItem, nextItem, + dir = e.which === OO.ui.Keys.DOWN ? 1 : ( e.which === OO.ui.Keys.UP ? -1 : 0 ); + + if ( dir ) { + highlightedItem = this.results.getHighlightedItem(); + if ( !highlightedItem ) { + highlightedItem = this.results.getSelectedItem(); + } + nextItem = this.results.getRelativeSelectableItem( highlightedItem, dir ); + this.results.highlightItem( nextItem ); + nextItem.scrollElementIntoView(); + } +}; + +/** + * Handle select widget select events. + * + * Clears existing results. Subclasses should repopulate items according to new query. + * + * @method + * @param {string} value New value + */ +OO.ui.SearchWidget.prototype.onQueryChange = function () { + // Reset + this.results.clearItems(); +}; + +/** + * Handle select widget enter key events. + * + * Selects highlighted item. + * + * @method + * @param {string} value New value + */ +OO.ui.SearchWidget.prototype.onQueryEnter = function () { + // Reset + this.results.selectItem( this.results.getHighlightedItem() ); +}; + +/** + * Handle select widget highlight events. + * + * @method + * @param {OO.ui.OptionWidget} item Highlighted item + * @fires highlight + */ +OO.ui.SearchWidget.prototype.onResultsHighlight = function ( item ) { + this.emit( 'highlight', item ? item.getData() : null ); +}; + +/** + * Handle select widget select events. + * + * @method + * @param {OO.ui.OptionWidget} item Selected item + * @fires select + */ +OO.ui.SearchWidget.prototype.onResultsSelect = function ( item ) { + this.emit( 'select', item ? item.getData() : null ); +}; + +/** + * Get the query input. + * + * @method + * @returns {OO.ui.TextInputWidget} Query input + */ +OO.ui.SearchWidget.prototype.getQuery = function () { + return this.query; +}; + +/** + * Reset the widget to initial value. + */ +OO.ui.SearchWidget.prototype.clear = function () { + this.query.setValue( '' ); +}; + +/** + * Get the results list. + * + * @method + * @returns {OO.ui.SelectWidget} Select list + */ +OO.ui.SearchWidget.prototype.getResults = function () { + return this.results; +}; +/** + * Creates an OO.ui.TextInputWidget object. + * + * @class + * @extends OO.ui.InputWidget + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {string} [placeholder] Placeholder text + * @cfg {string} [icon] Symbolic name of icon + * @cfg {boolean} [multiline=false] Allow multiple lines of text + * @cfg {boolean} [autosize=false] Automatically resize to fit content + * @cfg {boolean} [maxRows=10] Maximum number of rows to make visible when autosizing + */ +OO.ui.TextInputWidget = function OoUiTextInputWidget( config ) { + config = $.extend( { 'maxRows': 10 }, config ); + + // Parent constructor + OO.ui.TextInputWidget.super.call( this, config ); + + // Properties + this.pending = 0; + this.multiline = !!config.multiline; + this.autosize = !!config.autosize; + this.maxRows = config.maxRows; + + // Events + this.$input.on( 'keypress', OO.ui.bind( this.onKeyPress, this ) ); + this.$element.on( 'DOMNodeInsertedIntoDocument', OO.ui.bind( this.onElementAttach, this ) ); + + // Initialization + this.$element.addClass( 'oo-ui-textInputWidget' ); + if ( config.icon ) { + this.$element.addClass( 'oo-ui-textInputWidget-decorated' ); + this.$element.append( + this.$( '<span>' ) + .addClass( 'oo-ui-textInputWidget-icon oo-ui-icon-' + config.icon ) + .mousedown( OO.ui.bind( function () { + this.$input.focus(); + return false; + }, this ) ) + ); + } + if ( config.placeholder ) { + this.$input.attr( 'placeholder', config.placeholder ); + } +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.TextInputWidget, OO.ui.InputWidget ); + +/* Events */ + +/** + * User presses enter inside the text box. + * + * Not called if input is multiline. + * + * @event enter + */ + +/* Methods */ + +/** + * Handles key press events. + * + * @param {jQuery.Event} e Key press event + * @fires enter If enter key is pressed and input is not multiline + */ +OO.ui.TextInputWidget.prototype.onKeyPress = function ( e ) { + if ( e.which === OO.ui.Keys.ENTER && !this.multiline ) { + this.emit( 'enter' ); + } +}; + +/** + * Handles element attach events. + * + * @param {jQuery.Event} e Element attach event + */ +OO.ui.TextInputWidget.prototype.onElementAttach = function () { + this.adjustSize(); +}; + +/** + * @inheritdoc + */ +OO.ui.TextInputWidget.prototype.onEdit = function () { + this.adjustSize(); + + // Parent method + return OO.ui.InputWidget.prototype.onEdit.call( this ); +}; + +/** + * Automatically adjust the size of the text input. + * + * This only affects multi-line inputs that are auto-sized. + * + * @chainable + */ +OO.ui.TextInputWidget.prototype.adjustSize = function () { + var $clone, scrollHeight, innerHeight, outerHeight, maxInnerHeight, idealHeight; + + if ( this.multiline && this.autosize ) { + $clone = this.$input.clone() + .val( this.$input.val() ) + .css( { 'height': 0 } ) + .insertAfter( this.$input ); + // Set inline height property to 0 to measure scroll height + scrollHeight = $clone[0].scrollHeight; + // Remove inline height property to measure natural heights + $clone.css( 'height', '' ); + innerHeight = $clone.innerHeight(); + outerHeight = $clone.outerHeight(); + // Measure max rows height + $clone.attr( 'rows', this.maxRows ).css( 'height', 'auto' ); + maxInnerHeight = $clone.innerHeight(); + $clone.removeAttr( 'rows' ).css( 'height', '' ); + $clone.remove(); + idealHeight = Math.min( maxInnerHeight, scrollHeight ); + // Only apply inline height when expansion beyond natural height is needed + this.$input.css( + 'height', + // Use the difference between the inner and outer height as a buffer + idealHeight > outerHeight ? idealHeight + ( outerHeight - innerHeight ) : '' + ); + } + return this; +}; + +/** + * Get input element. + * + * @method + * @param {Object} [config] Configuration options + * @returns {jQuery} Input element + */ +OO.ui.TextInputWidget.prototype.getInputElement = function ( config ) { + return config.multiline ? this.$( '<textarea>' ) : this.$( '<input type="text" />' ); +}; + +/* Methods */ + +/** + * Checks if input supports multiple lines. + * + * @method + * @returns {boolean} Input supports multiple lines + */ +OO.ui.TextInputWidget.prototype.isMultiline = function () { + return !!this.multiline; +}; + +/** + * Checks if input automatically adjusts its size. + * + * @method + * @returns {boolean} Input automatically adjusts its size + */ +OO.ui.TextInputWidget.prototype.isAutosizing = function () { + return !!this.autosize; +}; + +/** + * Checks if input is pending. + * + * @method + * @returns {boolean} Input is pending + */ +OO.ui.TextInputWidget.prototype.isPending = function () { + return !!this.pending; +}; + +/** + * Increases the pending stack. + * + * @method + * @chainable + */ +OO.ui.TextInputWidget.prototype.pushPending = function () { + this.pending++; + this.$element.addClass( 'oo-ui-textInputWidget-pending' ); + this.$input.addClass( 'oo-ui-texture-pending' ); + return this; +}; + +/** + * Reduces the pending stack. + * + * Clamped at zero. + * + * @method + * @chainable + */ +OO.ui.TextInputWidget.prototype.popPending = function () { + this.pending = Math.max( 0, this.pending - 1 ); + if ( !this.pending ) { + this.$element.removeClass( 'oo-ui-textInputWidget-pending' ); + this.$input.removeClass( 'oo-ui-texture-pending' ); + } + return this; +}; +/** + * Creates an OO.ui.TextInputMenuWidget object. + * + * @class + * @extends OO.ui.MenuWidget + * + * @constructor + * @param {OO.ui.TextInputWidget} input Text input widget to provide menu for + * @param {Object} [config] Configuration options + * @cfg {jQuery} [$container=input.$element] Element to render menu under + */ +OO.ui.TextInputMenuWidget = function OoUiTextInputMenuWidget( input, config ) { + // Parent constructor + OO.ui.TextInputMenuWidget.super.call( this, config ); + + // Properties + this.input = input; + this.$container = config.$container || this.input.$element; + this.onWindowResizeHandler = OO.ui.bind( this.onWindowResize, this ); + + // Initialization + this.$element.addClass( 'oo-ui-textInputMenuWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.TextInputMenuWidget, OO.ui.MenuWidget ); + +/* Methods */ + +/** + * Handle window resize event. + * + * @method + * @param {jQuery.Event} e Window resize event + */ +OO.ui.TextInputMenuWidget.prototype.onWindowResize = function () { + this.position(); +}; + +/** + * Shows the menu. + * + * @method + * @chainable + */ +OO.ui.TextInputMenuWidget.prototype.show = function () { + // Parent method + OO.ui.MenuWidget.prototype.show.call( this ); + + this.position(); + this.$( this.getElementWindow() ).on( 'resize', this.onWindowResizeHandler ); + return this; +}; + +/** + * Hides the menu. + * + * @method + * @chainable + */ +OO.ui.TextInputMenuWidget.prototype.hide = function () { + // Parent method + OO.ui.MenuWidget.prototype.hide.call( this ); + + this.$( this.getElementWindow() ).off( 'resize', this.onWindowResizeHandler ); + return this; +}; + +/** + * Positions the menu. + * + * @method + * @chainable + */ +OO.ui.TextInputMenuWidget.prototype.position = function () { + var frameOffset, + $container = this.$container, + dimensions = $container.offset(); + + // Position under input + dimensions.top += $container.height(); + + // Compensate for frame position if in a differnt frame + if ( this.input.$.frame && this.input.$.context !== this.$element[0].ownerDocument ) { + frameOffset = OO.ui.Element.getRelativePosition( + this.input.$.frame.$element, this.$element.offsetParent() + ); + dimensions.left += frameOffset.left; + dimensions.top += frameOffset.top; + } else { + // Fix for RTL (for some reason, no need to fix if the frameoffset is set) + if ( this.$element.css( 'direction' ) === 'rtl' ) { + dimensions.right = this.$element.parent().position().left - + dimensions.width - dimensions.left; + // Erase the value for 'left': + delete dimensions.left; + } + } + + this.$element.css( dimensions ); + this.setIdealSize( $container.width() ); + return this; +}; +/** + * Mixin for widgets with a boolean state. + * + * @class + * @abstract + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [value=false] Initial value + */ +OO.ui.ToggleWidget = function OoUiToggleWidget( config ) { + // Configuration initialization + config = config || {}; + + // Properties + this.value = null; + + // Initialization + this.$element.addClass( 'oo-ui-toggleWidget' ); + this.setValue( !!config.value ); +}; + +/* Events */ + +/** + * @event change + * @param {boolean} value Changed value + */ + +/* Methods */ + +/** + * Get the value of the toggle. + * + * @method + * @returns {boolean} Toggle value + */ +OO.ui.ToggleWidget.prototype.getValue = function () { + return this.value; +}; + +/** + * Set the value of the toggle. + * + * @method + * @param {boolean} value New value + * @fires change + * @chainable + */ +OO.ui.ToggleWidget.prototype.setValue = function ( value ) { + value = !!value; + if ( this.value !== value ) { + this.value = value; + this.emit( 'change', value ); + this.$element.toggleClass( 'oo-ui-toggleWidget-on', value ); + this.$element.toggleClass( 'oo-ui-toggleWidget-off', !value ); + } + return this; +}; +/** + * @class + * @extends OO.ui.ButtonWidget + * @mixins OO.ui.ToggleWidget + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [value=false] Initial value + */ +OO.ui.ToggleButtonWidget = function OoUiToggleButtonWidget( config ) { + // Configuration initialization + config = config || {}; + + // Parent constructor + OO.ui.ToggleButtonWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.ToggleWidget.call( this, config ); + + // Initialization + this.$element.addClass( 'oo-ui-toggleButtonWidget' ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ToggleButtonWidget, OO.ui.ButtonWidget ); + +OO.mixinClass( OO.ui.ToggleButtonWidget, OO.ui.ToggleWidget ); + +/* Methods */ + +/** + * @inheritdoc + */ +OO.ui.ToggleButtonWidget.prototype.onClick = function () { + if ( !this.disabled ) { + this.setValue( !this.value ); + } + + // Parent method + return OO.ui.ButtonWidget.prototype.onClick.call( this ); +}; + +/** + * @inheritdoc + */ +OO.ui.ToggleButtonWidget.prototype.setValue = function ( value ) { + value = !!value; + if ( value !== this.value ) { + this.setActive( value ); + } + + // Parent method + OO.ui.ToggleWidget.prototype.setValue.call( this, value ); + + return this; +}; +/** + * @class + * @abstract + * @extends OO.ui.Widget + * @mixins OO.ui.ToggleWidget + * + * @constructor + * @param {Object} [config] Configuration options + * @cfg {boolean} [value=false] Initial value + */ +OO.ui.ToggleSwitchWidget = function OoUiToggleSwitchWidget( config ) { + // Parent constructor + OO.ui.ToggleSwitchWidget.super.call( this, config ); + + // Mixin constructors + OO.ui.ToggleWidget.call( this, config ); + + // Properties + this.dragging = false; + this.dragStart = null; + this.sliding = false; + this.$glow = this.$( '<span>' ); + this.$grip = this.$( '<span>' ); + + // Events + this.$element.on( 'click', OO.ui.bind( this.onClick, this ) ); + + // Initialization + this.$glow.addClass( 'oo-ui-toggleSwitchWidget-glow' ); + this.$grip.addClass( 'oo-ui-toggleSwitchWidget-grip' ); + this.$element + .addClass( 'oo-ui-toggleSwitchWidget' ) + .append( this.$glow, this.$grip ); +}; + +/* Inheritance */ + +OO.inheritClass( OO.ui.ToggleSwitchWidget, OO.ui.Widget ); + +OO.mixinClass( OO.ui.ToggleSwitchWidget, OO.ui.ToggleWidget ); + +/* Methods */ + +/** + * Handles mouse down events. + * + * @method + * @param {jQuery.Event} e Mouse down event + */ +OO.ui.ToggleSwitchWidget.prototype.onClick = function ( e ) { + if ( !this.disabled && e.which === 1 ) { + this.setValue( !this.value ); + } +}; +}( OO ) ); diff --git a/resources/lib/oojs-ui/oojs-ui.svg.css b/resources/lib/oojs-ui/oojs-ui.svg.css new file mode 100644 index 000000000000..a7eecc1e576c --- /dev/null +++ b/resources/lib/oojs-ui/oojs-ui.svg.css @@ -0,0 +1,1230 @@ +/*! + * OOjs UI v0.1.0-pre (eaa1b7f06d) + * https://www.mediawiki.org/wiki/OOjs_UI + * + * Copyright 2011–2014 OOjs Team and other contributors. + * Released under the MIT license + * http://oojs.mit-license.org + * + * Date: Thu Apr 03 2014 16:56:21 GMT-0700 (PDT) + */ + +/* Textures */ + +.oo-ui-texture-pending { + background-image: /* @embed */ url(images/textures/pending.gif); +} + +.oo-ui-texture-transparency { + background-image: /* @embed */ url(images/textures/transparency.png); +} + +/* RTL Definitions */ + +/* @noflip */ + +.oo-ui-rtl { + direction: rtl; +} + +/* @noflip */ + +.oo-ui-ltr { + direction: ltr; +} + +.oo-ui-dialog { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + padding: 1em; + line-height: 1em; + /* Fix for strange opacity-related rendering issues. + CAUTION: -webkit-backface-visibility: hidden; is EXTREMELY DANGEROUS. + If applied to a VE surface directly, it will break selection of + FocusableNodes, and in the past it's caused transparent PNGs to + render as opaque black images. For some reason applying it to the dialog + wrapper in the main document fixes opacity-related behavior in the iframe + document, but doesn't break the surface inside the iframe. */ + + -webkit-backface-visibility: hidden; + backface-visibility: hidden; +} + +.oo-ui-dialog .oo-ui-window-frame { + position: fixed; + top: 1em; + right: 0; + bottom: 1em; + left: 0; + min-height: 12em; + margin: auto; + overflow: hidden; +} + +.oo-ui-dialog-small .oo-ui-window-frame { + width: 400px; + max-height: 230px; +} + +.oo-ui-dialog-medium .oo-ui-window-frame { + width: 600px; + max-height: 460px; +} + +.oo-ui-dialog-large .oo-ui-window-frame { + width: 800px; + max-height: 690px; +} + +.oo-ui-dialog .oo-ui-frame { + width: 100%; + height: 100%; +} + +.oo-ui-dialog-content .oo-ui-window-head, +.oo-ui-dialog-content .oo-ui-window-body, +.oo-ui-dialog-content .oo-ui-window-foot { + position: absolute; + right: 0; + left: 0; + overflow: hidden; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.oo-ui-dialog-content .oo-ui-window-head { + top: 0; + height: 3.8em; + padding: 0.5em; +} + +.oo-ui-dialog-content .oo-ui-window-title { + line-height: 2.8em; +} + +.oo-ui-dialog-content .oo-ui-window-icon { + width: 2.4em; + height: 2.8em; + line-height: 2.8em; +} + +.oo-ui-dialog-content .oo-ui-window-closeButton { + float: right; + margin: 0.25em 0.25em; +} + +.oo-ui-dialog-content .oo-ui-window-body { + top: 3.8em; + bottom: 4.8em; +} + +.oo-ui-dialog-content .oo-ui-window-foot { + bottom: 0; + height: 4.8em; + padding: 1em; +} + +.oo-ui-dialog-content .oo-ui-window-foot .oo-ui-buttonedElement-framed { + float: left; + margin: 0.125em 0.25em; +} + +.oo-ui-dialog-content .oo-ui-window-foot .oo-ui-flaggableElement-primary, +.oo-ui-dialog-content .oo-ui-window-foot .oo-ui-flaggableElement-constructive, +.oo-ui-dialog-content .oo-ui-window-foot .oo-ui-flaggableElement-destructive { + float: right; +} + +.oo-ui-dialog-content-footless .oo-ui-window-body { + bottom: 0; +} + +.oo-ui-dialog-content-footless .oo-ui-window-foot { + display: none; +} + +.oo-ui-frame { + padding: 0; + margin: 0; +} + +.oo-ui-frame-body { + padding: 0; + margin: 0; + background: none; +} + +.oo-ui-toolbar { + clear: both; +} + +.oo-ui-toolbar-bar { + line-height: 1em; +} + +.oo-ui-toolbar-bottom .oo-ui-toolbar-bar { + position: absolute; +} + +.oo-ui-toolbar-actions { + float: right; +} + +.oo-ui-toolbar-tools { + float: left; +} + +.oo-ui-toolbar-tools, +.oo-ui-toolbar-actions, +.oo-ui-toolbar-shadow { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; +} + +.oo-ui-toolbar-actions .oo-ui-popupWidget { + -webkit-user-select: all; + -moz-user-select: all; + -ms-user-select: all; + user-select: all; + -webkit-touch-callout: default; +} + +.oo-ui-toolbar-shadow { + position: absolute; + width: 100%; + pointer-events: none; + background-position: left top; + background-repeat: repeat-x; +} + +.oo-ui-toolGroup { + display: inline-block; + margin: 0.3em; + vertical-align: middle; +} + +.oo-ui-toolGroup-empty { + display: none; +} + +.oo-ui-toolGroup .oo-ui-tool-link .oo-ui-iconedElement-icon { + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-window-head { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; +} + +.oo-ui-window-icon { + float: left; + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-window-title { + float: left; + white-space: nowrap; + cursor: default; +} + +.oo-ui-window-overlay { + position: absolute; + top: 0; + left: 0; +} + +.oo-ui-buttonedElement .oo-ui-buttonedElement-button { + display: inline-block; + vertical-align: middle; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; +} + +.oo-ui-buttonedElement .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + display: none; + margin-left: 0; +} + +.oo-ui-buttonedElement .oo-ui-buttonedElement-button > .oo-ui-indicatedElement-indicator { + display: none; + margin-right: -0.75em; +} + +.oo-ui-buttonedElement.oo-ui-widget-disabled .oo-ui-buttonedElement-button { + cursor: default; +} + +.oo-ui-buttonedElement.oo-ui-indicatedElement .oo-ui-buttonedElement-button > .oo-ui-indicatedElement-indicator, +.oo-ui-buttonedElement.oo-ui-iconedElement .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + display: inline-block; + vertical-align: middle; + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-buttonedElement-frameless { + position: relative; + display: inline-block; +} + +.oo-ui-buttonedElement-frameless .oo-ui-buttonedElement-button > .oo-ui-labeledElement-label { + display: inline-block; + margin-left: 0.25em; + vertical-align: middle; +} + +.oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button { + display: inline-block; + padding: 0.2em 0.8em; + margin: 0.1em 0; + text-align: center; + vertical-align: top; +} + +.oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button > .oo-ui-labeledElement-label { + display: inline-block; + line-height: 1.9em; + vertical-align: middle; +} + +.oo-ui-buttonedElement-framed.oo-ui-iconedElement .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + margin-right: -0.5em; + margin-left: -0.5em; +} + +.oo-ui-buttonedElement-framed.oo-ui-iconedElement.oo-ui-labeledElement .oo-ui-buttonedElement-button > .oo-ui-iconedElement-icon { + margin-right: 0.3em; + margin-left: -0.5em; +} + +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-active, +.oo-ui-buttonedElement-framed.oo-ui-widget-disabled .oo-ui-buttonedElement-button.oo-ui-buttonedElement-pressed { + cursor: default; +} + +.oo-ui-clippableElement-clippable { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.oo-ui-bookletLayout-stackLayout.oo-ui-stackLayout-continuous .oo-ui-panelLayout-scrollable { + overflow-y: hidden; +} + +.oo-ui-bookletLayout-stackLayout .oo-ui-panelLayout { + width: 100%; + padding: 1.5em; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.oo-ui-bookletLayout-stackLayout .oo-ui-panelLayout-scrollable { + overflow-y: auto; +} + +.oo-ui-bookletLayout-stackLayout .oo-ui-panelLayout-padded { + padding: 2em; +} + +.oo-ui-bookletLayout-outlinePanel-editable .oo-ui-outlineWidget { + position: absolute; + top: 0; + right: 0; + bottom: 3em; + left: 0; + overflow-y: auto; +} + +.oo-ui-bookletLayout-outlinePanel .oo-ui-outlineControlsWidget { + position: absolute; + right: 0; + bottom: 0; + left: 0; +} + +.oo-ui-fieldLayout { + margin-bottom: 1em; +} + +.oo-ui-fieldLayout:last-child { + margin-bottom: 0; +} + +.oo-ui-fieldLayout:before, +.oo-ui-fieldLayout:after { + display: table; + content: " "; +} + +.oo-ui-fieldLayout:after { + clear: both; +} + +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-left > .oo-ui-labeledElement-label, +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-right > .oo-ui-labeledElement-label { + display: block; + float: left; + width: 35%; + padding-top: 0.5em; + margin-right: 5%; +} + +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-left > .oo-ui-fieldLayout-field, +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-right > .oo-ui-fieldLayout-field { + display: block; + float: left; + width: 60%; +} + +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-right > .oo-ui-labeledElement-label { + text-align: right; +} + +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-inline > .oo-ui-labeledElement-label { + display: inline-block; + padding: 0.75em 0.5em 0.5em 0.5em; + vertical-align: middle; +} + +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-inline > .oo-ui-fieldLayout-field { + display: inline-block; + padding: 0.5em 0; + vertical-align: middle; +} + +.oo-ui-fieldLayout.oo-ui-fieldLayout-align-top > .oo-ui-labeledElement-label { + padding: 0.5em 0; +} + +.oo-ui-fieldsetLayout { + position: relative; + padding: 0; + margin: 0; +} + +.oo-ui-fieldsetLayout + .oo-ui-fieldsetLayout { + margin-top: 2em; +} + +.oo-ui-fieldsetLayout-labeled { + margin-top: -0.75em; +} + +.oo-ui-fieldsetLayout > legend.oo-ui-labeledElement-label { + padding: 0.25em 0; + margin-bottom: 0.5em; +} + +.oo-ui-fieldsetLayout.oo-ui-iconedElement > legend.oo-ui-labeledElement-label { + padding-left: 1.75em; +} + +.oo-ui-fieldsetLayout.oo-ui-iconedElement > .oo-ui-iconedElement-icon { + position: absolute; + top: 0; + left: 0; + display: block; + width: 2em; + height: 2em; + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-gridLayout { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; +} + +.oo-ui-labelWidget { + padding: 0.5em 0; +} + +.oo-ui-panelLayout { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; +} + +.oo-ui-panelLayout-scrollable { + overflow-y: auto; +} + +.oo-ui-panelLayout-padded { + padding: 2em; +} + +.oo-ui-stackLayout > .oo-ui-panelLayout { + display: none; +} + +.oo-ui-stackLayout-continuous > .oo-ui-panelLayout { + position: relative; + display: block; +} + +.oo-ui-barToolGroup > .oo-ui-iconedElement-icon, +.oo-ui-barToolGroup > .oo-ui-labeledElement-label { + display: none; +} + +.oo-ui-barToolGroup .oo-ui-tool { + position: relative; + display: inline-block; + vertical-align: top; +} + +.oo-ui-barToolGroup .oo-ui-tool-link { + display: block; + height: 1.5em; + padding: 0.25em; +} + +.oo-ui-barToolGroup .oo-ui-tool-link .oo-ui-iconedElement-icon { + display: block; + width: 1.5em; + height: 1.5em; +} + +.oo-ui-barToolGroup .oo-ui-tool-link .oo-ui-tool-title { + display: none; +} + +.oo-ui-barToolGroup .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link { + cursor: default; +} + +.oo-ui-barToolGroup .oo-ui-tool-title, +.oo-ui-barToolGroup .oo-ui-tool-accel { + display: none; +} + +.oo-ui-barToolGroup.oo-ui-widget-enabled .oo-ui-tool-link { + cursor: pointer; +} + +.oo-ui-listToolGroup .oo-ui-toolGroup-tools { + padding: 0.25em; +} + +.oo-ui-listToolGroup .oo-ui-tool { + display: inline-block; + width: 100%; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.oo-ui-listToolGroup .oo-ui-tool-link { + display: block; + padding-right: 0.5em; + white-space: nowrap; + cursor: pointer; +} + +.oo-ui-listToolGroup .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link { + cursor: default; +} + +.oo-ui-menuToolGroup .oo-ui-popupToolGroup-handle { + min-width: 8em; +} + +.oo-ui-menuToolGroup .oo-ui-tool { + display: block; +} + +.oo-ui-menuToolGroup .oo-ui-tool-link { + display: block; + padding: 0.25em 1em 0.25em 0.25em; + white-space: nowrap; + cursor: pointer; +} + +.oo-ui-menuToolGroup .oo-ui-tool-link .oo-ui-iconedElement-icon { + background-image: none; +} + +.oo-ui-menuToolGroup .oo-ui-tool-active .oo-ui-tool-link .oo-ui-iconedElement-icon { + background-image: /* @embed */ url(images/icons/check.png); +} + +.oo-ui-menuToolGroup .oo-ui-tool.oo-ui-widget-disabled .oo-ui-tool-link { + cursor: default; +} + +.oo-ui-popupToolGroup { + position: relative; + height: 2em; + min-width: 2.5em; +} + +.oo-ui-popupToolGroup.oo-ui-indicatedElement.oo-ui-iconedElement { + min-width: 3.5em; +} + +.oo-ui-popupToolGroup-handle { + display: block; + cursor: pointer; +} + +.oo-ui-popupToolGroup-handle .oo-ui-indicatedElement-indicator, +.oo-ui-popupToolGroup-handle .oo-ui-iconedElement-icon { + position: absolute; + top: 0; + width: 2em; + height: 2em; + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-popupToolGroup-handle .oo-ui-indicatedElement-indicator { + right: 0; +} + +.oo-ui-popupToolGroup-handle .oo-ui-iconedElement-icon { + left: 0.25em; +} + +.oo-ui-popupToolGroup-handle .oo-ui-labeledElement-label { + margin: 0 1em; + font-size: 0.8em; + line-height: 2.6em; +} + +.oo-ui-popupToolGroup.oo-ui-widget-disabled .oo-ui-popupToolGroup-handle { + cursor: default; +} + +.oo-ui-popupToolGroup.oo-ui-iconedElement .oo-ui-popupToolGroup-handle .oo-ui-labeledElement-label { + margin-left: 3em; +} + +.oo-ui-popupToolGroup.oo-ui-indicatedElement .oo-ui-popupToolGroup-handle .oo-ui-labeledElement-label { + margin-right: 2.25em; +} + +.oo-ui-popupToolGroup .oo-ui-toolGroup-tools { + position: absolute; + top: 2em; + left: -1px; + z-index: 4; + display: none; +} + +.oo-ui-popupToolGroup .oo-ui-toolGroup-tools .oo-ui-iconedElement-icon { + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-popupToolGroup-active.oo-ui-widget-enabled > .oo-ui-toolGroup-tools { + display: block; +} + +.oo-ui-popupToolGroup .oo-ui-tool-link .oo-ui-iconedElement-icon { + display: inline-block; + width: 2em; + height: 2em; + margin-right: 0.25em; + vertical-align: middle; +} + +.oo-ui-popupToolGroup .oo-ui-tool-link .oo-ui-tool-title { + display: inline-block; + font-size: 0.8em; + line-height: 2em; + vertical-align: middle; +} + +.oo-ui-popupToolGroup .oo-ui-tool-accel { + display: none; +} + +.oo-ui-popupTool .oo-ui-popupWidget { + margin-left: 1.25em; + font-size: 0.8em; +} + +.oo-ui-popupTool .oo-ui-popupWidget-popup, +.oo-ui-popupTool .oo-ui-popupWidget-tail { + z-index: 4; +} + +.oo-ui-iconWidget { + display: inline-block; + width: 1.9em; + height: 1.9em; + line-height: 2.5em; + vertical-align: middle; + background-position: center center; + background-repeat: no-repeat; + opacity: 0.8; +} + +.oo-ui-iconWidget.oo-ui-widget-disabled { + opacity: 0.2; +} + +.oo-ui-indicatorWidget { + display: inline-block; + width: 1.9em; + height: 1.9em; + line-height: 2.5em; + vertical-align: middle; + background-position: center center; + background-repeat: no-repeat; + opacity: 0.8; +} + +.oo-ui-indicatorWidget.oo-ui-widget-disabled { + opacity: 0.2; +} + +.oo-ui-selectWidget { + padding: 0; + margin: 0; + list-style: none; +} + +.oo-ui-optionWidget { + position: relative; + display: block; + margin: 0; + list-style: none; + cursor: pointer; + border: none; +} + +.oo-ui-optionWidget.oo-ui-widget-disabled { + cursor: default; +} + +.oo-ui-optionWidget .oo-ui-labeledElement-label { + display: block; + overflow: hidden; + line-height: 1.5em; + text-overflow: ellipsis; + white-space: nowrap; +} + +.oo-ui-optionWidget .oo-ui-iconedElement-icon, +.oo-ui-optionWidget .oo-ui-indicatedElement-indicator { + position: absolute; + top: 50%; + width: 2em; + height: 2em; + margin-top: -1em; + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-optionWidget .oo-ui-iconedElement-icon { + left: 0.5em; +} + +.oo-ui-optionWidget .oo-ui-indicatedElement-indicator { + right: 0.5em; +} + +.oo-ui-menuWidget { + position: absolute; +} + +.oo-ui-menuWidget input { + position: absolute; + width: 0; + height: 0; + overflow: hidden; + opacity: 0; +} + +.oo-ui-popupWidget-popup { + position: absolute; + overflow: hidden; +} + +.oo-ui-popupWidget-tail { + display: none; +} + +.oo-ui-popupWidget-tailed .oo-ui-popupWidget-popup { + margin-top: 7px; +} + +.oo-ui-popupWidget-tailed .oo-ui-popupWidget-tail { + position: absolute; + display: block; + background-repeat: no-repeat; +} + +.oo-ui-popupWidget-head { + height: 2.5em; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; +} + +.oo-ui-popupWidget-head .oo-ui-buttonWidget { + float: right; + margin: 0.25em; +} + +.oo-ui-popupWidget-head .oo-ui-labeledElement-label { + float: left; + margin: 0.75em 1em; + cursor: default; +} + +.oo-ui-popupWidget-body { + clear: both; +} + +.oo-ui-buttonGroupWidget { + border-radius: 0.3em; +} + +.oo-ui-buttonGroupWidget .oo-ui-buttonedElement-framed .oo-ui-buttonedElement-button { + margin-bottom: -1px; + margin-left: -1px; + border-radius: 0; +} + +.oo-ui-buttonGroupWidget .oo-ui-buttonedElement-framed:first-child .oo-ui-buttonedElement-button { + margin-left: 0; + border-bottom-left-radius: 0.3em; + border-top-left-radius: 0.3em; +} + +.oo-ui-buttonGroupWidget .oo-ui-buttonedElement-framed:last-child .oo-ui-buttonedElement-button { + border-top-right-radius: 0.3em; + border-bottom-right-radius: 0.3em; +} + +.oo-ui-buttonOptionWidget { + display: inline-block; + background-color: transparent; +} + +.oo-ui-buttonOptionWidget .oo-ui-buttonedElement-button { + position: relative; + height: 1.9em; +} + +.oo-ui-buttonOptionWidget.oo-ui-iconedElement .oo-ui-iconedElement-icon, +.oo-ui-buttonOptionWidget.oo-ui-indicatedElement .oo-ui-indicatedElement-indicator { + position: static; + display: inline-block; + height: 1.9em; + margin-top: 0; + vertical-align: middle; +} + +.oo-ui-buttonSelectWidget { + display: inline-block; + white-space: nowrap; +} + +.oo-ui-buttonWidget { + display: inline-block; + vertical-align: middle; +} + +.oo-ui-inlineMenuWidget { + position: relative; + display: inline-block; + min-width: 20em; + margin: 0.25em 0; +} + +.oo-ui-inlineMenuWidget-handle { + display: inline-block; + width: 100%; + height: 2.5em; + cursor: pointer; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; +} + +.oo-ui-inlineMenuWidget-handle .oo-ui-indicatedElement-indicator, +.oo-ui-inlineMenuWidget-handle .oo-ui-iconedElement-icon { + position: absolute; + top: 0; + width: 2.5em; + height: 2.5em; + background-position: center center; + background-repeat: no-repeat; +} + +.oo-ui-inlineMenuWidget-handle .oo-ui-indicatedElement-indicator { + right: 0; +} + +.oo-ui-inlineMenuWidget-handle .oo-ui-iconedElement-icon { + left: 0.25em; +} + +.oo-ui-inlineMenuWidget-handle .oo-ui-labeledElement-label { + margin: 0 0.5em; + line-height: 2.5em; +} + +.oo-ui-inlineMenuWidget.oo-ui-iconedElement .oo-ui-inlineMenuWidget-handle .oo-ui-labeledElement-label { + margin-left: 3em; +} + +.oo-ui-inlineMenuWidget.oo-ui-indicatedElement .oo-ui-inlineMenuWidget-handle .oo-ui-labeledElement-label { + margin-right: 2em; +} + +.oo-ui-inlineMenuWidget .oo-ui-menuWidget { + z-index: 1; + width: 100%; +} + +.oo-ui-inlineMenuWidget.oo-ui-widget-disabled .oo-ui-inlineMenuWidget-handle { + cursor: default; +} + +.oo-ui-menuItemWidget { + position: relative; +} + +.oo-ui-menuItemWidget .oo-ui-iconedElement-icon { + display: none; +} + +.oo-ui-menuItemWidget.oo-ui-optionWidget-selected { + background-color: transparent; +} + +.oo-ui-menuItemWidget.oo-ui-optionWidget-selected .oo-ui-iconedElement-icon { + display: block; +} + +.oo-ui-menuSectionItemWidget { + cursor: default; +} + +.oo-ui-outlineControlsWidget { + height: 3em; +} + +.oo-ui-outlineControlsWidget-adders, +.oo-ui-outlineControlsWidget-movers { + float: left; + height: 2em; + padding: 0; + margin: 0.5em; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.oo-ui-outlineControlsWidget > .oo-ui-iconedElement-icon { + float: left; + width: 1.5em; + height: 2em; + margin: 0.5em 0 0.5em 0.5em; + background-position: right center; + background-repeat: no-repeat; +} + +.oo-ui-outlineControlsWidget-adders { + float: left; + margin-left: 0; +} + +.oo-ui-outlineControlsWidget-adders .oo-ui-buttonWidget { + float: left; +} + +.oo-ui-outlineControlsWidget-movers { + float: right; +} + +.oo-ui-outlineControlsWidget-movers .oo-ui-buttonWidget { + float: right; +} + +.oo-ui-outlineItemWidget { + position: relative; + padding: 0.75em; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; +} + +.oo-ui-popupButtonWidget { + position: relative; +} + +.oo-ui-popupButtonWidget .oo-ui-popupWidget { + position: absolute; + left: 1em; + cursor: auto; +} + +.oo-ui-searchWidget-query { + position: absolute; + top: 0; + right: 0; + left: 0; + height: 4em; + padding: 0 1em; +} + +.oo-ui-searchWidget-query .oo-ui-textInputWidget { + width: 100%; + margin: 0.75em 0; +} + +.oo-ui-searchWidget-results { + position: absolute; + top: 4em; + right: 0; + bottom: 0; + left: 0; + padding: 1em; + overflow-x: hidden; + overflow-y: auto; + line-height: 0; +} + +.oo-ui-textInputWidget { + position: relative; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.oo-ui-textInputWidget input, +.oo-ui-textInputWidget textarea { + display: inline-block; + width: 100%; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + resize: none; +} + +.oo-ui-textInputWidget-icon { + position: absolute; + top: 0; + left: 0; + height: 100%; + background-position: right center; + background-repeat: no-repeat; +} + +.oo-ui-toggleSwitchWidget { + position: relative; + display: inline-block; + width: 4em; + height: 2em; + overflow: hidden; + vertical-align: middle; + cursor: pointer; + -webkit-transform: translateZ(0); + -moz-transform: translateZ(0); + -ms-transform: translateZ(0); + -o-transform: translateZ(0); + transform: translateZ(0); + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +.oo-ui-toggleSwitchWidget.oo-ui-widget-disabled { + cursor: default; +} + +.oo-ui-toggleSwitchWidget-grip { + position: absolute; + top: 0.25em; + left: 0.25em; + display: block; + width: 1.5em; + height: 1.5em; + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + -webkit-transition: left 200ms ease-in-out, margin-left 200ms ease-in-out; + -moz-transition: left 200ms ease-in-out, margin-left 200ms ease-in-out; + -ms-transition: left 200ms ease-in-out, margin-left 200ms ease-in-out; + -o-transition: left 200ms ease-in-out, margin-left 200ms ease-in-out; + transition: left 200ms ease-in-out, margin-left 200ms ease-in-out; +} + +.oo-ui-toggleSwitchWidget .oo-ui-toggleSwitchWidget-glow { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + -webkit-transition: opacity 200ms ease-in-out; + -moz-transition: opacity 200ms ease-in-out; + -ms-transition: opacity 200ms ease-in-out; + -o-transition: opacity 200ms ease-in-out; + transition: opacity 200ms ease-in-out; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; +} + +.oo-ui-toggleWidget-on .oo-ui-toggleSwitchWidget-grip { + left: 2.25em; + margin-left: -2px; +} + +.oo-ui-toggleWidget-off .oo-ui-toggleSwitchWidget-grip { + left: 0.25em; + margin-left: 0; +} + +.oo-ui-toggleWidget-off .oo-ui-toggleSwitchWidget-glow { + display: none; +} + +/* Icons */ + +.oo-ui-icon-add-item { + background-image: /* @embed */ url(images/icons/add-item.svg); +} + +.oo-ui-icon-advanced { + background-image: /* @embed */ url(images/icons/advanced.svg); +} + +.oo-ui-icon-alert { + background-image: /* @embed */ url(images/icons/alert.svg); +} + +.oo-ui-icon-check { + background-image: /* @embed */ url(images/icons/check.svg); +} + +.oo-ui-icon-clear { + background-image: /* @embed */ url(images/icons/clear.svg); +} + +.oo-ui-icon-close { + background-image: /* @embed */ url(images/icons/close.svg); +} + +.oo-ui-icon-code { + background-image: /* @embed */ url(images/icons/code.svg); +} + +.oo-ui-icon-collapse { + background-image: /* @embed */ url(images/icons/collapse.svg); +} + +.oo-ui-icon-comment { + background-image: /* @embed */ url(images/icons/comment.svg); +} + +.oo-ui-icon-expand { + background-image: /* @embed */ url(images/icons/expand.svg); +} + +.oo-ui-icon-help { + background-image: /* @embed */ url(images/icons/help.svg); +} + +.oo-ui-icon-link { + background-image: /* @embed */ url(images/icons/link.svg); +} + +.oo-ui-icon-menu { + background-image: /* @embed */ url(images/icons/menu.svg); +} + +.oo-ui-icon-next { + background-image: /* @embed */ url(images/icons/move-ltr.svg); +} + +.oo-ui-icon-picture { + background-image: /* @embed */ url(images/icons/picture.svg); +} + +.oo-ui-icon-previous { + background-image: /* @embed */ url(images/icons/move-rtl.svg); +} + +.oo-ui-icon-redo { + background-image: /* @embed */ url(images/icons/arched-arrow-ltr.svg); +} + +.oo-ui-icon-remove { + background-image: /* @embed */ url(images/icons/remove.svg); +} + +.oo-ui-icon-search { + background-image: /* @embed */ url(images/icons/search.svg); +} + +.oo-ui-icon-settings { + background-image: /* @embed */ url(images/icons/settings.svg); +} + +.oo-ui-icon-tag { + background-image: /* @embed */ url(images/icons/tag.svg); +} + +.oo-ui-icon-undo { + background-image: /* @embed */ url(images/icons/arched-arrow-rtl.svg); +} + +.oo-ui-icon-window { + background-image: /* @embed */ url(images/icons/window.svg); +} + +/* Indicators */ + +.oo-ui-indicator-down { + background-image: /* @embed */ url(images/indicators/down.svg); +} + +.oo-ui-indicator-required { + background-image: /* @embed */ url(images/indicators/required.svg); +} + +.oo-ui-indicator-up { + background-image: /* @embed */ url(images/indicators/up.svg); +}
\ No newline at end of file diff --git a/resources/lib/oojs-ui/update-oojs-ui.sh b/resources/lib/oojs-ui/update-oojs-ui.sh new file mode 100755 index 000000000000..edc7425dd8c1 --- /dev/null +++ b/resources/lib/oojs-ui/update-oojs-ui.sh @@ -0,0 +1,99 @@ +#!/usr/bin/env bash + +# FIXME this script is duplicated from update-oojs.sh - factor this out + +# This script generates a commit that updates the oojs-ui distribution +# ./bin/update-oojs-ui.sh path/to/repo/for/oojs-ui + +function oojsuihash() { + grep "OOjs UI v" resources/oojs-ui/oojs-ui.js \ + | head -n 1 \ + | grep -Eo '\([a-z0-9]+\)' \ + | sed 's/^(//' \ + | sed 's/)$//' +} + +function oojsuitag() { + grep "OOjs UI v" resources/oojs-ui/oojs-ui.js \ + | head -n 1 \ + | grep -Eo '\bv[0-9a-z.-]+\b' +} + +function oojsuiversion() { + grep "OOjs UI v" resources/oojs-ui/oojs-ui.js \ + | head -n 1 \ + | grep -Eo '\bv[0-9a-z.-]+\b.*$' +} + +# cd to the VisualEditor directory +cd $(cd $(dirname $0)/../..; pwd) + +if [ "x$1" == "x" ] +then + echo >&2 "Usage: update-oojs-ui.sh path/to/repo/for/oojs-ui" + exit 1 +fi + +# Undo any changes in the oojs-ui directory +git reset resources/oojs-ui/ +git checkout resources/oojs-ui/ + +git fetch origin +# Create a branch of MW if needed, and reset it to master +git checkout -B update-oojsui origin/master + +# Get the old oojs-ui version +OLDVERSION=$(oojsuihash) +if [ "x$OLDVERSION" == "x" ] +then + TAG=$(oojsuitag) +fi + +# cd to the oojs-ui directory +cd $1 || exit 1 +if [ "x$OLDVERSION" == "x" ] +then + # Try the tag + OLDVERSION=$(git rev-parse $TAG) + if [ $? != 0 ] + then + echo Could not find OOjs UI version + cd - + exit 1 + fi +fi +if [ "$(git rev-parse $OLDVERSION)" == "$(git rev-parse HEAD)" ] +then + echo "No changes (already at $OLDVERSION)" + cd - + exit 0 +fi +# Build the distribution +npm install || exit 1 +grunt || exit 1 +# Get the list of changes +NEWCHANGES=$(git log $OLDVERSION.. --oneline --no-merges --reverse --color=never) +NEWCHANGESDISPLAY=$(git log $OLDVERSION.. --oneline --no-merges --reverse --color=always) +# cd back to the VisualEditor directory +cd - + +# Copy files from dist/ to resources/oojs-ui +cp -a $1/dist/{oojs-ui.js,oojs-ui.svg.css,oojs-ui-apex.css,oojs-ui-agora.css,images,i18n} resources/oojs-ui/ +# Figure out what the new version is +NEWVERSION=$(oojsuiversion) +# Generate commit summary +COMMITMSG=$(cat <<END +Update OOjs UI to $NEWVERSION + +New changes: +$NEWCHANGES +END +) +# Commit +git commit resources/oojs-ui/ -m "$COMMITMSG" +cat >&2 <<END + + +Created commit with changes: +$NEWCHANGESDISPLAY +END diff --git a/resources/lib/oojs/oojs.js b/resources/lib/oojs/oojs.js new file mode 100644 index 000000000000..f9538784dc91 --- /dev/null +++ b/resources/lib/oojs/oojs.js @@ -0,0 +1,844 @@ +/*! + * OOjs v1.0.9 + * https://www.mediawiki.org/wiki/OOjs + * + * Copyright 2011-2014 OOjs Team and other contributors. + * Released under the MIT license + * http://oojs.mit-license.org + * + * Date: Wed Apr 02 2014 14:29:36 GMT-0700 (PDT) + */ +( function ( global ) { + +'use strict'; +var + /** + * Namespace for all classes, static methods and static properties. + * @class OO + * @singleton + */ + oo = {}, + hasOwn = oo.hasOwnProperty, + toString = oo.toString; + +/* Class Methods */ + +/** + * Assert whether a value is a plain object or not. + * + * @param {Mixed} obj + * @return {boolean} + */ +oo.isPlainObject = function ( obj ) { + // Any object or value whose internal [[Class]] property is not "[object Object]" + if ( toString.call( obj ) !== '[object Object]' ) { + return false; + } + + // The try/catch suppresses exceptions thrown when attempting to access + // the "constructor" property of certain host objects suich as window.location + // in Firefox < 20 (https://bugzilla.mozilla.org/814622) + try { + if ( obj.constructor && + !hasOwn.call( obj.constructor.prototype, 'isPrototypeOf' ) ) { + return false; + } + } catch ( e ) { + return false; + } + + return true; +}; + +/** + * Utility to initialize a class for OO inheritance. + * + * Currently this just initializes an empty static object. + * + * @param {Function} fn + */ +oo.initClass = function ( fn ) { + fn.static = fn.static || {}; +}; + +/** + * Utility for common usage of Object#create for inheriting from one + * prototype to another. + * + * Beware: This redefines the prototype, call before setting your prototypes. + * Beware: This redefines the prototype, can only be called once on a function. + * If called multiple times on the same function, the previous prototype is lost. + * This is how prototypal inheritance works, it can only be one straight chain + * (just like classical inheritance in PHP for example). If you need to work with + * multiple constructors consider storing an instance of the other constructor in a + * property instead, or perhaps use a mixin (see OO.mixinClass). + * + * function Thing() {} + * Thing.prototype.exists = function () {}; + * + * function Person() { + * Person.super.apply( this, arguments ); + * } + * OO.inheritClass( Person, Thing ); + * Person.static.defaultEyeCount = 2; + * Person.prototype.walk = function () {}; + * + * function Jumper() { + * Jumper.super.apply( this, arguments ); + * } + * OO.inheritClass( Jumper, Person ); + * Jumper.prototype.jump = function () {}; + * + * Jumper.static.defaultEyeCount === 2; + * var x = new Jumper(); + * x.jump(); + * x.walk(); + * x instanceof Thing && x instanceof Person && x instanceof Jumper; + * + * @param {Function} targetFn + * @param {Function} originFn + * @throws {Error} If target already inherits from origin + */ +oo.inheritClass = function ( targetFn, originFn ) { + if ( targetFn.prototype instanceof originFn ) { + throw new Error( 'Target already inherits from origin' ); + } + + var targetConstructor = targetFn.prototype.constructor; + + targetFn.super = originFn; + targetFn.prototype = Object.create( originFn.prototype, { + // Restore constructor property of targetFn + constructor: { + value: targetConstructor, + enumerable: false, + writable: true, + configurable: true + } + } ); + + // Extend static properties - always initialize both sides + oo.initClass( originFn ); + targetFn.static = Object.create( originFn.static ); +}; + +/** + * Utility to copy over *own* prototype properties of a mixin. + * The 'constructor' (whether implicit or explicit) is not copied over. + * + * This does not create inheritance to the origin. If inheritance is needed + * use oo.inheritClass instead. + * + * Beware: This can redefine a prototype property, call before setting your prototypes. + * Beware: Don't call before oo.inheritClass. + * + * function Foo() {} + * function Context() {} + * + * // Avoid repeating this code + * function ContextLazyLoad() {} + * ContextLazyLoad.prototype.getContext = function () { + * if ( !this.context ) { + * this.context = new Context(); + * } + * return this.context; + * }; + * + * function FooBar() {} + * OO.inheritClass( FooBar, Foo ); + * OO.mixinClass( FooBar, ContextLazyLoad ); + * + * @param {Function} targetFn + * @param {Function} originFn + */ +oo.mixinClass = function ( targetFn, originFn ) { + var key; + + // Copy prototype properties + for ( key in originFn.prototype ) { + if ( key !== 'constructor' && hasOwn.call( originFn.prototype, key ) ) { + targetFn.prototype[key] = originFn.prototype[key]; + } + } + + // Copy static properties - always initialize both sides + oo.initClass( targetFn ); + if ( originFn.static ) { + for ( key in originFn.static ) { + if ( hasOwn.call( originFn.static, key ) ) { + targetFn.static[key] = originFn.static[key]; + } + } + } else { + oo.initClass( originFn ); + } +}; + +/* Object Methods */ + +/** + * Create a new object that is an instance of the same + * constructor as the input, inherits from the same object + * and contains the same own properties. + * + * This makes a shallow non-recursive copy of own properties. + * To create a recursive copy of plain objects, use #copy. + * + * var foo = new Person( mom, dad ); + * foo.setAge( 21 ); + * var foo2 = OO.cloneObject( foo ); + * foo.setAge( 22 ); + * + * // Then + * foo2 !== foo; // true + * foo2 instanceof Person; // true + * foo2.getAge(); // 21 + * foo.getAge(); // 22 + * + * @param {Object} origin + * @return {Object} Clone of origin + */ +oo.cloneObject = function ( origin ) { + var key, r; + + r = Object.create( origin.constructor.prototype ); + + for ( key in origin ) { + if ( hasOwn.call( origin, key ) ) { + r[key] = origin[key]; + } + } + + return r; +}; + +/** + * Get an array of all property values in an object. + * + * @param {Object} Object to get values from + * @return {Array} List of object values + */ +oo.getObjectValues = function ( obj ) { + var key, values; + + if ( obj !== Object( obj ) ) { + throw new TypeError( 'Called on non-object' ); + } + + values = []; + for ( key in obj ) { + if ( hasOwn.call( obj, key ) ) { + values[values.length] = obj[key]; + } + } + + return values; +}; + +/** + * Recursively compares properties between two objects. + * + * A false result may be caused by property inequality or by properties in one object missing from + * the other. An asymmetrical test may also be performed, which checks only that properties in the + * first object are present in the second object, but not the inverse. + * + * @param {Object} a First object to compare + * @param {Object} b Second object to compare + * @param {boolean} [asymmetrical] Whether to check only that b contains values from a + * @return {boolean} If the objects contain the same values as each other + */ +oo.compare = function ( a, b, asymmetrical ) { + var aValue, bValue, aType, bType, k; + + if ( a === b ) { + return true; + } + + for ( k in a ) { + aValue = a[k]; + bValue = b[k]; + aType = typeof aValue; + bType = typeof bValue; + if ( aType !== bType || + ( ( aType === 'string' || aType === 'number' ) && aValue !== bValue ) || + ( aValue === Object( aValue ) && !oo.compare( aValue, bValue, asymmetrical ) ) ) { + return false; + } + } + // If the check is not asymmetrical, recursing with the arguments swapped will verify our result + return asymmetrical ? true : oo.compare( b, a, true ); +}; + +/** + * Create a plain deep copy of any kind of object. + * + * Copies are deep, and will either be an object or an array depending on `source`. + * + * @param {Object} source Object to copy + * @param {Function} [callback] Applied to leaf values before they added to the clone + * @return {Object} Copy of source object + */ +oo.copy = function ( source, callback ) { + var key, sourceValue, sourceType, destination; + + if ( typeof source.clone === 'function' ) { + return source.clone(); + } + + destination = Array.isArray( source ) ? new Array( source.length ) : {}; + + for ( key in source ) { + sourceValue = source[key]; + sourceType = typeof sourceValue; + if ( Array.isArray( sourceValue ) ) { + // Array + destination[key] = oo.copy( sourceValue, callback ); + } else if ( sourceValue && typeof sourceValue.clone === 'function' ) { + // Duck type object with custom clone method + destination[key] = callback ? + callback( sourceValue.clone() ) : sourceValue.clone(); + } else if ( sourceValue && typeof sourceValue.cloneNode === 'function' ) { + // DOM Node + destination[key] = callback ? + callback( sourceValue.cloneNode( true ) ) : sourceValue.cloneNode( true ); + } else if ( oo.isPlainObject( sourceValue ) ) { + // Plain objects + destination[key] = oo.copy( sourceValue, callback ); + } else { + // Non-plain objects (incl. functions) and primitive values + destination[key] = callback ? callback( sourceValue ) : sourceValue; + } + } + + return destination; +}; + +/** + * Generate a hash of an object based on its name and data. + * + * Performance optimization: <http://jsperf.com/ve-gethash-201208#/toJson_fnReplacerIfAoForElse> + * + * To avoid two objects with the same values generating different hashes, we utilize the replacer + * argument of JSON.stringify and sort the object by key as it's being serialized. This may or may + * not be the fastest way to do this; we should investigate this further. + * + * Objects and arrays are hashed recursively. When hashing an object that has a .getHash() + * function, we call that function and use its return value rather than hashing the object + * ourselves. This allows classes to define custom hashing. + * + * @param {Object} val Object to generate hash for + * @return {string} Hash of object + */ +oo.getHash = function ( val ) { + return JSON.stringify( val, oo.getHash.keySortReplacer ); +}; + +/** + * Helper function for OO.getHash which sorts objects by key. + * + * This is a callback passed into JSON.stringify. + * + * @method getHash_keySortReplacer + * @param {string} key Property name of value being replaced + * @param {Mixed} val Property value to replace + * @return {Mixed} Replacement value + */ +oo.getHash.keySortReplacer = function ( key, val ) { + var normalized, keys, i, len; + if ( val && typeof val.getHashObject === 'function' ) { + // This object has its own custom hash function, use it + val = val.getHashObject(); + } + if ( !Array.isArray( val ) && Object( val ) === val ) { + // Only normalize objects when the key-order is ambiguous + // (e.g. any object not an array). + normalized = {}; + keys = Object.keys( val ).sort(); + i = 0; + len = keys.length; + for ( ; i < len; i += 1 ) { + normalized[keys[i]] = val[keys[i]]; + } + return normalized; + + // Primitive values and arrays get stable hashes + // by default. Lets those be stringified as-is. + } else { + return val; + } +}; + +/** + * Compute the union (duplicate-free merge) of a set of arrays. + * + * Arrays values must be convertable to object keys (strings). + * + * By building an object (with the values for keys) in parallel with + * the array, a new item's existence in the union can be computed faster. + * + * @param {Array...} arrays Arrays to union + * @return {Array} Union of the arrays + */ +oo.simpleArrayUnion = function () { + var i, ilen, arr, j, jlen, + obj = {}, + result = []; + + for ( i = 0, ilen = arguments.length; i < ilen; i++ ) { + arr = arguments[i]; + for ( j = 0, jlen = arr.length; j < jlen; j++ ) { + if ( !obj[ arr[j] ] ) { + obj[ arr[j] ] = true; + result.push( arr[j] ); + } + } + } + + return result; +}; + +/** + * Combine arrays (intersection or difference). + * + * An intersection checks the item exists in 'b' while difference checks it doesn't. + * + * Arrays values must be convertable to object keys (strings). + * + * By building an object (with the values for keys) of 'b' we can + * compute the result faster. + * + * @private + * @param {Array} a First array + * @param {Array} b Second array + * @param {boolean} includeB Whether to items in 'b' + * @return {Array} Combination (intersection or difference) of arrays + */ +function simpleArrayCombine( a, b, includeB ) { + var i, ilen, isInB, + bObj = {}, + result = []; + + for ( i = 0, ilen = b.length; i < ilen; i++ ) { + bObj[ b[i] ] = true; + } + + for ( i = 0, ilen = a.length; i < ilen; i++ ) { + isInB = !!bObj[ a[i] ]; + if ( isInB === includeB ) { + result.push( a[i] ); + } + } + + return result; +} + +/** + * Compute the intersection of two arrays (items in both arrays). + * + * Arrays values must be convertable to object keys (strings). + * + * @param {Array} a First array + * @param {Array} b Second array + * @return {Array} Intersection of arrays + */ +oo.simpleArrayIntersection = function ( a, b ) { + return simpleArrayCombine( a, b, true ); +}; + +/** + * Compute the difference of two arrays (items in 'a' but not 'b'). + * + * Arrays values must be convertable to object keys (strings). + * + * @param {Array} a First array + * @param {Array} b Second array + * @return {Array} Intersection of arrays + */ +oo.simpleArrayDifference = function ( a, b ) { + return simpleArrayCombine( a, b, false ); +}; +/** + * @class OO.EventEmitter + * + * @constructor + */ +oo.EventEmitter = function OoEventEmitter() { + // Properties + + /** + * Storage of bound event handlers by event name. + * + * @property + */ + this.bindings = {}; +}; + +/* Methods */ + +/** + * Add a listener to events of a specific event. + * + * If the callback/context are already bound to the event, they will not be bound again. + * + * @param {string} event Type of event to listen to + * @param {Function} callback Function to call when event occurs + * @param {Array} [args] Arguments to pass to listener, will be prepended to emitted arguments + * @param {Object} [context=null] Object to use as context for callback function or call method on + * @throws {Error} Listener argument is not a function or method name + * @chainable + */ +oo.EventEmitter.prototype.on = function ( event, callback, args, context ) { + var i, bindings, binding; + + // Validate callback + if ( typeof callback !== 'function' ) { + throw new Error( 'Invalid callback. Function or method name expected.' ); + } + // Fallback to null context + if ( arguments.length < 4 ) { + context = null; + } + if ( this.bindings.hasOwnProperty( event ) ) { + // Check for duplicate callback and context for this event + bindings = this.bindings[event]; + i = bindings.length; + while ( i-- ) { + binding = bindings[i]; + if ( bindings.callback === callback && bindings.context === context ) { + return this; + } + } + } else { + // Auto-initialize bindings list + bindings = this.bindings[event] = []; + } + // Add binding + bindings.push( { + callback: callback, + args: args, + context: context + } ); + return this; +}; + +/** + * Adds a one-time listener to a specific event. + * + * @param {string} event Type of event to listen to + * @param {Function} listener Listener to call when event occurs + * @chainable + */ +oo.EventEmitter.prototype.once = function ( event, listener ) { + var eventEmitter = this; + return this.on( event, function listenerWrapper() { + eventEmitter.off( event, listenerWrapper ); + listener.apply( eventEmitter, Array.prototype.slice.call( arguments, 0 ) ); + } ); +}; + +/** + * Remove a specific listener from a specific event. + * + * @param {string} event Type of event to remove listener from + * @param {Function} [callback] Listener to remove, omit to remove all + * @param {Object} [context=null] Object used context for callback function or method + * @chainable + * @throws {Error} Listener argument is not a function + */ +oo.EventEmitter.prototype.off = function ( event, callback, context ) { + var i, bindings; + + if ( arguments.length === 1 ) { + // Remove all bindings for event + if ( event in this.bindings ) { + delete this.bindings[event]; + } + } else { + if ( typeof callback !== 'function' ) { + throw new Error( 'Invalid callback. Function expected.' ); + } + if ( !( event in this.bindings ) || !this.bindings[event].length ) { + // No matching bindings + return this; + } + // Fallback to null context + if ( arguments.length < 3 ) { + context = null; + } + // Remove matching handlers + bindings = this.bindings[event]; + i = bindings.length; + while ( i-- ) { + if ( bindings[i].callback === callback && bindings[i].context === context ) { + bindings.splice( i, 1 ); + } + } + // Cleanup if now empty + if ( bindings.length === 0 ) { + delete this.bindings[event]; + } + } + return this; +}; + +/** + * Emit an event. + * + * TODO: Should this be chainable? What is the usefulness of the boolean + * return value here? + * + * @param {string} event Type of event + * @param {Mixed} args First in a list of variadic arguments passed to event handler (optional) + * @return {boolean} If event was handled by at least one listener + */ +oo.EventEmitter.prototype.emit = function ( event ) { + var i, len, binding, bindings, args; + + if ( event in this.bindings ) { + // Slicing ensures that we don't get tripped up by event handlers that add/remove bindings + bindings = this.bindings[event].slice(); + args = Array.prototype.slice.call( arguments, 1 ); + for ( i = 0, len = bindings.length; i < len; i++ ) { + binding = bindings[i]; + binding.callback.apply( + binding.context, + binding.args ? binding.args.concat( args ) : args + ); + } + return true; + } + return false; +}; + +/** + * Connect event handlers to an object. + * + * @param {Object} context Object to call methods on when events occur + * @param {Object.<string,string>|Object.<string,Function>|Object.<string,Array>} methods List of + * event bindings keyed by event name containing either method names, functions or arrays containing + * method name or function followed by a list of arguments to be passed to callback before emitted + * arguments + * @chainable + */ +oo.EventEmitter.prototype.connect = function ( context, methods ) { + var method, callback, args, event; + + for ( event in methods ) { + method = methods[event]; + // Allow providing additional args + if ( Array.isArray( method ) ) { + args = method.slice( 1 ); + method = method[0]; + } else { + args = []; + } + // Allow callback to be a method name + if ( typeof method === 'string' ) { + // Validate method + if ( !context[method] || typeof context[method] !== 'function' ) { + throw new Error( 'Method not found: ' + method ); + } + // Resolve to function + callback = context[method]; + } else { + callback = method; + } + // Add binding + this.on.apply( this, [ event, callback, args, context ] ); + } + return this; +}; + +/** + * Disconnect event handlers from an object. + * + * @param {Object} context Object to disconnect methods from + * @param {Object.<string,string>|Object.<string,Function>|Object.<string,Array>} [methods] List of + * event bindings keyed by event name containing either method names or functions + * @chainable + */ +oo.EventEmitter.prototype.disconnect = function ( context, methods ) { + var i, method, callback, event, bindings; + + if ( methods ) { + // Remove specific connections to the context + for ( event in methods ) { + method = methods[event]; + if ( typeof method === 'string' ) { + // Validate method + if ( !context[method] || typeof context[method] !== 'function' ) { + throw new Error( 'Method not found: ' + method ); + } + // Resolve to function + callback = context[method]; + } else { + callback = method; + } + this.off( event, callback, context ); + } + } else { + // Remove all connections to the context + for ( event in this.bindings ) { + bindings = this.bindings[event]; + i = bindings.length; + while ( i-- ) { + if ( bindings[i].context === context ) { + this.off( event, bindings[i].callback, context ); + } + } + } + } + + return this; +}; +/** + * @class OO.Registry + * @mixins OO.EventEmitter + * + * @constructor + */ +oo.Registry = function OoRegistry() { + // Mixin constructors + oo.EventEmitter.call( this ); + + // Properties + this.registry = {}; +}; + +/* Inheritance */ + +oo.mixinClass( oo.Registry, oo.EventEmitter ); + +/* Events */ + +/** + * @event register + * @param {string} name + * @param {Mixed} data + */ + +/* Methods */ + +/** + * Associate one or more symbolic names with some data. + * + * Only the base name will be registered, overriding any existing entry with the same base name. + * + * @param {string|string[]} name Symbolic name or list of symbolic names + * @param {Mixed} data Data to associate with symbolic name + * @fires register + * @throws {Error} Name argument must be a string or array + */ +oo.Registry.prototype.register = function ( name, data ) { + var i, len; + if ( typeof name === 'string' ) { + this.registry[name] = data; + this.emit( 'register', name, data ); + } else if ( Array.isArray( name ) ) { + for ( i = 0, len = name.length; i < len; i++ ) { + this.register( name[i], data ); + } + } else { + throw new Error( 'Name must be a string or array, cannot be a ' + typeof name ); + } +}; + +/** + * Get data for a given symbolic name. + * + * Lookups are done using the base name. + * + * @param {string} name Symbolic name + * @return {Mixed|undefined} Data associated with symbolic name + */ +oo.Registry.prototype.lookup = function ( name ) { + return this.registry[name]; +}; +/** + * @class OO.Factory + * @extends OO.Registry + * + * @constructor + */ +oo.Factory = function OoFactory() { + oo.Factory.super.call( this ); + + // Properties + this.entries = []; +}; + +/* Inheritance */ + +oo.inheritClass( oo.Factory, oo.Registry ); + +/* Methods */ + +/** + * Register a constructor with the factory. + * + * Classes must have a static `name` property to be registered. + * + * function MyClass() {}; + * OO.initClass( MyClass ); + * // Adds a static property to the class defining a symbolic name + * MyClass.static.name = 'mine'; + * // Registers class with factory, available via symbolic name 'mine' + * factory.register( MyClass ); + * + * @param {Function} constructor Constructor to use when creating object + * @throws {Error} Name must be a string and must not be empty + * @throws {Error} Constructor must be a function + */ +oo.Factory.prototype.register = function ( constructor ) { + var name; + + if ( typeof constructor !== 'function' ) { + throw new Error( 'constructor must be a function, cannot be a ' + typeof constructor ); + } + name = constructor.static && constructor.static.name; + if ( typeof name !== 'string' || name === '' ) { + throw new Error( 'Name must be a string and must not be empty' ); + } + this.entries.push( name ); + + oo.Factory.super.prototype.register.call( this, name, constructor ); +}; + +/** + * Create an object based on a name. + * + * Name is used to look up the constructor to use, while all additional arguments are passed to the + * constructor directly, so leaving one out will pass an undefined to the constructor. + * + * @param {string} name Object name + * @param {Mixed...} [args] Arguments to pass to the constructor + * @return {Object} The new object + * @throws {Error} Unknown object name + */ +oo.Factory.prototype.create = function ( name ) { + var args, obj, constructor; + + if ( !this.registry.hasOwnProperty( name ) ) { + throw new Error( 'No class registered by that name: ' + name ); + } + constructor = this.registry[name]; + + // Convert arguments to array and shift the first argument (name) off + args = Array.prototype.slice.call( arguments, 1 ); + + // We can't use the "new" operator with .apply directly because apply needs a + // context. So instead just do what "new" does: create an object that inherits from + // the constructor's prototype (which also makes it an "instanceof" the constructor), + // then invoke the constructor with the object as context, and return it (ignoring + // the constructor's return value). + obj = Object.create( constructor.prototype ); + constructor.apply( obj, args ); + return obj; +}; +/*jshint node:true */ +if ( typeof module !== 'undefined' && module.exports ) { + module.exports = oo; +} else { + global.OO = oo; +} +}( this ) ); diff --git a/resources/lib/oojs/update-oojs.sh b/resources/lib/oojs/update-oojs.sh new file mode 100755 index 000000000000..57c762588237 --- /dev/null +++ b/resources/lib/oojs/update-oojs.sh @@ -0,0 +1,99 @@ +#!/usr/bin/env bash + +# FIXME this script is duplicated from update-oojs-ui.sh - factor this out + +# This script generates a commit that updates the oojs distribution +# ./bin/update-oojs.sh path/to/repo/for/oojs + +function oojshash() { + grep "OOjs v" resources/oojs/oojs.js \ + | head -n 1 \ + | grep -Eo '\([a-z0-9]+\)' \ + | sed 's/^(//' \ + | sed 's/)$//' +} + +function oojstag() { + grep "OOjs v" resources/oojs/oojs.js \ + | head -n 1 \ + | grep -Eo '\bv[0-9a-z.-]+\b' +} + +function oojsversion() { + grep "OOjs v" resources/oojs/oojs.js \ + | head -n 1 \ + | grep -Eo '\bv[0-9a-z.-]+\b.*$' +} + +# cd to the MW directory +cd $(cd $(dirname $0)/../..; pwd) + +if [ "x$1" == "x" ] +then + echo >&2 "Usage: update-oojs.sh path/to/repo/for/oojs" + exit 1 +fi + +# Undo any changes in the oojs directory +git reset resources/oojs/ +git checkout resources/oojs/ + +git fetch origin +# Create a branch of MW if needed, and reset it to master +git checkout -B update-oojs origin/master + +# Get the old oojs version +OLDVERSION=$(oojshash) +if [ "x$OLDVERSION" == "x" ] +then + TAG=$(oojstag) +fi + +# cd to the oojs directory +cd $1 || exit 1 +if [ "x$OLDVERSION" == "x" ] +then + # Try the tag + OLDVERSION=$(git rev-parse $TAG) + if [ $? != 0 ] + then + echo Could not find OOjs version + cd - + exit 1 + fi +fi +if [ "$(git rev-parse $OLDVERSION)" == "$(git rev-parse HEAD)" ] +then + echo "No changes (already at $OLDVERSION)" + cd - + exit 0 +fi +# Build the distribution +npm install || exit 1 +grunt || exit 1 +# Get the list of changes +NEWCHANGES=$(git log $OLDVERSION.. --oneline --no-merges --reverse --color=never) +NEWCHANGESDISPLAY=$(git log $OLDVERSION.. --oneline --no-merges --reverse --color=always) +# cd back to the VisualEditor directory +cd - + +# Copy files from dist/ to resources/oojs/ +cp -a $1/dist/* resources/oojs/ +# Figure out what the new version is +NEWVERSION=$(oojsversion) +# Generate commit summary +COMMITMSG=$(cat <<END +Update OOjs to $NEWVERSION + +New changes: +$NEWCHANGES +END +) +# Commit +git commit resources/oojs/ -m "$COMMITMSG" +cat >&2 <<END + + +Created commit with changes: +$NEWCHANGESDISPLAY +END diff --git a/resources/lib/sinonjs/sinon-1.9.0.js b/resources/lib/sinonjs/sinon-1.9.0.js new file mode 100644 index 000000000000..428b729b649b --- /dev/null +++ b/resources/lib/sinonjs/sinon-1.9.0.js @@ -0,0 +1,4794 @@ +/** + * Sinon.JS 1.9.0, 2014/03/05 + * + * @author Christian Johansen (christian@cjohansen.no) + * @author Contributors: https://github.com/cjohansen/Sinon.JS/blob/master/AUTHORS + * + * (The BSD License) + * + * Copyright (c) 2010-2014, Christian Johansen, christian@cjohansen.no + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * * Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * * Neither the name of Christian Johansen nor the names of his contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + * WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE + * DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR + * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER + * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, + * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +this.sinon = (function () { +var samsam, formatio; +function define(mod, deps, fn) { if (mod == "samsam") { samsam = deps(); } else { formatio = fn(samsam); } } +define.amd = true; +((typeof define === "function" && define.amd && function (m) { define("samsam", m); }) || + (typeof module === "object" && + function (m) { module.exports = m(); }) || // Node + function (m) { this.samsam = m(); } // Browser globals +)(function () { + var o = Object.prototype; + var div = typeof document !== "undefined" && document.createElement("div"); + + function isNaN(value) { + // Unlike global isNaN, this avoids type coercion + // typeof check avoids IE host object issues, hat tip to + // lodash + var val = value; // JsLint thinks value !== value is "weird" + return typeof value === "number" && value !== val; + } + + function getClass(value) { + // Returns the internal [[Class]] by calling Object.prototype.toString + // with the provided value as this. Return value is a string, naming the + // internal class, e.g. "Array" + return o.toString.call(value).split(/[ \]]/)[1]; + } + + /** + * @name samsam.isArguments + * @param Object object + * + * Returns ``true`` if ``object`` is an ``arguments`` object, + * ``false`` otherwise. + */ + function isArguments(object) { + if (typeof object !== "object" || typeof object.length !== "number" || + getClass(object) === "Array") { + return false; + } + if (typeof object.callee == "function") { return true; } + try { + object[object.length] = 6; + delete object[object.length]; + } catch (e) { + return true; + } + return false; + } + + /** + * @name samsam.isElement + * @param Object object + * + * Returns ``true`` if ``object`` is a DOM element node. Unlike + * Underscore.js/lodash, this function will return ``false`` if ``object`` + * is an *element-like* object, i.e. a regular object with a ``nodeType`` + * property that holds the value ``1``. + */ + function isElement(object) { + if (!object || object.nodeType !== 1 || !div) { return false; } + try { + object.appendChild(div); + object.removeChild(div); + } catch (e) { + return false; + } + return true; + } + + /** + * @name samsam.keys + * @param Object object + * + * Return an array of own property names. + */ + function keys(object) { + var ks = [], prop; + for (prop in object) { + if (o.hasOwnProperty.call(object, prop)) { ks.push(prop); } + } + return ks; + } + + /** + * @name samsam.isDate + * @param Object value + * + * Returns true if the object is a ``Date``, or *date-like*. Duck typing + * of date objects work by checking that the object has a ``getTime`` + * function whose return value equals the return value from the object's + * ``valueOf``. + */ + function isDate(value) { + return typeof value.getTime == "function" && + value.getTime() == value.valueOf(); + } + + /** + * @name samsam.isNegZero + * @param Object value + * + * Returns ``true`` if ``value`` is ``-0``. + */ + function isNegZero(value) { + return value === 0 && 1 / value === -Infinity; + } + + /** + * @name samsam.equal + * @param Object obj1 + * @param Object obj2 + * + * Returns ``true`` if two objects are strictly equal. Compared to + * ``===`` there are two exceptions: + * + * - NaN is considered equal to NaN + * - -0 and +0 are not considered equal + */ + function identical(obj1, obj2) { + if (obj1 === obj2 || (isNaN(obj1) && isNaN(obj2))) { + return obj1 !== 0 || isNegZero(obj1) === isNegZero(obj2); + } + } + + + /** + * @name samsam.deepEqual + * @param Object obj1 + * @param Object obj2 + * + * Deep equal comparison. Two values are "deep equal" if: + * + * - They are equal, according to samsam.identical + * - They are both date objects representing the same time + * - They are both arrays containing elements that are all deepEqual + * - They are objects with the same set of properties, and each property + * in ``obj1`` is deepEqual to the corresponding property in ``obj2`` + * + * Supports cyclic objects. + */ + function deepEqualCyclic(obj1, obj2) { + + // used for cyclic comparison + // contain already visited objects + var objects1 = [], + objects2 = [], + // contain pathes (position in the object structure) + // of the already visited objects + // indexes same as in objects arrays + paths1 = [], + paths2 = [], + // contains combinations of already compared objects + // in the manner: { "$1['ref']$2['ref']": true } + compared = {}; + + /** + * used to check, if the value of a property is an object + * (cyclic logic is only needed for objects) + * only needed for cyclic logic + */ + function isObject(value) { + + if (typeof value === 'object' && value !== null && + !(value instanceof Boolean) && + !(value instanceof Date) && + !(value instanceof Number) && + !(value instanceof RegExp) && + !(value instanceof String)) { + + return true; + } + + return false; + } + + /** + * returns the index of the given object in the + * given objects array, -1 if not contained + * only needed for cyclic logic + */ + function getIndex(objects, obj) { + + var i; + for (i = 0; i < objects.length; i++) { + if (objects[i] === obj) { + return i; + } + } + + return -1; + } + + // does the recursion for the deep equal check + return (function deepEqual(obj1, obj2, path1, path2) { + var type1 = typeof obj1; + var type2 = typeof obj2; + + // == null also matches undefined + if (obj1 === obj2 || + isNaN(obj1) || isNaN(obj2) || + obj1 == null || obj2 == null || + type1 !== "object" || type2 !== "object") { + + return identical(obj1, obj2); + } + + // Elements are only equal if identical(expected, actual) + if (isElement(obj1) || isElement(obj2)) { return false; } + + var isDate1 = isDate(obj1), isDate2 = isDate(obj2); + if (isDate1 || isDate2) { + if (!isDate1 || !isDate2 || obj1.getTime() !== obj2.getTime()) { + return false; + } + } + + if (obj1 instanceof RegExp && obj2 instanceof RegExp) { + if (obj1.toString() !== obj2.toString()) { return false; } + } + + var class1 = getClass(obj1); + var class2 = getClass(obj2); + var keys1 = keys(obj1); + var keys2 = keys(obj2); + + if (isArguments(obj1) || isArguments(obj2)) { + if (obj1.length !== obj2.length) { return false; } + } else { + if (type1 !== type2 || class1 !== class2 || + keys1.length !== keys2.length) { + return false; + } + } + + var key, i, l, + // following vars are used for the cyclic logic + value1, value2, + isObject1, isObject2, + index1, index2, + newPath1, newPath2; + + for (i = 0, l = keys1.length; i < l; i++) { + key = keys1[i]; + if (!o.hasOwnProperty.call(obj2, key)) { + return false; + } + + // Start of the cyclic logic + + value1 = obj1[key]; + value2 = obj2[key]; + + isObject1 = isObject(value1); + isObject2 = isObject(value2); + + // determine, if the objects were already visited + // (it's faster to check for isObject first, than to + // get -1 from getIndex for non objects) + index1 = isObject1 ? getIndex(objects1, value1) : -1; + index2 = isObject2 ? getIndex(objects2, value2) : -1; + + // determine the new pathes of the objects + // - for non cyclic objects the current path will be extended + // by current property name + // - for cyclic objects the stored path is taken + newPath1 = index1 !== -1 + ? paths1[index1] + : path1 + '[' + JSON.stringify(key) + ']'; + newPath2 = index2 !== -1 + ? paths2[index2] + : path2 + '[' + JSON.stringify(key) + ']'; + + // stop recursion if current objects are already compared + if (compared[newPath1 + newPath2]) { + return true; + } + + // remember the current objects and their pathes + if (index1 === -1 && isObject1) { + objects1.push(value1); + paths1.push(newPath1); + } + if (index2 === -1 && isObject2) { + objects2.push(value2); + paths2.push(newPath2); + } + + // remember that the current objects are already compared + if (isObject1 && isObject2) { + compared[newPath1 + newPath2] = true; + } + + // End of cyclic logic + + // neither value1 nor value2 is a cycle + // continue with next level + if (!deepEqual(value1, value2, newPath1, newPath2)) { + return false; + } + } + + return true; + + }(obj1, obj2, '$1', '$2')); + } + + var match; + + function arrayContains(array, subset) { + if (subset.length === 0) { return true; } + var i, l, j, k; + for (i = 0, l = array.length; i < l; ++i) { + if (match(array[i], subset[0])) { + for (j = 0, k = subset.length; j < k; ++j) { + if (!match(array[i + j], subset[j])) { return false; } + } + return true; + } + } + return false; + } + + /** + * @name samsam.match + * @param Object object + * @param Object matcher + * + * Compare arbitrary value ``object`` with matcher. + */ + match = function match(object, matcher) { + if (matcher && typeof matcher.test === "function") { + return matcher.test(object); + } + + if (typeof matcher === "function") { + return matcher(object) === true; + } + + if (typeof matcher === "string") { + matcher = matcher.toLowerCase(); + var notNull = typeof object === "string" || !!object; + return notNull && + (String(object)).toLowerCase().indexOf(matcher) >= 0; + } + + if (typeof matcher === "number") { + return matcher === object; + } + + if (typeof matcher === "boolean") { + return matcher === object; + } + + if (getClass(object) === "Array" && getClass(matcher) === "Array") { + return arrayContains(object, matcher); + } + + if (matcher && typeof matcher === "object") { + var prop; + for (prop in matcher) { + if (!match(object[prop], matcher[prop])) { + return false; + } + } + return true; + } + + throw new Error("Matcher was not a string, a number, a " + + "function, a boolean or an object"); + }; + + return { + isArguments: isArguments, + isElement: isElement, + isDate: isDate, + isNegZero: isNegZero, + identical: identical, + deepEqual: deepEqualCyclic, + match: match, + keys: keys + }; +}); +((typeof define === "function" && define.amd && function (m) { + define("formatio", ["samsam"], m); +}) || (typeof module === "object" && function (m) { + module.exports = m(require("samsam")); +}) || function (m) { this.formatio = m(this.samsam); } +)(function (samsam) { + + var formatio = { + excludeConstructors: ["Object", /^.$/], + quoteStrings: true + }; + + var hasOwn = Object.prototype.hasOwnProperty; + + var specialObjects = []; + if (typeof global !== "undefined") { + specialObjects.push({ object: global, value: "[object global]" }); + } + if (typeof document !== "undefined") { + specialObjects.push({ + object: document, + value: "[object HTMLDocument]" + }); + } + if (typeof window !== "undefined") { + specialObjects.push({ object: window, value: "[object Window]" }); + } + + function functionName(func) { + if (!func) { return ""; } + if (func.displayName) { return func.displayName; } + if (func.name) { return func.name; } + var matches = func.toString().match(/function\s+([^\(]+)/m); + return (matches && matches[1]) || ""; + } + + function constructorName(f, object) { + var name = functionName(object && object.constructor); + var excludes = f.excludeConstructors || + formatio.excludeConstructors || []; + + var i, l; + for (i = 0, l = excludes.length; i < l; ++i) { + if (typeof excludes[i] === "string" && excludes[i] === name) { + return ""; + } else if (excludes[i].test && excludes[i].test(name)) { + return ""; + } + } + + return name; + } + + function isCircular(object, objects) { + if (typeof object !== "object") { return false; } + var i, l; + for (i = 0, l = objects.length; i < l; ++i) { + if (objects[i] === object) { return true; } + } + return false; + } + + function ascii(f, object, processed, indent) { + if (typeof object === "string") { + var qs = f.quoteStrings; + var quote = typeof qs !== "boolean" || qs; + return processed || quote ? '"' + object + '"' : object; + } + + if (typeof object === "function" && !(object instanceof RegExp)) { + return ascii.func(object); + } + + processed = processed || []; + + if (isCircular(object, processed)) { return "[Circular]"; } + + if (Object.prototype.toString.call(object) === "[object Array]") { + return ascii.array.call(f, object, processed); + } + + if (!object) { return String((1/object) === -Infinity ? "-0" : object); } + if (samsam.isElement(object)) { return ascii.element(object); } + + if (typeof object.toString === "function" && + object.toString !== Object.prototype.toString) { + return object.toString(); + } + + var i, l; + for (i = 0, l = specialObjects.length; i < l; i++) { + if (object === specialObjects[i].object) { + return specialObjects[i].value; + } + } + + return ascii.object.call(f, object, processed, indent); + } + + ascii.func = function (func) { + return "function " + functionName(func) + "() {}"; + }; + + ascii.array = function (array, processed) { + processed = processed || []; + processed.push(array); + var i, l, pieces = []; + for (i = 0, l = array.length; i < l; ++i) { + pieces.push(ascii(this, array[i], processed)); + } + return "[" + pieces.join(", ") + "]"; + }; + + ascii.object = function (object, processed, indent) { + processed = processed || []; + processed.push(object); + indent = indent || 0; + var pieces = [], properties = samsam.keys(object).sort(); + var length = 3; + var prop, str, obj, i, l; + + for (i = 0, l = properties.length; i < l; ++i) { + prop = properties[i]; + obj = object[prop]; + + if (isCircular(obj, processed)) { + str = "[Circular]"; + } else { + str = ascii(this, obj, processed, indent + 2); + } + + str = (/\s/.test(prop) ? '"' + prop + '"' : prop) + ": " + str; + length += str.length; + pieces.push(str); + } + + var cons = constructorName(this, object); + var prefix = cons ? "[" + cons + "] " : ""; + var is = ""; + for (i = 0, l = indent; i < l; ++i) { is += " "; } + + if (length + indent > 80) { + return prefix + "{\n " + is + pieces.join(",\n " + is) + "\n" + + is + "}"; + } + return prefix + "{ " + pieces.join(", ") + " }"; + }; + + ascii.element = function (element) { + var tagName = element.tagName.toLowerCase(); + var attrs = element.attributes, attr, pairs = [], attrName, i, l, val; + + for (i = 0, l = attrs.length; i < l; ++i) { + attr = attrs.item(i); + attrName = attr.nodeName.toLowerCase().replace("html:", ""); + val = attr.nodeValue; + if (attrName !== "contenteditable" || val !== "inherit") { + if (!!val) { pairs.push(attrName + "=\"" + val + "\""); } + } + } + + var formatted = "<" + tagName + (pairs.length > 0 ? " " : ""); + var content = element.innerHTML; + + if (content.length > 20) { + content = content.substr(0, 20) + "[...]"; + } + + var res = formatted + pairs.join(" ") + ">" + content + + "</" + tagName + ">"; + + return res.replace(/ contentEditable="inherit"/, ""); + }; + + function Formatio(options) { + for (var opt in options) { + this[opt] = options[opt]; + } + } + + Formatio.prototype = { + functionName: functionName, + + configure: function (options) { + return new Formatio(options); + }, + + constructorName: function (object) { + return constructorName(this, object); + }, + + ascii: function (object, processed, indent) { + return ascii(this, object, processed, indent); + } + }; + + return Formatio.prototype; +}); +/*jslint eqeqeq: false, onevar: false, forin: true, nomen: false, regexp: false, plusplus: false*/ +/*global module, require, __dirname, document*/ +/** + * Sinon core utilities. For internal use only. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +var sinon = (function (formatio) { + var div = typeof document != "undefined" && document.createElement("div"); + var hasOwn = Object.prototype.hasOwnProperty; + + function isDOMNode(obj) { + var success = false; + + try { + obj.appendChild(div); + success = div.parentNode == obj; + } catch (e) { + return false; + } finally { + try { + obj.removeChild(div); + } catch (e) { + // Remove failed, not much we can do about that + } + } + + return success; + } + + function isElement(obj) { + return div && obj && obj.nodeType === 1 && isDOMNode(obj); + } + + function isFunction(obj) { + return typeof obj === "function" || !!(obj && obj.constructor && obj.call && obj.apply); + } + + function mirrorProperties(target, source) { + for (var prop in source) { + if (!hasOwn.call(target, prop)) { + target[prop] = source[prop]; + } + } + } + + function isRestorable (obj) { + return typeof obj === "function" && typeof obj.restore === "function" && obj.restore.sinon; + } + + var sinon = { + wrapMethod: function wrapMethod(object, property, method) { + if (!object) { + throw new TypeError("Should wrap property of object"); + } + + if (typeof method != "function") { + throw new TypeError("Method wrapper should be function"); + } + + var wrappedMethod = object[property], + error; + + if (!isFunction(wrappedMethod)) { + error = new TypeError("Attempted to wrap " + (typeof wrappedMethod) + " property " + + property + " as function"); + } + + if (wrappedMethod.restore && wrappedMethod.restore.sinon) { + error = new TypeError("Attempted to wrap " + property + " which is already wrapped"); + } + + if (wrappedMethod.calledBefore) { + var verb = !!wrappedMethod.returns ? "stubbed" : "spied on"; + error = new TypeError("Attempted to wrap " + property + " which is already " + verb); + } + + if (error) { + if (wrappedMethod._stack) { + error.stack += '\n--------------\n' + wrappedMethod._stack; + } + throw error; + } + + // IE 8 does not support hasOwnProperty on the window object and Firefox has a problem + // when using hasOwn.call on objects from other frames. + var owned = object.hasOwnProperty ? object.hasOwnProperty(property) : hasOwn.call(object, property); + object[property] = method; + method.displayName = property; + // Set up a stack trace which can be used later to find what line of + // code the original method was created on. + method._stack = (new Error('Stack Trace for original')).stack; + + method.restore = function () { + // For prototype properties try to reset by delete first. + // If this fails (ex: localStorage on mobile safari) then force a reset + // via direct assignment. + if (!owned) { + delete object[property]; + } + if (object[property] === method) { + object[property] = wrappedMethod; + } + }; + + method.restore.sinon = true; + mirrorProperties(method, wrappedMethod); + + return method; + }, + + extend: function extend(target) { + for (var i = 1, l = arguments.length; i < l; i += 1) { + for (var prop in arguments[i]) { + if (arguments[i].hasOwnProperty(prop)) { + target[prop] = arguments[i][prop]; + } + + // DONT ENUM bug, only care about toString + if (arguments[i].hasOwnProperty("toString") && + arguments[i].toString != target.toString) { + target.toString = arguments[i].toString; + } + } + } + + return target; + }, + + create: function create(proto) { + var F = function () {}; + F.prototype = proto; + return new F(); + }, + + deepEqual: function deepEqual(a, b) { + if (sinon.match && sinon.match.isMatcher(a)) { + return a.test(b); + } + if (typeof a != "object" || typeof b != "object") { + return a === b; + } + + if (isElement(a) || isElement(b)) { + return a === b; + } + + if (a === b) { + return true; + } + + if ((a === null && b !== null) || (a !== null && b === null)) { + return false; + } + + if (a instanceof RegExp && b instanceof RegExp) { + return (a.source === b.source) && (a.global === b.global) && + (a.ignoreCase === b.ignoreCase) && (a.multiline === b.multiline); + } + + var aString = Object.prototype.toString.call(a); + if (aString != Object.prototype.toString.call(b)) { + return false; + } + + if (aString == "[object Date]") { + return a.valueOf() === b.valueOf(); + } + + var prop, aLength = 0, bLength = 0; + + if (aString == "[object Array]" && a.length !== b.length) { + return false; + } + + for (prop in a) { + aLength += 1; + + if (!deepEqual(a[prop], b[prop])) { + return false; + } + } + + for (prop in b) { + bLength += 1; + } + + return aLength == bLength; + }, + + functionName: function functionName(func) { + var name = func.displayName || func.name; + + // Use function decomposition as a last resort to get function + // name. Does not rely on function decomposition to work - if it + // doesn't debugging will be slightly less informative + // (i.e. toString will say 'spy' rather than 'myFunc'). + if (!name) { + var matches = func.toString().match(/function ([^\s\(]+)/); + name = matches && matches[1]; + } + + return name; + }, + + functionToString: function toString() { + if (this.getCall && this.callCount) { + var thisValue, prop, i = this.callCount; + + while (i--) { + thisValue = this.getCall(i).thisValue; + + for (prop in thisValue) { + if (thisValue[prop] === this) { + return prop; + } + } + } + } + + return this.displayName || "sinon fake"; + }, + + getConfig: function (custom) { + var config = {}; + custom = custom || {}; + var defaults = sinon.defaultConfig; + + for (var prop in defaults) { + if (defaults.hasOwnProperty(prop)) { + config[prop] = custom.hasOwnProperty(prop) ? custom[prop] : defaults[prop]; + } + } + + return config; + }, + + format: function (val) { + return "" + val; + }, + + defaultConfig: { + injectIntoThis: true, + injectInto: null, + properties: ["spy", "stub", "mock", "clock", "server", "requests"], + useFakeTimers: true, + useFakeServer: true + }, + + timesInWords: function timesInWords(count) { + return count == 1 && "once" || + count == 2 && "twice" || + count == 3 && "thrice" || + (count || 0) + " times"; + }, + + calledInOrder: function (spies) { + for (var i = 1, l = spies.length; i < l; i++) { + if (!spies[i - 1].calledBefore(spies[i]) || !spies[i].called) { + return false; + } + } + + return true; + }, + + orderByFirstCall: function (spies) { + return spies.sort(function (a, b) { + // uuid, won't ever be equal + var aCall = a.getCall(0); + var bCall = b.getCall(0); + var aId = aCall && aCall.callId || -1; + var bId = bCall && bCall.callId || -1; + + return aId < bId ? -1 : 1; + }); + }, + + log: function () {}, + + logError: function (label, err) { + var msg = label + " threw exception: "; + sinon.log(msg + "[" + err.name + "] " + err.message); + if (err.stack) { sinon.log(err.stack); } + + setTimeout(function () { + err.message = msg + err.message; + throw err; + }, 0); + }, + + typeOf: function (value) { + if (value === null) { + return "null"; + } + else if (value === undefined) { + return "undefined"; + } + var string = Object.prototype.toString.call(value); + return string.substring(8, string.length - 1).toLowerCase(); + }, + + createStubInstance: function (constructor) { + if (typeof constructor !== "function") { + throw new TypeError("The constructor should be a function."); + } + return sinon.stub(sinon.create(constructor.prototype)); + }, + + restore: function (object) { + if (object !== null && typeof object === "object") { + for (var prop in object) { + if (isRestorable(object[prop])) { + object[prop].restore(); + } + } + } + else if (isRestorable(object)) { + object.restore(); + } + } + }; + + var isNode = typeof module !== "undefined" && module.exports; + var isAMD = typeof define === 'function' && typeof define.amd === 'object' && define.amd; + + if (isAMD) { + define(function(){ + return sinon; + }); + } else if (isNode) { + try { + formatio = require("formatio"); + } catch (e) {} + module.exports = sinon; + module.exports.spy = require("./sinon/spy"); + module.exports.spyCall = require("./sinon/call"); + module.exports.behavior = require("./sinon/behavior"); + module.exports.stub = require("./sinon/stub"); + module.exports.mock = require("./sinon/mock"); + module.exports.collection = require("./sinon/collection"); + module.exports.assert = require("./sinon/assert"); + module.exports.sandbox = require("./sinon/sandbox"); + module.exports.test = require("./sinon/test"); + module.exports.testCase = require("./sinon/test_case"); + module.exports.assert = require("./sinon/assert"); + module.exports.match = require("./sinon/match"); + } + + if (formatio) { + var formatter = formatio.configure({ quoteStrings: false }); + sinon.format = function () { + return formatter.ascii.apply(formatter, arguments); + }; + } else if (isNode) { + try { + var util = require("util"); + sinon.format = function (value) { + return typeof value == "object" && value.toString === Object.prototype.toString ? util.inspect(value) : value; + }; + } catch (e) { + /* Node, but no util module - would be very old, but better safe than + sorry */ + } + } + + return sinon; +}(typeof formatio == "object" && formatio)); + +/* @depend ../sinon.js */ +/*jslint eqeqeq: false, onevar: false, plusplus: false*/ +/*global module, require, sinon*/ +/** + * Match functions + * + * @author Maximilian Antoni (mail@maxantoni.de) + * @license BSD + * + * Copyright (c) 2012 Maximilian Antoni + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + function assertType(value, type, name) { + var actual = sinon.typeOf(value); + if (actual !== type) { + throw new TypeError("Expected type of " + name + " to be " + + type + ", but was " + actual); + } + } + + var matcher = { + toString: function () { + return this.message; + } + }; + + function isMatcher(object) { + return matcher.isPrototypeOf(object); + } + + function matchObject(expectation, actual) { + if (actual === null || actual === undefined) { + return false; + } + for (var key in expectation) { + if (expectation.hasOwnProperty(key)) { + var exp = expectation[key]; + var act = actual[key]; + if (match.isMatcher(exp)) { + if (!exp.test(act)) { + return false; + } + } else if (sinon.typeOf(exp) === "object") { + if (!matchObject(exp, act)) { + return false; + } + } else if (!sinon.deepEqual(exp, act)) { + return false; + } + } + } + return true; + } + + matcher.or = function (m2) { + if (!arguments.length) { + throw new TypeError("Matcher expected"); + } else if (!isMatcher(m2)) { + m2 = match(m2); + } + var m1 = this; + var or = sinon.create(matcher); + or.test = function (actual) { + return m1.test(actual) || m2.test(actual); + }; + or.message = m1.message + ".or(" + m2.message + ")"; + return or; + }; + + matcher.and = function (m2) { + if (!arguments.length) { + throw new TypeError("Matcher expected"); + } else if (!isMatcher(m2)) { + m2 = match(m2); + } + var m1 = this; + var and = sinon.create(matcher); + and.test = function (actual) { + return m1.test(actual) && m2.test(actual); + }; + and.message = m1.message + ".and(" + m2.message + ")"; + return and; + }; + + var match = function (expectation, message) { + var m = sinon.create(matcher); + var type = sinon.typeOf(expectation); + switch (type) { + case "object": + if (typeof expectation.test === "function") { + m.test = function (actual) { + return expectation.test(actual) === true; + }; + m.message = "match(" + sinon.functionName(expectation.test) + ")"; + return m; + } + var str = []; + for (var key in expectation) { + if (expectation.hasOwnProperty(key)) { + str.push(key + ": " + expectation[key]); + } + } + m.test = function (actual) { + return matchObject(expectation, actual); + }; + m.message = "match(" + str.join(", ") + ")"; + break; + case "number": + m.test = function (actual) { + return expectation == actual; + }; + break; + case "string": + m.test = function (actual) { + if (typeof actual !== "string") { + return false; + } + return actual.indexOf(expectation) !== -1; + }; + m.message = "match(\"" + expectation + "\")"; + break; + case "regexp": + m.test = function (actual) { + if (typeof actual !== "string") { + return false; + } + return expectation.test(actual); + }; + break; + case "function": + m.test = expectation; + if (message) { + m.message = message; + } else { + m.message = "match(" + sinon.functionName(expectation) + ")"; + } + break; + default: + m.test = function (actual) { + return sinon.deepEqual(expectation, actual); + }; + } + if (!m.message) { + m.message = "match(" + expectation + ")"; + } + return m; + }; + + match.isMatcher = isMatcher; + + match.any = match(function () { + return true; + }, "any"); + + match.defined = match(function (actual) { + return actual !== null && actual !== undefined; + }, "defined"); + + match.truthy = match(function (actual) { + return !!actual; + }, "truthy"); + + match.falsy = match(function (actual) { + return !actual; + }, "falsy"); + + match.same = function (expectation) { + return match(function (actual) { + return expectation === actual; + }, "same(" + expectation + ")"); + }; + + match.typeOf = function (type) { + assertType(type, "string", "type"); + return match(function (actual) { + return sinon.typeOf(actual) === type; + }, "typeOf(\"" + type + "\")"); + }; + + match.instanceOf = function (type) { + assertType(type, "function", "type"); + return match(function (actual) { + return actual instanceof type; + }, "instanceOf(" + sinon.functionName(type) + ")"); + }; + + function createPropertyMatcher(propertyTest, messagePrefix) { + return function (property, value) { + assertType(property, "string", "property"); + var onlyProperty = arguments.length === 1; + var message = messagePrefix + "(\"" + property + "\""; + if (!onlyProperty) { + message += ", " + value; + } + message += ")"; + return match(function (actual) { + if (actual === undefined || actual === null || + !propertyTest(actual, property)) { + return false; + } + return onlyProperty || sinon.deepEqual(value, actual[property]); + }, message); + }; + } + + match.has = createPropertyMatcher(function (actual, property) { + if (typeof actual === "object") { + return property in actual; + } + return actual[property] !== undefined; + }, "has"); + + match.hasOwn = createPropertyMatcher(function (actual, property) { + return actual.hasOwnProperty(property); + }, "hasOwn"); + + match.bool = match.typeOf("boolean"); + match.number = match.typeOf("number"); + match.string = match.typeOf("string"); + match.object = match.typeOf("object"); + match.func = match.typeOf("function"); + match.array = match.typeOf("array"); + match.regexp = match.typeOf("regexp"); + match.date = match.typeOf("date"); + + if (commonJSModule) { + module.exports = match; + } else { + sinon.match = match; + } +}(typeof sinon == "object" && sinon || null)); + +/** + * @depend ../sinon.js + * @depend match.js + */ +/*jslint eqeqeq: false, onevar: false, plusplus: false*/ +/*global module, require, sinon*/ +/** + * Spy calls + * + * @author Christian Johansen (christian@cjohansen.no) + * @author Maximilian Antoni (mail@maxantoni.de) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + * Copyright (c) 2013 Maximilian Antoni + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + function throwYieldError(proxy, text, args) { + var msg = sinon.functionName(proxy) + text; + if (args.length) { + msg += " Received [" + slice.call(args).join(", ") + "]"; + } + throw new Error(msg); + } + + var slice = Array.prototype.slice; + + var callProto = { + calledOn: function calledOn(thisValue) { + if (sinon.match && sinon.match.isMatcher(thisValue)) { + return thisValue.test(this.thisValue); + } + return this.thisValue === thisValue; + }, + + calledWith: function calledWith() { + for (var i = 0, l = arguments.length; i < l; i += 1) { + if (!sinon.deepEqual(arguments[i], this.args[i])) { + return false; + } + } + + return true; + }, + + calledWithMatch: function calledWithMatch() { + for (var i = 0, l = arguments.length; i < l; i += 1) { + var actual = this.args[i]; + var expectation = arguments[i]; + if (!sinon.match || !sinon.match(expectation).test(actual)) { + return false; + } + } + return true; + }, + + calledWithExactly: function calledWithExactly() { + return arguments.length == this.args.length && + this.calledWith.apply(this, arguments); + }, + + notCalledWith: function notCalledWith() { + return !this.calledWith.apply(this, arguments); + }, + + notCalledWithMatch: function notCalledWithMatch() { + return !this.calledWithMatch.apply(this, arguments); + }, + + returned: function returned(value) { + return sinon.deepEqual(value, this.returnValue); + }, + + threw: function threw(error) { + if (typeof error === "undefined" || !this.exception) { + return !!this.exception; + } + + return this.exception === error || this.exception.name === error; + }, + + calledWithNew: function calledWithNew() { + return this.proxy.prototype && this.thisValue instanceof this.proxy; + }, + + calledBefore: function (other) { + return this.callId < other.callId; + }, + + calledAfter: function (other) { + return this.callId > other.callId; + }, + + callArg: function (pos) { + this.args[pos](); + }, + + callArgOn: function (pos, thisValue) { + this.args[pos].apply(thisValue); + }, + + callArgWith: function (pos) { + this.callArgOnWith.apply(this, [pos, null].concat(slice.call(arguments, 1))); + }, + + callArgOnWith: function (pos, thisValue) { + var args = slice.call(arguments, 2); + this.args[pos].apply(thisValue, args); + }, + + "yield": function () { + this.yieldOn.apply(this, [null].concat(slice.call(arguments, 0))); + }, + + yieldOn: function (thisValue) { + var args = this.args; + for (var i = 0, l = args.length; i < l; ++i) { + if (typeof args[i] === "function") { + args[i].apply(thisValue, slice.call(arguments, 1)); + return; + } + } + throwYieldError(this.proxy, " cannot yield since no callback was passed.", args); + }, + + yieldTo: function (prop) { + this.yieldToOn.apply(this, [prop, null].concat(slice.call(arguments, 1))); + }, + + yieldToOn: function (prop, thisValue) { + var args = this.args; + for (var i = 0, l = args.length; i < l; ++i) { + if (args[i] && typeof args[i][prop] === "function") { + args[i][prop].apply(thisValue, slice.call(arguments, 2)); + return; + } + } + throwYieldError(this.proxy, " cannot yield to '" + prop + + "' since no callback was passed.", args); + }, + + toString: function () { + var callStr = this.proxy.toString() + "("; + var args = []; + + for (var i = 0, l = this.args.length; i < l; ++i) { + args.push(sinon.format(this.args[i])); + } + + callStr = callStr + args.join(", ") + ")"; + + if (typeof this.returnValue != "undefined") { + callStr += " => " + sinon.format(this.returnValue); + } + + if (this.exception) { + callStr += " !" + this.exception.name; + + if (this.exception.message) { + callStr += "(" + this.exception.message + ")"; + } + } + + return callStr; + } + }; + + callProto.invokeCallback = callProto.yield; + + function createSpyCall(spy, thisValue, args, returnValue, exception, id) { + if (typeof id !== "number") { + throw new TypeError("Call id is not a number"); + } + var proxyCall = sinon.create(callProto); + proxyCall.proxy = spy; + proxyCall.thisValue = thisValue; + proxyCall.args = args; + proxyCall.returnValue = returnValue; + proxyCall.exception = exception; + proxyCall.callId = id; + + return proxyCall; + } + createSpyCall.toString = callProto.toString; // used by mocks + + if (commonJSModule) { + module.exports = createSpyCall; + } else { + sinon.spyCall = createSpyCall; + } +}(typeof sinon == "object" && sinon || null)); + + +/** + * @depend ../sinon.js + * @depend call.js + */ +/*jslint eqeqeq: false, onevar: false, plusplus: false*/ +/*global module, require, sinon*/ +/** + * Spy functions + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + var push = Array.prototype.push; + var slice = Array.prototype.slice; + var callId = 0; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + function spy(object, property) { + if (!property && typeof object == "function") { + return spy.create(object); + } + + if (!object && !property) { + return spy.create(function () { }); + } + + var method = object[property]; + return sinon.wrapMethod(object, property, spy.create(method)); + } + + function matchingFake(fakes, args, strict) { + if (!fakes) { + return; + } + + for (var i = 0, l = fakes.length; i < l; i++) { + if (fakes[i].matches(args, strict)) { + return fakes[i]; + } + } + } + + function incrementCallCount() { + this.called = true; + this.callCount += 1; + this.notCalled = false; + this.calledOnce = this.callCount == 1; + this.calledTwice = this.callCount == 2; + this.calledThrice = this.callCount == 3; + } + + function createCallProperties() { + this.firstCall = this.getCall(0); + this.secondCall = this.getCall(1); + this.thirdCall = this.getCall(2); + this.lastCall = this.getCall(this.callCount - 1); + } + + var vars = "a,b,c,d,e,f,g,h,i,j,k,l"; + function createProxy(func) { + // Retain the function length: + var p; + if (func.length) { + eval("p = (function proxy(" + vars.substring(0, func.length * 2 - 1) + + ") { return p.invoke(func, this, slice.call(arguments)); });"); + } + else { + p = function proxy() { + return p.invoke(func, this, slice.call(arguments)); + }; + } + return p; + } + + var uuid = 0; + + // Public API + var spyApi = { + reset: function () { + this.called = false; + this.notCalled = true; + this.calledOnce = false; + this.calledTwice = false; + this.calledThrice = false; + this.callCount = 0; + this.firstCall = null; + this.secondCall = null; + this.thirdCall = null; + this.lastCall = null; + this.args = []; + this.returnValues = []; + this.thisValues = []; + this.exceptions = []; + this.callIds = []; + if (this.fakes) { + for (var i = 0; i < this.fakes.length; i++) { + this.fakes[i].reset(); + } + } + }, + + create: function create(func) { + var name; + + if (typeof func != "function") { + func = function () { }; + } else { + name = sinon.functionName(func); + } + + var proxy = createProxy(func); + + sinon.extend(proxy, spy); + delete proxy.create; + sinon.extend(proxy, func); + + proxy.reset(); + proxy.prototype = func.prototype; + proxy.displayName = name || "spy"; + proxy.toString = sinon.functionToString; + proxy._create = sinon.spy.create; + proxy.id = "spy#" + uuid++; + + return proxy; + }, + + invoke: function invoke(func, thisValue, args) { + var matching = matchingFake(this.fakes, args); + var exception, returnValue; + + incrementCallCount.call(this); + push.call(this.thisValues, thisValue); + push.call(this.args, args); + push.call(this.callIds, callId++); + + try { + if (matching) { + returnValue = matching.invoke(func, thisValue, args); + } else { + returnValue = (this.func || func).apply(thisValue, args); + } + + var thisCall = this.getCall(this.callCount - 1); + if (thisCall.calledWithNew() && typeof returnValue !== 'object') { + returnValue = thisValue; + } + } catch (e) { + exception = e; + } + + push.call(this.exceptions, exception); + push.call(this.returnValues, returnValue); + + createCallProperties.call(this); + + if (exception !== undefined) { + throw exception; + } + + return returnValue; + }, + + getCall: function getCall(i) { + if (i < 0 || i >= this.callCount) { + return null; + } + + return sinon.spyCall(this, this.thisValues[i], this.args[i], + this.returnValues[i], this.exceptions[i], + this.callIds[i]); + }, + + getCalls: function () { + var calls = []; + var i; + + for (i = 0; i < this.callCount; i++) { + calls.push(this.getCall(i)); + } + + return calls; + }, + + calledBefore: function calledBefore(spyFn) { + if (!this.called) { + return false; + } + + if (!spyFn.called) { + return true; + } + + return this.callIds[0] < spyFn.callIds[spyFn.callIds.length - 1]; + }, + + calledAfter: function calledAfter(spyFn) { + if (!this.called || !spyFn.called) { + return false; + } + + return this.callIds[this.callCount - 1] > spyFn.callIds[spyFn.callCount - 1]; + }, + + withArgs: function () { + var args = slice.call(arguments); + + if (this.fakes) { + var match = matchingFake(this.fakes, args, true); + + if (match) { + return match; + } + } else { + this.fakes = []; + } + + var original = this; + var fake = this._create(); + fake.matchingAguments = args; + fake.parent = this; + push.call(this.fakes, fake); + + fake.withArgs = function () { + return original.withArgs.apply(original, arguments); + }; + + for (var i = 0; i < this.args.length; i++) { + if (fake.matches(this.args[i])) { + incrementCallCount.call(fake); + push.call(fake.thisValues, this.thisValues[i]); + push.call(fake.args, this.args[i]); + push.call(fake.returnValues, this.returnValues[i]); + push.call(fake.exceptions, this.exceptions[i]); + push.call(fake.callIds, this.callIds[i]); + } + } + createCallProperties.call(fake); + + return fake; + }, + + matches: function (args, strict) { + var margs = this.matchingAguments; + + if (margs.length <= args.length && + sinon.deepEqual(margs, args.slice(0, margs.length))) { + return !strict || margs.length == args.length; + } + }, + + printf: function (format) { + var spy = this; + var args = slice.call(arguments, 1); + var formatter; + + return (format || "").replace(/%(.)/g, function (match, specifyer) { + formatter = spyApi.formatters[specifyer]; + + if (typeof formatter == "function") { + return formatter.call(null, spy, args); + } else if (!isNaN(parseInt(specifyer, 10))) { + return sinon.format(args[specifyer - 1]); + } + + return "%" + specifyer; + }); + } + }; + + function delegateToCalls(method, matchAny, actual, notCalled) { + spyApi[method] = function () { + if (!this.called) { + if (notCalled) { + return notCalled.apply(this, arguments); + } + return false; + } + + var currentCall; + var matches = 0; + + for (var i = 0, l = this.callCount; i < l; i += 1) { + currentCall = this.getCall(i); + + if (currentCall[actual || method].apply(currentCall, arguments)) { + matches += 1; + + if (matchAny) { + return true; + } + } + } + + return matches === this.callCount; + }; + } + + delegateToCalls("calledOn", true); + delegateToCalls("alwaysCalledOn", false, "calledOn"); + delegateToCalls("calledWith", true); + delegateToCalls("calledWithMatch", true); + delegateToCalls("alwaysCalledWith", false, "calledWith"); + delegateToCalls("alwaysCalledWithMatch", false, "calledWithMatch"); + delegateToCalls("calledWithExactly", true); + delegateToCalls("alwaysCalledWithExactly", false, "calledWithExactly"); + delegateToCalls("neverCalledWith", false, "notCalledWith", + function () { return true; }); + delegateToCalls("neverCalledWithMatch", false, "notCalledWithMatch", + function () { return true; }); + delegateToCalls("threw", true); + delegateToCalls("alwaysThrew", false, "threw"); + delegateToCalls("returned", true); + delegateToCalls("alwaysReturned", false, "returned"); + delegateToCalls("calledWithNew", true); + delegateToCalls("alwaysCalledWithNew", false, "calledWithNew"); + delegateToCalls("callArg", false, "callArgWith", function () { + throw new Error(this.toString() + " cannot call arg since it was not yet invoked."); + }); + spyApi.callArgWith = spyApi.callArg; + delegateToCalls("callArgOn", false, "callArgOnWith", function () { + throw new Error(this.toString() + " cannot call arg since it was not yet invoked."); + }); + spyApi.callArgOnWith = spyApi.callArgOn; + delegateToCalls("yield", false, "yield", function () { + throw new Error(this.toString() + " cannot yield since it was not yet invoked."); + }); + // "invokeCallback" is an alias for "yield" since "yield" is invalid in strict mode. + spyApi.invokeCallback = spyApi.yield; + delegateToCalls("yieldOn", false, "yieldOn", function () { + throw new Error(this.toString() + " cannot yield since it was not yet invoked."); + }); + delegateToCalls("yieldTo", false, "yieldTo", function (property) { + throw new Error(this.toString() + " cannot yield to '" + property + + "' since it was not yet invoked."); + }); + delegateToCalls("yieldToOn", false, "yieldToOn", function (property) { + throw new Error(this.toString() + " cannot yield to '" + property + + "' since it was not yet invoked."); + }); + + spyApi.formatters = { + "c": function (spy) { + return sinon.timesInWords(spy.callCount); + }, + + "n": function (spy) { + return spy.toString(); + }, + + "C": function (spy) { + var calls = []; + + for (var i = 0, l = spy.callCount; i < l; ++i) { + var stringifiedCall = " " + spy.getCall(i).toString(); + if (/\n/.test(calls[i - 1])) { + stringifiedCall = "\n" + stringifiedCall; + } + push.call(calls, stringifiedCall); + } + + return calls.length > 0 ? "\n" + calls.join("\n") : ""; + }, + + "t": function (spy) { + var objects = []; + + for (var i = 0, l = spy.callCount; i < l; ++i) { + push.call(objects, sinon.format(spy.thisValues[i])); + } + + return objects.join(", "); + }, + + "*": function (spy, args) { + var formatted = []; + + for (var i = 0, l = args.length; i < l; ++i) { + push.call(formatted, sinon.format(args[i])); + } + + return formatted.join(", "); + } + }; + + sinon.extend(spy, spyApi); + + spy.spyCall = sinon.spyCall; + + if (commonJSModule) { + module.exports = spy; + } else { + sinon.spy = spy; + } +}(typeof sinon == "object" && sinon || null)); + +/** + * @depend ../sinon.js + */ +/*jslint eqeqeq: false, onevar: false*/ +/*global module, require, sinon, process, setImmediate, setTimeout*/ +/** + * Stub behavior + * + * @author Christian Johansen (christian@cjohansen.no) + * @author Tim Fischbach (mail@timfischbach.de) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + var slice = Array.prototype.slice; + var join = Array.prototype.join; + var proto; + + var nextTick = (function () { + if (typeof process === "object" && typeof process.nextTick === "function") { + return process.nextTick; + } else if (typeof setImmediate === "function") { + return setImmediate; + } else { + return function (callback) { + setTimeout(callback, 0); + }; + } + })(); + + function throwsException(error, message) { + if (typeof error == "string") { + this.exception = new Error(message || ""); + this.exception.name = error; + } else if (!error) { + this.exception = new Error("Error"); + } else { + this.exception = error; + } + + return this; + } + + function getCallback(behavior, args) { + var callArgAt = behavior.callArgAt; + + if (callArgAt < 0) { + var callArgProp = behavior.callArgProp; + + for (var i = 0, l = args.length; i < l; ++i) { + if (!callArgProp && typeof args[i] == "function") { + return args[i]; + } + + if (callArgProp && args[i] && + typeof args[i][callArgProp] == "function") { + return args[i][callArgProp]; + } + } + + return null; + } + + return args[callArgAt]; + } + + function getCallbackError(behavior, func, args) { + if (behavior.callArgAt < 0) { + var msg; + + if (behavior.callArgProp) { + msg = sinon.functionName(behavior.stub) + + " expected to yield to '" + behavior.callArgProp + + "', but no object with such a property was passed."; + } else { + msg = sinon.functionName(behavior.stub) + + " expected to yield, but no callback was passed."; + } + + if (args.length > 0) { + msg += " Received [" + join.call(args, ", ") + "]"; + } + + return msg; + } + + return "argument at index " + behavior.callArgAt + " is not a function: " + func; + } + + function callCallback(behavior, args) { + if (typeof behavior.callArgAt == "number") { + var func = getCallback(behavior, args); + + if (typeof func != "function") { + throw new TypeError(getCallbackError(behavior, func, args)); + } + + if (behavior.callbackAsync) { + nextTick(function() { + func.apply(behavior.callbackContext, behavior.callbackArguments); + }); + } else { + func.apply(behavior.callbackContext, behavior.callbackArguments); + } + } + } + + proto = { + create: function(stub) { + var behavior = sinon.extend({}, sinon.behavior); + delete behavior.create; + behavior.stub = stub; + + return behavior; + }, + + isPresent: function() { + return (typeof this.callArgAt == 'number' || + this.exception || + typeof this.returnArgAt == 'number' || + this.returnThis || + this.returnValueDefined); + }, + + invoke: function(context, args) { + callCallback(this, args); + + if (this.exception) { + throw this.exception; + } else if (typeof this.returnArgAt == 'number') { + return args[this.returnArgAt]; + } else if (this.returnThis) { + return context; + } + + return this.returnValue; + }, + + onCall: function(index) { + return this.stub.onCall(index); + }, + + onFirstCall: function() { + return this.stub.onFirstCall(); + }, + + onSecondCall: function() { + return this.stub.onSecondCall(); + }, + + onThirdCall: function() { + return this.stub.onThirdCall(); + }, + + withArgs: function(/* arguments */) { + throw new Error('Defining a stub by invoking "stub.onCall(...).withArgs(...)" is not supported. ' + + 'Use "stub.withArgs(...).onCall(...)" to define sequential behavior for calls with certain arguments.'); + }, + + callsArg: function callsArg(pos) { + if (typeof pos != "number") { + throw new TypeError("argument index is not number"); + } + + this.callArgAt = pos; + this.callbackArguments = []; + this.callbackContext = undefined; + this.callArgProp = undefined; + this.callbackAsync = false; + + return this; + }, + + callsArgOn: function callsArgOn(pos, context) { + if (typeof pos != "number") { + throw new TypeError("argument index is not number"); + } + if (typeof context != "object") { + throw new TypeError("argument context is not an object"); + } + + this.callArgAt = pos; + this.callbackArguments = []; + this.callbackContext = context; + this.callArgProp = undefined; + this.callbackAsync = false; + + return this; + }, + + callsArgWith: function callsArgWith(pos) { + if (typeof pos != "number") { + throw new TypeError("argument index is not number"); + } + + this.callArgAt = pos; + this.callbackArguments = slice.call(arguments, 1); + this.callbackContext = undefined; + this.callArgProp = undefined; + this.callbackAsync = false; + + return this; + }, + + callsArgOnWith: function callsArgWith(pos, context) { + if (typeof pos != "number") { + throw new TypeError("argument index is not number"); + } + if (typeof context != "object") { + throw new TypeError("argument context is not an object"); + } + + this.callArgAt = pos; + this.callbackArguments = slice.call(arguments, 2); + this.callbackContext = context; + this.callArgProp = undefined; + this.callbackAsync = false; + + return this; + }, + + yields: function () { + this.callArgAt = -1; + this.callbackArguments = slice.call(arguments, 0); + this.callbackContext = undefined; + this.callArgProp = undefined; + this.callbackAsync = false; + + return this; + }, + + yieldsOn: function (context) { + if (typeof context != "object") { + throw new TypeError("argument context is not an object"); + } + + this.callArgAt = -1; + this.callbackArguments = slice.call(arguments, 1); + this.callbackContext = context; + this.callArgProp = undefined; + this.callbackAsync = false; + + return this; + }, + + yieldsTo: function (prop) { + this.callArgAt = -1; + this.callbackArguments = slice.call(arguments, 1); + this.callbackContext = undefined; + this.callArgProp = prop; + this.callbackAsync = false; + + return this; + }, + + yieldsToOn: function (prop, context) { + if (typeof context != "object") { + throw new TypeError("argument context is not an object"); + } + + this.callArgAt = -1; + this.callbackArguments = slice.call(arguments, 2); + this.callbackContext = context; + this.callArgProp = prop; + this.callbackAsync = false; + + return this; + }, + + + "throws": throwsException, + throwsException: throwsException, + + returns: function returns(value) { + this.returnValue = value; + this.returnValueDefined = true; + + return this; + }, + + returnsArg: function returnsArg(pos) { + if (typeof pos != "number") { + throw new TypeError("argument index is not number"); + } + + this.returnArgAt = pos; + + return this; + }, + + returnsThis: function returnsThis() { + this.returnThis = true; + + return this; + } + }; + + // create asynchronous versions of callsArg* and yields* methods + for (var method in proto) { + // need to avoid creating anotherasync versions of the newly added async methods + if (proto.hasOwnProperty(method) && + method.match(/^(callsArg|yields)/) && + !method.match(/Async/)) { + proto[method + 'Async'] = (function (syncFnName) { + return function () { + var result = this[syncFnName].apply(this, arguments); + this.callbackAsync = true; + return result; + }; + })(method); + } + } + + if (commonJSModule) { + module.exports = proto; + } else { + sinon.behavior = proto; + } +}(typeof sinon == "object" && sinon || null)); +/** + * @depend ../sinon.js + * @depend spy.js + * @depend behavior.js + */ +/*jslint eqeqeq: false, onevar: false*/ +/*global module, require, sinon*/ +/** + * Stub functions + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + function stub(object, property, func) { + if (!!func && typeof func != "function") { + throw new TypeError("Custom stub should be function"); + } + + var wrapper; + + if (func) { + wrapper = sinon.spy && sinon.spy.create ? sinon.spy.create(func) : func; + } else { + wrapper = stub.create(); + } + + if (!object && typeof property === "undefined") { + return sinon.stub.create(); + } + + if (typeof property === "undefined" && typeof object == "object") { + for (var prop in object) { + if (typeof object[prop] === "function") { + stub(object, prop); + } + } + + return object; + } + + return sinon.wrapMethod(object, property, wrapper); + } + + function getDefaultBehavior(stub) { + return stub.defaultBehavior || getParentBehaviour(stub) || sinon.behavior.create(stub); + } + + function getParentBehaviour(stub) { + return (stub.parent && getCurrentBehavior(stub.parent)); + } + + function getCurrentBehavior(stub) { + var behavior = stub.behaviors[stub.callCount - 1]; + return behavior && behavior.isPresent() ? behavior : getDefaultBehavior(stub); + } + + var uuid = 0; + + sinon.extend(stub, (function () { + var proto = { + create: function create() { + var functionStub = function () { + return getCurrentBehavior(functionStub).invoke(this, arguments); + }; + + functionStub.id = "stub#" + uuid++; + var orig = functionStub; + functionStub = sinon.spy.create(functionStub); + functionStub.func = orig; + + sinon.extend(functionStub, stub); + functionStub._create = sinon.stub.create; + functionStub.displayName = "stub"; + functionStub.toString = sinon.functionToString; + + functionStub.defaultBehavior = null; + functionStub.behaviors = []; + + return functionStub; + }, + + resetBehavior: function () { + var i; + + this.defaultBehavior = null; + this.behaviors = []; + + delete this.returnValue; + delete this.returnArgAt; + this.returnThis = false; + + if (this.fakes) { + for (i = 0; i < this.fakes.length; i++) { + this.fakes[i].resetBehavior(); + } + } + }, + + onCall: function(index) { + if (!this.behaviors[index]) { + this.behaviors[index] = sinon.behavior.create(this); + } + + return this.behaviors[index]; + }, + + onFirstCall: function() { + return this.onCall(0); + }, + + onSecondCall: function() { + return this.onCall(1); + }, + + onThirdCall: function() { + return this.onCall(2); + } + }; + + for (var method in sinon.behavior) { + if (sinon.behavior.hasOwnProperty(method) && + !proto.hasOwnProperty(method) && + method != 'create' && + method != 'withArgs' && + method != 'invoke') { + proto[method] = (function(behaviorMethod) { + return function() { + this.defaultBehavior = this.defaultBehavior || sinon.behavior.create(this); + this.defaultBehavior[behaviorMethod].apply(this.defaultBehavior, arguments); + return this; + }; + }(method)); + } + } + + return proto; + }())); + + if (commonJSModule) { + module.exports = stub; + } else { + sinon.stub = stub; + } +}(typeof sinon == "object" && sinon || null)); + +/** + * @depend ../sinon.js + * @depend stub.js + */ +/*jslint eqeqeq: false, onevar: false, nomen: false*/ +/*global module, require, sinon*/ +/** + * Mock functions. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + var push = [].push; + var match; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + match = sinon.match; + + if (!match && commonJSModule) { + match = require("./match"); + } + + function mock(object) { + if (!object) { + return sinon.expectation.create("Anonymous mock"); + } + + return mock.create(object); + } + + sinon.mock = mock; + + sinon.extend(mock, (function () { + function each(collection, callback) { + if (!collection) { + return; + } + + for (var i = 0, l = collection.length; i < l; i += 1) { + callback(collection[i]); + } + } + + return { + create: function create(object) { + if (!object) { + throw new TypeError("object is null"); + } + + var mockObject = sinon.extend({}, mock); + mockObject.object = object; + delete mockObject.create; + + return mockObject; + }, + + expects: function expects(method) { + if (!method) { + throw new TypeError("method is falsy"); + } + + if (!this.expectations) { + this.expectations = {}; + this.proxies = []; + } + + if (!this.expectations[method]) { + this.expectations[method] = []; + var mockObject = this; + + sinon.wrapMethod(this.object, method, function () { + return mockObject.invokeMethod(method, this, arguments); + }); + + push.call(this.proxies, method); + } + + var expectation = sinon.expectation.create(method); + push.call(this.expectations[method], expectation); + + return expectation; + }, + + restore: function restore() { + var object = this.object; + + each(this.proxies, function (proxy) { + if (typeof object[proxy].restore == "function") { + object[proxy].restore(); + } + }); + }, + + verify: function verify() { + var expectations = this.expectations || {}; + var messages = [], met = []; + + each(this.proxies, function (proxy) { + each(expectations[proxy], function (expectation) { + if (!expectation.met()) { + push.call(messages, expectation.toString()); + } else { + push.call(met, expectation.toString()); + } + }); + }); + + this.restore(); + + if (messages.length > 0) { + sinon.expectation.fail(messages.concat(met).join("\n")); + } else { + sinon.expectation.pass(messages.concat(met).join("\n")); + } + + return true; + }, + + invokeMethod: function invokeMethod(method, thisValue, args) { + var expectations = this.expectations && this.expectations[method]; + var length = expectations && expectations.length || 0, i; + + for (i = 0; i < length; i += 1) { + if (!expectations[i].met() && + expectations[i].allowsCall(thisValue, args)) { + return expectations[i].apply(thisValue, args); + } + } + + var messages = [], available, exhausted = 0; + + for (i = 0; i < length; i += 1) { + if (expectations[i].allowsCall(thisValue, args)) { + available = available || expectations[i]; + } else { + exhausted += 1; + } + push.call(messages, " " + expectations[i].toString()); + } + + if (exhausted === 0) { + return available.apply(thisValue, args); + } + + messages.unshift("Unexpected call: " + sinon.spyCall.toString.call({ + proxy: method, + args: args + })); + + sinon.expectation.fail(messages.join("\n")); + } + }; + }())); + + var times = sinon.timesInWords; + + sinon.expectation = (function () { + var slice = Array.prototype.slice; + var _invoke = sinon.spy.invoke; + + function callCountInWords(callCount) { + if (callCount == 0) { + return "never called"; + } else { + return "called " + times(callCount); + } + } + + function expectedCallCountInWords(expectation) { + var min = expectation.minCalls; + var max = expectation.maxCalls; + + if (typeof min == "number" && typeof max == "number") { + var str = times(min); + + if (min != max) { + str = "at least " + str + " and at most " + times(max); + } + + return str; + } + + if (typeof min == "number") { + return "at least " + times(min); + } + + return "at most " + times(max); + } + + function receivedMinCalls(expectation) { + var hasMinLimit = typeof expectation.minCalls == "number"; + return !hasMinLimit || expectation.callCount >= expectation.minCalls; + } + + function receivedMaxCalls(expectation) { + if (typeof expectation.maxCalls != "number") { + return false; + } + + return expectation.callCount == expectation.maxCalls; + } + + function verifyMatcher(possibleMatcher, arg){ + if (match && match.isMatcher(possibleMatcher)) { + return possibleMatcher.test(arg); + } else { + return true; + } + } + + return { + minCalls: 1, + maxCalls: 1, + + create: function create(methodName) { + var expectation = sinon.extend(sinon.stub.create(), sinon.expectation); + delete expectation.create; + expectation.method = methodName; + + return expectation; + }, + + invoke: function invoke(func, thisValue, args) { + this.verifyCallAllowed(thisValue, args); + + return _invoke.apply(this, arguments); + }, + + atLeast: function atLeast(num) { + if (typeof num != "number") { + throw new TypeError("'" + num + "' is not number"); + } + + if (!this.limitsSet) { + this.maxCalls = null; + this.limitsSet = true; + } + + this.minCalls = num; + + return this; + }, + + atMost: function atMost(num) { + if (typeof num != "number") { + throw new TypeError("'" + num + "' is not number"); + } + + if (!this.limitsSet) { + this.minCalls = null; + this.limitsSet = true; + } + + this.maxCalls = num; + + return this; + }, + + never: function never() { + return this.exactly(0); + }, + + once: function once() { + return this.exactly(1); + }, + + twice: function twice() { + return this.exactly(2); + }, + + thrice: function thrice() { + return this.exactly(3); + }, + + exactly: function exactly(num) { + if (typeof num != "number") { + throw new TypeError("'" + num + "' is not a number"); + } + + this.atLeast(num); + return this.atMost(num); + }, + + met: function met() { + return !this.failed && receivedMinCalls(this); + }, + + verifyCallAllowed: function verifyCallAllowed(thisValue, args) { + if (receivedMaxCalls(this)) { + this.failed = true; + sinon.expectation.fail(this.method + " already called " + times(this.maxCalls)); + } + + if ("expectedThis" in this && this.expectedThis !== thisValue) { + sinon.expectation.fail(this.method + " called with " + thisValue + " as thisValue, expected " + + this.expectedThis); + } + + if (!("expectedArguments" in this)) { + return; + } + + if (!args) { + sinon.expectation.fail(this.method + " received no arguments, expected " + + sinon.format(this.expectedArguments)); + } + + if (args.length < this.expectedArguments.length) { + sinon.expectation.fail(this.method + " received too few arguments (" + sinon.format(args) + + "), expected " + sinon.format(this.expectedArguments)); + } + + if (this.expectsExactArgCount && + args.length != this.expectedArguments.length) { + sinon.expectation.fail(this.method + " received too many arguments (" + sinon.format(args) + + "), expected " + sinon.format(this.expectedArguments)); + } + + for (var i = 0, l = this.expectedArguments.length; i < l; i += 1) { + + if (!verifyMatcher(this.expectedArguments[i],args[i])) { + sinon.expectation.fail(this.method + " received wrong arguments " + sinon.format(args) + + ", didn't match " + this.expectedArguments.toString()); + } + + if (!sinon.deepEqual(this.expectedArguments[i], args[i])) { + sinon.expectation.fail(this.method + " received wrong arguments " + sinon.format(args) + + ", expected " + sinon.format(this.expectedArguments)); + } + } + }, + + allowsCall: function allowsCall(thisValue, args) { + if (this.met() && receivedMaxCalls(this)) { + return false; + } + + if ("expectedThis" in this && this.expectedThis !== thisValue) { + return false; + } + + if (!("expectedArguments" in this)) { + return true; + } + + args = args || []; + + if (args.length < this.expectedArguments.length) { + return false; + } + + if (this.expectsExactArgCount && + args.length != this.expectedArguments.length) { + return false; + } + + for (var i = 0, l = this.expectedArguments.length; i < l; i += 1) { + if (!verifyMatcher(this.expectedArguments[i],args[i])) { + return false; + } + + if (!sinon.deepEqual(this.expectedArguments[i], args[i])) { + return false; + } + } + + return true; + }, + + withArgs: function withArgs() { + this.expectedArguments = slice.call(arguments); + return this; + }, + + withExactArgs: function withExactArgs() { + this.withArgs.apply(this, arguments); + this.expectsExactArgCount = true; + return this; + }, + + on: function on(thisValue) { + this.expectedThis = thisValue; + return this; + }, + + toString: function () { + var args = (this.expectedArguments || []).slice(); + + if (!this.expectsExactArgCount) { + push.call(args, "[...]"); + } + + var callStr = sinon.spyCall.toString.call({ + proxy: this.method || "anonymous mock expectation", + args: args + }); + + var message = callStr.replace(", [...", "[, ...") + " " + + expectedCallCountInWords(this); + + if (this.met()) { + return "Expectation met: " + message; + } + + return "Expected " + message + " (" + + callCountInWords(this.callCount) + ")"; + }, + + verify: function verify() { + if (!this.met()) { + sinon.expectation.fail(this.toString()); + } else { + sinon.expectation.pass(this.toString()); + } + + return true; + }, + + pass: function(message) { + sinon.assert.pass(message); + }, + fail: function (message) { + var exception = new Error(message); + exception.name = "ExpectationError"; + + throw exception; + } + }; + }()); + + if (commonJSModule) { + module.exports = mock; + } else { + sinon.mock = mock; + } +}(typeof sinon == "object" && sinon || null)); + +/** + * @depend ../sinon.js + * @depend stub.js + * @depend mock.js + */ +/*jslint eqeqeq: false, onevar: false, forin: true*/ +/*global module, require, sinon*/ +/** + * Collections of stubs, spies and mocks. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + var push = [].push; + var hasOwnProperty = Object.prototype.hasOwnProperty; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + function getFakes(fakeCollection) { + if (!fakeCollection.fakes) { + fakeCollection.fakes = []; + } + + return fakeCollection.fakes; + } + + function each(fakeCollection, method) { + var fakes = getFakes(fakeCollection); + + for (var i = 0, l = fakes.length; i < l; i += 1) { + if (typeof fakes[i][method] == "function") { + fakes[i][method](); + } + } + } + + function compact(fakeCollection) { + var fakes = getFakes(fakeCollection); + var i = 0; + while (i < fakes.length) { + fakes.splice(i, 1); + } + } + + var collection = { + verify: function resolve() { + each(this, "verify"); + }, + + restore: function restore() { + each(this, "restore"); + compact(this); + }, + + verifyAndRestore: function verifyAndRestore() { + var exception; + + try { + this.verify(); + } catch (e) { + exception = e; + } + + this.restore(); + + if (exception) { + throw exception; + } + }, + + add: function add(fake) { + push.call(getFakes(this), fake); + return fake; + }, + + spy: function spy() { + return this.add(sinon.spy.apply(sinon, arguments)); + }, + + stub: function stub(object, property, value) { + if (property) { + var original = object[property]; + + if (typeof original != "function") { + if (!hasOwnProperty.call(object, property)) { + throw new TypeError("Cannot stub non-existent own property " + property); + } + + object[property] = value; + + return this.add({ + restore: function () { + object[property] = original; + } + }); + } + } + if (!property && !!object && typeof object == "object") { + var stubbedObj = sinon.stub.apply(sinon, arguments); + + for (var prop in stubbedObj) { + if (typeof stubbedObj[prop] === "function") { + this.add(stubbedObj[prop]); + } + } + + return stubbedObj; + } + + return this.add(sinon.stub.apply(sinon, arguments)); + }, + + mock: function mock() { + return this.add(sinon.mock.apply(sinon, arguments)); + }, + + inject: function inject(obj) { + var col = this; + + obj.spy = function () { + return col.spy.apply(col, arguments); + }; + + obj.stub = function () { + return col.stub.apply(col, arguments); + }; + + obj.mock = function () { + return col.mock.apply(col, arguments); + }; + + return obj; + } + }; + + if (commonJSModule) { + module.exports = collection; + } else { + sinon.collection = collection; + } +}(typeof sinon == "object" && sinon || null)); + +/*jslint eqeqeq: false, plusplus: false, evil: true, onevar: false, browser: true, forin: false*/ +/*global module, require, window*/ +/** + * Fake timer API + * setTimeout + * setInterval + * clearTimeout + * clearInterval + * tick + * reset + * Date + * + * Inspired by jsUnitMockTimeOut from JsUnit + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +if (typeof sinon == "undefined") { + var sinon = {}; +} + +(function (global) { + var id = 1; + + function addTimer(args, recurring) { + if (args.length === 0) { + throw new Error("Function requires at least 1 parameter"); + } + + if (typeof args[0] === "undefined") { + throw new Error("Callback must be provided to timer calls"); + } + + var toId = id++; + var delay = args[1] || 0; + + if (!this.timeouts) { + this.timeouts = {}; + } + + this.timeouts[toId] = { + id: toId, + func: args[0], + callAt: this.now + delay, + invokeArgs: Array.prototype.slice.call(args, 2) + }; + + if (recurring === true) { + this.timeouts[toId].interval = delay; + } + + return toId; + } + + function parseTime(str) { + if (!str) { + return 0; + } + + var strings = str.split(":"); + var l = strings.length, i = l; + var ms = 0, parsed; + + if (l > 3 || !/^(\d\d:){0,2}\d\d?$/.test(str)) { + throw new Error("tick only understands numbers and 'h:m:s'"); + } + + while (i--) { + parsed = parseInt(strings[i], 10); + + if (parsed >= 60) { + throw new Error("Invalid time " + str); + } + + ms += parsed * Math.pow(60, (l - i - 1)); + } + + return ms * 1000; + } + + function createObject(object) { + var newObject; + + if (Object.create) { + newObject = Object.create(object); + } else { + var F = function () {}; + F.prototype = object; + newObject = new F(); + } + + newObject.Date.clock = newObject; + return newObject; + } + + sinon.clock = { + now: 0, + + create: function create(now) { + var clock = createObject(this); + + if (typeof now == "number") { + clock.now = now; + } + + if (!!now && typeof now == "object") { + throw new TypeError("now should be milliseconds since UNIX epoch"); + } + + return clock; + }, + + setTimeout: function setTimeout(callback, timeout) { + return addTimer.call(this, arguments, false); + }, + + clearTimeout: function clearTimeout(timerId) { + if (!this.timeouts) { + this.timeouts = []; + } + + if (timerId in this.timeouts) { + delete this.timeouts[timerId]; + } + }, + + setInterval: function setInterval(callback, timeout) { + return addTimer.call(this, arguments, true); + }, + + clearInterval: function clearInterval(timerId) { + this.clearTimeout(timerId); + }, + + setImmediate: function setImmediate(callback) { + var passThruArgs = Array.prototype.slice.call(arguments, 1); + + return addTimer.call(this, [callback, 0].concat(passThruArgs), false); + }, + + clearImmediate: function clearImmediate(timerId) { + this.clearTimeout(timerId); + }, + + tick: function tick(ms) { + ms = typeof ms == "number" ? ms : parseTime(ms); + var tickFrom = this.now, tickTo = this.now + ms, previous = this.now; + var timer = this.firstTimerInRange(tickFrom, tickTo); + + var firstException; + while (timer && tickFrom <= tickTo) { + if (this.timeouts[timer.id]) { + tickFrom = this.now = timer.callAt; + try { + this.callTimer(timer); + } catch (e) { + firstException = firstException || e; + } + } + + timer = this.firstTimerInRange(previous, tickTo); + previous = tickFrom; + } + + this.now = tickTo; + + if (firstException) { + throw firstException; + } + + return this.now; + }, + + firstTimerInRange: function (from, to) { + var timer, smallest = null, originalTimer; + + for (var id in this.timeouts) { + if (this.timeouts.hasOwnProperty(id)) { + if (this.timeouts[id].callAt < from || this.timeouts[id].callAt > to) { + continue; + } + + if (smallest === null || this.timeouts[id].callAt < smallest) { + originalTimer = this.timeouts[id]; + smallest = this.timeouts[id].callAt; + + timer = { + func: this.timeouts[id].func, + callAt: this.timeouts[id].callAt, + interval: this.timeouts[id].interval, + id: this.timeouts[id].id, + invokeArgs: this.timeouts[id].invokeArgs + }; + } + } + } + + return timer || null; + }, + + callTimer: function (timer) { + if (typeof timer.interval == "number") { + this.timeouts[timer.id].callAt += timer.interval; + } else { + delete this.timeouts[timer.id]; + } + + try { + if (typeof timer.func == "function") { + timer.func.apply(null, timer.invokeArgs); + } else { + eval(timer.func); + } + } catch (e) { + var exception = e; + } + + if (!this.timeouts[timer.id]) { + if (exception) { + throw exception; + } + return; + } + + if (exception) { + throw exception; + } + }, + + reset: function reset() { + this.timeouts = {}; + }, + + Date: (function () { + var NativeDate = Date; + + function ClockDate(year, month, date, hour, minute, second, ms) { + // Defensive and verbose to avoid potential harm in passing + // explicit undefined when user does not pass argument + switch (arguments.length) { + case 0: + return new NativeDate(ClockDate.clock.now); + case 1: + return new NativeDate(year); + case 2: + return new NativeDate(year, month); + case 3: + return new NativeDate(year, month, date); + case 4: + return new NativeDate(year, month, date, hour); + case 5: + return new NativeDate(year, month, date, hour, minute); + case 6: + return new NativeDate(year, month, date, hour, minute, second); + default: + return new NativeDate(year, month, date, hour, minute, second, ms); + } + } + + return mirrorDateProperties(ClockDate, NativeDate); + }()) + }; + + function mirrorDateProperties(target, source) { + if (source.now) { + target.now = function now() { + return target.clock.now; + }; + } else { + delete target.now; + } + + if (source.toSource) { + target.toSource = function toSource() { + return source.toSource(); + }; + } else { + delete target.toSource; + } + + target.toString = function toString() { + return source.toString(); + }; + + target.prototype = source.prototype; + target.parse = source.parse; + target.UTC = source.UTC; + target.prototype.toUTCString = source.prototype.toUTCString; + + for (var prop in source) { + if (source.hasOwnProperty(prop)) { + target[prop] = source[prop]; + } + } + + return target; + } + + var methods = ["Date", "setTimeout", "setInterval", + "clearTimeout", "clearInterval"]; + + if (typeof global.setImmediate !== "undefined") { + methods.push("setImmediate"); + } + + if (typeof global.clearImmediate !== "undefined") { + methods.push("clearImmediate"); + } + + function restore() { + var method; + + for (var i = 0, l = this.methods.length; i < l; i++) { + method = this.methods[i]; + + if (global[method].hadOwnProperty) { + global[method] = this["_" + method]; + } else { + try { + delete global[method]; + } catch (e) {} + } + } + + // Prevent multiple executions which will completely remove these props + this.methods = []; + } + + function stubGlobal(method, clock) { + clock[method].hadOwnProperty = Object.prototype.hasOwnProperty.call(global, method); + clock["_" + method] = global[method]; + + if (method == "Date") { + var date = mirrorDateProperties(clock[method], global[method]); + global[method] = date; + } else { + global[method] = function () { + return clock[method].apply(clock, arguments); + }; + + for (var prop in clock[method]) { + if (clock[method].hasOwnProperty(prop)) { + global[method][prop] = clock[method][prop]; + } + } + } + + global[method].clock = clock; + } + + sinon.useFakeTimers = function useFakeTimers(now) { + var clock = sinon.clock.create(now); + clock.restore = restore; + clock.methods = Array.prototype.slice.call(arguments, + typeof now == "number" ? 1 : 0); + + if (clock.methods.length === 0) { + clock.methods = methods; + } + + for (var i = 0, l = clock.methods.length; i < l; i++) { + stubGlobal(clock.methods[i], clock); + } + + return clock; + }; +}(typeof global != "undefined" && typeof global !== "function" ? global : this)); + +sinon.timers = { + setTimeout: setTimeout, + clearTimeout: clearTimeout, + setImmediate: (typeof setImmediate !== "undefined" ? setImmediate : undefined), + clearImmediate: (typeof clearImmediate !== "undefined" ? clearImmediate: undefined), + setInterval: setInterval, + clearInterval: clearInterval, + Date: Date +}; + +if (typeof module !== 'undefined' && module.exports) { + module.exports = sinon; +} + +/*jslint eqeqeq: false, onevar: false*/ +/*global sinon, module, require, ActiveXObject, XMLHttpRequest, DOMParser*/ +/** + * Minimal Event interface implementation + * + * Original implementation by Sven Fuchs: https://gist.github.com/995028 + * Modifications and tests by Christian Johansen. + * + * @author Sven Fuchs (svenfuchs@artweb-design.de) + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2011 Sven Fuchs, Christian Johansen + */ + +if (typeof sinon == "undefined") { + this.sinon = {}; +} + +(function () { + var push = [].push; + + sinon.Event = function Event(type, bubbles, cancelable, target) { + this.initEvent(type, bubbles, cancelable, target); + }; + + sinon.Event.prototype = { + initEvent: function(type, bubbles, cancelable, target) { + this.type = type; + this.bubbles = bubbles; + this.cancelable = cancelable; + this.target = target; + }, + + stopPropagation: function () {}, + + preventDefault: function () { + this.defaultPrevented = true; + } + }; + + sinon.ProgressEvent = function ProgressEvent(type, progressEventRaw, target) { + this.initEvent(type, false, false, target); + this.loaded = progressEventRaw.loaded || null; + this.total = progressEventRaw.total || null; + }; + + sinon.ProgressEvent.prototype = new sinon.Event(); + + sinon.ProgressEvent.prototype.constructor = sinon.ProgressEvent; + + sinon.CustomEvent = function CustomEvent(type, customData, target) { + this.initEvent(type, false, false, target); + this.detail = customData.detail || null; + }; + + sinon.CustomEvent.prototype = new sinon.Event(); + + sinon.CustomEvent.prototype.constructor = sinon.CustomEvent; + + sinon.EventTarget = { + addEventListener: function addEventListener(event, listener) { + this.eventListeners = this.eventListeners || {}; + this.eventListeners[event] = this.eventListeners[event] || []; + push.call(this.eventListeners[event], listener); + }, + + removeEventListener: function removeEventListener(event, listener) { + var listeners = this.eventListeners && this.eventListeners[event] || []; + + for (var i = 0, l = listeners.length; i < l; ++i) { + if (listeners[i] == listener) { + return listeners.splice(i, 1); + } + } + }, + + dispatchEvent: function dispatchEvent(event) { + var type = event.type; + var listeners = this.eventListeners && this.eventListeners[type] || []; + + for (var i = 0; i < listeners.length; i++) { + if (typeof listeners[i] == "function") { + listeners[i].call(this, event); + } else { + listeners[i].handleEvent(event); + } + } + + return !!event.defaultPrevented; + } + }; +}()); + +/** + * @depend ../../sinon.js + * @depend event.js + */ +/*jslint eqeqeq: false, onevar: false*/ +/*global sinon, module, require, ActiveXObject, XMLHttpRequest, DOMParser*/ +/** + * Fake XMLHttpRequest object + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +// wrapper for global +(function(global) { + if (typeof sinon === "undefined") { + global.sinon = {}; + } + + var supportsProgress = typeof ProgressEvent !== "undefined"; + var supportsCustomEvent = typeof CustomEvent !== "undefined"; + sinon.xhr = { XMLHttpRequest: global.XMLHttpRequest }; + var xhr = sinon.xhr; + xhr.GlobalXMLHttpRequest = global.XMLHttpRequest; + xhr.GlobalActiveXObject = global.ActiveXObject; + xhr.supportsActiveX = typeof xhr.GlobalActiveXObject != "undefined"; + xhr.supportsXHR = typeof xhr.GlobalXMLHttpRequest != "undefined"; + xhr.workingXHR = xhr.supportsXHR ? xhr.GlobalXMLHttpRequest : xhr.supportsActiveX + ? function() { return new xhr.GlobalActiveXObject("MSXML2.XMLHTTP.3.0") } : false; + xhr.supportsCORS = 'withCredentials' in (new sinon.xhr.GlobalXMLHttpRequest()); + + /*jsl:ignore*/ + var unsafeHeaders = { + "Accept-Charset": true, + "Accept-Encoding": true, + "Connection": true, + "Content-Length": true, + "Cookie": true, + "Cookie2": true, + "Content-Transfer-Encoding": true, + "Date": true, + "Expect": true, + "Host": true, + "Keep-Alive": true, + "Referer": true, + "TE": true, + "Trailer": true, + "Transfer-Encoding": true, + "Upgrade": true, + "User-Agent": true, + "Via": true + }; + /*jsl:end*/ + + function FakeXMLHttpRequest() { + this.readyState = FakeXMLHttpRequest.UNSENT; + this.requestHeaders = {}; + this.requestBody = null; + this.status = 0; + this.statusText = ""; + this.upload = new UploadProgress(); + if (sinon.xhr.supportsCORS) { + this.withCredentials = false; + } + + + var xhr = this; + var events = ["loadstart", "load", "abort", "loadend"]; + + function addEventListener(eventName) { + xhr.addEventListener(eventName, function (event) { + var listener = xhr["on" + eventName]; + + if (listener && typeof listener == "function") { + listener.call(this, event); + } + }); + } + + for (var i = events.length - 1; i >= 0; i--) { + addEventListener(events[i]); + } + + if (typeof FakeXMLHttpRequest.onCreate == "function") { + FakeXMLHttpRequest.onCreate(this); + } + } + + // An upload object is created for each + // FakeXMLHttpRequest and allows upload + // events to be simulated using uploadProgress + // and uploadError. + function UploadProgress() { + this.eventListeners = { + "progress": [], + "load": [], + "abort": [], + "error": [] + } + } + + UploadProgress.prototype.addEventListener = function(event, listener) { + this.eventListeners[event].push(listener); + }; + + UploadProgress.prototype.removeEventListener = function(event, listener) { + var listeners = this.eventListeners[event] || []; + + for (var i = 0, l = listeners.length; i < l; ++i) { + if (listeners[i] == listener) { + return listeners.splice(i, 1); + } + } + }; + + UploadProgress.prototype.dispatchEvent = function(event) { + var listeners = this.eventListeners[event.type] || []; + + for (var i = 0, listener; (listener = listeners[i]) != null; i++) { + listener(event); + } + }; + + function verifyState(xhr) { + if (xhr.readyState !== FakeXMLHttpRequest.OPENED) { + throw new Error("INVALID_STATE_ERR"); + } + + if (xhr.sendFlag) { + throw new Error("INVALID_STATE_ERR"); + } + } + + // filtering to enable a white-list version of Sinon FakeXhr, + // where whitelisted requests are passed through to real XHR + function each(collection, callback) { + if (!collection) return; + for (var i = 0, l = collection.length; i < l; i += 1) { + callback(collection[i]); + } + } + function some(collection, callback) { + for (var index = 0; index < collection.length; index++) { + if(callback(collection[index]) === true) return true; + } + return false; + } + // largest arity in XHR is 5 - XHR#open + var apply = function(obj,method,args) { + switch(args.length) { + case 0: return obj[method](); + case 1: return obj[method](args[0]); + case 2: return obj[method](args[0],args[1]); + case 3: return obj[method](args[0],args[1],args[2]); + case 4: return obj[method](args[0],args[1],args[2],args[3]); + case 5: return obj[method](args[0],args[1],args[2],args[3],args[4]); + } + }; + + FakeXMLHttpRequest.filters = []; + FakeXMLHttpRequest.addFilter = function(fn) { + this.filters.push(fn) + }; + var IE6Re = /MSIE 6/; + FakeXMLHttpRequest.defake = function(fakeXhr,xhrArgs) { + var xhr = new sinon.xhr.workingXHR(); + each(["open","setRequestHeader","send","abort","getResponseHeader", + "getAllResponseHeaders","addEventListener","overrideMimeType","removeEventListener"], + function(method) { + fakeXhr[method] = function() { + return apply(xhr,method,arguments); + }; + }); + + var copyAttrs = function(args) { + each(args, function(attr) { + try { + fakeXhr[attr] = xhr[attr] + } catch(e) { + if(!IE6Re.test(navigator.userAgent)) throw e; + } + }); + }; + + var stateChange = function() { + fakeXhr.readyState = xhr.readyState; + if(xhr.readyState >= FakeXMLHttpRequest.HEADERS_RECEIVED) { + copyAttrs(["status","statusText"]); + } + if(xhr.readyState >= FakeXMLHttpRequest.LOADING) { + copyAttrs(["responseText"]); + } + if(xhr.readyState === FakeXMLHttpRequest.DONE) { + copyAttrs(["responseXML"]); + } + if(fakeXhr.onreadystatechange) fakeXhr.onreadystatechange.call(fakeXhr, { target: fakeXhr }); + }; + if(xhr.addEventListener) { + for(var event in fakeXhr.eventListeners) { + if(fakeXhr.eventListeners.hasOwnProperty(event)) { + each(fakeXhr.eventListeners[event],function(handler) { + xhr.addEventListener(event, handler); + }); + } + } + xhr.addEventListener("readystatechange",stateChange); + } else { + xhr.onreadystatechange = stateChange; + } + apply(xhr,"open",xhrArgs); + }; + FakeXMLHttpRequest.useFilters = false; + + function verifyRequestOpened(xhr) { + if (xhr.readyState != FakeXMLHttpRequest.OPENED) { + throw new Error("INVALID_STATE_ERR - " + xhr.readyState); + } + } + + function verifyRequestSent(xhr) { + if (xhr.readyState == FakeXMLHttpRequest.DONE) { + throw new Error("Request done"); + } + } + + function verifyHeadersReceived(xhr) { + if (xhr.async && xhr.readyState != FakeXMLHttpRequest.HEADERS_RECEIVED) { + throw new Error("No headers received"); + } + } + + function verifyResponseBodyType(body) { + if (typeof body != "string") { + var error = new Error("Attempted to respond to fake XMLHttpRequest with " + + body + ", which is not a string."); + error.name = "InvalidBodyException"; + throw error; + } + } + + sinon.extend(FakeXMLHttpRequest.prototype, sinon.EventTarget, { + async: true, + + open: function open(method, url, async, username, password) { + this.method = method; + this.url = url; + this.async = typeof async == "boolean" ? async : true; + this.username = username; + this.password = password; + this.responseText = null; + this.responseXML = null; + this.requestHeaders = {}; + this.sendFlag = false; + if(sinon.FakeXMLHttpRequest.useFilters === true) { + var xhrArgs = arguments; + var defake = some(FakeXMLHttpRequest.filters,function(filter) { + return filter.apply(this,xhrArgs) + }); + if (defake) { + return sinon.FakeXMLHttpRequest.defake(this,arguments); + } + } + this.readyStateChange(FakeXMLHttpRequest.OPENED); + }, + + readyStateChange: function readyStateChange(state) { + this.readyState = state; + + if (typeof this.onreadystatechange == "function") { + try { + this.onreadystatechange(); + } catch (e) { + sinon.logError("Fake XHR onreadystatechange handler", e); + } + } + + this.dispatchEvent(new sinon.Event("readystatechange")); + + switch (this.readyState) { + case FakeXMLHttpRequest.DONE: + this.dispatchEvent(new sinon.Event("load", false, false, this)); + this.dispatchEvent(new sinon.Event("loadend", false, false, this)); + this.upload.dispatchEvent(new sinon.Event("load", false, false, this)); + if (supportsProgress) { + this.upload.dispatchEvent(new sinon.ProgressEvent('progress', {loaded: 100, total: 100})); + } + break; + } + }, + + setRequestHeader: function setRequestHeader(header, value) { + verifyState(this); + + if (unsafeHeaders[header] || /^(Sec-|Proxy-)/.test(header)) { + throw new Error("Refused to set unsafe header \"" + header + "\""); + } + + if (this.requestHeaders[header]) { + this.requestHeaders[header] += "," + value; + } else { + this.requestHeaders[header] = value; + } + }, + + // Helps testing + setResponseHeaders: function setResponseHeaders(headers) { + verifyRequestOpened(this); + this.responseHeaders = {}; + + for (var header in headers) { + if (headers.hasOwnProperty(header)) { + this.responseHeaders[header] = headers[header]; + } + } + + if (this.async) { + this.readyStateChange(FakeXMLHttpRequest.HEADERS_RECEIVED); + } else { + this.readyState = FakeXMLHttpRequest.HEADERS_RECEIVED; + } + }, + + // Currently treats ALL data as a DOMString (i.e. no Document) + send: function send(data) { + verifyState(this); + + if (!/^(get|head)$/i.test(this.method)) { + if (this.requestHeaders["Content-Type"]) { + var value = this.requestHeaders["Content-Type"].split(";"); + this.requestHeaders["Content-Type"] = value[0] + ";charset=utf-8"; + } else { + this.requestHeaders["Content-Type"] = "text/plain;charset=utf-8"; + } + + this.requestBody = data; + } + + this.errorFlag = false; + this.sendFlag = this.async; + this.readyStateChange(FakeXMLHttpRequest.OPENED); + + if (typeof this.onSend == "function") { + this.onSend(this); + } + + this.dispatchEvent(new sinon.Event("loadstart", false, false, this)); + }, + + abort: function abort() { + this.aborted = true; + this.responseText = null; + this.errorFlag = true; + this.requestHeaders = {}; + + if (this.readyState > sinon.FakeXMLHttpRequest.UNSENT && this.sendFlag) { + this.readyStateChange(sinon.FakeXMLHttpRequest.DONE); + this.sendFlag = false; + } + + this.readyState = sinon.FakeXMLHttpRequest.UNSENT; + + this.dispatchEvent(new sinon.Event("abort", false, false, this)); + + this.upload.dispatchEvent(new sinon.Event("abort", false, false, this)); + + if (typeof this.onerror === "function") { + this.onerror(); + } + }, + + getResponseHeader: function getResponseHeader(header) { + if (this.readyState < FakeXMLHttpRequest.HEADERS_RECEIVED) { + return null; + } + + if (/^Set-Cookie2?$/i.test(header)) { + return null; + } + + header = header.toLowerCase(); + + for (var h in this.responseHeaders) { + if (h.toLowerCase() == header) { + return this.responseHeaders[h]; + } + } + + return null; + }, + + getAllResponseHeaders: function getAllResponseHeaders() { + if (this.readyState < FakeXMLHttpRequest.HEADERS_RECEIVED) { + return ""; + } + + var headers = ""; + + for (var header in this.responseHeaders) { + if (this.responseHeaders.hasOwnProperty(header) && + !/^Set-Cookie2?$/i.test(header)) { + headers += header + ": " + this.responseHeaders[header] + "\r\n"; + } + } + + return headers; + }, + + setResponseBody: function setResponseBody(body) { + verifyRequestSent(this); + verifyHeadersReceived(this); + verifyResponseBodyType(body); + + var chunkSize = this.chunkSize || 10; + var index = 0; + this.responseText = ""; + + do { + if (this.async) { + this.readyStateChange(FakeXMLHttpRequest.LOADING); + } + + this.responseText += body.substring(index, index + chunkSize); + index += chunkSize; + } while (index < body.length); + + var type = this.getResponseHeader("Content-Type"); + + if (this.responseText && + (!type || /(text\/xml)|(application\/xml)|(\+xml)/.test(type))) { + try { + this.responseXML = FakeXMLHttpRequest.parseXML(this.responseText); + } catch (e) { + // Unable to parse XML - no biggie + } + } + + if (this.async) { + this.readyStateChange(FakeXMLHttpRequest.DONE); + } else { + this.readyState = FakeXMLHttpRequest.DONE; + } + }, + + respond: function respond(status, headers, body) { + this.status = typeof status == "number" ? status : 200; + this.statusText = FakeXMLHttpRequest.statusCodes[this.status]; + this.setResponseHeaders(headers || {}); + this.setResponseBody(body || ""); + }, + + uploadProgress: function uploadProgress(progressEventRaw) { + if (supportsProgress) { + this.upload.dispatchEvent(new sinon.ProgressEvent("progress", progressEventRaw)); + } + }, + + uploadError: function uploadError(error) { + if (supportsCustomEvent) { + this.upload.dispatchEvent(new sinon.CustomEvent("error", {"detail": error})); + } + } + }); + + sinon.extend(FakeXMLHttpRequest, { + UNSENT: 0, + OPENED: 1, + HEADERS_RECEIVED: 2, + LOADING: 3, + DONE: 4 + }); + + // Borrowed from JSpec + FakeXMLHttpRequest.parseXML = function parseXML(text) { + var xmlDoc; + + if (typeof DOMParser != "undefined") { + var parser = new DOMParser(); + xmlDoc = parser.parseFromString(text, "text/xml"); + } else { + xmlDoc = new ActiveXObject("Microsoft.XMLDOM"); + xmlDoc.async = "false"; + xmlDoc.loadXML(text); + } + + return xmlDoc; + }; + + FakeXMLHttpRequest.statusCodes = { + 100: "Continue", + 101: "Switching Protocols", + 200: "OK", + 201: "Created", + 202: "Accepted", + 203: "Non-Authoritative Information", + 204: "No Content", + 205: "Reset Content", + 206: "Partial Content", + 300: "Multiple Choice", + 301: "Moved Permanently", + 302: "Found", + 303: "See Other", + 304: "Not Modified", + 305: "Use Proxy", + 307: "Temporary Redirect", + 400: "Bad Request", + 401: "Unauthorized", + 402: "Payment Required", + 403: "Forbidden", + 404: "Not Found", + 405: "Method Not Allowed", + 406: "Not Acceptable", + 407: "Proxy Authentication Required", + 408: "Request Timeout", + 409: "Conflict", + 410: "Gone", + 411: "Length Required", + 412: "Precondition Failed", + 413: "Request Entity Too Large", + 414: "Request-URI Too Long", + 415: "Unsupported Media Type", + 416: "Requested Range Not Satisfiable", + 417: "Expectation Failed", + 422: "Unprocessable Entity", + 500: "Internal Server Error", + 501: "Not Implemented", + 502: "Bad Gateway", + 503: "Service Unavailable", + 504: "Gateway Timeout", + 505: "HTTP Version Not Supported" + }; + + sinon.useFakeXMLHttpRequest = function () { + sinon.FakeXMLHttpRequest.restore = function restore(keepOnCreate) { + if (xhr.supportsXHR) { + global.XMLHttpRequest = xhr.GlobalXMLHttpRequest; + } + + if (xhr.supportsActiveX) { + global.ActiveXObject = xhr.GlobalActiveXObject; + } + + delete sinon.FakeXMLHttpRequest.restore; + + if (keepOnCreate !== true) { + delete sinon.FakeXMLHttpRequest.onCreate; + } + }; + if (xhr.supportsXHR) { + global.XMLHttpRequest = sinon.FakeXMLHttpRequest; + } + + if (xhr.supportsActiveX) { + global.ActiveXObject = function ActiveXObject(objId) { + if (objId == "Microsoft.XMLHTTP" || /^Msxml2\.XMLHTTP/i.test(objId)) { + + return new sinon.FakeXMLHttpRequest(); + } + + return new xhr.GlobalActiveXObject(objId); + }; + } + + return sinon.FakeXMLHttpRequest; + }; + + sinon.FakeXMLHttpRequest = FakeXMLHttpRequest; + +})(typeof global === "object" ? global : this); + +if (typeof module !== 'undefined' && module.exports) { + module.exports = sinon; +} + +/** + * @depend fake_xml_http_request.js + */ +/*jslint eqeqeq: false, onevar: false, regexp: false, plusplus: false*/ +/*global module, require, window*/ +/** + * The Sinon "server" mimics a web server that receives requests from + * sinon.FakeXMLHttpRequest and provides an API to respond to those requests, + * both synchronously and asynchronously. To respond synchronuously, canned + * answers have to be provided upfront. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +if (typeof sinon == "undefined") { + var sinon = {}; +} + +sinon.fakeServer = (function () { + var push = [].push; + function F() {} + + function create(proto) { + F.prototype = proto; + return new F(); + } + + function responseArray(handler) { + var response = handler; + + if (Object.prototype.toString.call(handler) != "[object Array]") { + response = [200, {}, handler]; + } + + if (typeof response[2] != "string") { + throw new TypeError("Fake server response body should be string, but was " + + typeof response[2]); + } + + return response; + } + + var wloc = typeof window !== "undefined" ? window.location : {}; + var rCurrLoc = new RegExp("^" + wloc.protocol + "//" + wloc.host); + + function matchOne(response, reqMethod, reqUrl) { + var rmeth = response.method; + var matchMethod = !rmeth || rmeth.toLowerCase() == reqMethod.toLowerCase(); + var url = response.url; + var matchUrl = !url || url == reqUrl || (typeof url.test == "function" && url.test(reqUrl)); + + return matchMethod && matchUrl; + } + + function match(response, request) { + var requestUrl = request.url; + + if (!/^https?:\/\//.test(requestUrl) || rCurrLoc.test(requestUrl)) { + requestUrl = requestUrl.replace(rCurrLoc, ""); + } + + if (matchOne(response, this.getHTTPMethod(request), requestUrl)) { + if (typeof response.response == "function") { + var ru = response.url; + var args = [request].concat(ru && typeof ru.exec == "function" ? ru.exec(requestUrl).slice(1) : []); + return response.response.apply(response, args); + } + + return true; + } + + return false; + } + + function log(response, request) { + var str; + + str = "Request:\n" + sinon.format(request) + "\n\n"; + str += "Response:\n" + sinon.format(response) + "\n\n"; + + sinon.log(str); + } + + return { + create: function () { + var server = create(this); + this.xhr = sinon.useFakeXMLHttpRequest(); + server.requests = []; + + this.xhr.onCreate = function (xhrObj) { + server.addRequest(xhrObj); + }; + + return server; + }, + + addRequest: function addRequest(xhrObj) { + var server = this; + push.call(this.requests, xhrObj); + + xhrObj.onSend = function () { + server.handleRequest(this); + + if (server.autoRespond && !server.responding) { + setTimeout(function () { + server.responding = false; + server.respond(); + }, server.autoRespondAfter || 10); + + server.responding = true; + } + }; + }, + + getHTTPMethod: function getHTTPMethod(request) { + if (this.fakeHTTPMethods && /post/i.test(request.method)) { + var matches = (request.requestBody || "").match(/_method=([^\b;]+)/); + return !!matches ? matches[1] : request.method; + } + + return request.method; + }, + + handleRequest: function handleRequest(xhr) { + if (xhr.async) { + if (!this.queue) { + this.queue = []; + } + + push.call(this.queue, xhr); + } else { + this.processRequest(xhr); + } + }, + + respondWith: function respondWith(method, url, body) { + if (arguments.length == 1 && typeof method != "function") { + this.response = responseArray(method); + return; + } + + if (!this.responses) { this.responses = []; } + + if (arguments.length == 1) { + body = method; + url = method = null; + } + + if (arguments.length == 2) { + body = url; + url = method; + method = null; + } + + push.call(this.responses, { + method: method, + url: url, + response: typeof body == "function" ? body : responseArray(body) + }); + }, + + respond: function respond() { + if (arguments.length > 0) this.respondWith.apply(this, arguments); + var queue = this.queue || []; + var requests = queue.splice(0); + var request; + + while(request = requests.shift()) { + this.processRequest(request); + } + }, + + processRequest: function processRequest(request) { + try { + if (request.aborted) { + return; + } + + var response = this.response || [404, {}, ""]; + + if (this.responses) { + for (var l = this.responses.length, i = l - 1; i >= 0; i--) { + if (match.call(this, this.responses[i], request)) { + response = this.responses[i].response; + break; + } + } + } + + if (request.readyState != 4) { + log(response, request); + + request.respond(response[0], response[1], response[2]); + } + } catch (e) { + sinon.logError("Fake server request processing", e); + } + }, + + restore: function restore() { + return this.xhr.restore && this.xhr.restore.apply(this.xhr, arguments); + } + }; +}()); + +if (typeof module !== 'undefined' && module.exports) { + module.exports = sinon; +} + +/** + * @depend fake_server.js + * @depend fake_timers.js + */ +/*jslint browser: true, eqeqeq: false, onevar: false*/ +/*global sinon*/ +/** + * Add-on for sinon.fakeServer that automatically handles a fake timer along with + * the FakeXMLHttpRequest. The direct inspiration for this add-on is jQuery + * 1.3.x, which does not use xhr object's onreadystatehandler at all - instead, + * it polls the object for completion with setInterval. Dispite the direct + * motivation, there is nothing jQuery-specific in this file, so it can be used + * in any environment where the ajax implementation depends on setInterval or + * setTimeout. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function () { + function Server() {} + Server.prototype = sinon.fakeServer; + + sinon.fakeServerWithClock = new Server(); + + sinon.fakeServerWithClock.addRequest = function addRequest(xhr) { + if (xhr.async) { + if (typeof setTimeout.clock == "object") { + this.clock = setTimeout.clock; + } else { + this.clock = sinon.useFakeTimers(); + this.resetClock = true; + } + + if (!this.longestTimeout) { + var clockSetTimeout = this.clock.setTimeout; + var clockSetInterval = this.clock.setInterval; + var server = this; + + this.clock.setTimeout = function (fn, timeout) { + server.longestTimeout = Math.max(timeout, server.longestTimeout || 0); + + return clockSetTimeout.apply(this, arguments); + }; + + this.clock.setInterval = function (fn, timeout) { + server.longestTimeout = Math.max(timeout, server.longestTimeout || 0); + + return clockSetInterval.apply(this, arguments); + }; + } + } + + return sinon.fakeServer.addRequest.call(this, xhr); + }; + + sinon.fakeServerWithClock.respond = function respond() { + var returnVal = sinon.fakeServer.respond.apply(this, arguments); + + if (this.clock) { + this.clock.tick(this.longestTimeout || 0); + this.longestTimeout = 0; + + if (this.resetClock) { + this.clock.restore(); + this.resetClock = false; + } + } + + return returnVal; + }; + + sinon.fakeServerWithClock.restore = function restore() { + if (this.clock) { + this.clock.restore(); + } + + return sinon.fakeServer.restore.apply(this, arguments); + }; +}()); + +/** + * @depend ../sinon.js + * @depend collection.js + * @depend util/fake_timers.js + * @depend util/fake_server_with_clock.js + */ +/*jslint eqeqeq: false, onevar: false, plusplus: false*/ +/*global require, module*/ +/** + * Manages fake collections as well as fake utilities such as Sinon's + * timers and fake XHR implementation in one convenient object. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +if (typeof module !== 'undefined' && module.exports) { + var sinon = require("../sinon"); + sinon.extend(sinon, require("./util/fake_timers")); +} + +(function () { + var push = [].push; + + function exposeValue(sandbox, config, key, value) { + if (!value) { + return; + } + + if (config.injectInto && !(key in config.injectInto)) { + config.injectInto[key] = value; + sandbox.injectedKeys.push(key); + } else { + push.call(sandbox.args, value); + } + } + + function prepareSandboxFromConfig(config) { + var sandbox = sinon.create(sinon.sandbox); + + if (config.useFakeServer) { + if (typeof config.useFakeServer == "object") { + sandbox.serverPrototype = config.useFakeServer; + } + + sandbox.useFakeServer(); + } + + if (config.useFakeTimers) { + if (typeof config.useFakeTimers == "object") { + sandbox.useFakeTimers.apply(sandbox, config.useFakeTimers); + } else { + sandbox.useFakeTimers(); + } + } + + return sandbox; + } + + sinon.sandbox = sinon.extend(sinon.create(sinon.collection), { + useFakeTimers: function useFakeTimers() { + this.clock = sinon.useFakeTimers.apply(sinon, arguments); + + return this.add(this.clock); + }, + + serverPrototype: sinon.fakeServer, + + useFakeServer: function useFakeServer() { + var proto = this.serverPrototype || sinon.fakeServer; + + if (!proto || !proto.create) { + return null; + } + + this.server = proto.create(); + return this.add(this.server); + }, + + inject: function (obj) { + sinon.collection.inject.call(this, obj); + + if (this.clock) { + obj.clock = this.clock; + } + + if (this.server) { + obj.server = this.server; + obj.requests = this.server.requests; + } + + return obj; + }, + + restore: function () { + sinon.collection.restore.apply(this, arguments); + this.restoreContext(); + }, + + restoreContext: function () { + if (this.injectedKeys) { + for (var i = 0, j = this.injectedKeys.length; i < j; i++) { + delete this.injectInto[this.injectedKeys[i]]; + } + this.injectedKeys = []; + } + }, + + create: function (config) { + if (!config) { + return sinon.create(sinon.sandbox); + } + + var sandbox = prepareSandboxFromConfig(config); + sandbox.args = sandbox.args || []; + sandbox.injectedKeys = []; + sandbox.injectInto = config.injectInto; + var prop, value, exposed = sandbox.inject({}); + + if (config.properties) { + for (var i = 0, l = config.properties.length; i < l; i++) { + prop = config.properties[i]; + value = exposed[prop] || prop == "sandbox" && sandbox; + exposeValue(sandbox, config, prop, value); + } + } else { + exposeValue(sandbox, config, "sandbox", value); + } + + return sandbox; + } + }); + + sinon.sandbox.useFakeXMLHttpRequest = sinon.sandbox.useFakeServer; + + if (typeof module !== 'undefined' && module.exports) { + module.exports = sinon.sandbox; + } +}()); + +/** + * @depend ../sinon.js + * @depend stub.js + * @depend mock.js + * @depend sandbox.js + */ +/*jslint eqeqeq: false, onevar: false, forin: true, plusplus: false*/ +/*global module, require, sinon*/ +/** + * Test function, sandboxes fakes + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + function test(callback) { + var type = typeof callback; + + if (type != "function") { + throw new TypeError("sinon.test needs to wrap a test function, got " + type); + } + + return function () { + var config = sinon.getConfig(sinon.config); + config.injectInto = config.injectIntoThis && this || config.injectInto; + var sandbox = sinon.sandbox.create(config); + var exception, result; + var args = Array.prototype.slice.call(arguments).concat(sandbox.args); + + try { + result = callback.apply(this, args); + } catch (e) { + exception = e; + } + + if (typeof exception !== "undefined") { + sandbox.restore(); + throw exception; + } + else { + sandbox.verifyAndRestore(); + } + + return result; + }; + } + + test.config = { + injectIntoThis: true, + injectInto: null, + properties: ["spy", "stub", "mock", "clock", "server", "requests"], + useFakeTimers: true, + useFakeServer: true + }; + + if (commonJSModule) { + module.exports = test; + } else { + sinon.test = test; + } +}(typeof sinon == "object" && sinon || null)); + +/** + * @depend ../sinon.js + * @depend test.js + */ +/*jslint eqeqeq: false, onevar: false, eqeqeq: false*/ +/*global module, require, sinon*/ +/** + * Test case, sandboxes all test functions + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon) { + var commonJSModule = typeof module !== 'undefined' && module.exports; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon || !Object.prototype.hasOwnProperty) { + return; + } + + function createTest(property, setUp, tearDown) { + return function () { + if (setUp) { + setUp.apply(this, arguments); + } + + var exception, result; + + try { + result = property.apply(this, arguments); + } catch (e) { + exception = e; + } + + if (tearDown) { + tearDown.apply(this, arguments); + } + + if (exception) { + throw exception; + } + + return result; + }; + } + + function testCase(tests, prefix) { + /*jsl:ignore*/ + if (!tests || typeof tests != "object") { + throw new TypeError("sinon.testCase needs an object with test functions"); + } + /*jsl:end*/ + + prefix = prefix || "test"; + var rPrefix = new RegExp("^" + prefix); + var methods = {}, testName, property, method; + var setUp = tests.setUp; + var tearDown = tests.tearDown; + + for (testName in tests) { + if (tests.hasOwnProperty(testName)) { + property = tests[testName]; + + if (/^(setUp|tearDown)$/.test(testName)) { + continue; + } + + if (typeof property == "function" && rPrefix.test(testName)) { + method = property; + + if (setUp || tearDown) { + method = createTest(property, setUp, tearDown); + } + + methods[testName] = sinon.test(method); + } else { + methods[testName] = tests[testName]; + } + } + } + + return methods; + } + + if (commonJSModule) { + module.exports = testCase; + } else { + sinon.testCase = testCase; + } +}(typeof sinon == "object" && sinon || null)); + +/** + * @depend ../sinon.js + * @depend stub.js + */ +/*jslint eqeqeq: false, onevar: false, nomen: false, plusplus: false*/ +/*global module, require, sinon*/ +/** + * Assertions matching the test spy retrieval interface. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ + +(function (sinon, global) { + var commonJSModule = typeof module !== "undefined" && module.exports; + var slice = Array.prototype.slice; + var assert; + + if (!sinon && commonJSModule) { + sinon = require("../sinon"); + } + + if (!sinon) { + return; + } + + function verifyIsStub() { + var method; + + for (var i = 0, l = arguments.length; i < l; ++i) { + method = arguments[i]; + + if (!method) { + assert.fail("fake is not a spy"); + } + + if (typeof method != "function") { + assert.fail(method + " is not a function"); + } + + if (typeof method.getCall != "function") { + assert.fail(method + " is not stubbed"); + } + } + } + + function failAssertion(object, msg) { + object = object || global; + var failMethod = object.fail || assert.fail; + failMethod.call(object, msg); + } + + function mirrorPropAsAssertion(name, method, message) { + if (arguments.length == 2) { + message = method; + method = name; + } + + assert[name] = function (fake) { + verifyIsStub(fake); + + var args = slice.call(arguments, 1); + var failed = false; + + if (typeof method == "function") { + failed = !method(fake); + } else { + failed = typeof fake[method] == "function" ? + !fake[method].apply(fake, args) : !fake[method]; + } + + if (failed) { + failAssertion(this, fake.printf.apply(fake, [message].concat(args))); + } else { + assert.pass(name); + } + }; + } + + function exposedName(prefix, prop) { + return !prefix || /^fail/.test(prop) ? prop : + prefix + prop.slice(0, 1).toUpperCase() + prop.slice(1); + } + + assert = { + failException: "AssertError", + + fail: function fail(message) { + var error = new Error(message); + error.name = this.failException || assert.failException; + + throw error; + }, + + pass: function pass(assertion) {}, + + callOrder: function assertCallOrder() { + verifyIsStub.apply(null, arguments); + var expected = "", actual = ""; + + if (!sinon.calledInOrder(arguments)) { + try { + expected = [].join.call(arguments, ", "); + var calls = slice.call(arguments); + var i = calls.length; + while (i) { + if (!calls[--i].called) { + calls.splice(i, 1); + } + } + actual = sinon.orderByFirstCall(calls).join(", "); + } catch (e) { + // If this fails, we'll just fall back to the blank string + } + + failAssertion(this, "expected " + expected + " to be " + + "called in order but were called as " + actual); + } else { + assert.pass("callOrder"); + } + }, + + callCount: function assertCallCount(method, count) { + verifyIsStub(method); + + if (method.callCount != count) { + var msg = "expected %n to be called " + sinon.timesInWords(count) + + " but was called %c%C"; + failAssertion(this, method.printf(msg)); + } else { + assert.pass("callCount"); + } + }, + + expose: function expose(target, options) { + if (!target) { + throw new TypeError("target is null or undefined"); + } + + var o = options || {}; + var prefix = typeof o.prefix == "undefined" && "assert" || o.prefix; + var includeFail = typeof o.includeFail == "undefined" || !!o.includeFail; + + for (var method in this) { + if (method != "export" && (includeFail || !/^(fail)/.test(method))) { + target[exposedName(prefix, method)] = this[method]; + } + } + + return target; + }, + + match: function match(actual, expectation) { + var matcher = sinon.match(expectation); + if (matcher.test(actual)) { + assert.pass("match"); + } else { + var formatted = [ + "expected value to match", + " expected = " + sinon.format(expectation), + " actual = " + sinon.format(actual) + ] + failAssertion(this, formatted.join("\n")); + } + } + }; + + mirrorPropAsAssertion("called", "expected %n to have been called at least once but was never called"); + mirrorPropAsAssertion("notCalled", function (spy) { return !spy.called; }, + "expected %n to not have been called but was called %c%C"); + mirrorPropAsAssertion("calledOnce", "expected %n to be called once but was called %c%C"); + mirrorPropAsAssertion("calledTwice", "expected %n to be called twice but was called %c%C"); + mirrorPropAsAssertion("calledThrice", "expected %n to be called thrice but was called %c%C"); + mirrorPropAsAssertion("calledOn", "expected %n to be called with %1 as this but was called with %t"); + mirrorPropAsAssertion("alwaysCalledOn", "expected %n to always be called with %1 as this but was called with %t"); + mirrorPropAsAssertion("calledWithNew", "expected %n to be called with new"); + mirrorPropAsAssertion("alwaysCalledWithNew", "expected %n to always be called with new"); + mirrorPropAsAssertion("calledWith", "expected %n to be called with arguments %*%C"); + mirrorPropAsAssertion("calledWithMatch", "expected %n to be called with match %*%C"); + mirrorPropAsAssertion("alwaysCalledWith", "expected %n to always be called with arguments %*%C"); + mirrorPropAsAssertion("alwaysCalledWithMatch", "expected %n to always be called with match %*%C"); + mirrorPropAsAssertion("calledWithExactly", "expected %n to be called with exact arguments %*%C"); + mirrorPropAsAssertion("alwaysCalledWithExactly", "expected %n to always be called with exact arguments %*%C"); + mirrorPropAsAssertion("neverCalledWith", "expected %n to never be called with arguments %*%C"); + mirrorPropAsAssertion("neverCalledWithMatch", "expected %n to never be called with match %*%C"); + mirrorPropAsAssertion("threw", "%n did not throw exception%C"); + mirrorPropAsAssertion("alwaysThrew", "%n did not always throw exception%C"); + + if (commonJSModule) { + module.exports = assert; + } else { + sinon.assert = assert; + } +}(typeof sinon == "object" && sinon || null, typeof window != "undefined" ? window : (typeof self != "undefined") ? self : global)); + +return sinon;}.call(typeof window != 'undefined' && window || {})); diff --git a/resources/lib/sinonjs/sinon-ie-1.9.0.js b/resources/lib/sinonjs/sinon-ie-1.9.0.js new file mode 100644 index 000000000000..c9fbd9da2e99 --- /dev/null +++ b/resources/lib/sinonjs/sinon-ie-1.9.0.js @@ -0,0 +1,86 @@ +/** + * Sinon.JS 1.9.0, 2014/03/05 + * + * @author Christian Johansen (christian@cjohansen.no) + * @author Contributors: https://github.com/cjohansen/Sinon.JS/blob/master/AUTHORS + * + * (The BSD License) + * + * Copyright (c) 2010-2014, Christian Johansen, christian@cjohansen.no + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * * Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * * Neither the name of Christian Johansen nor the names of his contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED + * WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE + * DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR + * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER + * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, + * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/*global sinon, setTimeout, setInterval, clearTimeout, clearInterval, Date*/ +/** + * Helps IE run the fake timers. By defining global functions, IE allows + * them to be overwritten at a later point. If these are not defined like + * this, overwriting them will result in anything from an exception to browser + * crash. + * + * If you don't require fake timers to work in IE, don't include this file. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ +function setTimeout() {} +function clearTimeout() {} +function setImmediate() {} +function clearImmediate() {} +function setInterval() {} +function clearInterval() {} +function Date() {} + +// Reassign the original functions. Now their writable attribute +// should be true. Hackish, I know, but it works. +setTimeout = sinon.timers.setTimeout; +clearTimeout = sinon.timers.clearTimeout; +setImmediate = sinon.timers.setImmediate; +clearImmediate = sinon.timers.clearImmediate; +setInterval = sinon.timers.setInterval; +clearInterval = sinon.timers.clearInterval; +Date = sinon.timers.Date; + +/*global sinon*/ +/** + * Helps IE run the fake XMLHttpRequest. By defining global functions, IE allows + * them to be overwritten at a later point. If these are not defined like + * this, overwriting them will result in anything from an exception to browser + * crash. + * + * If you don't require fake XHR to work in IE, don't include this file. + * + * @author Christian Johansen (christian@cjohansen.no) + * @license BSD + * + * Copyright (c) 2010-2013 Christian Johansen + */ +function XMLHttpRequest() {} + +// Reassign the original function. Now its writable attribute +// should be true. Hackish, I know, but it works. +XMLHttpRequest = sinon.xhr.XMLHttpRequest || undefined; |